32021R0821[1]

Az Európai Parlament és a Tanács (EU) 2021/821 rendelete (2021. május 20.) a kettős felhasználású termékek kivitelére, az azokkal végzett brókertevékenységre, az azokkal kapcsolatos technikai segítségnyújtásra, valamint azok tranzitjára és transzferjére vonatkozó uniós ellenőrzési rendszer kialakításáról (átdolgozás)

AZ EURÓPAI PARLAMENT ÉS A TANÁCS (EU) 2021/821 RENDELETE

(2021. május 20.)

a kettős felhasználású termékek kivitelére, az azokkal végzett brókertevékenységre, az azokkal kapcsolatos technikai segítségnyújtásra, valamint azok tranzitjára és transzferjére vonatkozó uniós ellenőrzési rendszer kialakításáról (átdolgozás)

I. FEJEZET

TÁRGY ÉS FOGALOMMEGHATÁROZÁSOK

1. cikk

Ez a rendelet létrehozza a kettős felhasználású termékek kivitelére, az azokkal végzett brókertevékenységre, az azokkal kapcsolatos technikai segítségnyújtásra, valamint azok tranzitjára és transzferjére vonatkozó uniós ellenőrzési rendszert.

2. cikk

E rendelet alkalmazásában:

1. "kettős felhasználású termékek": azok a termékek, beleértve a szoftvert és a technológiát is, amelyek polgári és katonai célokra egyaránt felhasználhatók, és amelyek körébe beletartoznak azok a termékek, amelyek felhasználhatók nukleáris, vegyi vagy biológiai fegyverek vagy hordozóeszközeik tervezésére, kifejlesztésére, gyártására vagy alkalmazására, ideértve azokat a termékeket is, amelyek egyaránt felhasználhatók nem robbantási célokra és nukleáris fegyverek vagy más nukleáris robbanószerkezetek előállításához történő, bármilyen formájú hozzájárulás céljára;

2. "kivitel": a) az Uniós Vámkódex 269. cikke szerinti kiviteli eljárás; b) újrakivitel az Uniós Vámkódex 270. cikke szerint; újrakivitelre kerül sor akkor is, ha az e cikk 11. pontja szerinti, az Unió vámterületén keresztül történő tranzit során kilépési gyűjtő árunyilatkozatot kell benyújtani, mert a termékek végső rendeltetési helye megváltozott; c) passzív feldolgozási eljárás az Uniós Vámkódex 259. cikke szerint; vagy d) szoftver vagy technológia átadása elektronikus eszközök, így telefax, telefon, elektronikus levél útján vagy bármely más elektronikus úton az Unió vámterületén kívüli rendeltetési helyre; ez magában foglalja az ilyen szoftver és technológia elektronikus formában történő hozzáférhetővé tételét az Unió vámterületén kívüli természetes vagy jogi személyek vagy társaságok számára; továbbá magában foglalja a technológia szóbeli átadását is, ha a technológia leírására valamely hangátviteli eszközön keresztül kerül sor;

3. "exportőr": a) bármely természetes vagy jogi személy vagy bármely társaság, aki vagy amely a kiviteli nyilatkozat vagy az újrakiviteli árunyilatkozat vagy a kilépési gyűjtő árunyilatkozat elfogadásakor a harmadik országbeli címzett szerződő partnere, és jogosult a termékek Unió vámterületén kívülre történő kiküldésének meghatározására; amennyiben nem kötöttek kiviteli szerződést, vagy a szerződő partner nem saját nevében jár el, akkor az exportőr az a személy, aki vagy amely jogosult a termékek Unió vámterületén kívülre történő kiküldésének meghatározására; vagy b) bármely természetes vagy jogi személy vagy bármely társaság, aki vagy amely úgy dönt, hogy elektronikus eszközök, így telefax, telefon, elektronikus levél útján vagy bármely más elektronikus úton szoftvert vagy technológiát ad át az Unió vámterületén kívüli rendeltetési helyre, vagy ilyen szoftvert és technológiát elektronikus formában elérhetővé tesz az Unió vámterületén kívüli természetes vagy jogi személyek vagy társaságok számára. Amennyiben a kettős felhasználású termék feletti rendelkezési jog a kivitel alapját képező szerződés értelmében egy, az Unió vámterületén kívül lakóhellyel rendelkező vagy letelepedett személyé, exportőrnek az Unió vámterületén belül lakóhellyel rendelkező vagy letelepedett szerződő fél tekintendő; c) amennyiben az a) vagy a b) pont nem alkalmazandó, a kivitelre kerülő kettős felhasználású termékeket szállító bármely természetes személy, ha e kettős felhasználású termékek a személy személyes poggyászában vannak az (EU) 2015/2446 felhatalmazáson alapuló bizottsági rendelet ( 1 ) 1. cikke 19. pontjának a) alpontja értelmében;

4. "kiviteli nyilatkozat": az az okirat, amelyben valamely természetes vagy jogi személy vagy valamely társaság az előírt formában és módon kinyilvánítja szándékát, hogy az 1. pontban meghatározott kettős felhasználású termékeket kíván kiviteli eljárás alá vonni;

5. "újrakiviteli árunyilatkozat": az Uniós Vámkódex 5. cikkének 13. pontja szerinti cselekmény;

6. "kilépési gyűjtő árunyilatkozat": az Uniós Vámkódex 5. cikkének 10. pontja szerinti cselekmény;

7. "brókertevékenység": a) olyan ügyletek tárgyalása vagy intézése, amelyek célja kettős felhasználású termékek vétele, eladása vagy szállítása egy harmadik országból bármely másik harmadik országba; vagy b) harmadik országokban található kettős felhasználású termékek eladása vagy vétele egy más harmadik országba történő átadásuk céljából. E rendelet alkalmazásában e fogalommeghatározás nem terjed ki a pusztán járulékos szolgáltatások nyújtására. Járulékos szolgáltatások a fuvarozás, a pénzügyi szolgáltatások, a biztosítás vagy a viszontbiztosítás, vagy az általános hirdetés vagy reklám;

8. "bróker": bármely természetes vagy jogi személy vagy bármely társaság, aki vagy amely brókertevékenységet végez az Unió vámterületéről valamely harmadik ország területére irányulóan;

9. "technikai segítségnyújtás": bármely, javításhoz, fejlesztéshez, gyártáshoz, összeszereléshez, teszteléshez, karbantartáshoz és minden egyéb műszaki szolgáltatáshoz kapcsolódó technikai segítségnyújtás, amely lehet oktatás, tanácsadás, képzés, munkatapasztalatok vagy készségek átadása, vagy tanácsadási szolgáltatások nyújtása, ideértve az elektronikus eszközök révén, valamint a telefonon vagy egyéb szóbeli formák keretében történő támogatást is;

10. "technikai segítségnyújtást végző": a) bármely természetes vagy jogi személy vagy bármely társaság, aki vagy amely az Unió vámterületéről valamely harmadik ország területére irányulóan technikai segítségnyújtást végez; b) valamely tagállamban lakóhellyel rendelkező vagy letelepedett bármely természetes vagy jogi személy vagy bármely társaság, aki vagy amely harmadik ország területén technikai segítségnyújtást végez; vagy c) valamely tagállamban lakóhellyel rendelkező vagy letelepedett bármely természetes vagy jogi személy vagy bármely társaság, aki vagy amely technikai segítségnyújtást végez az Unió vámterületén ideiglenesen jelen lévő, valamely harmadik országban lakóhellyel rendelkező személy számára;

11. "tranzit": a nem uniós kettős felhasználású termékeknek az Unió vámterületére belépve és azon keresztülhaladva az Unió vámterületén kívüli rendeltetési helyre történő szállítása, amennyiben e termékeket: a) külső árutovábbítási eljárás alá vonják az Uniós Vámkódex 226. cikkének megfelelően, és amelyek csak áthaladnak az Unió vámterületén; b) egy vámszabad területen átrakodják, vagy amelyek közvetlenül onnan kerülnek újrakivitelre; c) átmeneti megőrzésbe helyezik, és amelyek közvetlenül egy átmeneti megőrzési létesítményből kerülnek újrakivitelre; vagy d) az Unió vámterületére ugyanazon a hajón vagy légi járművön szállították, amelyen erről a területről kirakodás nélkül elszállítják;

12. "egyedi exportengedély": egy meghatározott exportőrnek valamely harmadik országban lévő egyetlen végfelhasználó vagy címzett tekintetében, egy vagy több kettős felhasználású termékre adott engedély;

13. "globális exportengedély": egy meghatározott exportőrnek a kettős felhasználású termékek valamely típusának vagy kategóriájának tekintetében adott engedély, amely egy vagy több meghatározott végfelhasználó részére történő kivitelre és/vagy egy vagy több meghatározott harmadik országba történő kivitelre érvényes;

14. "nagy projektekre vonatkozó engedélyek": egy meghatározott exportőrnek a kettős felhasználású termékek valamely típusának vagy kategóriájának tekintetében adott egyedi exportengedély vagy globális exportengedély, amely egy vagy több meghatározott végfelhasználó részére történő kivitelre egy vagy több meghatározott harmadik országban lehet érvényes egy meghatározott nagy projekt céljára;

15. "uniós általános exportengedély": bizonyos rendeltetési országokba irányuló kivitelre érvényes exportengedély, amely minden exportőr számára hozzáférhető, aki tiszteletben tartja a II. melléklet A-H. szakaszában felsorolt feltételeket és követelményeket;

16. "nemzeti általános exportengedély": a 12. cikk (6) bekezdésének és a III. melléklet C. szakaszának megfelelően a nemzeti jog által meghatározott exportengedély;

17. "az Unió vámterülete": az Uniónak az Uniós Vámkódex 4. cikke szerinti vámterülete;

18. "nem uniós kettős felhasználású termékek": az Uniós Vámkódex 5. cikkének 24. pontja értelmében vett nem uniós áruk vámjogi helyzetével rendelkező termékek;

19. "fegyverembargó": a Tanács határozata vagy közös álláspontja vagy az Európai Biztonsági és Együttműködési Szervezet (EBESZ) döntése alapján, vagy pedig az ENSZ Biztonsági Tanácsának kötelező erejű határozata alapján elrendelt fegyverembargó;

20. "kibertér-megfigyelési termékek": olyan kettős felhasználású termékek, amelyeket kifejezetten arra terveztek, hogy lehetővé tegyék természetes személyek megfigyelését információs és telekommunikációs rendszerekből származó adatok nyomon követése, kinyerése, gyűjtése vagy elemzése révén;

21. "belső megfelelési program": az exportőrök által az e rendelet rendelkezéseinek és célkitűzéseinek, valamint az e rendelet alapján végrehajtott engedélyek feltételeinek való megfelelés elősegítése céljából elfogadott, folyamatban lévő, hatékony, megfelelő és arányos politikák és eljárások, ideértve többek között a termékek végfelhasználók számára történő kivitelével és végfelhasználásával kapcsolatos kockázatok értékelését szolgáló, a kellő gondosságra vonatkozó intézkedéseket is;

22. "lényegében azonos ügylet": olyan ügylet, amely egy másik ügyletével lényegében azonos paraméterekkel vagy műszaki jellemzőkkel rendelkező termékekre vonatkozik, és az adott másik ügyletével azonos végfelhasználót vagy címzettet érint.

II. FEJEZET

HATÁLY

3. cikk

4. cikk

Az I. mellékletben fel nem sorolt kettős felhasználású termékek kivitele engedélyköteles, amennyiben a hatáskörrel rendelkező hatóság az exportőrt tájékoztatta arról, hogy a szóban forgó termékeket részben vagy egészben:

a) vegyi, biológiai vagy nukleáris fegyverek, más nukleáris robbanószerkezetek fejlesztésével, gyártásával, kezelésével, működtetésével, karbantartásával, raktározásával, felderítésével, azonosításával vagy forgalmazásával, vagy az ilyen fegyverek célba juttatására alkalmas hordozórakéták fejlesztésével, gyártásával, karbantartásával vagy raktározásával kapcsolatos felhasználási célokra szánják vagy szánhatják;

b) katonai végfelhasználási célra szánják vagy szánhatják, amennyiben a vásárló országra vagy a rendeltetési országra fegyverembargó van érvényben; e pont alkalmazásában "katonai végfelhasználási cél": i. a tagállamok katonai listáin szereplő katonai célú termékekbe történő beépítés; ii. a tagállamok katonai listáin szereplő katonai célú termékek fejlesztéséhez, gyártásához vagy karbantartásához alkalmazott termelő-, ellenőrző vagy elemzőberendezéseknek és ezek alkatrészeinek felhasználása; vagy iii. egy termelő üzemben a tagállamok katonai listáin szereplő katonai célú termékek gyártásához bármilyen nem-késztermék felhasználása;

c) olyan - a nemzeti katonai listán felsorolt - katonai célú termékek alkatrészeként vagy részegységeként történő felhasználásra szánják vagy szánhatják, amelyeket valamely tagállam területéről engedély nélkül vagy a tagállam engedélyezésre vonatkozó nemzeti jogszabályainak megsértésével exportáltak.

5. cikk

6. cikk

7. cikk

A hatáskörrel rendelkező hatóság az engedélyezési kötelezettséget azon természetes vagy jogi személy vagy azon társaság számára írhatja elő, aki vagy amely a harmadik országbeli címzett szerződő partnere, és jogosult az Unió vámterületén keresztül haladó termékek kiküldésének meghatározására.

Ha a természetes vagy jogi személy vagy a társaság az Unió vámterületén nem rendelkezik lakóhellyel vagy nem letelepedett, a hatáskörrel rendelkező hatóság az engedélyezési kötelezettséget előírhatja a következők számára:

a) az Uniós Vámkódex 5. cikkének 15. pontja szerinti nyilatkozattevő;

b) az Uniós Vámkódex 5. cikkének 40. pontja szerinti fuvarozó; vagy

c) a tranzit alatt álló kettős felhasználású termékeket szállító természetes személy, ha e kettős felhasználású termékek a szóban forgó személy személyes poggyászában vannak.

8. cikk

Az (1) és a (2) bekezdés nem alkalmazandó, amennyiben a technikai segítségnyújtás:

a) végzésére a II. melléklet A. szakaszának 2. részében felsorolt ország területén belül vagy területére irányulóan, vagy a II. melléklet A. szakaszának 2. részében felsorolt országban lakóhellyel rendelkező személy számára kerül sor;

b) az I. mellékletben meghatározott általános technológiai megjegyzés vagy nukleáris technológiai megjegyzés szerinti nyilvánosan hozzáférhető információ átadásának vagy tudományos alapkutatásnak a formáját ölti;

c) biztosítására valamely tagállam hatóságai vagy ügynökségei által hivatalos feladataikkal összefüggésben kerül sor;

d) biztosítására valamely tagállam fegyveres erői számára a rájuk bízott feladatok alapján kerül sor;

e) a Rakétatechnológiai Ellenőrzési Rendszer (MTCR-technológia) IV. mellékletben szereplő termékeire vonatkozó kivételekben említett valamely célt szolgálja; vagy

f) a szükséges minimumot képezi azon termékek telepítéséhez, működtetéséhez, karbantartásához (ellenőrzéséhez) vagy javításához, amelyekre vonatkozóan kiviteli engedélyt bocsátottak ki.

9. cikk

10. cikk

11. cikk

Egy tagállam egyéb kettős felhasználású termékeknek saját területéről más tagállam területére történő transzferjéhez abban az esetben írhat elő engedélykötelezettséget, amennyiben a transzfer időpontjában:

a) a transzfert végzőnek vagy a hatáskörrel rendelkező hatóságnak tudomása van arról, hogy az érintett termék végső rendeltetési helye az Unió vámterületén kívül található;

b) az adott termékek említett végső rendeltetési helyre történő kivitele a 3., 4., 5., 9. vagy 10. cikk szerint engedélyköteles abban a tagállamban, ahonnan a termék transzferje történik, és a közvetlenül a területről történő ilyen kivitel nem engedélyezett valamely általános engedély vagy globális engedély alapján; továbbá

c) az Uniós Vámkódex 60. cikke (2) bekezdésében szereplő meghatározás szerint a termékeken semmiféle feldolgozást vagy megmunkálást nem szabad végezni abban a tagállamban, ahová a termékek transzferje történik.

III. FEJEZET

EXPORTENGEDÉLY ÉS A BRÓKERTEVÉKENYSÉG ÉS A TECHNIKAI SEGÍTSÉGNYÚJTÁS ENGEDÉLYEZÉSE

12. cikk

E rendelet az alábbi exportengedély-típusok kiadását teszi lehetővé, illetve az alábbi exportengedély-típusokat hozza létre:

a) egyedi exportengedélyek;

b) globális exportengedélyek;

c) nemzeti általános exportengedélyek;

d) bizonyos termékek bizonyos rendeltetési helyekre irányuló, a II. melléklet A-H. szakaszában meghatározott különös feltételek és követelmények szerinti kivitelére vonatkozó uniós általános exportengedélyek.

Az e rendelet szerint kiadott vagy létrehozott engedélyek az Unió vámterületének egészére érvényesek.

A 2. cikk 3. pontjának sérelme nélkül, amennyiben az exportőr az Unió vámterületén belül nem rendelkezik lakóhellyel vagy nem letelepedett, e rendelet alapján annak a tagállamnak a hatáskörrel rendelkező hatósága ad ki egyedi kiviteli engedélyeket, ahol a kettős felhasználású termékek találhatók.

Valamennyi egyedi vagy globális exportengedélyt lehetőség szerint elektronikus úton kell kiadni, olyan formanyomtatványokon, amelyek tartalmazzák legalább a III. melléklet A. szakaszában szereplő mintákban előírt valamennyi elemet, az ott meghatározott sorrendben.

A nagy projektekre vonatkozó engedélyek a hatáskörrel rendelkező hatóság által meghatározandó időtartamig, de legfeljebb négy évig érvényesek, kivéve a projekt időtartamán alapuló, kellően indokolt körülmények fennállása esetén.

Az egyedi exportengedélyek kiadását végfelhasználási nyilatkozat bemutatásától kell függővé tenni. A hatáskörrel rendelkező hatóság egyes kérelmeket mentesíthet a végfelhasználási nyilatkozat benyújtásának kötelezettsége alól. A globális exportengedélyek megadása megfelelő esetben végfelhasználási nyilatkozat bemutatásától tehető függővé.

A globális exportengedélyeket használó exportőröknek belső megfelelési programot kell végrehajtaniuk, kivéve, ha a hatáskörrel rendelkező hatóság azt az exportőr által a globális exportengedély iránt benyújtott kérelem feldolgozása során figyelembe vett egyéb információk miatt szükségtelennek tartja.

A globális exportengedélyek használatával kapcsolatos jelentéstételre és belső megfelelési programra vonatkozó követelményeket a tagállamok határozzák meg.

A mennyiségi korlátozásokat tartalmazó globális exportengedélyek az exportőr kérésére részletekre bontandók.

A nemzeti általános exportengedélyek:

a) nem vonatkozhatnak a II. melléklet I. szakaszában felsorolt termékekre;

b) meghatározására a nemzeti jogszabályok vagy gyakorlat által kerül sor; az engedélyeket az azokat kiállító tagállamban letelepedett vagy lakóhellyel rendelkező valamennyi exportőr használhatja, ha megfelel az e rendeletben és az azt kiegészítő nemzeti jogszabályokban megállapított követelményeknek; az engedélyeket a III. melléklet C. szakaszában szereplő iránymutatásoknak megfelelően kell kiadni;

c) nem használhatók fel, ha a hatáskörrel rendelkező hatóság tájékoztatta az exportőrt arról, hogy a szóban forgó termékeket részben vagy egészben a 4. cikk (1) bekezdésében említett valamely felhasználási célra szánják vagy szánhatják, vagy ha az exportőrnek tudomása van arról, hogy a termékeket ilyen célokra kívánják felhasználni.

A nemzeti általános exportengedélyek vonatkozhatnak a II. melléklet A-H. szakaszában felsorolt termékekre és rendeltetési helyekre is.

A tagállamok valamennyi nemzeti általános exportengedély kiadásáról vagy módosításáról haladéktalanul értesítik a Bizottságot. A Bizottság közzéteszi ezeket az értesítéseket az Európai Unió Hivatalos Lapjának C sorozatában.

A tagállamok hatáskörrel rendelkező hatóságai megosztják egymással az azon exportőrökkel kapcsolatos információkat, akik számára megtiltották az uniós általános exportengedély használatát, kivéve, ha az exportőr lakóhelye vagy letelepedési helye szerinti tagállam megállapítja, hogy az exportőr nem fog megpróbálni kettős felhasználású termékeket más tagállamokon keresztül exportálni. Az információcserét a 23. cikk (6) bekezdésében említett elektronikus rendszeren keresztül kell végrehajtani.

13. cikk

A technikai segítségnyújtásra vonatkozó engedélyekben pontosan meg kell határozni a végfelhasználót és annak pontos helyét.

Az engedélyek az Unió vámterületének egészére érvényesek.

14. cikk

Ha tíz munkanapon belül nem érkezik kifogás, akkor ezt úgy kell tekinteni, hogy a megkeresett tagállamoknak nincs ellenvetése.

A megkeresett tagállam kivételes esetben kérheti a tíznapos határidő meghosszabbítását. A meghosszabbítás azonban nem haladhatja meg a 30 munkanapot.

15. cikk

Az e rendelet szerinti engedély kiállításáról vagy a tranzit megtagadásáról való határozathozatal során a tagállamok minden lényeges szempontot figyelembe vesznek, ideértve:

a) az Unió és a tagállamok nemzetközi kötelezettségeit és vállalásait, különösen azokat a kötelezettségeket és vállalásokat, amelyeket a vonatkozó nemzetközi nonproliferációs rezsimek és exportellenőrzési megállapodások részeseként vagy a vonatkozó nemzetközi szerződések megerősítésével egyenként elfogadtak;

b) a Tanács határozata vagy közös álláspontja, az EBESZ határozata vagy az ENSZ Biztonsági Tanácsának kötelező határozata alapján elrendelt szankciókból eredő kötelezettségeket;

c) a nemzeti kül- és biztonságpolitikai megfontolásokat, beleértve a 2008/944/KKBP tanácsi közös álláspontban foglaltakat is;

d) a tervezett végfelhasználással és az engedélyezett végfelhasználástól történő eltérítés kockázatával kapcsolatos megfontolásokat.

16. cikk

A megkeresett tagállamok hatáskörrel rendelkező hatóságai tíz munkanapon belül közlik, hogy a szóban forgó ügyletet lényegében azonos ügyletnek tekintik-e. Ha tíz munkanapon belül nem érkezik válasz, úgy kell tekinteni, hogy a megkeresett tagállamok hatáskörrel rendelkező hatóságai nem tekintik a szóban forgó ügyletet lényegében azonos ügyletnek.

Amennyiben a szóban forgó ügylet helyes értékeléséhez több információra van szükség, az érintett tagállamok hatáskörrel rendelkező hatóságai megállapodnak a tíznapos határidő meghosszabbításáról. A meghosszabbítás azonban nem haladhatja meg a 30 munkanapot.

Ha az ilyen konzultációt követően a hatáskörrel rendelkező hatóság az engedély megadásáról vagy a tranzit engedélyezéséről határoz, úgy erről értesíti a többi tagállam hatáskörrel rendelkező hatóságait és a Bizottságot, és döntése indokolásául megad minden szükséges információt.

IV. FEJEZET

A KETTŐS FELHASZNÁLÁSÚ TERMÉKEK JEGYZÉKEINEK MÓDOSÍTÁSA

17. cikk

A Bizottság felhatalmazást kap arra, hogy a 18. cikkel összhangban felhatalmazáson alapuló jogi aktusokat fogadjon el a kettős felhasználású termékek I. és IV. mellékletben szereplő jegyzékeinek módosítására, az alábbiak szerint:

a) a kettős felhasználású termékek I. mellékletben szereplő jegyzékét azokkal a kötelezettségekkel és vállalásokkal, valamint azok módosításaival összhangban kell módosítani, amelyeket a nemzetközi nonproliferációs rezsimek és export-ellenőrzési megállapodások részeseiként vagy a vonatkozó nemzetközi szerződések megerősítésével a tagállamok és adott esetben az Unió elfogadtak;

b) amennyiben az I. melléklet módosítása a II. vagy a IV. mellékletben is felsorolt kettős felhasználású termékeket érint, az említett mellékleteket is megfelelően módosítani kell.

18. cikk

19. cikk

20. cikk

A kettős felhasználású termékek IV. mellékletben szereplő jegyzékét - amely az I. melléklet almellékletét képezi - az EUMSZ 36. cikkének, nevezetesen a tagállamok közrenddel és közbiztonsággal kapcsolatos érdekeinek figyelembevételével kell aktualizálni.

V. FEJEZET

VÁMELJÁRÁSOK

21. cikk

Az Uniós Vámkódex alapján és az annak értelmében ráruházott jogkör sérelme nélkül a tagállam ezenkívül a (4) bekezdésben hivatkozott időszakokat meg nem haladó időszakra felfüggesztheti a területéről történő kivitellel kapcsolatos eljárást, vagy - szükség esetén - más módon is megakadályozhatja azt, hogy a kettős felhasználású termékek - érvényes exportengedéllyel vagy anélkül - területén keresztül az Uniót elhagyják, amennyiben:

a) alapos okkal feltételezheti, hogy i. az engedély megadásakor valamely vonatkozó információt nem vettek figyelembe; vagy ii. az engedély megadása óta a körülmények jelentős mértékben megváltoztak; vagy

b) releváns információkkal rendelkezik a 4. cikk (1) bekezdése szerinti intézkedések lehetséges alkalmazásáról.

22. cikk

VI. FEJEZET

IGAZGATÁSI EGYÜTTMŰKÖDÉS ÉS VÉGREHAJTÁS

23. cikk

A tagállamok haladéktalanul tájékoztatják a Bizottságot az e rendelet végrehajtása érdekében elfogadott törvényi, rendeleti és közigazgatási rendelkezésekről, beleértve:

a) azoknak az illetékes tagállami hatóságoknak a jegyzékét, amelyek jogosultak: - kettős felhasználású termékek exportengedélyeinek kiadására, - e rendelet értelmében a brókertevékenység és a technikai segítségnyújtás végzésére vonatkozó engedélyek kiadására, - a nem uniós kettős felhasználású termékek tranzitjának tilalmára e rendelet értelmében;

b) a 25. cikk (1) bekezdésében említett intézkedéseket.

A Bizottság továbbítja az információkat a többi tagállamnak, és azokat az Európai Unió Hivatalos Lapjának C sorozatában közzéteszi.

A tagállamok - a Bizottsággal együttműködésben - minden szükséges intézkedést megtesznek a hatáskörrel rendelkező hatóságok közötti közvetlen együttműködés és információcsere kialakítása érdekében az uniós exportellenőrzési rendszer hatékonyságának növelése, valamint az Unió egész vámterületén az ellenőrzés következetes és hatékony végrehajtásának biztosítása céljából. Az ilyen információcsere az alábbiakra terjedhet ki:

a) a vonatkozó engedélyezési adatok, minden kiadott engedély esetében (pl. az engedélyek értéke és típusai, valamint a kapcsolódó rendeltetési helyek, az általános engedélyek felhasználóinak száma);

b) további információ az ellenőrzések alkalmazásáról, ideérve a 15. cikk (1) bekezdésében meghatározott kritériumok alkalmazására vonatkozó információkat, a belső megfelelési programmal rendelkező piaci szereplők számát és - amennyiben rendelkezésre állnak - a kettős felhasználású termékek más tagállamokban végzett kivitelére vonatkozó adatokat;

c) a nemzeti ellenőrzési jegyzékek 9. cikk szerinti kiegészítéseit vagy tervezett kiegészítéseit alátámasztó elemzéssel kapcsolatos információk;

d) információk az ellenőrzések végrehajtásával kapcsolatban, ideértve a kockázatalapú ellenőrzéseket, a nemzeti vagy uniós általános exportengedély felhasználásának jogától megfosztott exportőrök adatait, valamint, amennyiben rendelkezésre állnak, a szabálysértések, lefoglalások és egyéb alkalmazott büntetések számáról;

e) a különös figyelmet igénylő végfelhasználókra, a gyanús beszerzési tevékenységben részt vevő szereplőkre és adott esetben a használt útvonalakra vonatkozó adatok.

24. cikk

25. cikk

A végrehajtási koordinációs mechanizmus keretében a tagállamok és a Bizottság továbbá információkat osztanak meg egymással a nemzeti végrehajtó hatóságok bevált gyakorlatairól a kockázatalapú ellenőrzések, a kettős felhasználású termékek engedély nélküli kivitelének felderítése és büntetőeljárás alá vonása és/vagy e rendelet és/vagy a vonatkozó nemzeti jogszabályok esetleges egyéb megsértései tekintetében.

A végrehajtási koordinációs mechanizmus keretében folytatott információcserének bizalmasnak kell lennie.

VII. FEJEZET

ÁTLÁTHATÓSÁG, BEVONÁS, FIGYELEMMEL KÍSÉRÉS ÉS ÉRTÉKELÉS

26. cikk

Az éves jelentésnek információkat kell tartalmaznia az engedélyekről (különösen azok terméktípusonkénti és rendeltetési helyek szerinti számáról és értékéről uniós és tagállami szinten), továbbá az e rendelet szerinti elutasításokról és tilalmakról. Az éves jelentésnek információkat kell tartalmaznia továbbá az igazgatásról (különösen a személyzetről, a megfelelésre vonatkozó és tájékoztatási tevékenységekről, a célzott engedélyezési vagy osztályozási eszközökről), valamint az ellenőrzések végrehajtásáról, különösen a jogsértések és a szankciók számáról.

A kibertér-megfigyelési termékek tekintetében az éves jelentésnek külön információkat kell tartalmaznia az engedélyekről, különösen a termékenként beérkezett kérelmek számáról, a kibocsátó tagállamról és az ezen kérelmek által érintett rendeltetési helyekről, valamint az ezen kérelmekről hozott határozatokról.

Az éves jelentésben foglalt információkat a (3) bekezdésben meghatározott elvekkel összhangban kell benyújtani.

A Bizottság és a Tanács iránymutatásokat bocsát rendelkezésre az éves jelentés elkészítéséhez szükséges adatgyűjtés és -kezelés módszertanára vonatkozóan, többek között a termékek típusainak meghatározására és a végrehajtási adatok rendelkezésre bocsátására vonatkozóan.

VIII. FEJEZET

ELLENŐRZÉSI INTÉZKEDÉSEK

27. cikk

A kettős felhasználású termékek exportőrei kiviteleikről az érintett tagállam nemzeti jogának vagy hatályos gyakorlatának megfelelő részletes nyilvántartást vagy kimutatást vezetnek. E nyilvántartásoknak vagy kimutatásoknak különösen olyan kereskedelmi okmányokat kell tartalmazniuk, mint például számlák, árunyilatkozatok, valamint fuvar- és egyéb szállítási okmányok, amelyek adattartalma lehetővé teszi az alábbiak azonosítását:

a) a kettős felhasználású termékek megnevezése;

b) a kettős felhasználású termékek mennyisége;

c) az exportőr és a címzett neve és címe;

d) amennyiben ismert, a kettős felhasználású termékek végfelhasználása és végső felhasználója.

28. cikk

E rendelet megfelelő alkalmazása érdekében az egyes tagállamok minden szükséges intézkedést megtesznek, hogy hatáskörrel rendelkező hatóságaik:

a) információkat tudjanak beszerezni a kettős felhasználású termékeket magukban foglaló megrendelésekről vagy ügyletekről;

b) meggyőződhessenek az exportellenőrző intézkedések megfelelő alkalmazásáról, amelyek különösen kiterjedhetnek arra a jogosultságukra, hogy a kiviteli ügyletben érdekelt személyek vagy a 6. cikkben említett körülmények között végzett brókertevékenységben részt vevő brókerek vagy a 8. cikkben említett körülmények közötti technikai segítségnyújtást végzők helyiségeibe beléphessenek.

IX. FEJEZET

EGYÜTTMŰKÖDÉS HARMADIK ORSZÁGOKKAL

29. cikk

A párbeszédek támogathatják a harmadik országokkal folytatott rendszeres és kölcsönös együttműködést, beleértve az információk és a bevált gyakorlatok cseréjét, valamint a kapacitásépítést és a harmadik országokkal való kapcsolatfelvételt. A párbeszédek arra is ösztönözhetik a harmadik országokat, hogy alkalmazzák a többoldalú exportellenőrzési rendszerek által kidolgozott szigorú exportellenőrzési eljárásokat mint a nemzetközi bevált gyakorlat modelljét.

E tárgyalásokat az EUMSZ 207. cikkének (3) bekezdésében és adott esetben az Európai Atomenergia-közösséget létrehozó szerződésben megállapított eljárásokkal összhangban kell folytatni.

X. FEJEZET

ZÁRÓ RENDELKEZÉSEK

30. cikk

E rendelet az 1104/2011/EU határozat kiegészítéséről szóló, 2015. szeptember 15-i felhatalmazáson alapuló bizottsági határozat sérelme nélkül alkalmazandó.

31. cikk

A 428/2009/EK rendelet hatályát veszti.

A 2021. szeptember 9-át megelőzően benyújtott, exportengedély iránti kérelmekre azonban továbbra is az 428/2009/EK rendelet vonatkozó rendelkezéseit kell alkalmazni.

A hatályon kívül helyezett rendeletre való hivatkozásokat erre a rendeletre való hivatkozásnak kell tekinteni, és a VI. mellékletben foglalt megfelelési táblázattal összhangban kell értelmezni.

32. cikk

Ez a rendelet az Európai Unió Hivatalos Lapjában való kihirdetését követő kilencvenedik napon lép hatályba.

Ez a rendelet teljes egészében kötelező és közvetlenül alkalmazandó valamennyi tagállamban.

I. MELLÉKLET

AZ E RENDELET 3. CIKKÉBEN EMLÍTETT KETTŐS FELHASZNÁLÁSÚ TERMÉKEK JEGYZÉKE

Az e mellékletben szereplő jegyzék a kettős felhasználású termékekre vonatkozóan többek között az Ausztrália Csoport ( 4 ), a Rakétatechnológiai Ellenőrzési Rendszer (MTCR) ( 5 ), a Nukleáris Szállítók Csoportja (NSG) ( 6 ), a Wassenaari Megállapodás ( 7 ) és a Vegyifegyver-tilalmi Egyezmény (CWC) ( 8 ) által nemzetközileg elfogadott ellenőrzések végrehajtását tartalmazza.

I. RÉSZ

Általános megjegyzések, Mozaikszavak és rövidítések, Fogalommeghatározások

ÁLTALÁNOS MEGJEGYZÉSEK AZ I. MELLÉKLETHEZ

1. A katonai célra tervezett vagy átalakított termékek ellenőrzése tekintetében lásd az egyes uniós tagállamok katonai célú termékekre vonatkozó ellenőrzéseinek jegyzéke(i)t. E mellékletnek azok a hivatkozásai, amelyek a "LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE" megjegyzéssel vannak ellátva, ugyanezekre a jegyzékekre utalnak.

2. Az e mellékletben szereplő ellenőrzések célja nem kerülhető meg olyan nem ellenőrzött termékek (például termelő üzemek) kivitelével, amelyek egy vagy több ellenőrzött alkatrészt tartalmaznak, ha az ellenőrzött alkatrész vagy alkatrészek a termék alapvető elemei és ténylegesen eltávolíthatók vagy más célra felhasználhatók.

N.B. Annak eldöntése során, hogy az ellenőrzött alkatrész vagy alkatrészek lényeges elemnek minősíthetők-e, mérlegelni kell a mennyiséget, az értéket és az alkalmazott műszaki know-how-t, valamint azokat az egyéb speciális körülményeket, amelyek az ellenőrzött alkatrészt vagy alkatrészeket a beszerzendő termék alapvető elemévé teszik.

3. Az e mellékletben megnevezett termékek lehetnek újak és használtak is.

4. A vegyi anyagok helyenként névvel, illetőleg CAS-számmal vannak felsorolva. A lista az azonos szerkezeti képletű vegyi anyagokra vonatkozik (pl. hidrátok, izotóppal jelölt változatok vagy sztereoizomerek), függetlenül elnevezésüktől és CAS-számuktól. A CAS-számok feltüntetésének célja, hogy segítsenek az adott vegyi anyag vagy keverék azonosításában, tekintet nélkül a nómenklatúrára. A CAS-szám nem használható egyedi azonosítóként, mivel a felsorolt vegyi anyagok egyes formáinak különböző CAS-számuk van, és a felsorolt vegyi anyagot tartalmazó keverékeknek is különböző CAS-számuk lehet.

NUKLEÁRIS TECHNOLÓGIAI MEGJEGYZÉS (NTM)

(A 0. kategória E. fejezetéhez)

A 0. kategóriában ellenőrzendő termékekhez közvetlenül kapcsolódó "technológia" ellenőrzésére a 0. kategória rendelkezései vonatkoznak.

Az ellenőrzés alá eső termékek "fejlesztésére", "előállítására" és "felhasználására" szolgáló "technológiát" akkor is ellenőrizni kell, ha az a nem ellenőrizendő termékekhez is alkalmazható.

A termékekre megadott exportengedély magában foglalja a termékek üzembe helyezéséhez, üzemeltetéséhez, karbantartásához és javításához szükséges minimális "technológia" ugyanazon végfelhasználó részére történő kivitelét.

A "technológiaátadás" ellenőrzése nem vonatkozik a "nyilvánosan hozzáférhető" információkra, valamint a "tudományos alapkutatásra".

ÁLTALÁNOS TECHNOLÓGIAI MEGJEGYZÉS (ÁTM)

(Az 1-9. kategória E. fejezetéhez)

Az 1-9. kategória termékeinek "fejlesztéséhez", "előállításához" és "felhasználásához" "szükséges" "technológia" kivitelét az 1-9. kategória rendelkezéseinek megfelelően kell ellenőrizni.

Az ellenőrzés alá vont termékek "fejlesztéséhez", "előállításához" és "felhasználásához" "szükséges" "technológiát" akkor is ellenőrizni kell, ha az a nem ellenőrizendő termékekhez is alkalmazható.

Az ellenőrzés nem terjed ki a nem ellenőrzött vagy exportengedéllyel rendelkező termékek üzembe helyezéséhez, működtetéséhez, karbantartásához (teszteléséhez) vagy javításához minimálisan szükséges "technológiára".

Megjegyzés : Ez nem vonja ki az ellenőrzés alól az 1E002.e., 1E002.f., 8E002.a. és 8E002.b. pontokban meghatározott "technológiákat".

A "technológiaátadások" ellenőrzése nem vonatkozik a "nyilvánosan hozzáférhető" információkra, valamint a "tudományos alapkutatásra", illetve a szabadalmi bejelentésekhez minimálisan szükséges információkra.

NUKLEÁRIS SZOFTVER MEGJEGYZÉS (NSM)

(E megjegyzés hatálytalanítja a 0. kategória D. fejezetében meghatározott ellenőrzéseket)

A lista 0. kategóriájának D része nem ellenőrzi a "szoftvert", amely az exportra engedélyezett cikkek telepítéséhez, működtetéséhez, karbantartásához (ellenőrzés) vagy javításához szükséges minimális "tárgykód".

A termékekre megadott exportengedély magában foglalja a termékek üzembe helyezéséhez, üzemeltetéséhez, karbantartásához (ellenőrzéséhez) vagy javításához, vagy a javak javításához szükséges minimális szükséges "tárgykód" ugyanazon végfelhasználó részére történő kivitelét.

Megjegyzés : A nukleáris szoftver megjegyzésben foglaltak nem mentesítik az ellenőrzés alól az 5. kategória 2. részében meghatározott "szoftvert" ("információ-biztonság").

ÁLTALÁNOS SZOFTVER MEGJEGYZÉS (ÁSZM)

(E megjegyzés hatálytalanítja az 1-9. kategória D. fejezetében meghatározott ellenőrzéseket)

E jegyzék 1-9. kategóriája nem vonja ellenőrzés alá azt a "szoftvert", amely az alábbiak egyike:

a. Szabadon hozzáférhető, mivel: 1. Kiskereskedelmi forgalomban mindenféle korlátozás nélkül megvásárolható: a. Közvetlenül az üzletben; b. Postai rendelés útján; c. Elektronikus tranzakcióval; vagy d. Telefonos rendelés útján; valamint 2. Úgy tervezték, hogy a felhasználó a szállító további számottevő segítsége nélkül üzembe helyezhesse; Megjegyzés : Az általános szoftver megjegyzés a. bekezdésében foglaltak nem mentesítik az ellenőrzés alól az 5. kategória 2. részében meghatározott "szoftvert" ("információbiztonság").

b. A "nyilvánosság számára hozzáférhető"; vagy

c. Az exportra engedélyezett cikkek telepítéséhez, működtetéséhez, karbantartásához (ellenőrzés) vagy javításához szükséges minimális "tárgykód".

Megjegyzés : Az általános szoftver megjegyzés c. bekezdésében foglaltak nem mentesítik az ellenőrzés alól az 5. kategória 2. részében meghatározott "szoftvert" ("információbiztonság").

ÁLTALÁNOS "INFORMÁCIÓBIZTONSÁGI" MEGJEGYZÉS (ÁIM)

Az "információbiztonsági" termékeket vagy funkciókat abban az esetben is meg kell vizsgálni az 5. kategória 2. részének rendelkezései alapján, ha azok más termékek alkatrészei, "szoftverei" vagy funkciói.

SZERKESZTÉSI GYAKORLAT AZ EURÓPAI UNIÓ HIVATALOS LAPJÁBAN

Az intézményközi szerkesztési útmutatóban meghatározott szabályokkal összhangban az Európai Unió Hivatalos Lapjában közzétett magyar nyelvű szövegekben:

- az egész számok és a törtek elválasztására vessző szolgál,

- az egész számok tagolása három számjeggyel történik, és az egyes számjegycsoportokat szóköz választja el.

Az e mellékletben szereplő szöveg szerkesztése a fent leírt gyakorlatot követi.

A MELLÉKLETBEN HASZNÁLT MOZAIKSZAVAK ÉS RÖVIDÍTÉSEK

A definícióként használt mozaikszavakat és rövidítéseket lásd ‘A mellékletben szereplő kifejezések fogalommeghatározása' című részben.

MOZAIKSZAVAK ÉS RÖVIDÍTÉSEK
ABECAnnular Bearing Engineers Committee Gördülőcsapágy-mérnökök Bizottsága
ABMAAmerican Bearing Manufacturers Association Amerikai Csapágygyártók Szövetsége
ADCAnalogue-to-Digital Converter analóg-digitális átalakító
AGMAAmerican Gear Manufacturers' Association Amerikai Fogaskerékgyártók Szövetsége
AHRSAttitude and Heading Reference Systems helyzet- és irányrendszerek
AISIAmerican Iron and Steel Institute Amerikai Vas és Acél Intézet
ALEAtomic Layer Epitaxy atomréteg-epitaxia
ALUArithmetic Logical Unit aritmetikai logikai egység
ANSIAmerican National Standards Institute Amerikai Nemzeti Szabványügyi Intézet
APPAdjusted Peak Performance kiigazított csúcsteljesítmény
APUAuxiliary Power Unit segédhajtómű
ASTMAmerican Society for Testing and Materials Amerikai Anyagvizsgálati Társaság
ATCAir Traffic Control légiforgalmi irányítás
BJTBipolar Junction Transistors bipoláris tranzisztorok
BPPBeam Parameter Product sugárparaméter-szorzat
BSCBase Station Controller bázisállomás-vezérlő
CADComputer-Aided-Design számítógéppel támogatott tervezés
CASChemical Abstracts Service Vegyi Kivonatok Szolgálata
CCDCharge Coupled Device töltéscsatolt eszköz
CDUControl and Display Unit vezérlő és kijelző egység
CEPCircular Error Probable szórási kör sugara
CMMCoordinate Measuring Machine koordinált mérőgép
CMOSComplementary Metal Oxide Semiconductor komplementer fémoxid félvezető
CNTDControlled Nucleation Thermal Deposition irányított gócképződésű termikus rétegleválasztás
CPLDComplex Programmable Logic Device komplex programozható logikai eszköz
CPUCentral Processing Unit központi feldolgozó egység
CVDChemical Vapour Deposition gőzfázisú kémiai leválasztás
CWChemical Warfare vegyi hadviselés
CW (lézerek esetében)Continuos Wave folytonos hullám
DACDigital-to-Analogue Converter digitális-analóg átalakító
DANLDisplayed Average Noise Level kijelzett átlagos zajszint
DBRNData-Base Referenced Navigation adatalapú referencianavigáció
DDSDirect Digital Synthesizer közvetlen digitális szintetizátor
DMADynamic Mechanical Analysis dinamikus mechanikai analízis
DMEDistance Measuring Equipment távolságmérő berendezés
DMOSFETDiffused Metal Oxide Semiconductor Field Effect Transistor diffundáltatott, fém-oxid-félvezető térvezérlésű tranzisztorok
DSDirectionally Solidified irányított kristályosodású
EBExploding Bridge robbantó kapcsoló
EB-PVDElectron Beam Physical Vapour Generation elektronsugaras fizikai gőzgenerálás
EBWExploding Bridge Wire robbantó izzószál
ECADElektronikus számítógépes tervezés
ECMElectro-Chemical Machining elektrokémiai megmunkálás
EDMElectrical Discharge Machines szikraforgácsoló gépek
EFIExploding Foil Initiators robbantófólia-iniciátor
EIRPEffective Isotropic Radiated Power tényleges izotróp kisugárzott teljesítmény
EMPElectromagnetic Pulse elektromágneses impulzus
ENOBEffective Number of Bits effektív bitszám
ERFElectrorheological Finishing elektroreológiai megmunkálás
ERPEffective Isotropic Radiated Power effektív kisugárzott teljesítmény
ESDElectrostatic Discharge Elektrosztatikus kisülés
ETOEmitter Turn-Off Thyristor emittorral kikapcsolható tirisztor
ETTElectrical Triggering Thyristor elektromos kapcsolású tirisztor
EUEurópai Unió
EUVExtreme UltraViolet extrém ultraibolya
FADECFull Authority Digital Engine Control teljesen önálló digitális hajtóművezérlési rendszerek
FFTFast Fourier Transform gyors Fourier-transzformáció
FPGAField Programmable Gate Array felhasználó által programozható kapu tömb
FPICField Programmable Interconnect felhasználó által programozható összekapcsoló
FPLAField Programmable Gate Array felhasználó által programozható logikai tömb
FPOFloating Point Operation lebegőpontos művelet
FWHMFull-Width Half-Maximum félértékszélességű
GAAFETGate-All-Around Field-Effect Transistor nanohuzalos térvezérlésű tranzisztor
GLONASSGlobal Navigation Satellite System globális műholdas navigációs rendszer
GNSSGlobal Navigation Satellite System globális műholdas navigációs rendszer
GPSGlobal Positioning System globális helymeghatározó rendszer
GSMGlobal System for Mobile Communications globális mobil kommunikációs rendszer
GTOGate Turn-off Thyristor vezérlőelektródával kikapcsolható tirisztor
HBTHetero-Bipolar Transistors hetero-bipoláris tranzisztorok
HDMIHigh-Definition Multimedia Interface nagyfelbontású multimédia-interfész
HEMTHigh Electron Mobility Transistor nagy elektronmozgékonyságú tranzisztor
ICAONemzetközi Polgári Repülési Szervezet
IECNemzetközi Elektrotechnikai Bizottság
IEDImprovised Explosive Device házikészítésű robbanószerkezet
IEEEInstitute of Electrical and Electronic Engineers Villamos- és Elektronikai Mérnöki Szervezet
IFOVInstantaneous-Field-Of-View pillanatnyi látómező
IGBTInsulated Gate Bipolar Transistor szigetelt vezérlőelektródos bipoláris tranzisztor
IGCTIntegrated Gate Commutated Thyristor integrált vezérlőelektródával szabályozott tirisztor
IHOInternational Hydrographic Organization Nemzetközi Hidrográfiai Szervezet
ILSInstrument Landing System műszeres leszállító rendszer
IMUInertial Measurement Unit inerciális mérőegység
INSInertial Navigation System inerciális navigációs rendszer
IPInternet Protocol internetprotokoll
IRSInertial Reference System inerciális referencia rendszer
IRUInertial Reference Unit inerciális referencia egység
ISAInternational Standard Atmosphere nemzetközi egyezményes légkör
ISARInverse Synthetic Aperture Radar inverz szintetikus apertúrájú radar
ISOInternational Organisation for Standardisation Nemzetközi Szabványügyi Szervezet
ITUInternational Telecommunication Union Nemzetközi Távközlési Unió
JTJoule-Thompson effektus
LIDARLight Detection and Ranging lézerlokátor
LIDTLaser Induced Damage Threshold lézer indukálta roncsolási küszöb
LOALength Overall teljes hossz
LRULine Replaceable Unit gépben-cserélhető egység
LTTLight Triggering Thyristor fénykapcsolású tirisztor
MLSMicrowave Landing System mikrohullámú leszállítórendszer
MMICMonolithic Microwave Integrated Circuit monolitikus, mikrohullámú integrált áramkörök
MOCVDMetal Organic Chemical Vapour Deposition szerves fémgőz rétegleválasztás
MOSFETMetal-Oxide-Semiconductor Field Effect Transistor fém-oxid-félvezető térvezérlésű tranzisztor
MPMMicrowave Power Module mikrohullámú teljesítménymérő
MRFMagnetorheological Finishing magnetoreológiai megmunkálás
MRFMinimum Resolvable Feature size minimális felbontási méret
MRIMagnetic Resonance Imaging mágneses rezonancia leképezés
MTBFMean-Time-Between-Failures átlagos hibamentes működési idő
MTTFMean-Time-To-Failure átlagos idő a következő meghibásodásig
NANumerical Aperture numerikus apertúra
NDTNon-Destructive Test roncsolásmentes anyagvizsgálat
NEQNet Explosive Quantity nettó robbanóanyag-mennyiség
NIJNemzeti Igazságügyi Intézet
OAMOperations, Administration or Maintenance működés, adminisztráció vagy karbantartás
OSIOpen Systems Interconnection nyíltrendszer-összekapcsolás
PAIPolyamide-imides poliamid-imidek
PARPrecision Approach Radar precíziós bevezető radar
PCLPassive Coherent Location passzív koherens helymeghatározás
PDKProcess Design Kit folyamattervezési készlet
PINszemélyi azonosító szám
PMRPrivate Mobile Radio magán mobil rádiórendszer
PVDPhysical Vapour Deposition fizikai gőzfázisú leválasztás
ppmparts per million milliomodrész
QAMQuadrature-Amplitude-Modulation kvadratúra-amplitúdó-moduláció
QEQuantum Efficiency kvantumhatásfok
RAPReactive Atom Plasmas reaktív atomplazma
RFRadio Frequency rádiófrekvencia
rmsRoot Mean Square négyzetes középérték
RNCRadio Network Controller rádióhálózat-vezérlő
RNSSRegional Navigation Satellite System regionális műholdas navigációs rendszer
ROICRead-out Integrated Circuit kiolvasáshoz használt integrált áramkör
S-FILStep and Flash Imprint Lithography Step and Flesh imprinting litográfia
SARSynthetic Aperture Radar szintetikus apertúrájú radar
SASSynthetic Aperture Sonar szintetikus apertúrájú szonár
SCSingle Crystal egykristály
SCRSilicon Controlled Rectifier szilíciumvezérlésű egyenirányító
SFDRSpurious Free Dynamic Range torzítás feletti dinamikatartomány
SHPLSuper High Powered Laser szuper nagyteljesítményű lézer
SLARSidelooking Airborne Radar oldallátású fedélzeti radar
SOISilicon-on-Insulator szilícium-szigetelő
SQUIDSuperconducting Quantum Interference Device szupravezető kvantum interferométer
SRAShop Replaceable Assembly műhelyben kicserélhető alkatrész
SRAMStatic Random Access Memory statikus véletlen elérésű tár
SSBSingle Sideband egy oldalsávos
SSRSecondary Surveillance Radar másodlagos felderítő radar
SSSSide Scan Sonar oldalirányban pásztázó szonár
TIRTotal Indicated Reading összes kijelzett érték
TVRTransmitting Voltage Response sugárzott feszültségre adott válasz
uAtomic Mass Unit atomtömeg-egység
UPRUnidirectional Positioning Repeatability egyirányú pozicionálási ismételhetőség
UTSUltimate Tensile Strength szakítószilárdság
UVultraviolet ultraibolya
VJFETVertical Junction Field Effect Transistor záróréteges térvezérlésű vertikális tranzisztor
VORVery High Frequency Omni-Directional Range körsugárzó rádió irányadó
WHOEgészségügyi Világszervezet
WLANWireless Local Area Network vezeték nélküli helyi hálózat

A MELLÉKLETBEN SZEREPLŐ KIFEJEZÉSEK FOGALOMMEGHATÁROZÁSA

Az ‘egyszeres idézőjelbe' tett kifejezések fogalommeghatározása az adott termékhez tartozó műszaki megjegyzéseknél található.

A "normál idézőjelbe" tett kifejezések fogalommeghatározása a következő:

N.B. A kategóriákra való hivatkozásokat a meghatározott kifejezés után zárójelben tüntetjük fel.

"Pontosság" (accuracy) (2 3 6 7 8): általában a pontatlanság mérésével jelölik, egy mért értéknek az elfogadott standardtól vagy a tényleges értéktől való maximális (pozitív vagy negatív) eltérését jelenti.

"Aktív repülésirányítási rendszerek" (active flight control systems) (7): olyan rendszerek, amelyek a különböző szenzorok jelzéseinek autonóm feldolgozása és az automatikus irányítás működésbe hozásához szükséges megelőző parancsok kiadása által a nemkívánatos "repülőgép"- és rakétamozgások és strukturális megterhelések megakadályozására szolgálnak.

"Aktív képelem" (active pixel) (6): a félvezető rendszernek az a minimális (egyetlen) eleme, amely fény (elektromágneses) sugárzás hatására fotoelektromos átvitelt hoz létre.

"Kiigazított csúcsteljesítmény" (adjusted peak performance - APP) (4): az "APP" az a kiigazított csúcssebesség, amellyel a "digitális számítógépek" a 64 bites vagy annál nagyobb lebegőpont-összeadásokat és szorzásokat végzik, és amelyet WT-ben (Weighted TeraFLOPS), azaz másodpercenként 1012 kiigazított lebegőpontos műveletnek megfelelő egységekben fejezünk ki.

N.B. Lásd: 4. kategória, műszaki megjegyzés.

"Légi jármű" (aircraft) (1, 6, 7, 9): merevszárnyas, csuklósszárnyas, forgószárnyas (helikopter), döntött rotoros vagy döntött szárnyas légi jármű.

N.B. Lásd még "Polgári repülőeszköz".

"Léghajó" (airship) (9): olyan, motorral hajtott légi jármű, amelyet a levegőnél könnyebb gáztest (általában hélium, korábban hidrogén) tart fenn.

"Összes rendelkezésre álló kompenzáció" (all compensations available) (2): a gyártó számára rendelkezésre álló összes olyan elfogadható intézkedés, amellyel egy adott szerszámgép-típusnál valamennyi szisztematikus pozícionálási hibát vagy egy adott koordináta mérőeszköznél valamennyi mérési hibát minimalizálja.

"ITU által kiosztott" (allocated by the ITU) (3, 5): frekvenciasávok kiosztása az ITU Rádió Szabályzat jelenlegi kiadása szerint elsődleges, engedélyezett és másodlagos szolgáltatások részére.

N.B. Nem tartoznak ide a további és az alternatív kiosztások.

"Szögeltérés" (angular position deviation) (2): a szöghelyzet és a tényleges, nagy pontossággal mért szöghelyzet közötti maximális eltérés, miután az asztalra szerelt munkadarabot kiinduló helyzetéből elfordították.

"Véletlenszerű szögelcsúszás" (angle random walk) (7): a szögsebesség fehér zaja következtében az idő függvényében fellépő szöghiba (IEEE STD 528-2001).

"APP" (4): az "adjusted peak performance" (kiigazított csúcsteljesítmény) rövidítése.

"Aszimmetrikus algoritmus" (asymmetric algorythm) (5): olyan rejtjelző algoritmus, amely a titkosításhoz és a dekódoláshoz különböző matematikai kulcsokat használ.

N.B. Az "aszimmetrikus algoritmus" kifejezést általában a rejtjelkulcsok kezelésével kapcsolatban használják.

"Hitelesítés" (authentication) (5): egy felhasználó, folyamat vagy eszköz személyazonosságának ellenőrzése, gyakran egy információs rendszerben szereplő erőforrásokhoz való hozzáférés engedélyezésének előfeltételeként. A hitelesítés magában foglalja egy üzenet vagy más információ eredetének és tartalmának ellenőrzését, valamint a hozzáférés-védelem minden olyan elemét, amelynél nincs fájl- vagy szövegtitkosítás, kivéve a közvetlen jelszóvédelmet, a személyi azonosító (PIN) vagy hasonló adatok illetéktelen hozzáférés elleni védelmét.

"Átlagos kimenőteljesítmény" (average output power) (6): a "lézer" Joule-ban kifejezett teljes kimenő energiája, osztva azon másodpercben kifejezett időtartammal, amelyen belül a lézer egymást követő impulzusok sorozatát bocsátja ki. Állandó sűrűségű impulzusok sorozatát tekintve egyenlő egy "lézer"-impulzus teljes, Joule-ban kifejezett kimenő energiájával, szorozva a "lézer" hertzben kifejezett impulzusfrekvenciájával

"Alapkapu késleltetési idő" (basic gate propagation delay time) (3): egy "monolit integrált áramkörben" alkalmazott alapkapu késleltetési idejét jelenti. A "monolit integrált áramkörök" ‘családjánál' a késleltetési idő meghatározható a ‘családon' belüli tipikus kapu késleltetési idejével, vagy az adott ‘családon' belüli kapunkénti tipikus késleltetési idővel.

N.B.1. "Az alapkapu késleltetési időt" nem szabad összekeverni az összetett "monolit integrált áramkör" be-/kimeneti késleltetési idejével.

N.B.2. A ‘családhoz' tartozik az összes olyan integrált áramkör, amelyre az adott funkcióját kivéve az összes következő azonos gyártási eljárást és előírást alkalmazták:

a. azonos hardver és szoftver architektúra;

b. azonos kialakítási és feldolgozási technológia; valamint

c. azonos alapjellemzők.

"Tudományos alapkutatás" (basic scientific research) (ÁMM, NMM): kísérleti vagy elméleti munka, melynek alapvető célja új ismeretek megszerzése a jelenségek vagy a megfigyelhető tények alapelveiről, s alapvetően nem meghatározott gyakorlati cél vagy szándék elérésére irányul.

"Torzítás" (gyorsulásmérő) (bias [accelerometer]) (7): a gyorsulásmérő adott időtartam alatt, meghatározott működési feltételek fennállása mellett mért kimeneti értékének az átlaga, amely nincs kölcsönviszonyban bementi gyorsulással vagy elfordulással. A "torzítást" grammban vagy méter per négyzetmásodpercben (g vagy m/s2) fejezzük ki. (IEEE Std 528-2001) (Micro g egyenlő 1 × 10-6 g).

"Torzítás" (giroszkóp) (bias [gyro]) (7): a gyorsulási teljesítmény adott időtartam alatt, meghatározott működési feltételek fennállása mellett mért átlaga, amely nincs kölcsönviszonyban bemeneti elfordulással vagy gyorsulással. A "torzítást" jellemzően szögfok per órában fejezzük ki. (IEEE Std 528-2001)

A "biológiai ágensek" (biological agents) (1): olyan kórokozók vagy toxinok, amelyeken olyan módosítást vagy szelektálást (mint a tisztaság, szavatossági vagy lejárati idő, fertőzőképesség, terjedési jellemzők vagy az UV-sugárzással szembeni ellenálló-képesség megváltoztatása) végeznek, amelynek célja, hogy növelje az ember- vagy állatveszteséget, roncsolja a berendezéseket, vagy kárt tegyen a termésben vagy a környezetben.

"Excenter" (camming) (2): tengelyirányú elmozdulás a főtengely egy fordulata során, a tengely síktárcsára merőleges síkban, a kerület melletti ponton mérve (lásd: ISO 230-1:1986, 5.63 bekezdés).

"CEP" (CEP) (7): "Cirkuláris hibavalószínűség" (Circular Error Probable) - egy köralakú normál eloszlásban annak a körnek a sugara, amelybe az elvégzett egyedi mérések 50 %-a esik, vagy annak a körnek a sugara, amelyben 50 % az előfordulás valószínűsége.

"Vegyi lézer" (chemical laser) (6): olyan "lézer", amelyben a gerjesztett részeket a vegyi reakció során felszabaduló energia biztosítja.

"Kémiai elegy" (chemical mixture) (1): szilárd, folyékony vagy légnemű termék, amely két vagy több olyan összetevőből áll, amelyek az elegy tárolásának körülményei között nem reagálnak egymással.

"Cirkulációvezérlésű nyomatékkiegyenlítő vagy cirkulációvezérlésű iránytartó-rendszerek" (circulation-controlled anti-torque or circulation direction control systems) (7): olyan rendszerek, amelyek aerodinamikai felületekre fúvatott levegőt alkalmaznak a felületek által keltett erők növelésére vagy szabályozására.

"Polgári légi jármű" (civil aircraft) (1, 3, 4, 7): egy vagy több uniós tagállam vagy a Wassenaari Megállapodásban részt vevő államok polgári repülésügyi hatóságai által közzétett, a repülésre való alkalmasságot minősítő listákban felsorolt "légi járművek", amelyek kereskedelmi, polgári, belső és külső útvonalakon repülhetnek, vagy polgári-, magán- vagy üzleti célokra használhatók.

N.B. Lásd még "Légi jármű".

"Adatcsatorna-vezérlőegység kontroller" (communications channel controller) (4): fizikai interfész, amely a szinkron vagy aszinkron digitális adatok áramlását ellenőrzi. Olyan részegység, amely az adatokhoz történő hozzáférés biztosítása céljából a számítógépbe vagy a távközlési berendezésbe beépíthető.

"Kompenzációs rendszerek" (compensation systems) (6): elsődleges skaláris érzékelőből, egy vagy több referenciaérzékelőből (pl. vektormagnetométer), valamint a platform merev teste elfordulási zajának csökkentését lehetővé tévő szoftverből álló rendszerek.

"Kompozit" (composite) (1, 2, 6, 8, 9): egy "mátrix" és egy további fázis vagy olyan további fázisok, amelyek szemcsékből, pászmákból, rostokból vagy azok kombinációjából állnak, és amely meghatározott célra vagy célokra szolgálnak.

"III/V vegyületek" (III/V compounds) (3, 6): olyan polikristály vagy bináris vagy komplex egykristályos termékek, amelyek a Mengyelejev-féle periódusos rendszer III/A és V/A csoportjának elemeiből állnak (pl. gallium-arzenid, gallium-alumínium-arzenid, indium-foszfid).

"Kontúrvezérlés" (contouring control) (2): két vagy több "számjegyvezérlésű" mozgás olyan utasításoknak megfelelően, amelyek meghatározzák a következő szükséges helyzetet, és az e helyzet eléréséhez szükséges előtolási sebességeket. Ezek az előtolási sebességek egymáshoz viszonyítva úgy változtathatók, hogy a kívánt kontúr elérhető legyen (lásd: ISO/DIS 2806 - 1980).

"Kritikus hőmérséklet" (critical temperature) (1, 3, 5): a "szupravezető anyag" kritikus hőmérséklete (más kifejezéssel átmeneti hőmérséklete) az a hőmérséklet, amelyen az anyag az elektromos egyenárammal szemben minden ellenállását elveszíti.

"Rejtjel-aktiválás" (Cryptographic activation) (5): olyan technika, amelynek segítségével a termék gyártója által alkalmazott mechanizmus révén kifejezetten aktiválható, azaz működésbe hozható egy termék rejtjelezési képessége, és ez a mechanizmus kizárólag az alábbiak valamelyikéhez kapcsolódik:

1. Valamely termék egyetlen példányához; vagy

2. Egy ügyfélhez, egy termék több példányához.

Műszaki megjegyzések :

1. A "rejtjel-aktiválási" technikák és mechanizmusok alkalmazása hardver, "szoftver" és "technológia" formájában egyaránt megvalósulhat.

2. A "rejtjel-aktiváláshoz" alkalmazott mechanizmusok között szerepelhetnek többek között sorozatszám-alapú termékkulcsok vagy hitelesítő eszközök, pl. digitális aláírással ellátott tanúsítványok.

"Rejtjelezés" (cryptography) (5): az adatok átalakítását szolgáló elvek, eszközök és módszerek összességét magában foglaló tudományág, melyek célja az információtartalom elrejtése, észrevétlen módosításának vagy illetéktelen felhasználásának megakadályozása. A "rejtjelezés" az információ olyan átalakítására korlátozódik, amikor egy vagy több ‘titkos paramétert' (pl. titkos változókat) vagy ahhoz kapcsolódó kulcsszót alkalmaznak.

Megjegyzések :

1. A "rejtjelezés" nem tartalmazza a ‘rögzített' adat-tömörítési vagy kódolási technikákat.

2. A "rejtjelezés" tartalmazza a dekódolást.

Műszaki megjegyzések :

1. ‘Titkos paraméter' mások előtt titokban tartott, illetve csak egy csoporton belül ismert állandó vagy kulcsszó.

2. ‘Rögzített' a kódolási vagy kompressziós algoritmus nem fogad külső paramétereket (pl. rejtjelezéssel vagy kulcsszóval megadott változókat) és a felhasználó által nem módosítható.

"Folytonos lézer" (CW laser) (6): 0,25 másodpercet meghaladó időtartamú, nominálisan állandó kimenő energiát létrehozó "lézer".

"Kiberbiztonsági esemény operatív kezelése" (Cyber incident response) (4): az a folyamat, amelynek során a kiberbiztonsági eseménnyel kapcsolatban lefolytatják a szükséges információcserét a kiberbiztonsági esemény kezeléséért vagy annak koordinálásáért felelős személyekkel vagy szervezetekkel.

"Adatalapú referencia navigáció" (Data-based Referenced Navigation - "DBRN") (7): olyan rendszerek, amely különféle, előre kimért, a pontos navigációs információk biztosítása érdekében dinamikus körülmények között integrált térképadat forrást használnak. Az adatforrások között szerepelnek a batométeres térképek, a csillagászati térképek, a gravitációs térképek, a mágneses térképek vagy a háromdimenziós tereptérképek.

"Szegényített urán" (depleted uranium) (0): olyan urán, amely a 235 izotópot természetes előfordulásánál kisebb arányban tartalmazza.

"Fejlesztés" (development): (ÁMM, NMM, Összes) kapcsolódik a sorozatgyártást megelőző valamennyi fázishoz: tervezés, tervezés-kutatás, tervezés-elemzések, tervezési koncepciók, a prototípusok összeszerelése és vizsgálata, kísérleti gyártási tervek, tervezési adatok, a tervezési adatok termékké történő átalakításának folyamata, konfigurációs tervezés, integrációtervezés, tervrajzok.

"Diffúziós kötés" (diffusion bonding) (1, 2): legalább két különböző fém szilárd állapotú összekapcsolódása, ahol a kötés erőssége a leggyengébb anyag szilárdságával egyezik meg, és a kötés alapvető mechanizmusa az atomok interdiffúziója a határfelületen.

"Digitális számítógép" (digital computer) (4, 5): berendezés, amely egy vagy több diszkrét változó formájában az alábbi jellemzők mindegyikét képes végrehajtani:

a. adatok elfogadása;

b. adatok vagy utasítások tárolása állandó vagy változtatható (írható) tárolóeszközökön;

c. adatok feldolgozása tárolt és módosítható utasítás-sorozattal; valamint

d. kimeneti adatok szolgáltatása.

N.B. A tárolt utasítás-sorozat módosítása magában foglalja az állandó tárolóeszközök cseréjét is, de nem tartalmazza a kábelezés vagy a csatlakozások fizikai megváltoztatását.

"Digitális átviteli sebesség" (digital transfer rate) (def): a bármilyen típusú átviteli közegen közvetlenül átvitt információ teljes bit-sebessége.

N.B. Lásd még "teljes digitális átviteli sebesség".

"Eltérési arány" (drift rate) (gyro) (7): a gyorsulási teljesítménynek a bemeneti forgástól funkcionálisan független összetevője. Szögsebességben fejezzük ki. (IEEE STD 528-2001).

"Effektív gramm" (effective gramme) (0, 1): a "különleges hasadóanyag" tekintetében az alábbiakat jelenti:

a. plutónium izotópok és urán-233 esetén: az izotóp tömege grammban;

b. az U-235 izotópban legalább 1 %-ra dúsított urán esetén: a grammokban megadott atomtömeg szorova a tizedes tört alakban megadott tömegarányként kifejezett dúsítási fok négyzetével;

c. az U-235 izotópban 1 %-nál alacsonyabb értékre dúsított urán esetében: a 0,0001-gyel megszorzott, grammban megadott atomtömeget;

"Elektronikus részegység" (electronic assembly) (2, 3, 4): több elektronikus komponens (pl. ‘áramköri elemek', ‘diszkrét komponensek', integrált áramkörök stb.) összekapcsolása azzal a céllal, hogy egyedi funkciót (funkciókat) lássanak el, és amely "elektronikus részegységek" önálló egységként kicserélhetők és általában szétszerelhetők.

N.B.1. ‘Áramköri elem': az elektromos áramkör aktív vagy passzív funkcionális része, pl. dióda, tranzisztor, ellenállás, kondenzátor stb.

N.B.2. ‘Diszkrét komponens': különálló részekből összerakott ‘áramköri elem' saját külső csatlakozásaival együtt.

"Energiahordozó anyagok" (energetic materials) (1): olyan anyagok vagy keverékek, amelyek a tervezett felhasználásukhoz szükséges energia kibocsátása céljából kémiai reakcióba lépnek. A "robbanóanyagok", "pirotechnikai eszközök" és "hajtóanyagok" az energiahordozó anyagok alosztályait képezik.

"Végeffektorok" (end-effectors) (2): végeffektorok a fogószerszámok, az ‘aktív szerszámegységek' és minden egyéb olyan szerszám, amelyet a "robot" manipulátorkar végén lévő alaplapra erősítenek.

N.B. ‘Aktív szerszámegység' eszköz, amely a hajtóerőt, a megmunkálási energiát vagy az érzékelést átviszi a munkadarabra.

"Ekvivalens sűrűség" (equivalent density) (6): az optikai felület egységnyi optikai területére vetített optikai tömeg.

"Ekvivalens szabvány" (equivalent standards) (1): egy vagy több uniós tagállam vagy a Wassenaari Megállapodásban részt vevő államok által elismert és az adott bejegyzésre alkalmazandó összehasonlítható nemzeti vagy nemzetközi szabványok.

"Robbanóanyagok" (explosives) (1): olyan szilárd, folyékony vagy gáz-halmazállapotú anyagok vagy anyagok keverékei, amelyek robbanófejekben elsődleges, indító- vagy főtöltetként, valamint bontások és egyéb alkalmazások során történő felhasználásukkor robbanást okoznak.

"FADEC-rendszerek" (FADEC Systems; full authority digital engine control systems) (9): teljesen önálló digitális hajtóművezérlési rendszerek - gázturbinás hajtóművek digitális elektromos vezérlőrendszere, amely normál körülmények között és meghibásodás esetén is képes önállóan vezérelni a hajtóművet annak beindításától a leállításáig.

"Rostos vagy szálas anyagok" (fibrous or filamentary materials) (0, 1, 8, 9): többek között:

a. folytonos "monofil szálak";

b. folytonos "cérnák" és "előfonatok";

c. "szalagok", szövetek, kusza fonatok és paszományok;

d. vágott szálak, szálkötegek és koherens szálú végek;

e. bármilyen hosszú, egykristályos vagy polikristályos tűkristályok;

f. aromás poliamid pép.

"Film típusú integrált áramkör" (film type integrated circuit) (3)a ‘áramköri elemek' és fémcsatlakozások sorozata, amelyet egy szigetelő "alaplemezre" vastag vagy vékony film formájában visznek fel.

N.B. ‘Áramköri elem' az elektromos áramkör aktív vagy passzív funkcionális része, pl. dióda, tranzisztor, ellenállás, kondenzátor stb.

"Optikai repülésvezérlő rendszer - Fly-by-light rendszer" (Fly-by-light system) (7): olyan elsődleges digitális repülésirányító rendszer, amely a "repülőgép" járat alatti ellenőrzéséhez visszacsatolást alkalmaz, és ahol a vezérlőnek/működtető egységnek optikai jelek formájában adnak parancsokat.

"Elektronikus repülésvezérlő rendszer - Fly-by-wire rendszer" (Fly-by-wire system) (7): olyan elsődleges digitális repülésirányító rendszer, amely a "repülőgép" járat alatti ellenőrzéséhez visszacsatolást alkalmaz, és ahol az effektornak/vezérlőtagnak elektromos jelek formájában adnak parancsokat.

"Fókuszsíkban levő detektorsor" (focal plane array) (6, 8): önálló detektor elemek olyan lineáris vagy kétdimenziós planáris rétege, vagy planáris rétegeinek kombinációja, kiolvasó elektronikával vagy anélkül, amely a fókuszsíkban működik.

N.B. Ebbe nem értendő bele egyedi detektorelemek halmaza vagy bármely két-, három-, vagy négyelemű detektor, feltéve, hogy az elemekben időkésleltetés és integráció nem valósul meg.

"Relatív sávszélesség" (fractional bandwidth) (3, 5): a "pillanatnyi sávszélesség" és a központi frekvencia hányadosa százalékban kifejezve.

"Frekvenciaugrás" (frequency hopping) (5, 6): a "kiterjesztett spektrum" egy formája, amelyben a hírközlő csatorna átviteli frekvenciája diszkrét lépések véletlen vagy pszeudovéletlen sorozatával változtatható.

"Frekvenciakapcsolási idő" (frequency switching time) (3): egy megadott kiindulási kimeneti frekvenciáról történő elkapcsolástól számítva a jel számára ahhoz szükséges idő (azaz késleltetés), hogy elérje a megadott végső kimeneti frekvenciát vagy annak tartományát a következők szerint:

a. kisebb mint 1 GHz megadott végső kimeneti frekvencia esetében ± 100 Hz; vagy

b. legalább 1 GHz megadott végső kimeneti frekvencia esetében ± 0,1 ppm.

"Üzemanyagcella" (fuel cell) (8): olyan elektrokémiai eszköz, amely képes egy külső forrásból kapott üzemanyag kémiai energiáját közvetlenül egyenárammá átalakítani.

"Olvasztható" (fusible) (1): hő, sugárzás, katalizátorok stb. alkalmazásával térhálósítható vagy tovább polimerizálható (kezelhető), illetve pirolízis (szenesedés) nélkül megolvasztható.

"Nanohuzalos térvezérlésű tranzisztor ("GAAFET") (3): olyan eszköz, amely egy vagy több, félvezetőből kialakított vezetőcsatorna elemmel és közös kapustruktúrával rendelkezik, amely körülzárja az összes, félvezetőből kialakított vezetőcsatornát és szabályozza azokban az áramot.

N.B. Ez a meghatározás magában foglalja a nanolemezes vagy a nanohuzalos térvezérlésű tranzisztorokat és a körülzáró kapuval rendelkező tranzisztorokat, továbbá az egyéb, "GAAFET" félvezetőcsatornaelem-struktúrákat.

"Erős szelektorok" (hard selectors) (5): az egyénnel kapcsolatos adatok vagy adatsorok (pl. vezetéknév, keresztnév, e-mail-cím, postai cím, telefonszám vagy csoporttagságok).

"Irányítási/vezérlő készlet" (guidance set) (7): olyan rendszer, amely járművek repülésirányító rendszerei számára, a röppálya korrigálása céljából egyesíti magában a járművek helyzet- és sebességmérésének és számításának folyamatát (azaz a navigálást) a számítás és parancskiadás folyamatával.

"Hibrid integrált áramkör" (hybrid integrated circuit) (3): olyan integrált áramkör(ök), vagy integrált áramkör és ‘áramköri elemek' vagy egymással összekapcsolt ‘diszkrét komponensek' bármely kombinációja, amelyek egyedi funkció(ka)t lát(nak) el, és rendelkezik az összes alábbi jellemzővel:

a. legalább egy tokozás nélküli eszközt tartalmaz;

b. szokásos IC-gyártási módszerek felhasználásával kapcsolták össze;

c. modulként cserélhető; valamint

d. általában nem szerelhető szét.

N.B.1. ‘Áramköri elem': az elektromos áramkör aktív vagy passzív funkcionális része, pl. dióda, tranzisztor, ellenállás, kondenzátor stb.

N.B.2. ‘Diszkrét komponens': különálló részekből összerakott ‘áramköri elem' saját külső csatlakozásaival együtt.

"Képminőség-javítás" (image enhancement) (4): kívülről bevitt információhordozó képek feldolgozása olyan algoritmusokkal, így például az időkompresszió, szűrés, extrahálás, kiválasztás, korreláció, konvolúció vagy az értelmezési tartományok közötti átalakítások (pl. gyors Fourier-transzformáció vagy Walsh-transzformáció). Nem tartalmazza az olyan algoritmusokat, amelyek csupán egyetlen kép lineáris vagy rotációs transzformációját végzik, ilyen pl. a fordítás, a jellemző extrahálása, a regisztráció vagy a hamis színezés.

"Immunotoxin" (immunotoxin) (1): egy sejtspecifikus monoklonális antitest és egy "toxin" vagy "toxinalegység" összekapcsolódása, amely szelektíven hat a megbetegedett sejtekre.

"Nyilvánosság számára hozzáférhető" (in the public domain) (ÁMM, NMM, ÁSM): ebben az alkalmazásban olyan "technológia" vagy "szoftver", amelynek továbbterjesztése korlátozás nélkül lehetséges (a szerzői jogi korlátozások nem jelentik azt, hogy a "szoftver" vagy a "technológia" a nyilvánosság számára nem hozzáférhető).

"Információbiztonság" (information security) (GSN GISN 5): mindazok az eszközök és funkciók, melyek az információ vagy a közlemények hozzáférhetőségét, bizalmasságát, illetve integritását biztosítják, kivéve a zavarok elleni védelmet szolgáló eszközöket és funkciókat. Idetartozik a "rejtjelezés", a "rejtjelaktiválás", a ‘rejtjelelemzés', a zavaró sugárzások elleni védelem és a számítógép biztonsága.

Műszaki megjegyzés :

‘Rejtjelelemzés': a rejtjelzési rendszernek vagy bemeneteinek és kimeneteinek elemzése a bizalmas változók vagy precíz adatok, többek között az érthető szöveg, feltárására.

"Pillanatnyi sávszélesség" (instantaneous bandwidth) (3, 5, 7): az a sávszélesség, amelyen a többi üzemi paraméter módosítása nélkül a kimenőteljesítmény 3 dB határon belül állandó marad.

"Szigetelés" (insulation) (9): a rakétahajtóműmotor komponenseire - azaz a testre, a fúvókára, a bemenetekre, a ház tömítéseire - vonatkozik, és a szigetelő vagy tűzálló réteget tartalmazó vulkanizált vagy félig vulkanizált többrétegű gumiterméket is magában foglalja. Feszültségcsökkentő karmantyúk vagy lapok formájában is beépíthető.

"Belső bélelés" (interior lining) (9): a szilárd hajtóanyag és a ház vagy a szigetelő bélés közötti összeköttetést biztosítja. Általában egy folyékony polimer alapú tűzálló vagy szigetelő anyag diszperzió, pl. szénnel töltött, hidroxil-csoportot tartalmazó poli-butadién (HTPB) vagy más polimer hozzáadott keményítőszerrel, amelyet a ház belsejére szórnak vagy simítanak.

A "közvetett AD átalakítók" (interleaved Analogue-to-Digital Converter [ADC]) (3): olyan készülékek, amelyek több AD átalakító egységből állnak, amelyek egyazon analóg bemenő jelet mintavételezik különböző időpontokban, oly módon, hogy végül a kimenetek aggregálásával hatékony módon, nagyobb mintavételezési sebességgel valósul meg az analóg bemeneti jel mintavételezése és átalakítása.

"Belső mágneses gradiométer" (intrinsic magnetic gradiometer) (6): mágneses mező gradiens-érzékelő elem a hozzá tartozó elektronikával, amelynek kimenete a mágneses mező gradiensének mértéke.

N.B. Lásd még: "Mágneses gradiométer".

"Támadószoftver" (intrusion software) (4, 5): kifejezetten valamely számítógép vagy hálózati eszköz ‘monitoring eszközök' által történő feltárásának elkerülésére vagy a ‘védő ellenintézkedések' hatálytalanítására tervezett vagy módosított "szoftver", amely az alábbiak valamelyikét látja el:

a. Adatok vagy információk kinyerése számítógépről vagy hálózati eszközről, vagy a rendszer- vagy felhasználói adatok módosítása; vagy

b. Egy program vagy folyamat standard végrehajtási útvonalának módosítása kívülről adott utastások végrehajtásának lehetővé tétele céljából.

Megjegyzések :

1. A "támadószoftver" az alábbiak egyikét sem foglalja magában:

a. Hipervizorok, hibakereső programok vagy szoftverek műszaki visszafejtésére (SRE) szolgáló eszközök;

b. a digitális jogok kezelésére (DRM) szolgáló "szoftver"; vagy

c. A gyártók, rendszergazdák vagy felhasználók által, eszközkövetés vagy helyreállítás céljából történő telepítésre tervezett "szoftver".

2. A hálózati eszközök magukban foglalják a mobil eszközöket és intelligens fogyasztásmérőket is.

Műszaki megjegyzések :

1. ‘Monitoring eszközök': olyan "szoftver" vagy hardver eszközök, amelyek figyelemmel kísérik a rendszerviselkedést vagy az eszközön futó folyamatokat. Ez magában foglalja az antivírus (AV) termékeket, végpontbiztonsági termékeket, személyes biztonsági termékeket (PSP), behatolásfelderítő rendszereket (IDS), behatolásvédő rendszereket (IPS) és tűzfalakat.

2. ‘Védő ellenintézkedések': a programkód biztonságos végrehajtásának biztosítására tervezett technikák, mint például az adatvégrehajtás-megelőzés (DEP), véletlenszerű címterület-kiosztás (ASLR) vagy a homokozó használata.

"Izolált élő kultúrák" (isolated live cultures) (1): ezek közé tartoznak az élő kultúrák vegetatív és nyugalmi formában, és szárított preparátumokként is.

"Izosztatikus sajtók" (isostatic presses) (2): olyan berendezés, amely zárt térben különböző közegek segítségével (gáz, folyadék, szilárd részecskék stb.) túlnyomást biztosít annak érdekében, hogy a zárt térben a munkadarabra vagy az anyagra minden irányban egyforma nyomás hasson.

"Lézer" (laser) (0, 1, 2, 3, 5, 6, 7, 8, 9): olyan termék, amely mind térben, mind időben olyan koherens fényt biztosít, amelyet stimulált sugárzáskibocsátással erősítenek fel.

Lásd még:

"Vegyi lézer"

"Folytonos lézer"

"Impulzuslézer"

"Szuper nagyteljesítményű lézer";

"Könyvtár" (1) (parametrikus műszaki adatbázis): olyan műszaki információk gyűjteményét jelenti, amelyre való hivatkozás javíthatja a vonatkozó rendszerek, berendezések vagy alkotórészek működését.

"A levegőnél könnyebb légi járművek" (lighter-than-air vehicles) (9): hőlégballonok és "léghajók", amelyek emelkedésükhöz forró levegőt vagy a levegőnél könnyebb gázokat - például héliumot vagy hidrogént - használnak.

"Linearitás" (linearity) (2): a linearitás (amit általában a non-linearitással mérünk) az adott jellemző maximális - pozitív vagy negatív irányú - eltérése (a skálán felfelé és lefelé leolvasott értékek átlaga) a lineáristól, úgy pozícionálva, hogy kiegyenlítse és minimalizálja a maximális eltéréseket.

"Helyi hálózat" (local area network) (4, 5): adatkommunikációs rendszer, amely az alábbi összes jellemzővel rendelkezik:

a. tetszőleges számú független ‘adatátviteli eszköz' számára lehetővé teszi az egymással való közvetlen összeköttetést; valamint

b. földrajzilag kis területre korlátozódik (pl. irodaépület, üzem, egyetem vagy főiskola, áruház).

N.B. ‘Adateszköz' digitális információk sorozatának adására, ill. vételére alkalmas berendezés.

"Mágneses gradiométer" (magnetic gradiometers) (6): külső forrásokból a műszerre ható mágneses mezők térbeli gradiensének detektálására szolgál. Több "magnetométerből" és a kapcsolódó elektronikából áll, amelynek kimenete a mágneses mező gradiensének mértéke.

N.B. Lásd még "Belső mágneses gradiométer".

"Magnetométer" (magnetometers) (6): külső forrásokból a műszerre ható mágneses mezők érzékelésére szolgál. A mágneses mezőt érzékelő elemből és a kapcsolódó elektronikából áll, amelynek kimenete a mágneses mező mértéke.

Az "UF6-nak ellenálló anyagok" (materials resistant to corrosion by UF6) (0) lehetnek réz, rézötvözet, rozsdamentes acél, alumínium, alumínium-oxid, alumíniumötvözet, nikkel vagy legalább 60 tömegszázakékban nikkelt tartalmazó ötvözetek, illetve fluorozott szénhidrogén-polimer.

"Mátrix" (matrix) (1, 2, 8, 9): lényegében folyamatos fázis, amely kitölti a részecskék, a tűkristályok vagy a rostok közötti teret.

"Mérési bizonytalanság" (measurement uncertainty) (2): az a jellemző paraméter, amely meghatározza, hogy a mérendő változó helyes értéke, 95 %-os biztonsággal, a kimeneti érték körüli mekkora tartományba esik. Tartalmazza a nem korrigált szisztematikus eltéréseket, a nem korrigált hibákat és a véletlen eltéréseket (Lásd: ISO 10360-2).

"Mikroszámítógép mikroáramkör" (microcomputer microcircuit) (3): "monolit integrált áramkör" vagy "multichip integrált áramkör", aritmetikai logikai egységgel (ALU), amely képes arra, hogy a belső tárolóban lévő adatokon a belső tárolóról kapott általános célú utasításokat hajtson végre.

N.B. A belső tároló megnövelhető egy külső tárolóval.

"Mikroprocesszor mikroáramkör" (microprocessor microcircuit) (3): "monolit integrált áramkör" vagy "multichip integrált áramkör" aritmetikai logikai egységgel (ALU), amely képes a külső tárolóról kapott általános célú utasítások sorozatának végrehajtására.

N.B.1. A "mikroprocesszor mikroáramkör" rendszerint nem tartalmaz integrált, a felhasználó számára hozzáférhető tárolót, bár a chip tárolókapacitása felhasználható logikai funkcióinak ellátására.

N.B.2. Tartalmazza azokat a chipkészleteket, amelyeket együttes működésre terveztek, a "mikroprocesszor mikroáramkörök" funkcióinak ellátása céljából.

"Mikroorganizmusok" (microorganisms) (1, 2): természetes, megnövelt képességű vagy módosított baktériumok, vírusok, mikoplazmák, rickettsiák, klamidiák vagy gombák, akár "izolált élő kultúrák" formájában, akár ilyen kultúrákkal szándékosan beoltott vagy beszennyezett élő anyagot tartalmazó anyagok formájában.

"Rakéták" (missiles) (1, 2, 3, 6, 7, 9): komplett rakétarendszerek és pilóta nélküli légijármű-rendszerek, melyek hatósugara legalább 300 km és legalább 500 kg hasznos teher célba juttatására képesek.

"Monofil elemi szál/rost" (monofilament) (1): a szál legkisebb egysége, rendszerint néhány mikrométernyi átmérővel.

"Monolit integrált áramkör" (monolithic integrated circuit) (3): passzív vagy aktív ‘áramköri elemek' vagy mindkettő kombinációja, amely:

a. diffúz, implantációs vagy depozíciós eljárásokkal készül egyetlen félvezető anyagon vagy anyagban, egy ún. "chipen";

b. oszthatatlannak tekinthető; valamint

c. áramköri funkció(ka)t lát el.

N.B. ‘Áramköri elem' az elektromos áramkör aktív vagy passzív funkcionális része, pl. dióda, tranzisztor, ellenállás, kondenzátor stb.

"Monolitikus, mikrohullámú integrált áramkör" (Monolithic Microwave Integrated Circuit, "MMIC") (3, 5): olyan "monolitikus integrált áramkör", amely mikrohullámú vagy milliméterhullámú frekvenciákon üzemel.

"Monospektrális képérzékelők" (monospectral imaging sensors) (6): egy diszkrét spektrális sávban képadat vételére alkalmas eszközök.

"Multichip integrált áramkör" (multichip integrated circuit) (3): közös "alaplemezre" rögzített két vagy több "monolit integrált áramkör".

"Többcsatornás AD átalakítók" (multiple channel Analogue-to-Digital Converter [ADC]) (3): olyan készülékek, amelyek egynél több közvetett AD átalakítót integrálnak úgy, hogy mindegyik közvetett AD átalakítónak külön analóg bemeneti jele van.

"Multispektrális képérzékelők" (multispectral imaging sensors) (6): két vagy több diszkrét spektrális sávból képadatok egyidejű vagy sorozatos vételére alkalmas eszközök. A több mint húsz diszkrét spektrális sávval rendelkező szenzorokat hiperspektrális képszenzoroként is említik.

"Természetes urán" (natural uranium) (0): a természetben előforduló izotópok keverékeit tartalmazó urán.

"Hálózati hozzáférés-szabályozó" (network access controller) (4): fizikai interfész osztott kapcsolású hálózathoz. Közönséges közeget használ, amely végig ugyanazon a "digitális átviteli sebességen" működik, a továbbítására arbitrációt (azaz jel- vagy hordozóérzékelőt) alkalmaz. Minden mástól függetlenül választja ki a neki címzett adatcsomagokat vagy adatcsoportokat (pl. IEEE 802.). Olyan részegység, amely a kommunikációs hozzáférés biztosítása céljából a számítógépbe vagy a távközlési berendezésbe beépíthető.

"Atomreaktor" (nuclear reactor) (0): olyan teljes reaktor, amely képes a szabályozott önfenntartó hasadási láncreakció fenntartására. Az "atomreaktor" magában foglalja a reaktortartályon belüli vagy ahhoz közvetlenül kapcsolódó valamennyi elemet, a magban lévő teljesítményszintet szabályozó berendezést, valamint a rendszerint a reaktormag primer hűtőközegével közvetlen érintkezésbe kerülő vagy azt szabályozó alkatrészeket.

"Számjegyvezérlés" (numerical control) (2): automatikus folyamatvezérlés olyan eszközzel, amely a rendszerint a művelet közben betáplált numerikus adatokat használja fel (lásd: ISO 2382:2015).

"Tárgykód" (object code) (GSN): egy vagy több folyamat alkalmas kifejezésének ("forráskód" [forrásnyelv]) a berendezés által végrehajtható formája, amelyet programrendszerrel hoztak létre.

"Működés, adminisztráció vagy karbantartás" (Operations, Administration or Maintenance, "OAM") (5): az alábbi feladatok közül egy vagy több ellátása:

a. Az alábbiak bármelyikének létrehozása vagy irányítása: 1. felhasználói vagy adminisztrátori fiókok vagy kiváltságok; 2. egy termék beállításai; vagy 3. hitelesítési adatok az a.1. vagy a.2. pontban leírt feladatokhoz.;

b. Egy termék üzemeltetési körülményének vagy teljesítményének ellenőrzése vagy irányítása; vagy

c. Naplózás vagy auditadatok kezelése az a. vagy b. pontban leírt bármely feladathoz;

Megjegyzés : Az "OAM" nem foglalja magába az alábbi feladatokat, vagy az azokhoz kapcsolódó fontosabb irányítási funkciókat:

a. a fenti a.1. vagy a.2. pontban leírt feladatokat segítő hitelesítési adatok létrehozásához vagy kezeléséhez nem közvetlenül kapcsolódó rejtjelezési funkció ellátása vagy felfejlesztése; vagy

b. bármilyen rejtjelezési funkció elvégzése a termék továbbítási vagy adatsíkján (forwarding/data plane).

"Optikai integrált áramkör" (optical integrated circuit) (3): "monolit integrált áramkör" vagy "hibrid integrált áramkör", amely egy vagy több olyan részből áll, melyeket arra terveztek, hogy fotoszenzorként vagy fotoemitterként funkcionáljanak, illetve hogy optikai vagy elektro-optikai funkciót(ka)t lássanak el.

"Optikai kapcsolás" (optical switching) (5): az optikai formájú jelek irányítása vagy kapcsolása villamos jelekké történő átalakításuk nélkül.

"Teljes áramsűrűség" (overall current density) (3): az összes ampermenet száma a tekercsben (azaz a menetek száma szorozva az egyes meneteken átfolyó maximális árammennyiséggel), osztva a tekercs teljes keresztmetszetével (amely magában foglalja a szupravezető rostokat, a fémmátrixot, amelybe a szupravezető rostok vannak beágyazva, a tokozó anyagot, az esetleges hűtőcsatornákat stb.).

"Részt vevő állam" (participating state) (7, 9): a Wassenaari Megállapodásban résztvevő állam (Lásd: www.wassenaar.org)

"Csúcsteljesítmény" (peak power) (6): az "impulzus-időtartam" során elért legmagasabb teljesítmény.

"Személyi hálózat" (personal area network) (5): olyan adatkommunikációs rendszer, amely az alábbi összes jellemzővel rendelkezik:

a. tetszőleges számú független vagy összekapcsolt ‘adateszköz' számára lehetővé teszi az egymással való közvetlen összeköttetést; valamint

b. egy adott személy vagy eszközellenőrző szerkezet közvetlen fizikai közelségében (pl. egyetlen helyiség, iroda vagy gépjármű) található eszközök közötti kommunikációra korlátozódik.

Műszaki megjegyzések :

1. ‘Adateszköz' digitális információk sorozatának adására, ill. vételére alkalmas berendezés.

2. A "helyi hálózat" túlmutat a "személyi hálózat" földrajzi területén.

"Előzetesen leválasztott" (previously separated) (1): bármely olyan eljárás alkalmazása, amelynek célja az ellenőrzött izotóp koncentrációjának növelése.

"Alapvető elem" (principal element) (4): a 4. kategória alkalmazásában egy elem akkor "alapvető elem", ha a csereértéke meghaladja az adott rendszer - amelynek az eleme - összértékének 35 %-át. Az elem értéke az az ár, amelyet a rendszer gyártója vagy a rendszer integrátora fizet az elemért. Az összérték a gyártási ponton vagy a szállítás teljesítésekor a kívülálló, pártatlan félnek kifizetett szokásos nemzetközi vételár.

"Gyártás" (ÁMM, NMM, Összes) (production (GTN NTN All)) valamennyi gyártási fázis összefoglaló jelentése, pl.: tervezés, termelés-előkészítés, gyártás, integrálás, összeszerelés, ellenőrzés, tesztelés, minőségbiztosítás.

"Gyártó berendezés" (production equipment) (1, 7, 9): olyan szerszámok, sablonok, pofák, tüskék, formázóminták, süllyesztékek, rögzítő elemek, egyengető mechanizmusok, vizsgáló berendezések, az ezekhez való egyéb gépek és komponensek, amelyeket kifejezetten a "fejlesztés" céljára, vagy a "gyártás" egy vagy több fázisához terveztek, illetve alakítottak át.

"Gyártó létesítmények" (production facilities) (7, 9): a "fejlesztés" vagy a "gyártás" egy vagy több fázisához szolgáló berendezésekhez tartozó "gyártási berendezések" és a hozzájuk tervezett szoftver.

"Program" (program) (6): egy folyamat végrehajtására adott utasítások sorozata az elektronikus számítógép által végrehajtható, vagy arra átalakítható formában.

"Impulzus-kompresszió" (pulse compression) (6): a hosszú időtartamú radarjel impulzus egy rövid időtartamúra történő átkódolása és feldolgozása a nagy impulzusenergia előnyeinek megtartásával.

"Impulzus-időtartam" (pulse duration) (6): a "lézer"-impulzus-időtartama, vagyis egy impulzus belépő élén és kilépő élén mért félteljesítménypontok között eltelt idő.

"Impulzuslézer" (pulsed laser) (6): olyan "lézer", amelynek "impulzus-időtartama" 0,25 másodperc vagy annál kevesebb.

"Kvantum-kriptográfia" (quantum cryptography) (5): olyan technikák összessége, amelyekkel egy adott fizikai rendszer kvantummechanikai tulajdonságainak mérése révén - beleértve a kifejezetten a kvantumoptika, kvantumtérelmélet vagy kvantum-elektrodinamika által meghatározott fizikai tulajdonságokat is - közös "rejtjelezési" kulcs hozható létre.

"Radarfrekvencia-agilitás" (radar frequency agility) (6): bármilyen olyan eljárástechnika, amely az impulzusrendszerű radaradó vivőfrekvenciáját az impulzusok között vagy az impulzuscsoportok között pszeudovéletlen sorrendben olyan mértékben változtatja meg, amely akkora vagy nagyobb, mint az impulzus-sávszélesség.

"Radar kiterjesztett spektrum" (radar spread spectrum) (6): bármely modulációs technika a viszonylag keskeny frekvenciasávú jelből eredő energia szélesebb frekvenciasávban történő szórására, véletlen vagy pszeudovéletlen kódolás alkalmazásával.

"Sugárérzékenység" (radiant sensitivity) (6): sugárérzékenység (mA/W) = 0,807 × (hullámhossz nm-ben) × kvantumhatásfok (Quantum Efficiency, QE).

Műszaki megjegyzés :

A kvantumhatásfokot általában százalékos arányként fejezik ki, ebben a képletben azonban egynél kisebb tizedes törtként jelenik meg, azaz pl. a 78 % megfelelője 0,78.

"Valós idejű feldolgozás" (real time processing) (6): a szükséges szintű szolgáltatást kínáló számítógép-rendszerrel a rendelkezésre álló források függvényében, garantált válaszidőn belül, külső esemény ösztönzésére, a rendszer terhelésétől függetlenül történő adatfeldolgozás.

"Ismételhetőség" (repeatability) (7): ugyanazon változó azonos működési feltételek melletti ismételt mérései közötti egyezés mértéke az egyes mérések között a feltételek változása vagy működésmentes időszakok előfordulása esetén. (Referencia: IEEE STD 528-2001 (1 szigma szórású normál eltérés))

"Szükséges" (required) (ÁMM, 3, 5, 6, 7, 9): a "technológia" tekintetében a "technológiának" kizárólag az a része, amely elsősorban felelős az ellenőrzött teljesítményszintek, jellemzők vagy funkciók elérésért vagy kiterjesztésért. Az ilyen "szükséges" "technológiából" különböző termékek egyaránt részesülhetnek.

"Tömegoszlató anyag" (riot control agent) (1): olyan anyag, amely - a tömegoszlatási célra történő tervezett felhasználása során - rövid idő alatt az emberi érzékszervek irritációját vagy a fizikai funkciók zavarát okozza, amely hatások az anyagnak való expozíció befejeződését követően rövid időn belül megszűnnek.

Műszaki megjegyzés :

A könnygáz a "tömegoszlató anyagok" egyik fajtája.

"Robot" (robot) (2, 8): olyan manipulációs mechanizmus, amely lehet folyamatos működésű vagy pontról pontra mozgatható manipulációs mechanizmus és szenzorokat is alkalmazhat, és rendelkezik az alábbi jellemzők mindegyikével:

a. többfunkciós;

b. képes anyagok, részegységek, szerszámok vagy különleges eszközök beállítására vagy orientálására, háromdimenziós térben történő változtatható mozgások révén;

c. három vagy több zárt- vagy nyílthurkú szervoeszközt foglal magában, amelyek léptető motorokat is tartalmazhatnak; valamint

d. a "felhasználó által programozható" tanít/visszajátszik módszerrel vagy elektronikus számítógéppel, amely lehet programozható logikai kontroller, azaz mechanikai beavatkozás nélküli.

N.B. A fenti meghatározás nem foglalja magában az alábbi eszközöket:

1. Olyan manipulációs mechanizmusok, amelyeket csak kézzel vagy távoperátorral lehet irányítani.

2. Állandó sorrendű manipulációs mechanizmusok, amelyek mechanikusan rögzített programozott mozgások szerint működő automatizált mozgó eszközök. A programot mechanikusan korlátozzák a rögzített, de állítható ütközők, pl. csapok vagy bütykök. A mozgások sorrendje és a pályák vagy szögek megválasztása mechanikai, elektronikus vagy elektromos úton nem változtatható, illetve nem is cserélhető.

3. Mechanikai vezérlésű, változtatható sorrendű manipulációs mechanizmusok, amelyek a mechanikusan rögzített programozott mozgások szerint működő automatikus mozgó eszközök. A programot mechanikusan korlátozzák a rögzített, de állítható ütközők, pl. csapok vagy bütykök. A mozgások sorozata és a pályák vagy szögek megválasztása a rögzített programsémán belül változtatható. A programséma változtatása vagy módosítása (pl. a csapok átállítása vagy a bütykök cseréje) egy vagy több mozgási tengelyen csak mechanikai műveletek révén történik.

4. Nem szervóvezérlésű, változtatható sorrendű manipulációs mechanizmusok, amelyek a mechanikusan rögzített programozott mozgások szerint működő automatikus mozgó eszközök. A program változtatható, de a folyamat csak a mechanikusan rögzített elektromos bináris eszközről vagy állítható ütközőkről kapott bináris jel hatására halad tovább.

5. Descartes-féle koordináta manipulátor rendszerként definiált rakodódaruk, amelyeket függőleges elhelyezett tárolórekeszek integrált részeként alakítottak ki, és e rekeszek tartalmának tárolás és kirakodás céljából történő elérésére szolgálnak.

"Előfonat" (roving) (1): közel párhuzamos ‘fonalak' (általában 12-120) kötege.

N.B. A ‘fonal' "monofil szálak" (általában több, mint 200) közel párhuzamosan elrendezett kötege.

"Kiesés a beállításból" (run out) (2): (a pontos beállítástól való eltérés) sugárirányú elmozdulás a főtengely egy fordulata során, a tengely síktárcsára merőleges síkban, a mérendő külső vagy belső forgófelület egy pontján mérve (lásd: ISO 230-1:1986, 5.61. bekezdés).

Az AD átalakító "mintavételezési sebessége" (sample rate) (3): a minták maximális számát jelenti, amelyeket egy másodperc alatt az analóg bemeneti jelnél mérnek, kivéve a túlmintavételező AD átalakítókat. A túlmintavételező AD átalakítók esetében a "mintavételi sebesség" a szókiviteli gyakorisággal egyezik meg. A "mintavételi sebességre" mintavételi sebességként is lehet hivatkozni, amelyet általában mega- minta / másodpercben (Ms/s) vagy giga- minta / másodpercben (Gs/s) adnak meg, vagy átváltási rátaként, amelyet általában hertzben (Hz) adnak meg.

"Műholdas navigációs rendszer" (satellite navigation system) (5, 7): olyan földi állomásokból, műholdakból és vevőkészülékekből álló rendszer, amely lehetővé teszi a vevőkészülék földrajzi helyének a műholdaktól kapott jelek alapján történő kiszámítását. Magában foglalja a globális műholdas navigációs rendszereket (GNSS) és a regionális műholdas navigációs rendszereket (RNSS).

"Skála faktor" (scale factor) (giroszkóp vagy gyorsulásmérő) (7): a kimenet változásának aránya a mérni kívánt bemenet változásához viszonyítva. A skála faktort általában a bemenetnek a bemeneti tartományban történő ciklikus változtatásával kapott bemeneti-kimeneti adatokra alkalmazott legkisebb négyzetek módszerével illeszthető egyenes meredekségeként adják meg.

"Jelanalizátor" (signal analysers) (3): többfrekvenciás jelek egyfrekvenciás összetevőinek fő jellemzőinek mérésére és kijelzésére képes készülék.

"Jelfeldolgozás" (signal processing) (3, 4, 5, 6): kívülről bevitt információhordozó jelek feldolgozása olyan algoritmusokkal, mint az időkompresszió, szűrés, extrahálás, kiválasztás, korreláció, konvolúció vagy az értelmezési tartományok közötti transzformáció (pl. gyors Fourier- vagy Walsh-transzformáció).

"Szoftver" (software) (ÁSM, Mind): bármilyen tényleges hordozóra rögzített, egy vagy több "program" vagy ‘mikroprogram' gyűjteménye.

N.B. A ‘mikroprogram' elemi utasítások sorozata, amelyeket különleges tárolóban tárolnak, és amelyeknek végrehajtását a referencia utasításainak utasításregiszterbe történő töltése indítja el.

"Forráskód/ forrásnyelv" (source code / source language) (6, 7, 9): egy vagy több olyan eljárás hétköznapi kifejezése, amely egy programozási rendszer révén gép által végrehajtható formába önthető (→"Tárgykód" / tárgynyelv).

"Űreszköz" (spacecraft) (9): aktív és passzív műholdak és űrszondák.

"Űreszközplatform" (spacecraft bus) (9): olyan berendezés, amely biztosítja az "űreszköz" kisegítő infrastruktúráját és az "űreszköz hasznos terhének" elhelyezését.

"Űreszköz hasznos terhe" (spacecraft payload) (9): az "űreszközplatformhoz" csatolt, az űrbeli küldetés (pl. kommunikációs, megfigyelő, tudományos feladatok) végrehajtásához tervezett berendezés.

"Űrminősítésű" (space-qualified) (3 6 7): a Föld felszíne fölött 100 km-es vagy nagyobb magasságban történő működésre tervezett, ellőálllított vagy sikeres teszteléseken keresztül arra minősített.

N.B. Az, hogy egy konkrét eszköz tesztelés révén "űrminősítést" kap, még nem jelenti azt, hogy az ugyanazon gyártási sorozatból vagy modellszériából származó más eszközök is "űrminősítésűek", hacsak nem tesztelték külön azokat is.

"Különleges hasadóanyag" (special fissile material) (0): 239-Pu, 233U vagy "235U vagy 233U izotópban dúsított urán", valamint az ezeket tartalmazó bármilyen anyag.

"Fajlagos modulus" (specific modulus) (0, 1, 9): a Pascalban, ami N/m2-nek felel meg, kifejezett Young-modulus osztva a N/m3-ben kifejezett fajsúllyal, (296 ± 2) K [(23 ± 2) °C] hőmérsékleten és (50 ± 5) % relatív páratartalom mellett mérve.

"Fajlagos szakítószilárdság" (Specific tensile strength) (0, 1, 9): a Pascalban, ami N/m2-nek felel meg, kifejezett szakítószilárdság osztva a N/m3-ben kifejezett fajsúllyal, (296 ± 2) K [(23 ± 2) °C] hőmérsékleten és (50 ± 5) % relatív páratartalom mellett mérve.

"Tehetetlenségi giroszkóp" (spinning mass gyros) (7): olyan giroszkóp, amely folytonosan forgó tömeget használ a szögmozgás érzékelésére.

"Kiterjesztett spektrum" (spread spectrum) (5): olyan technika, ahol a viszonylag keskeny sávú kommunikációs csatornában található energia sokkal szélesebb energiaspektrumon terjed szét.

"Kiterjesztett spektrumú radar" (spread spectrum radar) (6): lásd: "Radar kiterjesztett spektrum".

"Stabilitás" (stability) (7): adott paraméter stabil hőmérsékleti körülmények között mért kalibrált értéktől való eltérésének normál szórása (1 szigma). Ez az idő függvényében fejezhető ki.

"A Vegyifegyver-tilalmi Egyezményhez (nem) csatlakozó államok" (States (not) Party to the Chemical Weapon Convention) (1): azok az államok, amelyekben hatályba lépett (nem lépett hatályba) a Vegyi Fegyverek Fejlesztésének, Előállításának, Felhalmozásának és Használatának Tilalmáról szóló Egyezmény. (Ld. www.opcw.org)

A "folyamatos motorműködés" (Steady State Mode) (9): a motor olyan működési feltételeit jelzi, amelyek esetén, a motor bemeneténél mért állandó környezetei levegőhőmérséklet és nyomás mellett a motor paramétereiben - például hajtómű-tolóerő/teljesítmény, rpm és egyebek - nincs értékelhető fluktuáció.

"Szuborbitális jármű" (sub-orbital craft) (9): személy- vagy áruszállításra tervezett zárt területtel rendelkező jármű:

a. a sztratoszféra felett működik;

b. nem orbitális repülési útvonalat hajt végre; valamint

c. a személyekkel vagy az áruval sérülésmentesen tér vissza a Földre.

"Alaplemez" (substrate) (3): alaplemez csatlakozási mintákkal vagy anélkül, amelyen vagy amelyben ‘diszkrét komponensek' vagy integrált áramkörök vagy mindkettő elhelyezhető.

N.B.1. ‘Diszkrét komponens': különálló részekből összerakott ‘áramköri elem' saját külső csatlakozásaival együtt.

N.B.2. ‘Áramköri elem': az elektromos áramkör aktív vagy passzív funkcionális része, pl. dióda, tranzisztor, ellenállás, kondenzátor stb.

"Nyers alaplemez" (substrate blanks) (3 6): olyan optikai elemek, mint a tükrök vagy az optikai ablakok gyártására alkalmas méretekkel rendelkező monolit elegy.

"Toxin alegysége" (sub-unit of toxin) (1): a teljes "toxin" szerkezetileg és funkcionálisan elkülönült komponense.

"Szuperötvözetek" (superalloys) (2, 9): nikkel-, kobalt- vagy vasalapú ötvözetek, amelyeknek 922 K (649 °C) vagy annál magasabb hőmérsékleten a feszültségi törés-ellenállási élettartamuk meghaladja az 1 000 órát 400 MPa mechanikai feszültség terhelésnél és a szakítószilárdságuk meghaladja a 850 MPa-t.

"Szupravezető" (superconductive) (1, 3, 5, 6, 8): anyagok - fémek, ötvözetek vagy vegyületek -, amelyek elveszíthetik minden elektromos ellenállásukat, azaz végtelen elektromos vezetőképességgel rendelkezhetnek, és igen nagy elektromos áram átvitelére alkalmasak, Joule-hő keletkezése nélkül.

N.B. Az anyag kritikus "szupravezető" állapotát a "kritikus hőmérséklet", a kritikus mágneses mező - amely a hőmérséklet függvénye - és a kritikus áramsűrűség jellemzi, amely azonban a mágneses mezőtől és a hőmérséklettől egyaránt függ.

"Szuper nagyteljesítményű lézer" (super high power laser - "SHPL") (6): 50 milliszekundumon belül 1 kJ-t meghaladó kimenő energia (teljesen vagy részben történő) szolgáltatására alkalmas vagy 20 kW-t meghaladó átlag-, illetve CW (folyamatos) teljesítményű "lézer".

"Szuperképlékeny alakítás" (superplastic forming) (1, 2): szobahőmérsékleten a hagyományos szakítóvizsgálattal meghatározott töréspontnál alacsony szakadási nyúlással (20 %-nál alacsonyabb) rendelkező fémek hőkezelést alkalmazó alakítási eljárása abból a célból, hogy a feldolgozás során a szakadási nyúlás a fenti értékeknek legalább a kétszeresét érje el.

"Szimmetrikus algoritmus" (symmetric algorithm) (5): olyan kriptográfiai algoritmust jelent, amely azonos kulcsot használ a titkosításhoz és a dekódoláshoz is.

N.B. A "szimmetrikus algoritmus" kifejezést általában titkos adatoknál használják.

"Szalag" (tape) (1): összefont vagy egyirányú "monofil szálakból", ‘fonalból', "előfonatból", "kócból", "cérnából" stb. készített anyag, amelyet rendszerint előzetesen műgyantával impregnálnak.

N.B. A ‘fonal' "monofil szálak" (általában több, mint 200) közel párhuzamosan elrendezett kötege.

"Technológia" (technology) (ÁMM, NMM, Mind): az áruk "fejlesztéséhez", "gyártásához" vagy "felhasználásához" szükséges egyedi információ. Ez az információ lehet ‘műszaki adat' vagy ‘műszaki támogatás'.

N.B.1. A ‘műszaki támogatás' lehet útmutatások, készségek, képzés valamint a munkával kapcsolatos ismeretek átadása vagy konzultációs szolgáltatás és magában foglalhatja a ‘műszaki adatok' átadását is.

N.B.2. A ‘műszaki adat' lehet tervrajz, terv, ábra, modell, formula, táblázat, gépészeti terv és specifikáció, kézikönyv és útmutatás, akár írásban, akár más közegen, például mágneslemezen, mágnesszalagon vagy csak olvasható tárban rögzítve.

"Háromdimenziós integrált áramkör" (three dimensional integrated circuit) (3): egymáshoz illesztett félvezető lapkák vagy aktív elemek együttese, amelyek egy köztes kapcsolórétegen (interposer), félvezető hordozó anyagon, lapkán vagy rétegen teljesen áthatoló átmenő viákon keresztül hoznak létre kapcsolatot az elemek között. A köztes kapcsolóréteg egy elektromos csatlakozásokat lehetővé tevő felület.

"Billenő orsó" (tilting spindle) (2): szerszámtartó orsó, amely a megmunkálási folyamat során középvonalának szöghelyzetét bármelyik más tengelyhez képest módosítja.

"Időállandó" (time constant) (6): az aktuális növekmény számára szükséges idő, hogy a fénystimulus kezdetétől enyhe gerjesztés hatására a végső érték 1-1/e-szeresével (azaz a végső érték 63 %-ával) megegyező értéket érjen el.

"Regisztrálásra kész állapot eléréséhez szükséges idő" (time-to-steady-state registration) (6) (más néven: a graviméter válaszadási ideje): az az időtartam, amely alatt a platform által kiváltott gyorsulások zavaró hatásai (magas frekvenciájú zaj) csökkennek.

"Lapátvégtömítés" (tip shroud) (9): a hajtómű turbinaház belső állórészéhez vagy a forgólapát külső végéhez csatlakozó gyűrű, mely egy részből vagy szegmensekből áll, és elsődlegesen a forgólapátok és állórész közötti résveszteségek csökkentésére szolgál.

"Teljes repülésirányítás" (total control of flight) (7): a "légi jármű" állapotváltozóinak és repülési útjának olyan automatikus irányítását jelenti, amely a célok, veszélyek és más "légi járművek" tekintetében a valós idejű adatváltozásokra úgy válaszol, hogy az megfeleljen a küldetés céljának.

"Teljes digitális átviteli sebesség" (total digital transfer rate) (5): digitális átviteli rendszerben a megfelelő berendezések között időegység alatt áthaladó bitek - beleértve a vonali kódot, az overheadet (információ biteket), stb. - száma.

N.B. Lásd még "Digitális átviteli sebesség".

"Kóc" (tow) (1): rendszerint megközelítőleg párhuzamos "monoszálakból" álló köteg.

"Toxinok" (toxins) (1, 2): szándékosan előállított preparátumok vagy keverékek formájában jelen lévő toxinok az előállítás módjától függetlenül, kivéve más anyagokban, például beteg állatok, gabonafélék, élelmiszerek vagy "mikroorganizmusok" szennyezéseként jelen lévő toxinokat.

"Hangolható" (tunable) (6): a "lézer"-nek az a képessége, hogy folyamatos teljesítmény leadást biztosít minden hullámhosszon a különböző "lézer" átmenetek tartományában. A választható hangolású "lézer" egy "lézer" átmeneten belül biztosít diszkrét hullámhosszt és nem tekinthető hangolhatónak.

"Egyirányú pozicionálási ismételhetőség" (unidirectional positioning repeatability) (2): egy önálló szerszámgéptengely R↑ és R↓ (előre és vissza) értékei közül a kisebb, az ISO 230-2:2014 szabvány 3.21. pontjában vagy annak megfelelő nemzeti szabványban meghatározottak szerint.

"Pilóta nélküli légijármű" (Unmanned Aerial Vehicle, "UAV") (9): minden olyan repülőeszköz, amely a fedélzeten mindennemű emberi jelenlét nélkül képes a repülés megkezdésére, valamint az irányított repülés és navigálás fenntartására.

"235U vagy 233U izotópban dúsított urán" (uranium enriched in the isotopes 235 or 233) (0): 235U vagy 233U izotópot vagy mindkettőt olyan mennyiségben tartalmazó urán, amelyben az ilyen izotópok összegének a 238U izotóphoz viszonyított aránya nagyobb, mint a 235U izotópnak a 238U izotóphoz viszonyított természetben előforduló aránya. (0,71 % izotóp-arány).

"Felhasználás" (use): (ÁMM, NMM, Összes) üzemeltetés, üzembe helyezés (a helyszíni üzembe helyezést is beleértve), karbantartás (ellenőrzés), javítás, nagyjavítás és felújítás.

"Felhasználó általi programozhatóság" (user-accessible programmability) (6): olyan lehetőség, amely a felhasználó számára biztosítja a "programok" bevitelét, módosítását vagy cseréjét, az alábbi módszerek kivételével:

a. a kábelezés vagy összekötés fizikai megváltoztatása; vagy

b. a funkcióvezérlés átállítása, a paraméterek betáplálását is beleértve.

"Oltóanyag" (vaccine) (1): gyógyászati készítmény az emberi vagy állati védő immunválasz stimulálására a betegségek megelőzése céljából, amely rendelkezik a gyártó vagy a felhasználó országban illetékes szakhatóságok engedélyével, vagy forgalmazási vagy klinikai kipróbálásra vonatkozó engedélyével.

"Vákuumos elektronikus eszközök" (vacuum electronic devices) (3): olyan elektronikus eszközök, amelyek az elektronsugár és vákuum áramkörben terjedő elektromágneses hullám, illetve az elektronsugár és rádiófrekvenciás vákuumkavitációs/üreges rezonátorok interakcióján alapulnak. A "vákuumos elektronikus eszközök" magukban foglalják a klisztronokat, a haladóhullámú csöveket és származékaikat.

"Sebezhetőségfeltárás" (vulnerability disclosure) (4): az a folyamat, amelynek során a sebezhetőséget azonosítják, jelentik vagy közlik a sebezhetőség megszüntetését célzó korrekció elvégzéséért vagy koordinálásáért felelős magánszemélyek vagy szervezetek felé, illetőleg elemzik ilyen magánszemélyekkel vagy szervezetekkel.

"Cérna" (yarn) (1): csavart ‘fonalak' kötege.

N.B. A ‘fonal' "monofil szálak" (általában több, mint 200) közel párhuzamosan elrendezett kötege.

II. RÉSZ

0. kategória

0. KATEGÓRIA - NUKLEÁRIS ANYAGOK, LÉTESÍTMÉNYEK ÉS BERENDEZÉSEK

0ABerendezések, részegységek és alkatrészek

0A001"Atomreaktorok" és kifejezetten ezekhez tervezett vagy előkészített berendezések és alkatrészeik, az alábbiak szerint:

a. "Atomreaktorok";

b. Fém nyomástartó edények és ezek előre gyártott fő alkatrészei, beleértve a reaktor nyomástartó edényének felső fedelét is, melyeket kifejezetten arra terveztek vagy készítettek elő, hogy az "atomreaktor" aktív zónáját tartalmazzák;

c. "Atomreaktorok" fűtőelemeit kezelő berendezések, amelyeket kifejezetten a fűtőelemeknek az "atomreaktorba" történő behelyezésére és az onnan történő kivételére terveztek vagy készítettek elő;

d. Kifejezetten az "atomreaktorban" lezajló láncreakció szabályozására tervezett vagy előkészített szabályozó rudak és az ezek alátámasztására, felfüggesztésére szolgáló szerkezetek, valamint a rudak mozgató mechanizmusa és vezetőcsövei;

e. Nyomástartó csövek, amelyeket az "atomreaktor" fűtőelemei és primerköri hűtőközege együttes befogadására terveztek vagy készítettek elő;

f. A kifejezetten "atomreaktorokban" fűtőelem-burkolatként való felhasználásra tervezett vagy előkészített cirkónium csövek vagy cirkónium ötvözetből készült csövek (vagy ilyen csövekből összeszerelt szerkezetek), 10 kg-nál nagyobb mennyiségekben; N.B. A cirkónium nyomástartó csövekre vonatkozóan lásd a 0A001.e. pontot, a csőkígyókra vonatkozóan pedig a 0A001.h. pontot.

g. Kifejezetten "atomreaktorok" primerköri hűtőközegének keringtetésére tervezett vagy előkészített hűtőszivattyúk vagy keringtetők;

h. Kifejezetten "atomreaktorokban" történő felhasználásra tervezett vagy előkészített ‘belső atomreaktor-alkatrészek', ideértve az aktív zónát alátámasztó oszlopokat, a fűtőelem-/üzemanyag-csatornákat, a csőkígyókat, a hőpajzsokat, a terelőlemezeket, a zónatartó rácslemezeket és a diffúzor lemezeket; Műszaki megjegyzés : A 0A001.h. pontban a ‘belső atomreaktor-alkatrész' olyan fő szerkezetet jelent a reaktoredényen belül, amely egy vagy több funkciót lát el, például tartja a zónát, biztosítja a tüzelőanyag beállítást, irányítja a primerköri hűtőközeg áramlást, biztosítja a reaktoredény sugárzás elleni védelmét, és irányítja a zónán belüli műszerezést.

i. Hőcserélők, az alábbiak szerint: 1. Gőzfejlesztők, amelyeket kifejezetten "atomreaktorok" primerköri vagy köztes hűtőkörében történő felhasználásra terveztek vagy készítettek elő; 2. Más hőcserélők, amelyeket kifejezetten "atomreaktorok" primerköri hűtőkörében történő felhasználásra terveztek vagy készítettek elő; Megjegyzés : A 0A001.i. nem vonja ellenőrzés alá a reaktor kisegítő rendszereihez, például a vészhűtőrendszerhez vagy a bomlásihő-elvonó rendszerhez használt hőcserélőket.

j. Neutrondetektorok, amelyeket kifejezetten az "atomreaktorok" aktív zónájában a neutronfluxus meghatározására terveztek vagy készítettek elő.

k. Kifejezetten "atomreaktorban" való felhasználás céljából, a hőveszteség csökkentésére és a reaktortartály konténmentjének védelmére tervezett vagy előkészített ‘külső hőpajzsok'. Műszaki megjegyzés: A 0A001.k. pontban ‘külső hőpajzs': a reaktortartályra helyezett fő struktúrák, amelyek csökkentik a reaktorból történő hőveszteséget és a konténmenten belüli hőmérsékletet.

0BVizsgáló-, ellenőrző és gyártó berendezések

0B001"Természetes urán", "szegényített urán" vagy "különleges hasadóanyagok" izotópjainak elválasztására szolgáló üzemek és a kifejezetten ilyen üzemekhez tervezett vagy előkészített berendezések és alkatrészek, az alábbiak szerint:

a. Kifejezetten "természetes urán" és "szegényített urán" vagy "különleges hasadóanyagok" izotópjainak elválasztására tervezett üzemek, az alábbiak szerint 1. Gázcentrifugás elválasztó üzemek; 2. Gázdiffúziós elválasztó üzemek; 3. Aerodinamikai elválasztó üzemek; 4. Vegyi reakció útján elválasztó üzemek; 5. Ioncserélő elválasztó üzemek; 6. Atomos gőzfázisú "lézer" izotópos elválasztó üzemek; 7. Molekuláris "lézer" izotópos elválasztó üzemek; 8. Plazma elválasztó üzemek; 9. Elektromágneses elválasztó üzemek;

b. Gázcentrifugák és kifejezetten gázcentrifugás elválasztási eljáráshoz tervezett vagy előkészített részegységek és alkatrészek, az alábbiak szerint: Műszaki megjegyzés : A 0B001.b. pontban a ‘nagy szilárdság/sűrűség arányú anyag' az alábbiak bármelyikét jelenti: 1. Martenzites acél, amelynek szakítószilárdsága legalább 1,95 GPa; 2. Alumíniumötvözetek, amelyek szakítószilárdsága legalább 0,46 GPa; vagy 3. "Rostos vagy szálas anyag", amelynek "fajlagos modulusa" legalább 3,18 × 106 m és "fajlagos szakítószilárdsága" nagyobb, mint 7,62 × 104 m; 1. Gázcentrifugák; 2. Komplett rotorszerelvények; 3. ‘Nagy szilárdság/sűrűség arányú anyagból' készült rotorcső hengerek, melyek legnagyobb falvastagsága 12 mm, átmérője 75 mm és 650 mm között van; 4. A rotorcső helyi alátámasztására vagy több rotorcső összekapcsolására tervezett, ‘nagy szilárdság/sűrűség arányú anyagból' készült gyűrűk vagy harmonikák, amelyek falvastagsága legfeljebb 3 mm, átmérője pedig 75 mm és 650 mm között van; 5. ‘Nagy szilárdság/sűrűség arányú anyagból' készült, rotorcsőbe való beszerelésre szánt terelőlapok, amelyek átmérője 75 mm és 650 mm között van; 6. ‘Nagy szilárdság/sűrűség arányú anyagból' készült rotorcső végeire illeszkedő sapkák, amelyek átmérője 75 mm és 650 mm között van; 7. Mágneses felfüggesztésű csapágyak, az alábbiak szerint: a. Csapágyegységek, amelyek csillapító közeget tartalmazó, "UF6-nak ellenálló anyagból" készült vagy ilyen anyag által védett házban felfüggesztett gyűrű alakú mágnesből állnak, és a rotor fedelén rögzített mágnessaru vagy másik mágnes révén valósítanak meg mágneses csatolást; b. Aktív mágneses csapágyak, amelyeket kifejezetten gázcentrifugákhoz terveztek vagy készítettek elő. 8. Különleges csapágyak, amelyek csillapítóra szerelt forgócsapos csapágycsészéből álló részegységet tartalmaznak; 9. Molekuláris szivattyúk, amelyek belsőleg megmunkált vagy extrudált spirál hornyokkal és belsőleg megmunkált furatokkal rendelkező hengerekből állnak; 10. Gyűrű alakú motor állórész 600 Hz vagy annál magasabb frekvenciatartományban, 40 VA vagy magasabb teljesítménytartományban vákuumban üzemelő többfázisú, szinkron üzemmódú, AC hiszterézismotorokhoz (vagy reluktanciamotorokhoz); 11. Gázcentrifuga rotorcsőrészegységének befogadására szolgáló centrifugaház/gyűjtőegység, amely legfeljebb 30 mm falvastagságú, precíziósan megmunkált - egymással párhuzamos, a henger hosszanti tengelyére pedig merőleges vagy attól legfeljebb 0,05° fokkal eltérő - hengervégekből áll; 12. A központi gázeltávolító rendszerhez rögzíthető terelők, amelyek csöveit arra tervezték vagy készítettek elő, hogy a rotorcső belsejéből a Pitot-cső elve alapján távolítsák el az UF6 gázt; 13. Kifejezetten gázcentrifugás dúsító berendezések motorjainak állórészeihez tervezett vagy előkészített frekvenciaváltók (konverterek vagy inverterek), és a kifejezetten e célra tervezett alkatrészek, amelyek rendelkeznek valamennyi alábbi jellemzővel: a. 600 Hz vagy annál nagyobb többfázisú frekvenciakimenet; és b. Nagy stabilitás (0,2 %-nál jobb frekvenciaellenőrzéssel); 14. Elzárószelepek és szabályozószelepek, az alábbiak szerint: a. Egy gázcentrifuga bemeneti, végtermék vagy maradék UF6 gázáramán való működésre tervezett vagy előkészített elzárószelepek; b. Kifejezetten gázcentrifugás dúsítóüzemek fő vagy kisegítő rendszereihez tervezett vagy előkészített, "UF6-nak ellenálló anyagból" készült vagy ilyen anyaggal bevont, csőmembrános tömítésű, 10-160 mm belső átmérőjű elzáró- vagy szabályozószelep;

c. Kifejezetten a gázdiffúziós elválasztási eljárásokhoz tervezett vagy előkészített berendezések, valamint alkatrészeik, az alábbiak szerint: 1. "UF6-nak ellenálló anyagú" porózus fémből, polimerből, vagy kerámiából készült gázdiffúziós válaszfalak, amelyek pórusmérete 10 és 100 nm között van, legnagyobb vastagságuk 5 mm vagy annál kisebb, és csőformák esetén a legnagyobb átmérőjük 25 mm; 2. "UF6-nak ellenálló anyagból" készült, vagy azzal védett gázdiffúzor házak; 3. "UF6-nak ellenálló anyagból" készült, vagy azzal védett, 1 m3/perc, vagy ennél nagyobb UF6 szívókapacitású kompresszorok és gázfúvók legfeljebb 500 kPa kimeneti nyomással és legfeljebb 10:1 kompresszióaránnyal; 4. A 0B001.c.3. alatt meghatározott, továbbá 1 000 cm3/percnél kisebb puffergáz beszivárgási arányra tervezett kompresszorok, vagy gázfúvók forgótengely tömszelencéi; 5. "UF6-nak ellenálló anyagokból" készült vagy ilyen anyag által védett hőcserélők, amelyeket 100 kPa nyomáskülönbség esetén 10 Pa/óra-nál alacsonyabb szivárgási arányra terveztek; 6. "UF6-nak ellenálló anyagból" készült vagy ilyen anyag által védett csőmembrános tömítésű, kézi vagy automata, elzáró- vagy szabályozószelep;

d. Kifejezetten aerodinamikai szétválasztási eljáráshoz tervezett vagy előkészített berendezések és alkatrészek, az alábbiak szerint: 1. UF6-nak ellenálló, hornyolt, hajlított, 1 mm-nél kisebb görbületi sugarú csatornákból álló elválasztó fúvókák, ahol a fúvókán áthaladó gázt a fúvókában elhelyezett pengeél választja szét két áramra; 2. "UF6-nak ellenálló anyagból" készült, vagy ilyen anyag által védett hengeres, vagy kúpos csövek (vortex csövek), amelyek egy vagy több tangenciális bemenettel rendelkeznek; 3. "UF6-nak ellenálló anyagból" készült, vagy ilyen anyag által védett kompresszorok vagy gázfúvók, és az azokhoz készített forgótengely tömszelencék; 4. "UF6-nak ellenálló anyagból" készült, vagy ilyen anyag által védett hőcserélők; 5. Vortex csöveket, vagy szétválasztó fúvókákat tartalmazó, "UF6-nak ellenálló anyagból" készült vagy ilyen anyag által védett szétválasztóelem-házak; 6. "UF6-nak ellenálló anyagból" készült vagy ilyen anyag által védett csőmembrános tömítésű, kézi vagy automata, elzáró- vagy szabályozószelep, 40 mm vagy nagyobb átmérővel; 7. UF6-nak 1 ppm vagy annál kisebb UF6 tartalmú vivőgáztól (hidrogén vagy hélium) történő elválasztására szolgáló feldolgozórendszerek, az alábbiak szerint: a. 153 K (- 120 °C), vagy az alatti hőmérsékleten történő működésre képes kriogén hőcserélők és krioszeparátorok; b. 153 K (- 120 °C), vagy az alatti hőmérsékleten történő működésre képes kriogén hűtőegységek; c. Az UF6-nak a vivőgázból történő elválasztására szolgáló elválasztó fúvókák, vagy Vortex csövek; d. UF6 kifagyasztására alkalmas UF6 hidegcsapdák;

e. Kifejezetten kémiai cserekeakció útján történő elválasztási eljáráshoz tervezett vagy előkészített berendezések és alkatrészek, az alábbiak szerint: 1. Tömény sósavval szemben ellenálló, (azaz megfelelő műanyagból, például fluorozott szénhidrogén-polimerből vagy üvegből gyártott, vagy azzal bevont) gyors folyadék-folyadék pulzáló oszlopok maximum 30 másodperc tartózkodási idővel; 2. Tömény sósavval szemben ellenálló, (azaz megfelelő műanyagból, például fluorozott szénhidrogén-polimerből vagy üvegből gyártott, vagy azzal bevont) gyors folyadék-folyadék centrifugális kontaktorok maximum 30 másodperc tartózkodási idővel; 3. Tömény sósavas oldatokkal szemben ellenálló, az uránnak egy adott oxidációs fokról egy más oxidációs fokra történő redukálására tervezett elektrokémiai redukáló cellák; 4. U+4-et az áramló szerves fázisból leválasztó elektrokémiai redukáló cellák, ahol a feldolgozandó közeggel érintkező alkatrészek megfelelő anyagokból (üveg, fluorozott szénhidrogén-polimer, polifenil-szulfát, poliéter-szulfon és műgyantával impregnált grafit) készültek, vagy ilyen anyagok által védettek; 5. Nagy tisztaságú urán-klorid oldat előállítására szolgáló, oldóból, extraháló oldószerből és/vagy tisztítást végző ioncserélő berendezésekből, valamint az urán U+6-ot vagy U+4-et U+3-má redukáló elektrolitikus cellákból álló bemeneti előkészítő rendszerek; 6. U+3-nak U+4-gyé történő oxidálására szolgáló urán oxidáló rendszerek;

f. Kifejezetten ioncsere útján történő elválasztási eljáráshoz tervezett vagy előkészített berendezések és alkatrészek, az alábbiak szerint: 1. Gyorsan reagáló ioncserélő gyanták, hártyás vagy porózus makrohálós gyanták, melyekben az aktív kémiai cserélő csoportok elhelyezkedése az inaktív porózus anyag és egyéb, bármilyen megfelelő formájú kompozit anyag - beleértve a 0,2 mm, vagy annál kisebb átmérőjű részecskéket, vagy szálakat - felületén lévő bevonatra korlátozódik, amelyek tömény sósavval szemben ellenállóak és ioncsere felezési idejük kevesebb, mint 10 s, és képesek a 373 K (100 °C) és 473 K (200 °C) közötti hőmérsékleti tartományban történő működésre; 2. Tömény sósavval szemben ellenálló anyagból (titán, vagy fluorkarbon műanyag) készült, vagy ilyen anyaggal bevont és a 373-473 K (100-200 °C) hőmérsékleti-, valamint a 0,7 MPa feletti nyomástartományban történő működésre képes (hengeres) ioncserélő oszlopok, amelyek átmérője meghaladja az 1 000 mm-t; 3. Az ioncserés dúsító kaszkádokban használt, kémiailag redukáló, vagy oxidáló ágensek regenerálására szolgáló ioncsere reflux rendszerek (kémiai vagy elektrokémiai oxidáló, vagy redukáló rendszerek);

g. Kifejezetten az atomos gőzfázisú lézerizotópos elválasztási eljáráshoz tervezett vagy előkészített berendezések és alkatrészek, az alábbiak szerint: 1. A célanyagra 1 kW vagy annál nagyobb teljesítményt leadni képes fém urán porlasztó rendszerek lézeres dúsításban történő felhasználásra; 2. Kifejezetten lézeres dúsításhoz használt olvasztott urán, olvasztott uránötvözetek vagy uránfém-gőz kezelésére tervezett vagy előkészített, folyékony vagy gőz halmazállapotú uránfém kezelő rendszerek és a kifejezetten ezekhez tervezett alkatrészek; N.B. LÁSD MÉG: 2A225. 3. Az uránfém-gőz hő- és korróziós hatásával szemben ellenálló anyagokból - például ittriumbevonatú grafitból vagy tantálból - készült, vagy azzal bevont termék és maradékgyűjtő rendszerek folyékony vagy szilárd halmazállapotú fém urán összegyűjtésére; 4. Az uránfém-gőz forrás, az elektronágyú, valamint a termék- és maradékgyűjtő befogadására szolgáló szeparátor-modul házak (hengeres vagy téglatest alakú edények); 5. Kifejezetten uránizotópok elválasztására tervezett vagy előkészített, tartós működést biztosító spektrumfrekvencia-stabilizálással ellátott "lézerek", vagy "lézer"-rendszerek; N.B. LÁSD MÉG: 6A005 ÉS 6A205.

h. Kifejezetten a molekuláris "lézer"-izotópos szétválasztással működő "lézer"-izotópos leválasztási eljáráshoz tervezett vagy előkészített berendezések és alkatrészek, az alábbiak szerint: 1. Az UF6 és a vivőgáz keverékének 150 K (- 123 °C) vagy az alatti hőmérsékletre történő lehűtésére szolgáló "UF6-nak ellenálló anyagból" készült szuperszonikus expanziós fúvókák; 2. Kifejezetten uránfém vagy a lézerfényes megvilágításból visszamaradó uránmaradék-anyagok összegyűjtésére tervezett vagy előkészített, "UF6-nak ellenálló anyagból" készült termék és maradékgyűjtő-egységek; 3. "UF6-nak ellenálló anyagból" készült, vagy ilyen anyag által védett kompresszorok, és az azokhoz készített forgótengely tömszelencék; 4. (Szilárd) UF5 (gáznemű) UF6-tá történő fluorozására szolgáló berendezés; 5. Az UF6-nak a vivőgáztól (például nitrogén, argon vagy egyéb gáz) történő elválasztására szolgáló feldolgozó rendszerek, amelyek a következőket tartalmazzák: a. 153 K (- 120 °C), vagy az alatti hőmérsékleten történő működésre képes kriogén hőcserélők és krioszeparátorok; b. 153 K (- 120 °C), vagy az alatti hőmérsékleten történő működésre képes kriogén hűtőegységek; c. UF6 kifagyasztására alkalmas UF6 hidegcsapdák; 6. Kifejezetten uránizotópok elválasztására tervezett vagy előkészített, tartós működést biztosító spektrumfrekvencia-stabilizálással ellátott "lézerek", vagy "lézer"-rendszerek; N.B. LÁSD MÉG: 6A005 ÉS 6A205.

i. Kifejezetten plazmaleválasztási eljáráshoz tervezett vagy előkészített berendezések és alkatrészek, az alábbiak szerint: 1. Ionok előállítására vagy gyorsítására szolgáló, 30 GHz-nél nagyobb kimeneti frekvenciájú és 50 kW-ot meghaladó átlagos kimenő teljesítményű mikrohullámú energiaforrások és antennák; 2. 40 kW-nál nagyobb átlagos teljesítménnyel működni képes rádiófrekvenciás iongerjesztő tekercsek, a 100 kHz-nél nagyobb frekvenciákhoz; 3. Uránplazma generáló rendszerek; 4. Nem használt; 5. Az urángőz hő- és korróziós hatásával szemben ellenálló anyagokból - például ittriumbevonatú grafitból vagy tantálból - készült, vagy azzal bevont termék és maradékgyűjtő rendszerek szilárd halmazállapotú fém uránhoz; 6. Az urán plazmaforrást, a rádiófrekvenciás vezérlőtekercset, valamint a termék- és a dúsítási maradék-gyűjtőket magában foglaló, megfelelő, nem-mágneses anyagból (például rozsdamentes acél) készült (hengeres) leválasztómodul-házak;

j. Kifejezetten elektromágneses leválasztási eljáráshoz tervezett vagy előkészített berendezések és alkatrészek, az alábbiak szerint: 1. Megfelelő, nem-mágneses anyagból (például grafit, rozsdamentes acél vagy réz) készült, gőzforrásból, ionizálóból és sugárgyorsítóból álló egyszeres vagy többszörös ionforrások, melyek képesek 50 mA vagy ennél nagyobb ionsugár áram előállítására; 2. A dúsított vagy szegényített uránion-sugarak összegyűjtésére szolgáló két vagy több horonyból és fészekből álló, megfelelő, nem mágneses anyagból (például grafit vagy rozsdamentes acél) készült iongyűjtő lemezek; 3. Nem mágneses anyagból (például grafit vagy rozsdamentes acél) készült, és 0,1 Pa vagy annál alacsonyabb nyomáson történő üzemelésre tervezett vákuumházak elektromágneses uránleválasztókhoz; 4. 2 m-t meghaladó átmérőjű mágnes saruk; 5. Nagyfeszültségű tápegységek ionforrásokhoz, amelyek rendelkeznek az alábbi jellemzők mindegyikével: a. Képesek folyamatos működésre; b. 20 000 V vagy nagyobb kimeneti feszültség; c. 1 A vagy nagyobb kimeneti áramerősség; és d. 8 órás időintervallumban 0,01 %-nál jobb feszültségszabályozás; N.B. LÁSD MÉG: 3A227. 6. Mágnes tápegységek (nagy teljesítmény, egyenáram), amelyek rendelkeznek az alábbi jellemzők mindegyikével: a. 100 V vagy annál nagyobb feszültségen képesek 500 A vagy annál nagyobb kimeneti áramerősség melletti folyamatos működésre; és b. 8 órás időintervallumban 0,01 %-nál jobb áramerősség-, vagy feszültségszabályozás. N.B. LÁSD MÉG: 3A226.

0B002.Kifejezetten a 0B001 alatt meghatározott izotópleválasztó üzemhez tervezett vagy előkészített, "UF6-nak ellenálló anyagból" készített vagy ilyen anyag által védett kiegészítő rendszerek, berendezések és alkatrészek, az alábbiak szerint:

a. Az UF6-nak a dúsító folyamatba történő továbbítására szolgáló betápláló autoklávok, kemencék vagy rendszerek;

b. Az UF6-nak a dúsítási eljárásból történő eltávolítására, és egy ezt követő, felfűtéssel történő továbbítására szolgáló deszublimátorok és hidegcsapdák;

c. Az UF6-nak tartályokba történő továbbítására szolgáló termék- és maradékállomások;

d. Az UF6-nak a dúsítási folyamatból, sűrítéssel, és az UF6 folyadékká vagy szilárd halmazállapotúvá alakításával történő eltávolítására használt cseppfolyósító és szilárdító állomások;

e. Az UF6-nak kifejezetten gázdiffúziós, centrifuga vagy aerodinamikus kaszkádokban történő kezelésére tervezett vagy előkészített cső- és gyűjtőrendszerek;

f. Vákuumrendszerek és szivattyúk az alábbiak szerint: 1. Vákuum elosztócsövek, gyűjtőcsövek vagy vákuumszivattyúk, melyek legalább 5 m3/perc szívókapacitással rendelkeznek; 2. Kifejezetten UF6-tal terhelt atmoszférában történő felhasználásra tervezett, "UF6-nak ellenálló anyagból" készült vagy ilyen anyag által védett vákuumszivattyúk, vagy 3. Vákuum elosztócsövekből, gyűjtőcsövekből vagy vákuumszivattyúkból álló, UF6-tal terhelt atmoszférában történő felhasználásra tervezett vákuumrendszerek;

g. UF6 tömegspektrométerek/ionforrások, melyek képesek az UF6 gázáramokból online mintákat venni, és amelyek rendelkeznek az összes alábbi jellemzővel: 1. Képesek 320 atomtömeg-egységnyi vagy annál nagyobb tömegű ionok mérésére, és felbontóképességük jobb, mint 1 rész a 320-ban; 2. Nikkelből vagy legalább 60 tömegszázalékban nikkelt tartalmazó nikkel-réz-ötvözetből vagy nikkel-króm-ötvözetből készült, illetve ilyen anyagokkal védett ionforrások; 3. Elektronbombázásos ionizációs források; és 4. Rendelkezik izotópelemzésre alkalmas gyűjtőrendszerrel.

0B003.Urán átalakítására szolgáló üzemek, valamint a kifejezetten e célra tervezett vagy előkészített berendezések az alábbiak szerint:

a. Uránérc koncentrátumok UO3-má történő átalakítására szolgáló rendszerek;

b. UO3 UF6-dá történő átalakítására szolgáló rendszerek;

c. UO3 UO2-vé történő átalakítására szolgáló rendszerek;

d. UO2 UF4-tá történő átalakítására szolgáló rendszerek;

e. UF4 UF6-dá történő átalakítására szolgáló rendszerek;

f. UF4 uránfémmé történő átalakítására szolgáló rendszerek;

g. UF6 UO2-dá történő átalakítására szolgáló rendszerek;

h. UF6 UF4-dá történő átalakítására szolgáló rendszerek;

i. UO2 UCl4-dá történő átalakítására szolgáló rendszerek.

0B004.Nehézvíz, deutérium vagy deutériumvegyületek előállítására vagy koncentrálására szolgáló üzemek, és a kifejezetten ezekhez tervezett vagy előkészített berendezések és alkatrészek, az alábbiak szerint:

a. Nehézvíz, deutérium vagy deutériumvegyületek előállítására szolgáló üzemek, az alábbiak szerint: 1. Hidrogén-szulfid/víz cserereakción alapuló üzemek; 2. Ammónia/hidrogén cserereakción alapuló üzemek;

b. Berendezések és alkatrészek, ideértve a következőket: 1. Hidrogén-szulfid/víz cserereakciót végző tornyok, amelyek átmérője 1,5 m vagy nagyobb és 2 MPa vagy nagyobb nyomáson való működésre alkalmasak; 2. Hidrogén-szulfid gázcirkulációra (azaz 70 %-nál több H2S-t tartalmazó gáz) szolgáló egyfokozatú, alacsony nyomómagasságú (azaz 0,2 MPa) centrifugális befúvók vagy kompresszorok, amelyek legalább 1,8 MPa üzemi szívónyomáson 56 m3/s vagy annál nagyobb áteresztőképességgel és nedves H2S üzemre méretezett tömítésekkel rendelkeznek; 3. Ammónia/hidrogén cserélő tornyok, amelyek magassága legalább 35 m, átmérőjük 1,5 és 2,5 m között van, és képesek 15 MPa-t meghaladó nyomáson üzemelni; 4. Nehézvíz gyártására ammónia/hidrogén cserefolyamatot alkalmazó tornyok belső elemei, beleértve a fokozatkontaktorokat és a fokozatszivattyúkat, közöttük a teljesen bemerülő típusokat is; 5. Nehézvíz gyártására ammónia/hidrogén cserefolyamatot alkalmazó ammónia krakkolóüzem, legalább 3MPa üzemi nyomással; 6. Infravörös abszorpciós analizátorok, amelyek képesek a hidrogén/deutérium arány online elemzésére, amennyiben a deutérium koncentráció legalább 90 tömegszázalék; 7. Dúsított deutérium gáz nehézvízzé történő átalakítására szolgáló ammónia/hidrogén cserefolyamatot alkalmazó katalitikus égetők; 8. Reaktortisztaságú deutérium koncentrációjú nehézvíz előállítására szolgáló teljes nehézvíz javító rendszer vagy annak oszlopai; 9. Kifejezetten ammónia/hidrogén cserefolyamatot alkalmazó nehézvízgyártásra tervezett vagy előkészített ammóniaszintézis-konverterek vagy ammóniaszintézis-egységek.

0B005.Kifejezetten az "atomreaktorok" fűtőelemeinek gyártására tervezett létesítmények, valamint a kifejezetten ezekhez tervezett vagy előkészített berendezések.

Műszaki megjegyzés :

A kifejezetten "atomreaktorok" fűtőelemeinek gyártásához tervezett vagy előkészített berendezések olyan berendezéseket foglalnak magukban, amelyek:

1. Általában közvetlen kapcsolatba kerülnek a nukleáris anyagokkal, vagy közvetlenül feldolgozzák azokat, illetve szabályozzák azok gyártási folyamatát;

2. A nukleáris anyagokat a burkolaton belül tartják;

3. Ellenőrzik a burkolat, vagy a tömítés épségét;

4. Ellenőrzik a lezárt fűtőanyag végső kezelését; vagy

5. Reaktorelemek összerakásához használják.

0B006.A "atomreaktor" kiégett fűtőanyagának újrafeldolgozására (reprocesszálására) szolgáló üzem, valamint a kifejezetten ehhez tervezett vagy előkészített berendezések és alkatrészek.

Megjegyzés : A 0B006 az alábbiakat foglalja magában:

a. Az "atomreaktor" kiégett üzemanyagának újrafeldolgozására szolgáló üzem, beleértve az olyan berendezéseket és alkatrészeket, amelyek közvetlenül érintkezésbe lépnek a hasadóanyagokkal, és közvetlenül szabályozzák a kiégett fűtőanyag, a fő nukleáris anyag és hasadási termék feldolgozási folyamatát;

b. A fűtőelemek burkolatának eltávolítására szolgáló berendezés és fűtőelemdaraboló- vagy zúzógépek, azaz olyan távvezérelhető berendezések, amelyek az "atomreaktor" kiégett fűtőanyagok, elemkötegek vagy pálcák vágására, darabolására vagy zúzására szolgálnak;

c. Kifejezetten "atomreaktor" kiégett fűtőanyag feloldására tervezett vagy előkészített, mechanikus eszközöket alkalmazó tartóedények vagy tartályok, amelyek ellenállnak forró, erősen korrodáló folyadékok hatásának, és amelyek távvezérléssel tölthetők, üzemeltethetők és karbantarthatók;

d. A salétromsav korróziós hatásával szemben ellenálló, valamint kifejezetten a besugárzott "természetes urán", "szegényített urán" vagy "különleges hasadóanyagok" újrafeldolgozására szolgáló üzemben való felhasználásra tervezett vagy előkészített oldószerkivonók, mint például a töltetes vagy pulzáló oszlopok, a keverők ülepítő edényei vagy a centrifugális kontaktorok;

e. Kifejezetten a kritikusság szempontjából biztonságosnak és a salétromsav korróziós hatásával szemben ellenállónak tervezett tartó- vagy tároló edények; Műszaki megjegyzés : A tartó- és tárolóedények a következő tulajdonságokkal rendelkezhetnek: 1. a falak és belső szerkezetek bóregyenértéke (a 0C004 ponthoz fűzött megjegyzés szerint meghatározott összes alkotóelemre számítva) legalább 2 %, 2. a hengeres tartályok legnagyobb átmérője 175 mm; vagy 3. a gyűrű alakú, illetve a lapos tartályok legnagyobb szélessége 75 mm.

f. Kifejezetten a besugárzott "természetes urán", "szegényített urán" vagy "különleges hasadóanyagok" újrafeldolgozására szolgáló üzemben alkalmazott automatizált folyamatszabályozó rendszerekbe történő integrálásra és felhasználásra tervezett vagy előkészített neutronmérő rendszerek.

0B007.Kifejezetten a plutónium konverzióját végző létesítmények, és a kifejezetten ezekhez tervezett vagy előkészített berendezések, az alábbiak szerint:

a. Plutónium-nitrát oxiddá történő átalakítására szolgáló rendszerek;

b. Plutónium fém előállítására szolgáló rendszerek.

0C.Anyagok

0C001."Természetes urán", vagy "szegényített urán", vagy tórium, fém, ötvözet, vegyület, vagy koncentrátum formájában és bármilyen más anyag, amely fent említettek közül egyet vagy többet tartalmaz;

Megjegyzés : A 0C001 nem vonja ellenőrzés alá a következőket:

a. "Természetes urán", vagy "szegényített urán" maximum 4 grammnyi mennyisége, ha az műszerek érzékelő egységében van;

b. Kifejezetten a következő polgári, nem-nukleáris alkalmazásokra gyártott "szegényített urán": 1. Árnyékolás; 2. Csomagolás; 3. 100 kg-nál nem nagyobb tömegű ballasztok; 4. 100 kg-nál nem nagyobb tömegű ellensúlyok;

c. 5 %-nál kevesebb tóriumot tartalmazó ötvözetek;

d. Tóriumot tartalmazó kerámia termékek, amelyeket nem nukleáris felhasználásra gyártottak.

0C002."Különleges hasadóanyagok"

Megjegyzés : A 0C002 nem vonja ellenőrzés alá a legfeljebb 4 "effektív gramm" anyagmennyiséget, amennyiben az műszerek érzékelő egységében van.

0C003.Deutérium, nehézvíz (deutérium-oxid) és deutérium tartalmú vegyületek, keverékek és oldatok, amelyekben a deutérium/hidrogén izotóp arány meghaladja az 1:5 000 értéket.

0C004.Grafit, amelynek tisztasági mutatója kisebb, mint 5 ppm ‘bór egyenérték', és amelynek sűrűsége nagyobb, mint 1,50 g/cm3, "atomreaktorban" történő felhasználásra, 1 kg-ot meghaladó mennyiségben.

N.B. LÁSD MÉG: 1C107.

1. megjegyzés : Export-ellenőrzés céljából, az exportőr letelepedési helye szerinti uniós tagállam illetékes hatóságai határozzák meg, hogy a fenti meghatározásnak megfelelő grafit exportjának "atomreaktorban" való felhasználás-e a célja. A 0C004 nem vonja ellenőrzés alá a grafitot, amelynek tisztasági mutatója kisebb, mint 5 ppm bór egyenérték, és amelynek sűrűsége nagyobb, mint 1,50 g/cm3, nem "atomreaktorban" történő felhasználásra.

2. megjegyzés : A 0C004 pontban a ‘bór egyenérték' (BE) a szennyezőanyagok BEz összege (kivéve a BEszén, mivel a szén nem számít szennyező anyagnak) beleértve a bórt is, ahol:

BEZ (ppm) = CF × Z elem koncentrációja ppm-ben;

és σB és σZ a termikus neutron befogási hatáskeresztmetszet (barn-ban) a természetben előforduló bórra és Z elemre; és AB és AZ a természetben előforduló bór és Z elem atomtömege.

0C005.Kifejezetten gázdiffúziós gátak gyártásához tervezett, az UF6 korróziós hatásának ellenálló kompozíciók vagy porok (például nikkel vagy olyan ötvözetek, amelyekben 60 tömegszázalék vagy annál több nikkel van, alumínium-oxid és fluorozott szénhidrogén-polimerek), amelyek tisztasága 99,9 tömegszázalék vagy nagyobb, és az ASTM B330 szabvány szerint mért átlagos részecskeméretük kisebb, mint 10 μm, és a szemcseméret igen kis mértékű szórásával bírnak.

0D.Szoftver

0D001.A kifejezetten az ebben a kategóriában meghatározott termékek "fejlesztésére", "gyártására" vagy "felhasználására" tervezett vagy módosított "szoftverek".

0E.Technológia

0E001.Az ebben a kategóriában meghatározott termékek "fejlesztésére", "gyártására" vagy "felhasználására" vonatkozó, a Nukleáris Technológia Megjegyzés szerinti "technológia".

III. RÉSZ

1. kategória

1. KATEGÓRIA - SPECIÁLIS ANYAGOK ÉS KAPCSOLÓDÓ BERENDEZÉSEK

1ABerendezések, részegységek és alkatrészek

1A001Fluortartalmú vegyületekből készült alkatrészek, az alábbiak szerint:

a. Több mint 50 tömegszázalékban az 1C009.b. vagy 1C009.c. alatt meghatározott anyagok bármelyikéből készült, kifejezetten "légi járművekhez" vagy űralkalmazásokhoz tervezett szigetelések, tömítések, tömítőanyagok, üzemanyagtömlők;

b. Nem használt;

c. Nem használt.

1A002"Kompozit" szerkezetek vagy rétegelt anyagok, az alábbiak szerint:

N.B. LÁSD MÉG: 1A202, 9A010 ÉS 9A110.

a. Amelyek a következő anyagok bármelyikéből készültek: 1. Szerves "mátrix" és az 1C010.c. vagy az 1C010.d. alatt részletezett "rostos vagy szálas anyagok"; vagy 2. Az 1C010.e. alatt részletezett prepregek vagy preformok;

b. Fém vagy szén "mátrixból", valamint a következő anyagok bármelyikéből készült: 1. Szén "rostos vagy szálas anyagok", amelyek mindkét alábbi jellemzővel rendelkeznek: a. A "fajlagos modulus" nagyobb, mint 10,15 × 106 m; és b. A "fajlagos szakítószilárdság" meghaladja a 17,7 × 104 m-t; vagy 2. Az 1C010.c. alatt meghatározott anyagok.

1. megjegyzés : Az 1A002 nem vonja ellenőrzés alá a "polgári légi jármű" szerkezetek, vagy rétegelt anyagok javítására használatos, epoxigyantával impregnált, szén "rostos vagy szálas anyagokból" készített kompozit szerkezeteket, vagy rétegelt anyagokat, amelyek az összes alábbi jellemzővel rendelkeznek:

a. 1 m2-t nem meghaladó terület;

b. 2,5 métert nem meghaladó hosszúság; és

c. 15 mm-t meghaladó szélesség.

2. megjegyzés : Az 1A002 nem vonja ellenőrzés alá a kifejezetten az alábbi tisztán polgári területeken történő alkalmazásra tervezett félkész termékeket:

a. Sportszerek vagy -eszközök;

b. Autóipar;

c. Szerszámgépipar;

d. Gyógyászati alkalmazások.

3. megjegyzés : Az 1A002.b.1. nem vonja ellenőrzés alá az egymásba fonódó szálak legfeljebb 2 dimenzióját tartalmazó, és kifejezetten az alábbi alkalmazásokra tervezett félkész termékeket:

a. fém megeresztésére szolgáló hőkezelő kemencék;

b. szilíciumrúd-gyártó berendezések.

4. megjegyzés : Az 1A002 nem vonja ellenőrzés alá a kifejezetten egy meghatározott alkalmazásra tervezett késztermékeket.

5. megjegyzés : Az 1A002.b.1. nem vonja ellenőrzés alá a mechanikusan darabolt, zúzott és vágott szén "rostos vagy szálas anyagokat", amelyek hosszúsága legfeljebb 25,0 mm.

1A003Nem "olvasztható" aromás poliimidekből készült gyártmányok film, lemez vagy szalag formában, amelyek rendelkeznek az alábbi jellemzők bármelyikével:

a. 0,254 mm-t meghaladó vastagság; vagy

b. Szénnel, grafittal, fémekkel vagy mágneses anyagokkal vannak bevonva vagy laminálva.

Megjegyzés : Az 1A003 nem vonja ellenőrzés alá a gyártmányt, ha rézzel van bevonva vagy laminálva, és elektronikus nyomtatott áramkör gyártására tervezték.

N.B. Az "olvasztható" aromás poliimidek bármely formája tekintetében lásd az 1C008.a.3. pontot.

1A004Nem kifejezetten katonai felhasználásra tervezett védő- és detektáló berendezések és alkatrészek, az alábbiak szerint:

N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE, 2B351 ÉS 2B352.

a. Az alábbiak bármelyikével szembeni védelemre tervezett vagy átalakított teljes álarcok, szűrőbetétek és az azokhoz tartozó mentesítő berendezések, és a kifejezetten ezekhez tervezett alkatrészek: Megjegyzés : Az 1A004.a. magában foglalja azon motoros légtisztító légzőkészülékeket (PAPR), amelyeket az 1A004.a. pontban felsorolt anyagokkal szembeni védelemre terveztek vagy módosítottak. Műszaki megjegyzés : Az 1A004.a. alkalmazásában: 1. A teljes álarcok más néven gázálarcok. 2. A szűrőbetétek magukban foglalják a szűrőpatronokat is. 1. "Biológiai ágensek"; 2. ‘Radioaktív anyagok'; 3. Vegyi harcanyagok (CW); vagy 4. "tömegoszlató anyagok", beleértve az alábbiakat: a. α-bróm-benzol-acetonitril, (α-bromobenzil-cianid) (CA) (CAS 5798-79-8); b. [(2-klórfenil) metilén] propándinitril, (o-klórbenzilidénmalononitril) (CS) (CAS 2698-41-1); c. 2-klór-1-feniletanon, fenacil-klorid (ω-klóracetofenon) (CN) (CAS 532-27-4); d. Dibenz-(b,f)-1,4-oxazepin (CR) (CAS 257-07-8); e. 10-klór-5,10-dihidrofenarzin, (fenarzin klorid), (Adamzit), (DM) (CAS 578-94-9); f. N-Nonanoylmorfolin, (MPA) (CAS 5299-64-9);

b. Az alábbiak bármelyikével szembeni védelemre tervezett vagy módosított védőruhák, kesztyűk és cipők: 1. "Biológiai ágensek"; 2. ‘Radioaktív anyagok'; vagy 3. Vegyi harcanyagok (CW);

c. Az alábbiak bármelyikének detektálására vagy azonosítására tervezett vagy módosított detektálórendszerek és a kifejezetten ezekhez tervezett alkatrészek: 1. "Biológiai ágensek"; 2. ‘Radioaktív anyagok'; vagy 3. Vegyi harcanyagok (CW);

d. "Robbanóanyag"-maradványok automatikus detektálására, illetve azonosítására tervezett, és ‘nyomfelderítő' technikákat (pl. felületi akusztikai hullámot, ionmobilitás-spektrometriát, differenciálmobilitás-spektrometriát, tömegspektrometriát) alkalmazó elektronikus berendezések. Műszaki megjegyzés : A ‘nyomfelderítés' úgy határozható meg, mint az 1 milliomodrész (ppm) gőznél vagy 1 mg tömegű szilárd vagy folyékony anyagnál kevesebb észlelésére vonatkozó képesség. 1. megjegyzés : Az 1A004.d. pont nem vonja ellenőrzés alá a kifejezetten laboratóriumi használatra tervezett ellenőrző berendezéseket. 2. megjegyzés : Az 1A004.d. pont nem vonja ellenőrzés alá az érintésmentes biztonsági kapukat. Megjegyzés : Az 1A004 nem vonja ellenőrzés alá: a. a személyi sugárzásmérő dozimétereket; b. munkahelyi biztonsági és egészségvédelmi berendezéseket, amelyek tervezésük vagy funkciójuk alapján a lakóhelyek biztonságára és az alábbi polgári iparágakra jellemző veszélyek elleni védelemre korlátozódnak: 1. bányászat; 2. kőfejtés; 3. mezőgazdaság; 4. gyógyszeripar; 5. gyógyászat; 6. állatgyógyászat; 7. környezetvédelem; 8. hulladékgazdálkodás; 9. élelmiszeripar.

Műszaki megjegyzések :

1. Az 1A004 olyan eszközöket és alkatrészeket foglal magában, amelyeket a ‘radioaktív anyagok', "biológiai ágensek", vegyi harcanyagok, ‘modellanyagok' vagy "tömegoszlató anyagok" detektálására vagy az azokkal szembeni védelem céljára alkalmasnak találtak, a nemzeti előírásoknak sikeresen megfeleltettek, vagy azok hatékonysága egyéb módon nyert bizonyítást, abban az esetben is, ha ezen eszközöket vagy alkatrészeket olyan polgári gazdasági ágazatokban alkalmazzák, mint például a bányászat, a kőfejtés, a mezőgazdaság, a gyógyszeripar, az orvosi és állatorvosi ágazatok, a környezetvédelem, a hulladékgazdálkodás vagy az élelmiszeripar.

2. ‘Modellanyag': képzési, kutatási, vizsgálati vagy értékelési célból toxikus (vegyi vagy biológiai) anyagok helyett alkalmazott hatóanyag vagy anyag.

3. Az 1A004 alkalmazásában a ‘radioaktív anyagok' olyan anyagok, amelyeken olyan átalakítást vagy szelektálást végeznek, hogy hatékonyabbá tegyék őket arra, hogy ember- vagy állatveszteséget okozzanak, rombolják a berendezéseket, vagy kárt tegyenek a termésben vagy a környezetben.

1A005Testpáncél és ennek részei, az alábbiak szerint:

N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

a. Puha testpáncél, amelyeket nem a katonai - vagy azoknak megfelelő - szabványok és előírások szerint gyártottak, és a kifejezetten ezekhez tervezett alkatrészek;

b. Kemény testvédő páncéllemezek, melyek a IIIA. szint (lásd NIJ 0101.06, 2008. július), vagy az "ekvivalens szabványok" szerinti vagy annál kisebb ballisztikai védelmi képességet biztosítanak.

N.B. A testpáncél gyártásához használt "rostos vagy szálas anyagokra" vonatkozóan lásd: 1C010.

1. megjegyzés : Az 1A005 nem vonja ellenőrzés alá a testpáncélzatot, ha az a felhasználó személyes védelmét szolgálja.

2. megjegyzés : Az 1A005 nem vonja ellenőrzés alá a kizárólag nem-katonai eszközök robbanásából származó repesz és lökéshatás elleni frontális védelemre tervezett testpáncélt.

3. megjegyzés : Az 1A005 nem vonja ellenőrzés alá a csak a kés, szög, tű vagy ütőfegyverek elleni védelemre tervezett testpáncélt.

1A006Kifejezetten a Rögtönzött Robbanószerkezetek (IED-k) hatástalanítására tervezett vagy módosított, alábbi berendezések, és a kifejezetten ezekhez tervezett alkatrészek vagy kiegészítők:

N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

a. Távirányítású járművek;

b. ‘Hatástalanító eszközök (disruptors)'.

Műszaki megjegyzés :

Az 1A006.b. pont alkalmazásában ‘hatástalanító eszközök (disruptors)': kifejezetten a robbanóeszközök működésbe lépésének megakadályozására tervezett, folyékony, szilárd vagy törékeny lövedéket kibocsátó eszközök.

Megjegyzés : Az 1A006 nem vonja ellenőrzés alá az eszközöket azok működtetőjének jelenléte esetén.

1A007Kifejezetten gyújtás kiváltására tervezett elektromos berendezések és eszközök, valamint "energiahordozó anyagokat" tartalmazó eszközök, az alábbiak szerint:

N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE, 3A229 ÉS 3A232.

a. Az 1A007 b. pontban meghatározott robbanóanyag-detonátorokhoz tervezett robbanóanyag-detonátor gyújtóegységek;

b. Elektromosan vezérelt robbanóanyag-detonátorok, az alábbiak szerint: 1. robbantó kapcsoló (EB); 2. robbantó izzószál (EBW); 3. ütőszeg; 4. robbantófólia-iniciátor (EFI).

Műszaki megjegyzések :

1. A detonátor szó helyett időnként használják az indítógyújtó vagy gyutacs szót is.

2. Az 1A007 b. pont alkalmazásában az érintett detonátorok mindegyike kis elektromos vezetőt alkalmaz (híd, hídszál, vagy fólia), amely robbanásszerűen elpárolog, amikor gyors, nagyfeszültségű elektromos impulzus halad át rajta. A nem-ütőszeges típusoknál a felrobbanó vezető kémiai robbanást indít a hozzá érintkező nagy robbanóerejű anyagban, mint pl. a PETN (pentaeritrit-tetranitrát). Az ütőszeges detonátorokban az elektromos vezető robbanásszerű párolgása egy nyíláson keresztül gyújtószeget vagy ütőszeget repít át, és az ütőszeg becsapódása a robbanóanyagban kémiai robbanást indít el. Bizonyos rendszerek esetén az ütőszeget mágneses erő mozgatja. A robbantófólia-detonátor kifejezés vonatkozhat mind az EB, mind az ütőszeg típusú detonátorra.

1A008Töltetek, eszközök és alkatrészek, az alábbiak szerint:

a. ‘Formázott töltetek', amelyek az alábbi jellemzők mindegyikével rendelkeznek: 1. 90 grammnál nagyobb nettó robbanóanyag-mennyiség (NEQ); és 2. a külső tok átmérője legalább 75 mm;

b. Az alábbi jellemzők mindegyikével rendelkező lineáris vágótöltetek és a kifejezetten ezekhez tervezett alkatrészek: 1. 40 g/m-nél nagyobb mennyiségű robbanótöltet; és 2. legalább 10 mm-es szélesség;

c. Robbanózsinór 64 g/m-nél nagyobb mennyiségű robbanótöltettel;

d. Az 1A008.b. pontban meghatározottaktól eltérő olyan vágógépek, valamint olyan vágóeszközök, amelyek nettó robbanóanyag-mennyisége nagyobb, mint 3,5 kg.

Műszaki megjegyzés :

A ‘formázott töltetek' olyan robbanótöltetek, amelyeket a robbanás hatásának koncentrálására alakítanak ki.

1A102A 9A004 alatt meghatározott űrhajóhordozó eszközökhöz vagy a 9A104 alatt meghatározott rakétaszondákhoz tervezett újratelített pirolizált szén-szén alkatrészek.

1A202Az 1A002 alatt meghatározottaktól eltérő, cső formájú kompozit szerkezetek, amelyek rendelkeznek a következő jellemzők mindegyikével:

N.B. LÁSD MÉG: 9A010 ÉS 9A110.

a. 75 mm és 400 mm közötti belső átmérő; és

b. Az 1C010.a., vagy b., illetve az 1C210.a. alatt meghatározott "rostos vagy szálas anyagokból" vagy az 1C210.c. alatt meghatározott prepreg anyagból készültek.

1A225A trícium nehézvízből történő kinyerésére, vagy nehézvíz előállítására szolgáló, kifejezetten a hidrogén és a víz közötti hidrogénizotóp cserereakció elősegítésére tervezett vagy készített platina bevonatú katalizátorok.

1A226Speciális töltetek, amelyeket a nehézvíz közönséges vízből történő elválasztására használhatóak, és rendelkeznek az alábbi jellemzők mindegyikével:

a. Olyan foszforbronz hálóból készültek, amelyet a nedvesíthetőség javítása érdekében kémiailag kezeltek; és

b. Vákuumdesztillációs tornyokban történő felhasználásra tervezték.

1A227Nagy sűrűségű (ólomüveg vagy egyéb) sugárzásárnyékoló ablakok, valamint a kifejezetten ezek számára tervezett keretek, amelyek rendelkeznek az alábbi jellemzők mindegyikével:

a. Felületük ‘hideg területe' nagyobb, mint 0,09 m2;

b. Sűrűségük nagyobb, mint 3 g/cm3; és

c. Vastagságuk 100 mm vagy annál nagyobb.

Műszaki megjegyzés :

Az 1A227 alkalmazásában a ‘hideg terület' kifejezés az ablaknak az az áttekintő területe, amelyet a tervezett alkalmazásban a legkisebb szintű besugárzás ér.

1BVizsgáló-, ellenőrző és gyártó berendezések

1B001Az 1A002 alatt meghatározott "kompozit" szerkezetek vagy rétegelt anyagok vagy az 1C010 alatt meghatározott "rostos vagy szálas anyagok", gyártására és ellenőrzésére szolgáló berendezések, és a kifejezetten azokhoz tervezett alkatrészek és tartozékok, az alábbiak szerint:

N.B. LÁSD MÉG: 1B101 ÉS 1B201.

a. Kifejezetten a "kompozit" szerkezetek gyártására, vagy "rostos vagy szálas anyagokból" készült "kompozit" vagy rétegelt szerkezetek gyártására tervezett tekercselőgépek, amelyeknél a szálak pozícionálását, sodrását és tekercselését biztosító mozgást három vagy több ‘szervopozicionálású' főtengelyen koordinálják és programozzák;

b. Kifejezetten a "kompozit" repülőgéptestek vagy ‘rakéta' szerkezetek gyártásához tervezett ‘szalagfektető gépek', amelyeknél a szalag pozícionálását és fektetését biztosító mozgását öt vagy több ‘szervopozicionálású' főtengelyen koordinálják és programozzák; Megjegyzés : Az 1B001.b alkalmazásában a ‘rakéta' teljes rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent. Műszaki megjegyzés : Az 1B001.b. alkalmazásában a ‘szalagfektető gépek' képesek egy vagy több, 25,4 mm-t meghaladó, de legfeljebb 304,8 mm szélességű ‘filament-szalag' fektetésére, és a szalagfektetés alatt egy-egy ‘filament-szalag' elvágására és újrakezdésére.

c. A "kompozit" szerkezetekhez kifejezetten a szálak szövése, fonása vagy zsinórozása céljára tervezett vagy módosított többirányú, többdimenziójú szövőgépek vagy fonógépek, beleértve az adaptereket és a módosító készleteket is; Műszaki megjegyzés : Az 1B001.c. alkalmazásában a fonás magában foglalja a hurkolást is.

d. Kifejezetten az erősített szálak gyártására tervezett vagy átalakított berendezések, ideértve a következőket: 1. A polimerszálakat (például poliakrilnitril, műselyem, terpentingyanta vagy polikarboszilán) szénszálakká vagy szilíciumkarbid-szálakká átalakító berendezés, beleértve a hőkezelés során a szál megfeszítésére szolgáló speciális berendezést; 2. A felhevített szálas alaplemezeken elemek vagy vegyületek gőzfázisú kémiai leválasztására szolgáló berendezés szilíciumkarbid szálak gyártásához; 3. Tűzálló kerámia (mint pl. alumínium-oxid) nedves szálképzésére szolgáló berendezés; 4. Alumíniumtartalmú prekurzor szálakat hőkezeléssel alumínium-oxid szálakká átalakító berendezés;

e. Az 1C010.e. alatt meghatározott prepregek forró olvadék módszerrel történő gyártására szolgáló berendezés;

f. Kifejezetten a "kompozit" anyagokhoz tervezett, roncsolásmentes vizsgálóberendezés az alábbiak szerint: 1. röntgentomográfiás rendszerek a hibák háromdimenziós vizsgálatára; 2. számjegyvezérlésű ultrahangos vizsgálóberendezések, amelyek esetében az adó- vagy vevőegységek elhelyezkedésének változtatása párhuzamosan össze van hangolva és négy vagy annál több tengelyre van elosztva a vizsgálat tárgyát képező összetevő háromdimenziós körvonalának követése érdekében;

g. Kifejezetten a "kompozit" repülőgéptestek vagy ‘rakéta' szerkezetek gyártásához tervezett ‘rostelhelyező gépek', amelyeknél a rostok pozícionálását és fektetését biztosító mozgását két vagy több ‘szervopozicionálású' főtengelyen koordinálják és programozzák; Műszaki megjegyzés : Az 1B001.g. alkalmazásában a ‘rostelhelyező gépek' képesek egy vagy több, legfeljebb 25,4 mm szélességű ‘filament-szalag' elhelyezésére, és a rostelhelyezés alatt egy-egy ‘filament-szalag' elvágására és újrakezdésére.

Műszaki megjegyzések :

1. Az 1B001 alkalmazásában a ‘szervopozicionálású' főtengelyek számítógépes program irányítása alatt a végberendezésnek (azaz a fejnek) a munkadarabhoz viszonyított térbeli elhelyezkedését szabályozzák, hogy az a kívánt folyamat elvégzéséhez megfelelő orientálással és iránnyal rendelkezzen.

2. Az 1B001. pont alkalmazásában, a ‘filament-szalag' egyetlen folytonos szélességű, gyantával részben vagy egészben impregnált szalag, kóc vagy szál. A gyantával részben vagy egészben impregnált ‘filament-szalag' magában foglalja a melegítésre ragadó, száraz porral bevontat is.

1B002Fémötvözetporok vagy szemcsés anyagok előállítására tervezett berendezések, amelyek az alábbi jellemzők mindegyikével rendelkeznek:

a. Kifejezetten a szennyeződések elkerülésére tervezték; és

b. Kifejezetten az 1C002.c.2. alatt meghatározott eljárások valamelyikében való alkalmazásra tervezték.

N.B. LÁSD MÉG: 1B102.

1B003Titán, alumínium vagy ötvözeteik "szuperképlékeny alakítására" vagy "diffúziós kötésre" szolgáló szerszámok, matricák, formázó- vagy rögzítőelemek, amelyeket kifejezetten az alábbiak bármelyikének gyártására terveztek:

a. Repülőgépváz vagy űrszerkezetek;

b. "Légi jármű" vagy űrhajómotorok; vagy

c. Kifejezetten az 1B003.a. pontban meghatározott szerkezetekhez vagy az 1B003.b. pontban meghatározott motorokhoz tervezett alkatrészek.

1B101Az 1B001 alatt meghatározottak kivételével, a következő szerkezeti kompozitok "gyártására" felhasznált berendezések, valamint a kifejezetten ezekhez tervezett alkatrészek és tartozékok:

N.B. LÁSD MÉG: 1B201.

Megjegyzés : Az 1B101 alatt meghatározott alkatrészek és tartozékok a kompozit szerkezetek, rétegelt anyagok előformáló préselésének, kikeményítésének, öntésének, szinterezésének vagy ragasztásának végrehajtására, és a fent említett termékek gyártására szolgáló öntőformákat, tüskéket, matricákat, tartozékokat és szerszámokat foglalják magukban.

a. Száltekercselő gépek vagy szálbeültető gépek, amelyekben a szálak elhelyezését, felcsévélését, illetve feltekercselését végző mozgást három, vagy több tengely mentén koordinálják és programozzák, és amelyeket arra terveztek, hogy "rostos vagy szálas anyagokból" kompozit szerkezeteket vagy rétegelt anyagokat állítsanak elő, valamint ezek koordinálói és programvezérlői;

b. Szalagfektető gépek, amelyekben a szalag és a lemezek elhelyezését és felfektetését végző mozgás két vagy több tengely mentén koordinálható és programozható, és amelyeket kompozit repülőgépvázak és "rakéta"-szerkezetek gyártására terveztek;

c. "Rostos vagy szálas anyagok" "gyártására" tervezett vagy átalakított berendezések, az alábbiak szerint: 1. Polimer rostok (mint pl. poliakrilnitril, műselyem vagy polikarboszilán) átalakítására szolgáló berendezések, amelyek magukban foglalják a rost hevítés útján történő megfeszítésére szolgáló speciális felszereléseket is; 2. Elemek vagy vegyületek gőzeinek a felhevített szálas alaplemezekre történő vákuumlecsapatására szolgáló berendezések; 3. Tűzálló kerámia (mint pl. alumínium-oxid) nedves szálképzésére szolgáló berendezés;

d. Szálak felületének különleges kezelésére, vagy prepregek, vagy preformok előállítására tervezett, vagy átalakított, a 9C110. alatt meghatározott berendezés. Megjegyzés: Az 1B101.d. magában foglalja a görgőket, a feszítőket, a bevonóberendezéseket, a vágóberendezéseket és a kivágó matricákat.

1B102Az 1B002 alatt meghatározottaktól eltérő fémpor-"gyártó berendezés" és alkatrészei, ideértve a következőket:

N.B. LÁSD MÉG: 1B115.b.

a. Az 1C011.a., 1C011.b., 1C111.a.1., és 1C111.a.2. alatt, vagy a katonai célú termékek ellenőrzési jegyzékében meghatározott gömbös, szferoid vagy porlasztott anyag irányított közegben történő "gyártására" használható, fémpor-"gyártó berendezés".

b. Kifejezetten az 1B002 vagy az 1B102.a. alatt meghatározott "gyártó berendezéshez" tervezett alkatrész.

Megjegyzés : Az 1B102 magában foglalja az alábbiakat:

a. Plazmagenerátorok (nagyfrekvenciás ív-sugár), amelyek a folyamat argon/víz környezetben történő szervezésével porlasztott vagy gömb fémpor készítésre használhatók;

b. Elektromos ívkisülő berendezés, amely a folyamat argon/víz környezetben történő szervezésével porlasztott vagy gömb fémpor készítésre használható;

c. Az olvadékot közömbös közegbe (pl. nitrogén) porlasztó, gömb alumínium por "gyártására" használható berendezés;

1B115Az 1B002 vagy 1B102 alatt meghatározottaktól eltérő olyan berendezés, amely hajtóanyag vagy hajtóanyag alkotóelem gyártására szolgál, valamint a kifejezetten ehhez tervezett alkatrészek, az alábbiak szerint:

a. Az 1C011.a., 1C011.b., 1C111. alatt vagy a katonai célú termékek ellenőrzési jegyzékében meghatározott folyékony hajtóanyagok vagy hajtóanyag alkotóelemek "gyártására", kezelésére vagy átvételi vizsgálataira szolgáló "gyártó berendezések";

b. Az 1C011.a., 1C011.b., 1C111. alatt vagy a katonai célú termékek ellenőrzési jegyzékében meghatározott szilárd hajtóanyagok vagy hajtóanyag alkotóelemek "gyártására", kezelésére, keverésére, javítására, öntésére, sajtolására, megmunkálására, extrudálására vagy átvételi vizsgálataira szolgáló "gyártó berendezések"; Megjegyzés : Az 1B115.b. nem vonja ellenőrzés alá a szakaszos, folyamatos üzemű keverőgépeket és zúzógépeket. A szakaszos, folyamatos üzemű keverőgépek és zúzógépek tekintetében lásd: 1B117, 1B118 és 1B119.

1. megjegyzés : Kifejezetten katonai célra tervezett berendezések tekintetében lásd: katonai célú termékek ellenőrzési jegyzéke.

2. megjegyzés : Az 1B115 nem vonja ellenőrzés alá a bór-karbid "gyártására", kezelésére és minősítő vizsgálatára szolgáló berendezéseket.

1B116Kifejezetten az 1 573 K (1 300 °C) és 3 173 K (2 900 °C) közötti hőmérséklettartományban, valamint a 130 Pa és 20 kPa közötti nyomástartományban elbomló prekurzor gázokból öntőformán, tüskén vagy más alaplemezen, pirolízis útján nyert származék anyagok előállítására tervezett fúvókák.

1B117Az alábbi jellemzők mindegyikével rendelkező szakaszos keverőgépek, és a kifejezetten ezekhez tervezett alkatrészek:

a. Vákuumban 0 és 13,326 kPa közötti nyomástartományban való működésre tervezték vagy alakították át őket:

b. Képesek a keverőkamra hőmérsékletének szabályozására;

c. Legalább 110 liter teljes térfogatkapacitással rendelkeznek; és

d. Legalább egy excentrikusan szerelt ‘keverő-/dagasztótengellyel' rendelkeznek.

Megjegyzés : Az 1B117.d. alatt említett ‘keverő-/dagasztótengely' nem vonatkozik a deagglomerátorokra vagy forgókésekre.

1B118Az alábbi jellemzők mindegyikével rendelkező folyamatos üzemű keverőgépek, és a kifejezetten ehhez tervezett alkatrészek:

a. Vákuumban 0 és 13,326 kPa közötti nyomástartományban való működésre tervezték vagy alakították át őket;

b. Képesek a keverőkamra hőmérsékletének szabályozására;

c. Rendelkeznek az alábbiak bármelyikével: 1. Két vagy több keverő-/gyúrótengely; vagy 2. Az alábbiak mindegyike: a. Egyetlen forgó- és oszcillálótengely gyúrófogakkal/szegekkel; és b. A keverőkamra belső felületén található gyúrófogak/szegek.

1B119Folyékony energiájú zúzógépek, amelyek az 1C011.a., az 1C011.b., az 1C111 alatt vagy a katonai célú termékek ellenőrzési jegyzékében meghatározott anyagok darálására vagy őrlésére szolgálnak, és a kifejezetten ehhez tervezett alkatrészek.

1B201Az 1B001 vagy az 1B101 alatt meghatározottaktól eltérő szálsodró gépek, valamint az ezekhez tartozó berendezések, az alábbiak szerint:

a. Szálsodró gépek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. A pozicionáló, hurkoló és tekercselő mozgásokat két vagy több tengely mentén koordinálják vagy programozzák; 2. Kifejezetten "rostos vagy szálas anyagokból" készülő kompozit szerkezetek és rétegelt termékek készítésére tervezték; és 3. Képesek 75 mm-től 650 mm-ig terjedő belső átmérőjű és 300 mm, vagy nagyobb hosszúságú hengeres csövek tekercselésére;

b. Az 1B201.a. alatt meghatározott szálsodró gépeket koordináló és programozó vezérlők;

c. Precíziós tüskék az 1B201.a. alatt meghatározott szálsodró gépekhez.

1B225250 g/h-nál nagyobb kimeneti kapacitású fluorgyártásra szolgáló elektrolízis cellák.

1B226Elektromágneses izotópelválasztók, amelyekhez olyan egyszeres vagy többszörös ionforrásokat terveztek, amelyek képesek 50 mA vagy azt meghaladó erősségű ionáram létrehozására, vagy amelyeket ilyenekkel szereltek fel.

Megjegyzés: Az 1B226 magában foglalja azokat a szeparátorokat, amelyek:

a. Képesek stabil izotópok dúsítására;

b. Az ionforrások és a kollektorok a mágneses mezőben, valamint azokon kívül egyaránt elhelyezhetők.

1B228Hidrogén-kriogén desztillációs oszlopok, amelyek rendelkeznek az alábbi jellemzők mindegyikével:

a. 35 K (- 238 °C) vagy az alatti belső hőmérsékleten történő üzemelésre tervezték;

b. 0,5 és 5 MPa közötti belső nyomáson történő üzemelésre tervezték;

c. A következők egyikéből készült: 1. A Society of Automotive Engineers International (SAE) szerinti 300-as sorozatba tartozó alacsony kéntartalmú ausztenites rozsdamentes acél, amely ASTM (vagy ekvivalens szabvány) szerinti szemcseméret száma 5 vagy több; vagy 2. Ekvivalens anyag, amely mind hidegtűrő és mind hidrogén (H2) kompatibilis; és

d. Belső átmérőjük 30 cm vagy annál nagyobb, és ‘effektív hosszuk' 4 m vagy annál nagyobb.

Műszaki megjegyzés :

Az 1B228. pontban az ‘effektív hossz' töltetes oszlopban a töltet aktív magassága, vagy lemezes oszlopban a belső védőkapcsoló lemezek aktív magassága.

1B230Cseppfolyós ammóniában oldott, higított vagy tömény kálium-amid katalizátor oldatokat (KNH2/NH3) keringetésére képes szivattyúk, amelyek rendelkeznek az alábbi jellemzők mindegyikével:

a. gáztömörek (azaz hermetikusan zártak);

b. teljesítményük nagyobb, mint 8,5 m3/h; és

c. rendelkeznek az alábbi jellemzők valamelyikével: 1. tömény kálium-amid oldatok (1 % vagy nagyobb) esetén az üzemi nyomás 1,5-60 MPa; vagy 2. hígított (kisebb, mint 1 %) kálium-amid oldatok esetén az üzemi nyomás 20-60 MPa.

1B231Trícium létesítmények, vagy üzemek, valamint azok berendezései, az alábbiak szerint:

a. Trícium gyártására, visszanyerésére, kivonására, koncentrálására vagy kezelésére szolgáló létesítmények vagy üzemek;

b. Berendezések tríciumlétesítményekhez vagy -üzemekhez, az alábbiak szerint: 1. Hidrogén vagy hélium hűtőegységek, amelyek képesek 23 K (- 250 °C) alatti hőmérsékletre hűteni és hőelvételi teljesítményük nagyobb, mint 150 W; 2. Hidrogénizotóptároló- vagy hidrogénizotóptisztító-rendszerek, amelyekben tároló- vagy tisztítóközegként fémhidrideket alkalmaznak.

1B232Turboexpanderek, vagy turboexpander kompresszor egységek, amelyek rendelkeznek mindkét alábbi jellemzővel:

a. 35 K (- 238 °C) vagy az alatti hőmérsékleten történő üzemelésre tervezték; és

b. 1 000 kg/h, vagy nagyobb hidrogéngáz áteresztő kapacitásra tervezték.

1B233Lítium-izotóp szétválasztó létesítmények vagy üzemek, valamint azok rendszerei és berendezései, az alábbiak szerint

a. Lítiumizotópok szétválasztására szolgáló létesítmények vagy üzemek;

b. Lítium-amalgám folyamaton alapuló lítium-izotóp szétválasztó berendezések, az alábbiak szerint: 1. kifejezetten lítium-amalgámokhoz tervezett töltött folyadék-folyadék oszlopok; 2. higany- vagy lítium-amalgám szivattyúk; 3. lítium-amalgám elektrolízis cellák; 4. bepárlók tömény lítium-hidroxid oldathoz;

c. Kifejezetten lítium izotópok szétválasztására tervezett ioncserélő rendszerek, és a kifejezetten ezekhez tervezett alkatrészek;

d. Kifejezetten lítium izotópok szétválasztására tervezett (koronaétereket, kriptandokat, vagy lariát-étereket alkalmazó) kémiai cserélő rendszerek, és a kifejezetten ezekhez tervezett alkatrészek.

1B234Nagy hatású robbanószerekhez használt tartóedények, kamrák, tartályok és egyéb hasonló konténmentek, amelyeket nagy hatású robbanószerekhez vagy robbanószerkezetek tesztelésére terveztek, és amelyek rendelkeznek mindkét alábbi jellemzővel:

N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

a. Arra tervezték, hogy teljes mértékben elnyeljen egy 2 kg vagy annál nagyobb mennyiségű trinitro-toluolnak (TNT-nek) megfelelő erejű robbanást; és

b. Olyan design elemekkel vagy jellemzőkkel rendelkezik, amelyek lehetővé teszik a diagnosztikai vagy mérési információk valós idejű vagy késleltetett továbbítását.

1B235Célszerelvények és komponensek trícium gyártásához az alábbiak szerint:

a. Lítium-6 izotóppal dúsított lítiumból készült vagy azt tartalmazó, kifejezetten besugárzással, ideértve az atomreaktorba illesztéssel történő tríciumgyártáshoz tervezett célszerelvények.

b. Kifejezetten az 1B235.a. alatt meghatározott célszerelvényekhez tervezett komponensek.

Műszaki megjegyzés :

A kifejezetten a tríciumgyártáshoz használt célszerelvényekhez tervezett komponensek közé tartozhatnak a lítiumból készült pelletek, a trícium getterek és a speciális bevonattal ellátott burkolatok.

1CAnyagok

Műszaki megjegyzés :

a. Feldolgozott, vagy megmunkált anyagok, amelyeket hengerléssel, húzással, extrudálással, kovácsolással, sajtolással, granulálással, atomizálással és őrléssel állítottak elő, azaz azaz szögidomok, csatornák, abroncsok, tárcsák, por, lemezkék, fóliák és fémfóliák, kovácsdarabok, lemez, finom por, présöntvények és sajtolt áruk, szalagok, gyűrűk, rudak (beleértve a csupasz hegesztőpálcákat, huzalrudakat és hengerelt huzalokat), szelvények, idomok, finomelemezek, szalagok, csövek (beleértve a kerek, szögletes és egyéb zártszelvény csöveket), húzott, vagy extrudált huzal;

b. Homokformába, öntőszerszámba, fém-, gipsz- vagy egyéb formába történő öntéssel készített öntvények, beleértve a nagynyomású öntést, a szinterezett és a porkohászati eljárással készített idomokat.

1C001Kifejezetten az elektromágneses sugárzás elnyelésére tervezett anyagok vagy belsőleg vezető polimerek, az alábbiak szerint:

N.B. LÁSD MÉG: 1C101.

a. A 2 × 108 Hz-nél nagyobb, de 3 × 1012 Hz-nél kisebb frekvencia elnyelésére szolgáló anyagok: 1. megjegyzés : Az 1C001.a nem vonja ellenőrzés alá: a. Természetes vagy műszálakból készült hajtípusú abszorberek, amelyek az abszorpciót nem-mágneses töltéssel biztosítják; b. Mágneses veszteség nélküli abszorberek, amelyek becsapódási felülete nem síkban helyezkedik el, beleértve a gúlákat, a kúpokat, az ékeket és a csavart felületeket; c. Síkabszorberek, amelyek rendelkeznek a következő jellemzők mindegyikével: 1. Amelyek a következő anyagok bármelyikéből készültek: a. Műanyaghab (flexibilis vagy merev), széntöltettel, vagy szerves anyagok, beleértve a kötőanyagokat is, amelyek a fémekkel összehasonlítva több, mint 5 % visszhangot biztosítanak a becsapódási energia középfrekvenciáját ± 15 %-kal meghaladó sávszélességben, és nem képesek a 450 K (177 °C) értéket meghaladó hőmérsékleteknek ellenállni; vagy b. Kerámiaanyagok, amelyek a fémmel összehasonlítva több, mint 20 % visszhangot biztosítanak a becsapódási energia középfrekvenciáját ± 15 %-kal meghaladó sávszélességben, és nem képesek 800 K (527 °C) értéket meghaladó hőmérsékleteknek ellenállni; Műszaki megjegyzés : Az 1C001.a. 1.c.1. megjegyzését illetően az abszorpciós tesztmintáknak négyszög-hullámúaknak kell lenniük a központi frekvenciához tartozó hullámhossz legalább ötszörösét kitevő oldalmérettel, és a sugárzó egység távoli mezejében kell elhelyezkedniük. 2. A szakítószilárdság kisebb, mint 7 × 106 N/m2; és 3. A nyomószilárdság kisebb, mint 14 × 106 N/m2; d. Szinterezett ferritből készült síkabszorberek, amelyek rendelkeznek a következő jellemzők mindegyikével: 1. 4,4-et meghaladó fajsúly; és 2. legfeljebb 548 K (275 °C) legnagyobb működési hőmérséklet; e. Mágneses veszteség nélküli és legfeljebb 0,15 g/cm3 sűrűségű ‘nyitott cellás habból' álló műanyagból gyártott síkabszorberek. Műszaki megjegyzés : A ‘nyitott cellás hab' rugalmas és porózus anyag, amelynek belső szerkezete nyitott a külvilág felé. A ‘nyitott cellás hab' hálós szerkezetű habként is ismert. 2. megjegyzés : Az 1C001.a. ponthoz tartozó 1. megjegyzés alkalmazásában semmi sem vonja ki az ellenőrzés alól a festékekben lévő abszorbeáló mágneses anyagokat.

b. A látható fényben nem átlátszó és kifejezetten a 810 nm-nél nagyobb, de 2 000 nm-nél kisebb hullámhosszú (150 THz-nél nagyobb, de 370 THz-nél kisebb frekvenciájú) közel infravörös hullámok elnyelésére tervezett anyagok; Megjegyzés: Az 1C001.b. nem vonja ellenőrzés alá a kifejezetten az alábbi alkalmazások valamelyikéhez tervezett vagy előállított anyagokat: a. Polimerek "lézer" jelölése; vagy b. Polimerek "lézer" hegesztése.

c. Belső vezető polimer anyagok, amelyek ‘villamos vezetőképessége' meghaladja a 10 000 S/m-t (Siemens/méter) vagy ‘felületi (felszíni) fajlagos ellenállása' 100 Ohm/négyzetnél kevesebb, és amelyek az alábbi polimerek bármelyikén alapulnak: 1. Polianilin; 2. Polipirrol; 3. Politiofén; 4. Polifenilén-vinilén; vagy 5. Politienilén-vinilén. Megjegyzés : Az 1C001.c. nem vonja ellenőrzés alá a folyadék halmazállapotú anyagokat. Műszaki megjegyzés : a ‘villamos vezetőképességet' és a ‘fajlagos felületi (felszíni) ellenállást' az ASTM D-257 vagy a megfelelő nemzeti szabvány alapján kell meghatározni.

1C002Fémötvözetek, fémötvözet-porok vagy ötvözött anyagok, az alábbiak szerint:

N.B. LÁSD MÉG: 1C202.

Megjegyzés : Az 1C002 nem vonja ellenőrzés alá a felületi bevonatként kifejlesztett fémötvözeteket, fémötvözetporokat vagy ötvözött anyagokat.

Műszaki megjegyzések :

1. Az 1C002-ben említett fémötvözetek azok, amelyek az adott fémből magasabb tömegszázalékot tartalmaznak, mint bármely más elemből.

2. A ‘feszültségi törés-ellenállási élettartamot' az ASTM E-139 szabvány vagy az annak megfelelő nemzeti szabvány szerint kell mérni.

3. A ‘kisciklusú kifáradási határt' az ASTM E-606 ‘Ajánlott gyakorlat az állandó amplitúdójú kisciklusú fárasztóvizsgálathoz' c. szabvány vagy annak nemzeti megfelelője szerint kell mérni. A vizsgálat axiális, 1-gyel egyenlő átlagos feszültségaránnyal és 1-gyel egyenlő feszültség-koncentrációs faktorral (Kt). Az átlagos feszültség arányát úgy határozzuk meg, hogy a maximális feszültségből levonjuk a minimális feszültséget, és a különbséget osztjuk a maximális feszültséggel.

a. Aluminidek az alábbiak szerint: 1. Nikkel-aluminidek, amelyek legalább 15 és legfeljebb 38 tömegszázalék alumíniumot, és legalább még egy további ötvözőelemet tartalmaznak; 2. Titán-aluminidek, amelyek legalább 10 tömegszázalék alumíniumot, és legalább még egy további ötvözőelemet tartalmaznak;

b. Az 1C002.c. alatt meghatározott porokból vagy szemcsés anyagokból készült fémötvözetek, az alábbiak szerint: 1. A következő tulajdonságok bármelyikével rendelkező nikkelötvözetek: a. 923 K (650 °C) hőmérsékleten és 676 MPa terhelésen legalább 10 000 óra ‘feszültségi törés-ellenállási élettartam'; vagy b. 823 K (550 °C) hőmérsékleten és 1 095 MPa maximumterhelésen legalább 10 000 ciklust elérő ‘kisciklusú kifáradási határ'; 2. A következő tulajdonságok bármelyikével rendelkező nióbiumötvözetek: a. 1 073 K (800 °C) hőmérsékleten és 400 MPa terhelésen legalább 10 000 óra ‘feszültségi törés-ellenállási élettartam'; vagy b. 973 K (700 °C) hőmérsékleten és 700 MPa maximumterhelésen legalább 10 000 ciklust elérő ‘kisciklusú kifáradási határ'; 3. A következő tulajdonságok bármelyikével rendelkező titánötvözetek: a. 723 K (450 °C) hőmérsékleten és 200 MPa terhelésen legalább 10 000 óra ‘feszültségi törés-ellenállási élettartam'; vagy b. 723 K (450 °C) hőmérsékleten és 400 MPa maximumterhelésen legalább 10 000 ciklust elérő ‘kisciklusú kifáradási határ'; 4. A következő tulajdonságok bármelyikével rendelkező alumíniumötvözetek: a. 473 K (200 °C)-on legalább 240 MPa szakítószilárdság; vagy b. 298 K (25 °C)-on legalább 415 MPa szakítószilárdság; 5. A következő tulajdonságok mindegyikével rendelkező magnéziumötvözetek: a. Szakítószilárdsága legalább 345 MPa; és b. NaCl 3 %-os vizes oldatában az ASTM G-31 vagy annak megfelelő nemzeti szabvány szerint mért korróziós sebessége kisebb, mint 1 mm/év;

c. Fémötvözetporok vagy szemcsés anyagok az alábbi tulajdonságokkal rendelkező anyagokhoz: 1. A következő alkotórendszerek bármelyikéből készült: Műszaki megjegyzés : A következőkben X egy vagy több ötvözőelemet jelöl. a. Nikkelötvözetek (Ni-Al-X, Ni-X-Al) turbinamotor elemekhez- vagy alkatrészekhez, azaz 109 ötvözet részecskében 3-nál kevesebb olyan (a gyártási eljárás során bejuttatott) nemfémes részecskével, amelyek mérete meghaladja a 100 μm-t; b. Nióbiumötvözetek (Nb-Al-X vagy Nb-X-Al, Nb-Si-X vagy Nb-X-Si, Nb-Ti-X vagy Nb-X-Ti); c. Titánötvözetek (Ti-Al-X vagy Ti-X-Al); d. Alumínium ötvözetek (Al-Mg-X vagy Al-X-Mg, Al-Zn-X vagy Al-X-Zn, Al-Fe-X vagy Al-X-Fe); vagy e. Magnéziumötvözetek (Mg-Al-X vagy Mg-X-Al); 2. Ellenőrzött környezetben, az alábbi eljárások egyikével készült: a. ‘Vákuumporlasztás'; b. ‘Gáz atomizálás'; c. ‘Rotary-rendszerű atomizálás'; d. ‘Splat elfojtás'; e. ‘Olvadék pörgetése' és ‘szétzúzás'; f. ‘Olvadék-extrakció' és ‘szétzúzás'; g. ‘Mechanikus ötvözés'; vagy h. ‘Plazma atomizálás'; és 3. Alkalmas az 1C002.a. vagy 1C002.b. alatt meghatározott anyagok képzésére;

d. A következő tulajdonságokkal rendelkező ötvözött anyagok: 1. Az 1C002.c.1. alatt meghatározott alkotórendszerek bármelyikéből állították elő; 2. Nem zúzott pelyhek, szalagok vagy vékony rudak formájában van; és 3. Ellenőrzött környezetben az alábbiak bármelyikével állították elő: a. ‘Splat elfojtás'; b. ‘Olvadék pörgetése'; vagy c. ‘Olvadék-extrakció'. Műszaki megjegyzések : 1. ‘Vákuumporlasztás' (vacuum atomisation): eljárás a megolvasztott fémáram vákuum hatására gyorsan terjedő gáz segítségével történő, legfeljebb 500 μm átmérőjű cseppekre bontására. 2. ‘Gáz atomizálás' (gas atomisation): eljárás fémötvözet megolvasztott áramának nagynyomású gázáram segítségével történő, legfeljebb 500 μm átmérőjű cseppekre bontására. 3. ‘Rotary-rendszerű atomizálás' (rotary atomisation): eljárás a megolvasztott fémáram centrifugális erő segítségével történő, legfeljebb 500 μm átmérőjű cseppekre bontására. 4. ‘Splat elfojtás' (splat quenching): olyan ‘gyorsszilárdítási' eljárás, amelynek során a megolvasztott fémáram hűtött blokknak csapódik, és ezáltal pehelyszerű termék jön létre. 5. ‘Olvadék pörgetése' (melt spinning): olyan ‘gyorsszilárdítási' eljárás, amelynek során a megolvasztott fémáram forgó hűtött blokknak csapódik, és ezáltal pehely-, szalag- vagy rúdszerű termék jön létre. 6. ‘Szétzúzás' (comminution): eljárás az anyag zúzás vagy őrlés útján történő részecskékre bontására. 7. ‘Olvadék-extrakció' (melt extraction): olyan ‘gyorsszilárdítási' eljárás, amelynek során szalagszerű ötvözet jön létre azáltal, hogy a megolvasztott fémötvözet fürdőjébe forgó hűtött blokk rövid szegmensét helyezik be. 8. ‘Mechanikus ötvözés' (mechanical alloying): olyan ötvözési eljárás, amelynek során az ötvözet az elemi és a mesterötvözet-por mechanikai hatásra történő kötése, törése és újrakötése révén jön létre. Megfelelő porok hozzáadásával nemfémes részecskék építhetők be az ötvözetbe. 9. ‘Plazma atomizálás' (plasma atomisation): eljárás a megolvasztott fémáram vagy a szilárd fém semleges gázkörnyezetben, plazmafáklya segítségével történő, legfeljebb500 μm átmérőjű cseppekre bontására. 10. ‘Gyorsszilárdítás': a megolvasztott anyag szilárdítása 1 000 K/sec értéket meghaladó sebességű hűtési műveletekkel.

1C003Valamennyi típusú és formájú mágneses fém, amely rendelkezik az alábbi jellemzők bármelyikével:

a. Kiindulási relatív permeabilitás legalább 120 000 , a vastagság pedig legfeljebb 0,05 mm; Műszaki megjegyzés : A kiindulási relatív permeabilitás mérését teljesen kilágyított anyagokon kell végezni.

b. Magnetosztrikciós ötvözetek, amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. A telítési magnetosztrikció több, mint 5 × 10-4; vagy 2. A magnetomechanikai csatolási tényező (k) több, mint 0,8; vagy

c. Amorf vagy ‘nanokristályos' ötvözetszalagok, amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. Legalább 75 tömegszázalék vas, kobalt vagy nikkel tartalom; 2. A telítési mágneses indukció (Bs) legalább 1,6 T; és 3. Az alábbiak bármelyike: a. 0,02 mm vagy kisebb szalagvastagság; vagy b. 2 × 10-4 ohm cm vagy azt meghaladó villamos ellenállás. Műszaki megjegyzés : Az 1C003.c pontban említett ‘nanokristályos' anyagok azok az anyagok, amelyeknek (röntgendiffrakciós módszerrel meghatározott) kristályszemcse-mérete 50 nm vagy kevesebb.

1C004Urán-titán-ötvözetek vagy wolframötvözetek, vas-, nikkel- vagy rézbázisú "mátrix"-szal, amelyek rendelkeznek az alábbi jellemzők mindegyikével:

a. Sűrűségük nagyobb, mint 17,5 g/cm3;

b. A rugalmassági határ meghaladja a 880 MPa-t;

c. 1 270 MPa-t meghaladó szakítószilárdság; és

d. A nyúlás meghaladja a 8 %-ot.

1C005"Szupravezető" "kompozit" vezetők, amelyek hossza meghaladja a 100 métert, vagy amelyek tömege meghaladja a 100 grammot, az alábbiak szerint:

a. "szupravezető" "kompozit" vezetők, amelyek egy vagy több nióbium-titán'szálat' tartalmaznak, és az alábbi jellemzők mindegyikével rendelkeznek: 1. A réz vagy rézbázisú vegyes "mátrixtól" eltérő "mátrixba" beágyazva; és 2. Keresztmetszetük kisebb, mint 0,28 × 10-4 mm2 (körszelvényű ‘szálak' esetében az átmérő 6 μm);

b. egy vagy több "szupravezető" - nem nióbium-titán -'szálból' álló "szupravezető" "kompozit" vezetők, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. Zéró mágneses indukció mellett a "kritikus hőmérséklet" meghaladja a 9,85 K (- 263,31 °C) értéket; és 2. 4,2 K (- 268,96 °C) hőmérsékleten "szupravezető" állapotban maradnak, ha a vezető hosszirányú tengelyére merőleges bármilyen irányban 12 T mágneses indukciónak megfelelő mágneses mező hatásának teszik ki, amelyben a kritikus áramsűrűség a vezető keresztmetszetének egészében meghaladja az 1 750 A/mm2-t;

c. egy vagy több "szupravezető" ‘szálból' álló "szupravezető" "kompozit" vezetők, amelyek 115 K (- 158,16 °C) hőmérsékleten "szupravezető" állapotban maradnak.

Műszaki megjegyzés :

Az 1C005 pont alkalmazásában a ‘szálak' huzal, henger, film vagy szalag formáját ölthetik.

1C006Folyadékok és kenőanyagok, az alábbiak szerint:

a. Nem használt;

b. Kenőanyagok, amelyek fő összetevői fenilén- vagy alkilfenilén-éterek vagy -tioéterek, vagy keverékeik, amelyek több mint két éter vagy tioéter csoportot, vagy azok keverékeit tartalmazzák;

c. Csillapító vagy flotációs folyadékok, amelyek az alábbi jellemzők mindegyikével rendelkeznek: 1. tisztaságuk meghaladja a 99,8 %-ot, 2. 200 μm-es vagy nagyobb méretű részecskékből 100 ml-enként 25-nél kevesebbet tartalmaznak; és 3. legalább 85 %-ban a következők bármelyikéből készültek: a. Dibróm-tetrafluor-etán (CAS 25497-30-7, 124-73-2, 27336-23-8); b. Poli-klór-trifluor-etilén (csak olajos és viaszos módosulatok); vagy c. Poli-bróm-trifluor-etilén;

d. Elektronikus hűtésre tervezett fluorokarbon folyadékok, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. Legalább 85 tömegszázalékban tartalmazzák az alábbiak bármelyikét, illetve ezek keverékeit: a. perfluor-polialkil-éter-triazinok, vagy perfluor-alifás-éterek monomer formái; b. perfluor-alkil-aminok; c. perfluor-cikloalkánok; vagy d. perfluor-alkánok; 2. 298 K-en (25 °C) 1,5 g/ml, vagy nagyobb sűrűség; 3. 273 K-en (0 °C) folyékony halmazállapot; és 4. Legalább 60 tömegszázalékban tartalmaznak fluort. Megjegyzés : Az 1C006.d. nem vonja ellenőrzés alá a gyógyászati termékként meghatározott és csomagolt anyagokat.

1C007Kerámiaporok, kerámia- "mátrix" "kompozit" anyagok és ‘prekurzor anyagok', az alábbiak szerint

N.B. LÁSD MÉG: 1C107.

a. Titán-diborid (TiB2) (CAS 12045-63-5) kerámiaporok, amelyek teljes fémes szennyezettsége - a szándékosan hozzáadott adalékanyagok nélkül - kisebb, mint 5 000 ppm, az átlagos részecskeméret legfeljebb 5 μm, és a részecskék legfeljebb 10 %-ának mérete haladja meg a 10 μm-t;

b. Nem használt;

c. Kerámia- "mátrix" "kompozit" anyagok az alábbiak szerint: 1. Kerámia-kerámia "kompozit" anyagok üveg vagy oxid "mátrix"-szal, és az alábbiak valamelyikével erősítve: a. Folyamatos szálak az alábbi anyagok bármelyikéből: 1. Al2O3 (CAS 1344-28-1); vagy 2. Si-C-N; vagy Megjegyzés : Az 1C007.c.1.a. nem vonja ellenőrzés alá az olyan szálakból készült "kompozitokat", amelyek szakítószilárdsága 1 273 K-en (1 000 °C) 700 MPa-nál kisebb, vagy nyúlási alakváltozással szembeni ellenállása 100 MPa terhelés mellett és 1 273 K-en (1 000 °C) 100 óra alatt 1 %-nál nagyobb maradandó alakváltozást tesz lehetővé. b. Szálak, amelyek az alábbi összes jellemzővel rendelkeznek: 1. Az alábbi anyagok bármelyikéből készült: a. Si-N; b. Si-C; c. Si-Al-O-N; vagy d. Si-O-N; és 2. A "fajlagos szakítószilárdság" meghaladja a 12,7 × 103 m-t; 2. Kerámia"mátrix" "kompozit" anyagok, ahol szilícium-, cirkónium- vagy bór-karbidok vagy -nitridek alkotják a "mátrixot";

d. Nem használt;

e. Kifejezetten az 1C007.c alatt meghatározott berendezések "gyártásához" tervezett ‘prekurzor anyagok': 1. Poli-diorgano-szilánok; 2. Poli-szilazánok; 3. Poli-karboszilazánok;

f. Nem használt.

Műszaki megjegyzés :

Az 1C007 alkalmazásában a ‘prekurzor anyagok' olyan különleges célra szolgáló polimer vagy fémorganikus anyagok, amelyeket "szilícium-karbidok", "szilícium-nitridek" vagy szilícium-, szén- és nitrogéntartalmú kerámiák gyártásához használnak.

1C008Nem fluorozott polimer anyagok, az alábbiak szerint:

a. Imidek, az alábbiak szerint: 1. Bisz-maleimidek; 2. Aromás poliamid-imidek (PAI), amelyeknél az ‘üvegesedési hőmérséklet (Tg)' meghaladja az 563 K (290 °C) értéket; 3. Aromás poli-éter-imidek, amelyeknél az ‘üvegesedési hőmérséklet (Tg)' meghaladja az 505 K (232 °C) értéket; 4. Aromás poli-éter-imidek, amelyeknél az ‘üvegesedési hőmérséklet (Tg)' meghaladja az 563 K (290 °C) értéket; Megjegyzés : Az 1C008.a. pont ellenőrzés alá vonja a folyékony és az "olvasztható" szilárd anyagokat, beleértve a műgyantát, a port, a pelletet, a filmet, a finomlemezeket, a szalagot. N.B. A film, lemez vagy szalag formájú, nem "olvasztható" aromás polimidek tekintetében lásd az 1A003 pontot.

b. Nem használt;

c. Nem használt;

d. Poliarilén-ketonok;

e. Poliarilén-szulfidok, ahol az arilén csoport: bifenilén, trifenilén vagy ezek kombinációja;

f. Poli-bifenilén-éter-szulfon, amelyeknél az ‘üvegesedési hőmérséklet (Tg)' meghaladja az 563 K (290 °C) értéket.

Műszaki megjegyzések :

1. Az 1C008.a.2. pontban szereplő hőre lágyuló anyagok, az 1C008.a.4. pontban és az 1C008.f. pontban szereplő anyagok alkalmazásában az ‘üvegesedési hőmérséklet (Tg)' meghatározása az ISO 11357-2:1999-ben vagy annak megfelelő nemzeti szabványban leírt módszerek szerint történik.

2. Az 1C008.a.2. pontban szereplő hőre keményedő anyagok és az 1C008.a.3. pontban szereplő anyagok alkalmazásában az ‘üvegesedési hőmérséklet (Tg)' meghatározása az ASTM D 7028-07-ben vagy annak megfelelő nemzeti szabványban leírt hárompontos hajlítási módszer szerint történik. A vizsgálatot olyan száraz próbadarab felhasználásával kell elvégezni, amely az ASTM E 2160-04 vagy azzal egyenértékű nemzeti szabvány szerint legalább 90 %-os keményítési fokot ért el, és amelyet a legmagasabb ‘üvegesedési hőmérsékletet (Tg)' eredményező standard kezelési és kezelés utáni eljárások kombinációjának alkalmazásával kezeltek.

1C009Feldolgozatlan fluorozott vegyületek, az alábbiak szerint:

a. Nem használt;

b. Fluorozott poliimidek, amelyek legalább 10 tömegszázalékban kombinált fluort tartalmaznak;

c. Fluorozott foszfazán elasztomerek, amelyek legalább 30 tömegszázalékban kombinált fluort tartalmaznak.

1C010"Rostos vagy szálas anyagok", az alábbiak szerint:

N.B. LÁSD MÉG: 1C210 ÉS 9C110.

Műszaki megjegyzések :

1. Az 1C010.a., 1C010.b., 1C010.c. vagy 1C010.e.1.b. pontban szereplő "fajlagos szakítószilárdság", a "fajlagos modulus" vagy a "rostos vagy szálas anyagok" fajlagos súlyának kiszámítása céljából, a szakítószilárdságot és modulust az ISO 10618:2004 vagy annak megfelelő nemzeti szabványban ismertetett A módszer alkalmazásával kell meghatározni.

2. Az 1C010 alatt szereplő "fajlagos szakítószilárdság", a "fajlagos modulus" és a nem egyirányú "rostos vagy szálas anyagok" (pl. szövetek, kusza fonatok és paszományok) fajsúlyának értékelését az alkotó egyirányú monofil szálak (pl. monofil szálak, cérnák, előfonatok vagy kócok) - nem egyirányú "rostos vagy szálas anyagokká" történő feldolgozása előtti - mechanikai jellemzőire kell alapozni. d.

a. Szerves "rostos vagy szálas anyagok", amelyek mindkét alábbi jellemzővel rendelkeznek: 1. A "fajlagos modulus" nagyobb, mint 12,7 × 106 m; és 2. A "fajlagos szakítószilárdság" meghaladja a 23,5 × 104 m-t; Megjegyzés : Az 1C010.a. nem vonja ellenőrzés alá a polietilént.

b. Szén "rostos vagy szálas anyagok", amelyek mindkét alábbi jellemzővel rendelkeznek: 1. A "fajlagos modulus" nagyobb, mint 14,65 × 106 m; és 2. A "fajlagos szakítószilárdság" meghaladja a 26,82 × 104 m-t; Megjegyzés : Az 1C010.b. nem vonja ellenőrzés alá a következőket: a. Azon "rostos vagy szálas anyagokból" készült gyártmányokat, amelyek "polgári légi jármű"- szerkezetek vagy rétegelt anyagok javítására szolgálnak, és amelyek rendelkeznek az összes alábbi jellemzővel: 1. 1 m2-t nem meghaladó terület; 2. 2,5 métert nem meghaladó hosszúság; és 3. 15 mm-t meghaladó szélesség. b. Mechanikusan darabolt, zúzott és vágott szén "rostos vagy szálas anyagok", amelyek hosszúsága legfeljebb 25,0 mm.

c. Szervetlen "rostos vagy szálas anyagok", amelyek mindkét alábbi jellemzővel rendelkeznek: 1. Rendelkeznek az alábbiak bármelyikével: a. Legalább 50 tömegszázalékban szilícium-dioxidot tartalmaz és a "fajlagos modulus" nagyobb, mint 2,54 × 106 m; vagy b. Az 1C010.c.1.a. alatt meghatározottaktól eltérő és a "fajlagos modulus" nagyobb, mint 5,6 × 106 m; és 2. Az olvadási, lágyulási, bomlási vagy szublimációs pont semleges környezetben meghaladja az 1 922 K-t (1 649 °C); Megjegyzés : Az 1C010.c. nem vonja ellenőrzés alá a következőket: a. Az olyan 3 tömegszázalékban vagy annál nagyobb mennyiségben szilikátot tartalmazó, nem folytonos többfázisú polikristályos timföld-szálak vagdalt rost vagy kusza paplan formájában, amelyeknek "fajlagos modulusa" kisebb, mint 10 × 106m; b. Molibdén- és molibdénötvözet szálak; c. Bórszálak; d. Nem folytonos kerámiaszálak, amelyek olvadási, lágyulási, bomlási vagy szublimációs pontja semleges környezetben alacsonyabb, mint 2 043 K (1 770 °C).

d. Az alábbi jellemzők bármelyikével rendelkező "rostos vagy szálas anyagok": 1. A következők bármelyikéből állnak: a. Az 1C008.a. alatt meghatározott poliéter-imidek; vagy b. Az 1C008.d.-1C008.f. alatt meghatározott anyagok; vagy 2. Az 1C010.d.1.a. vagy az 1C010.d.1.b. alatt meghatározott anyagokból készültek, amelyeket az 1C010.a., az 1C010.b. és az 1C010.c. alatt meghatározott egyéb szálakkal ‘kevertek össze'; Műszaki megjegyzés : ‘Keverés' (commingled): hőre lágyuló rostok és erősítő rostok szálankénti keverése, teljes szálformájú szálerősített "mátrix" -keverék előállítása céljából.

e. Gyantával vagy terpentingyantával részben vagy egészben impregnált "rostos vagy szálas anyagok" (prepregek), fém- vagy szénbevonatú "rostos vagy szálas anyagok" (preformok) vagy ‘szénszál előformák', amelyek az összes alábbi jellemzővel rendelkeznek: 1. Rendelkeznek az alábbiak bármelyikével: a. Az 1C010.c. alatt meghatározott szervetlen "rostos vagy szálas anyagok"; vagy b. Szerves vagy szén "rostos vagy szálas anyagok", amelyek az összes alábbi jellemzővel rendelkeznek: 1. A "fajlagos modulus" nagyobb, mint 10,15 × 106 m; és 2. A "fajlagos szakítószilárdság" meghaladja a 17,7 × 104 m-t; és 2. Rendelkeznek az alábbiak bármelyikével: a. az 1C008 vagy az 1C009.b. alatt meghatározott műgyanta vagy szurok; b. a ‘dinamikus mechanikai analízissel meghatározott üvegesedési hőmérsékletük (DMA Tg)' legalább 453 K (180 °C), és fenolgyanta bevonattal rendelkeznek; vagy c. a ‘dinamikus mechanikai analízissel meghatározott üvegesedési hőmérsékletük (DMA Tg)' legalább 505 K (232 °C), és az 1C008 vagy 1C009.b. alatt meghatározottaktól eltérő műgyanta- vagy szurokbevonattal rendelkeznek, amely nem fenolgyanta bevonat; 1. megjegyzés : A gyantával vagy szurokkal nem impregnált fém- vagy szénbevonatú "rostos vagy szálas anyagokat" (preformokat) vagy ‘szénszál előformákat' az 1C010.a., az 1C010.b. vagy az 1C010.c. alatt említett "rostos vagy szálas anyagok" határozzák meg. 2. megjegyzés : Az 1C010.e. nem vonja ellenőrzés alá a következőket: a. A "polgári légi jármű"-szerkezetek, vagy rétegelt lemezek javítására szolgáló, epoxigyanta "mátrix"-szal impregnált szén "rostos vagy szálas anyagokat" (prepregeket), amelyek az összes alábbi jellemzővel rendelkeznek: 1. 1 m2-t nem meghaladó terület; 2. 2,5 métert nem meghaladó hosszúság; és 3. 15 mm-t meghaladó szélesség. b. A gyantával vagy szurokkal teljesen vagy részben impregnált, mechanikusan darabolt, zúzott és vágott szén "rostos vagy szálas anyagok", amelyek hosszúsága legfeljebb 25,0 mm, amennyiben a felhasznált gyanta vagy szurok nem szerepel sem az 1C008, sem az 1C009.b. alatt. Műszaki megjegyzések : 1. ‘Szénszál preformok' (carbon fibre preforms): bevonat nélküli vagy bevonattal rendelkező szálak olyan rendezett elrendezését jelenti, amelynek célja a "mátrix" felhordását megelőzően egy alkatrész keretváz létrehozása a "kompozit" kialakításához. 2. Az 1C010.e. alatt meghatározott anyagok alkalmazásában a ‘dinamikus mechanikai analízissel mért üvegesedési hőmérséklet (DMA Tg)' meghatározása az ASTM D7028-07 vagy azzal egyenértékű nemzeti szabvány szerinti módszerrel történik egy száraz próbadarabon. Hőre keményedő anyagok esetében a száraz próbadarabnak az ASTM E2160-04 vagy azzal egyenértékű nemzeti szabvány szerint legalább 90 %-os keményítési fokúnak kell lennie.

1C011Fémek és vegyületek, az alábbiak szerint:

N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE ÉS 1C111.

a. 60 μm-nél kisebb szemcseméretű, gömbös, porlasztott, szferoid, pikkelyes, vagy rögszerű fémrészecskék, amelyek cirkóniumot, magnéziumot, vagy ezek ötvözetét 99 %-ban vagy azt meghaladó arányban tartalmazó anyagból készültek; Műszaki megjegyzés : A cirkóniumban lévő hafnium természetes mennyiségét (általában 2-7 %) a cirkóniumhoz kell számolni. Megjegyzés : Az 1C011.a. alatt meghatározott fémek vagy ötvözetek, ellenőrzés alá esnek attól függetlenül, hogy azokat alumíniumba, magnéziumba, cirkóniumba, vagy berilliumba kapszulázták.

b. 60 μm, vagy az alatti szemcseméretű bór, vagy bór ötvözetek, az alábbiak szerint: 1. legalább 85 tömegszázalék tisztaságú bór; 2. legalább 85 tömegszázalék bórtartalmú bórötvözetek; Megjegyzés : Az 1C011.b.-ben meghatározott fémek, vagy ötvözetek ellenőrzés alá esnek attól függetlenül, hogy azokat alumíniumba, magnéziumba, cirkóniumba, vagy berilliumba kapszulázták.

c. Guanidin-nitrát (CAS 506-93-4);

d. Nitro-guanidin (NQ) (CAS 556-88-7).

N.B. A fémporok más anyagokkal történő, katonai célokra készített keverék előállítását célzó vegyítéséről lásd még a katonai célú termékek ellenőrzési jegyzékét.

1C012A következő anyagok:

Műszaki megjegyzés :

Ezeket az anyagokat tipikusan nukleáris hőforrásokhoz használják fel.

a. Plutónium bármely formában, több mint 50 tömegszázalék plutónium-238 izotóptartalommal; Megjegyzés : Az 1C012.a. nem vonja ellenőrzés alá a következőket: a. Az 1 g vagy annál kisebb plutóniumtartalmú szállítmányokat; b. A 3 "effektív gramm", vagy annál kisebb szállítmányokat, amennyiben az műszerek érzékelő alkatrészében van.

b. "Előzetesen leválasztott" neptúnium-237, bármilyen formában. Megjegyzés : Az 1C012.b. nem vonja ellenőrzés alá az 1 g vagy annál kisebb neptúnium-237 tartalmú szállítmányokat.

1C101Az 1C001 alatt nem részletezett, ‘rakétákban' és "rakéta"-alrendszerekben vagy a 9A012 vagy a 9A112.a. alatt meghatározott pilóta nélküli légijárművekben felhasználható, a csökkentett észlelhetőség érdekében - úgy mint radarvisszaverő-képesség, ibolyántúli/infravörös és akusztikus jelek - alkalmazott anyagok és eszközök.

1. megjegyzés : Az 1C101 magában foglalja az alábbiakat:

a. Kifejezetten a lokátorjelek visszaverődésének csökkentésére tervezett szerkezeti anyagok és bevonatok;

b. Kifejezetten az elektromágneses spektrum mikrohullámú, infravörös, vagy ultraibolya tartományában a csökkentett vagy átalakított visszaverő-, illetve sugárzóképességhez tervezett bevonatok, beleértve a festékeket is.

2. megjegyzés : Az 1C101 nem vonja ellenőrzés alá a kizárólag műholdak hőszabályozására használt bevonatokat.

Műszaki megjegyzés :

Az 1C101 alatt a ‘rakéta' olyan komplett rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent, melyek hatósugara legalább 300 km.

1C102Újratelített pirolizált szén-szén anyagokból készült alkatrészek a 9A004 alatt meghatározott űrhajóhordozó eszközökhöz vagy a 9A104 alatt meghatározott rakétaszondákhoz.

1C107Az 1C007 alatt meghatározottaktól eltérő grafit és kerámia anyagok, az alábbiak szerint:

a. Rakétafúvókákhoz és visszatérő egységek orrkúpjaihoz felhasználható, finomszemcsés, 288 K-en (15 °C) mérve legalább 1,72 g/cm3 sűrűségű és legfeljebb 100 μm szemcseméretű grafit, amely az alábbi termékek bármelyikévé megmunkálható: 1. Legalább 120 mm átmérőjű és legalább 50 mm hosszúságú hengerek; 2. Legalább 65 mm belső átmérőjű, legalább 25 mm falvastagságú és legalább 50 mm hosszúságú csövek; vagy 3. Legalább 120 mm × 120 mm × 50 mm nagyságú tömbök; N.B. Lásd még: 0C004.

b. Rakétafúvókákhoz és "rakétákhoz", a 9A004 alatt meghatározott űrhajóhordozó eszközökhöz vagy a 9A104 alatt meghatározott rakétaszondákhoz használatos visszatérő egységek orrkúpjaihoz felhasználható pirolitikus vagy szálerősített grafit; N.B. Lásd még: 0C004.

c. "Rakétákhoz", a 9A004 alatt meghatározott űrhajóhordozó eszközökhöz vagy a 9A104 alatt meghatározott rakétaszondákhoz használatos radarantenna burkolatokhoz felhasználható kerámia kompozit anyagok (amelyek dielektromos állandója 100 MHz és 100 GHz között bármely frekvencián 6-nál kisebb);

d. "Rakétákhoz", a 9A004 alatt meghatározott űrhajóhordozó eszközökhöz vagy a 9A104 alatt meghatározott rakétaszondákhoz használatos orrkúpokhoz felhasználható tömeggyártható kiégetetlen szilícium-karbid erősítésű kerámia;

e. "Rakétákhoz", a 9A004 alatt meghatározott űrhajóhordozó eszközökhöz vagy a 9A104 alatt meghatározott rakétaszondákhoz használatos orrkúpokhoz, visszatérő egységekhez és fúvóka-csappantyúkhoz felhasználható szilícium-karbid erősítésű kerámia kompozitok.

f. Tömeggyártható kerámia kompozit anyagok, amelyek 3 000 °C vagy annál magasabb olvadáspontú ‘ultra magas hőmérsékletű kerámia'-mátrixból állnak és szálakkal vagy rostokkal vannak megerősítve, és amelyek ‘rakétákhoz', a 9A004 alatt meghatározott űrhajóhordozó eszközökhöz vagy a 9A104 alatt meghatározott rakétaszondákhoz való rakétaalkatrészekhez (például orrkúpokhoz, visszatérő egységekhez, belépő élekhez, sugáreltérítő síkokhoz, vezérlő felületekhez vagy rakétafúvóka szűkületi betétjeihez) használhatók. Megjegyzés : Az 1C107.f. nem vonja ellenőrzés alá a nem kompozit formájú ‘ultra magas hőmérsékletű kerámia' anyagokat. 1. műszaki megjegyzés : Az 1C107.f. alkalmazásában a ‘rakéta' olyan komplett rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent, melyek hatósugara meghaladja a 300 km-t. 2. műszaki megjegyzés : Az ‘ultra magas hőmérsékletű kerámiák' magukban foglalják az alábbiakat: 1. Titán-diborid (TiB2); 2. Cirkónium-diborid (ZrB2); 3. Nióbium-diborid (NbB2); 4. Hafnium-diborid (HfB2); 5. Tantál-diborid (TaB2); 6. Titán-karbid (TiC); 7. Cirkónium-karbid (ZrC); 8. Nióbum-karbid (NbC); 9. Hafnium-karbid (HfC); 10. Tantál-karbid (TaC).

1C111Az 1C011 alatt meghatározottaktól eltérő hajtóanyagok és hajtóanyag alkotó vegyianyagok, az alábbiak szerint:

a. Hajtóanyagok: 1. A katonai célú termékek ellenőrzési jegyzékében meghatározottaktól eltérő gömbös vagy szferoid alumíniumpor, 200 μm-nél kisebb szemcsemérettel és 97 tömegszázalék, vagy azt meghaladó alumíniumtartalommal, ha az az ISO 2591-1:1988 vagy annak megfelelő nemzeti szabvány szerint az össztömeg legalább 10 %-a 63 μm-nél kisebb szemcsékből áll; Műszaki megjegyzés : A 63 μm szemcseméret (ISO R-565) 250 mesh (Tyler) vagy 230 mesh (ASTM E-11 szabvány) értéknek felel meg. 2. A katonai célú termékek ellenőrzési jegyzékében meghatározottaktól eltérő fémporok, az alábbiak szerint: a. Fémpor cirkóniumból, berilliumból vagy magnéziumból, illetve ezen anyagok ötvözeteiből, amennyiben az összes részecsketérfogat vagy -tömeg legalább 90 %-át 60 μm-nél kisebb (a részecskeméretet szitával, lézerdiffrakcióval vagy optikai szkenneléssel történő mérési technikákkal határozzák meg) gömbös, porlasztott, szferoid, pikkelyes vagy rögszerű részecskék alkotják, és amelyek 97 tömegszázalékban az alábbiak valamelyikéből állnak: 1. Cirkónium; 2. Berillium; vagy 3. Magnézium; Műszaki megjegyzés : A cirkóniumban lévő hafnium természetes mennyiségét (általában 2-7 %) a cirkóniumhoz kell számolni. b. Fémpor bórból vagy legalább 85 tömegszázalékban bórt tartalmazó bórötvözetből, amennyiben az összes részecsketérfogat vagy -tömeg legalább 90 %-át 60 μm-nél kisebb (a részecskeméretet szitával, lézerdiffrakcióval vagy optikai szkenneléssel történő mérési technikákkal határozzák meg) gömbös, porlasztott, szferoid, pikkelyes vagy rögszerű részecskék alkotják; Megjegyzés : Az 1C111a.2.a. és 1C111a.2.b. a multimodális részecskeeloszlással rendelkező (például különböző szemcseméretek keverékéből álló) porkeverékeket vonja ellenőrzés alá, amennyiben egy vagy több módot ellenőrzés alá vonnak. 3. Folyékony hajtóanyagú rakétamotorokban használatos oxidálószerek, az alábbiak szerint: a. Dinitrogén-trioxid (CAS 10544-73-7); b. Nitrogén-dioxid (CAS 10102-44-0)/dinitrogén-tetroxid (CAS 10544-72-6); c. Dinitrogén-pentoxid (CAS 10102-03-1); d. Kevert nitrogén-oxidok (MON); Műszaki megjegyzés : A kevert nitrogén-oxidok (MON) dinitrogén-tetroxid/nitrogén-dioxidban (N2O4/NO2) elkészített nitrogén-oxid (NO) oldatokat jelentenek, amelyek rakétarendszerekben alkalmazhatók. Számos olyan készítmény van, amelyek neve MONi vagy MONij, ahol i és j egész számok, amelyek a keverékben lévő nitrogén-oxid százalékos arányát jelölik (a MON3 pl. 3 % nitrogén-oxidot tartalmaz, a MON25 pedig 25 %-ot nitrogén-oxidot tartalmaz. A felső határ a MON40, amely 40 tömegszázalék nirogén-oxidot tartalmaz.) e. A gátolt vörösfüstös salétromsav (IRFNA) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; f. A fluort és egy vagy több más halogénatomot, oxigént vagy nitrogént tartalmazó vegyületek tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE ÉS 1C238; 4. Hidrazinszármazékok, az alábbiak szerint: N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE. a. Trimetilhidrazin (CAS 1741-01-1); b. Tetrametilhidrazin (CAS 6415-12-9); c. N,N-diallilhidrazin; (CAS 5164-11-4); d. Allilhidrazin (CAS 7422-78-8); e. Etilén-dihidrazin (CAS 6068-98-0); f. Monometil-hidrazin-dinitrát; g. Aszimmetrikus dimetilhidrazin-nitrát; h. Hidrazínium-azid (CAS 14546-44-2); i. 1,1-Dimetilhidrazínium-azid (CAS 227955-52-4) / 1,2-Dimetilhidrazínium-azid (CAS 299177-50-7); j. Hidrazínium-dinitrát (CAS 13464-98-7); k. Diimido-dihidrazin-oxalát (CAS 3457-37-2); l. 2-hidroxietil-hidrazin-nitrát (HEHN); m. A hidrazínium-perklorát tekintetében lásd a katonai célú termékek ellenőrzési jegyzékét; n. Hidrazinium diperklorát (CAS 13812-39-0); o. Metilhidrazin-nitrát (MHN) (CAS 29674-96-2); p. 1,1-Dietilhidrazin nitrát (DEHN) / 1,2-Dietilhidrazin nitrát (DEHN) (CAS 363453-17-2); q. 3,6-dihidrazin-tetrazin-nitrát (1,4-dihidrazin nitrát) (DHTN); 5. A katonai célú termékek ellenőrzési jegyzékében meghatározottaktól eltérő, ‘rakétákban' és a 9A012 vagy 9A112.a. pont alatt meghatározott pilóta nélküli légijárművekben felhasználható nagy energiasűrűségű anyagok; a. Szilárd és cseppfolyós üzemanyagot egyaránt tartalmazó üzemanyagkeverék, mint a bórtartalmú üzemanyag-keverékek, amelynek tömegalapú energiasűrűsége legalább 40 × 106 J/kg; b. Más nagy energiasűrűségű üzemanyagok és üzemanyag-adalékok (pl. kubán, ionos oldatok, JP-10), amelyek térfogatalapú energiasűrűsége legalább 37,5 × 109 J/m3 20 °C-on egy atmoszféra (101,325 kPa) nyomás mellett mérve; Megjegyzés : Az 1C111.a.5.b. nem vonja ellenőrzés alá a finomított fosszilis üzemanyagokat és a zöldségekből készült bioüzemanyagokat - ideértve a polgári légi közlekedésben való használatra hitelesített hajtóművekben használt üzemanyagokat is - kivéve, ha azok kifejezetten ‘rakétákban' vagy a 9A012 vagy 9A112.a. pont alatt meghatározott pilóta nélküli légi járművekben való használatra készültek. Műszaki megjegyzés : Az 1C111.a.5. alkalmazásában ‘rakéta': 300 km-t meghaladó hatótávolságú teljes rakétarendszer és pilóta nélküli légijármű-rendszer. 6. Hidrazin helyettesítő üzemanyag az alábbiak szerint: a. 2-Dimetil-aminoetil-azid (DMAZ) (CAS 86147-04-8);

b. Polimer anyagok: 1. Karboxi-végződésű polibutadién (a karboxil-végződésű polibutadiént is beleértve) (CTPB); 2. A katonai célú termékek ellenőrzési jegyzékében meghatározottaktól eltérő hidroxi-végződésű polibutadién (a hidroxil-végződésű polibutadiént is beleértve) (HTPB) (CAS 69102-90-5); 3. Polibutadién-akrilsav (PBAA); 4. Poli-butadién-akrilsav-akrilnitril(PBAN) (CAS 25265-19-4 / CAS 68891-50-9); 5. Poli-tetrahidrofurán polietilén glikol (TPEG); Műszaki megjegyzés : A poli-tetrahidrofurán-polietilén-glikol (TPEG) a poli-1,4-butánediol (CAS 110-63-4) és a polietilén-glikol (CAS 25322-68-3) (PEG) blokk-kopolimerje. 6. A poliglicidil-nitrát (PGN vagy poli-GLYN) (CAS 27814-48-8) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

c. Egyéb hajtóanyag-adalékok és ágensek: 1. A karboránok, dekaboránok, pentaboránok és ezek származékai tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; 2. Trietilén-glikol-dinitrát (TEGDN) (CAS 111-22-8); 3. 2-nitro-difenilamin (CAS 119-75-5); 4. A trimetilol-etán-trinitrát (TMETN) (CAS 3032-55-1) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; 5. Dietilénglikol-dinitrát (DEGDN) (CAS 693-21-0); 6. A következő ferrocénszármazékok. a. A katocén (CAS 37206-42-1) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; b. Az etil-ferrocén (CAS 1273-89-8) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; c. Az n-propil-ferrocén (CAS 1273-92-3)/izo-propil-ferrocén (CAS 12126-81-7) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; d. Az n-butil-ferrocén (CAS 31904-29-7) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; e. A pentil-ferrocén (CAS 1274-00-6) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; f. A diciklopentil-ferrocén (CAS 125861-17-8) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; g. A diciklohexil-ferrocén tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; h. A dietil-ferrocén (CAS 1273-97-8) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; i. A dipropil-ferrocén tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; j. A dibutil-ferrocén (CAS 1274-08-4) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; k. A dihexil-ferrocén (CAS 93894-59-8) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; l. Az acetil-ferrocén (CAS 1271-55-2)/1,1'-diacetil-ferrocén (CAS 1273-94-5) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; m. A ferrocén-karboxilsav (CAS 1271-42-7)/1,1'-ferrocén-dikarboxilsav (CAS 1293-87-4) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; n. A butacén (CAS 125856-62-4) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE; o. Egyéb, a katonai célú termékek ellenőrzési jegyzékében meghatározottaktól eltérő, a rakéta-hajtóanyag égési sebességének módosítására használt ferrocénszármazékok. Megjegyzés : Az 1C111.c.6.o. nem vonja ellenőrzés alá a ferrocén molekulához kapcsolódó, hat szénatomos aromás funkciós csoportot tartalmazó ferrocén származékokat. 7. A katonai célú termékek ellenőrzési jegyzékében meghatározottól eltérő 4,5-diazidometil-2-metil-1,2,3-triazol (iso-DAMTR).

d. A katonai célú termékek ellenőrzési jegyzékében meghatározott, kifejezetten "rakétákban" való felhasználásra készítettől eltérő ‘kocsonyás halmazállapotú hajtóanyag'. Műszaki megjegyzések: 1. Az 1C111.d. pontban a ‘kocsonyás halmazállapotú hajtóanyag' olyan üzemanyag- vagy oxidálószer-készítmény, amely olyan kocsonyás anyagot használ, mint például a szilikát, a kaolin (agyag), szén vagy polimer kocsonyásítószer. 2. A 1C111.d. alkalmazásában a ‘rakéta' 300 km-t meghaladó hatótávolságú teljes rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent.

Megjegyzés : Az 1C111 alatt meghatározottaktól eltérő hajtóanyagok és alkotó vegyületeik tekintetében lásd: katonai célú termékek ellenőrzési jegyzéke.

1C116‘Rakétákban' felhasználható "martenzites acél", amely rendelkezik az alábbi összes jellemzővel:

N.B. LÁSD MÉG: 1C216.

a. 293 K (20 °C) hőmérsékleten szakítószilárdsága legalább: 1. 0,9 GPa oldóizzított állapotban; vagy 2. 1,5 GPa kiválással keményített állapot; és

b. Az alábbi formák bármelyike: 1. 5,0 mm, vagy annál kisebb fal- vagy lemezvastagságú lap, lemez vagy cső; 2. Csőformák 50 mm vagy annál kisebb falvastagsággal és 270 mm vagy annál nagyobb belső átmérővel.

1. műszaki megjegyzés :

Martenzites acél:

1. általában magas nikkeltartalom és nagyon alacsony széntartalom jellemez, és amelynél az ötvözetek erősítéséhez és öregedéses keményítéséhez kiegészítő elemeket, vagy kicsapatást alkalmaznak; és

2. a martenzites átalakulás megkönnyítése céljából hőkezelési ciklusoknak vannak alávetve (oldóizzított állapot), majd azt követően öregítéssel szilárdítva (kiválással keményített állapot).

2. műszaki megjegyzés :

Az 1C116 alkalmazásában a ‘rakéta' olyan komplett rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent, melyek hatósugara meghaladja a 300 km-t.

1C117‘Rakétaalkatrészek' gyártásához használt anyagok, az alábbiak szerint:

a. Volfrám és legalább 97 tömegszázalék volfrámot tartalmazó és legfeljebb 50 × 10-6 m (50 μm) részecskenagyságú volfrámötvözet szemcsés formában;

b. Molibdén és legalább 97 tömegszázalék molibdént tartalmazó és legfeljebb 50 × 10-6 m (50 μm) részecskenagyságú molibdénötvözet szemcsés formában;

c. Szilárd volfrámanyagok, amelyek az összes alábbi jellemzővel rendelkeznek: 1. Az alábbi anyagösszetételek bármelyikével rendelkeznek: a. Volfrám és a legalább 97 tömegszázalék volfrámot tartalmazó ötvözetek; b. Legalább 80 tömegszázalék volfrámot tartalmazó volfrám-réz ötvözet; vagy c. Legalább 80 tömegszázalék volfrámot tartalmazó volfrám-ezüst ötvözet; és 2. Az alábbi termékek bármelyikévé megmunkálható: a. Legalább 120 mm átmérőjű és legalább 50 mm hosszúságú hengerek; b. Legalább 65 mm belső átmérőjű, legalább 25 mm falvastagságú és legalább 50 mm hosszúságú csövek; vagy c. Legalább 120 mm × 120 mm × 50 mm nagyságú tömbök.

Műszaki megjegyzés :

Az 1C117 alkalmazásában a ‘rakéta' olyan komplett rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent, melyek hatósugara meghaladja a 300 km-t.

1C118Titánnal stabilizált duplex rozsdamentes acél (Ti-DSS), amely rendelkezik a következők mindegyikével:

a. Az alábbi jellemzők mindegyikével: 1. 17,0-23,0 tömegszázalékban tartalmaz krómot és 4,5-7,0 tömegszázalékban nikkelt; 2. A titántartalma nagyobb, mint 0,10 tömegszázalék; és 3. A ferrites-ausztenites mikroszerkezet (amelyet kétfázisú mikrostruktúrának is neveznek) térfogatának legalább 10 %-a (az ASTM E-1181-87 vagy annak megfelelő nemzeti szabvány szerint) ausztenit; és

b. A következő formák bármelyikében: 1. Tömbök vagy rudak, amelyek mérete minden irányban legalább 100 mm; 2. Lemezek, amelyek szélessége legalább 600 mm és vastagságuk 3 mm, vagy kisebb; vagy 3. Csövek, amelyek külső átmérője legalább 600 mm, és falvastagságuk 3 mm vagy kisebb.

1C202Egyéb, az 1C002.b.3 vagy b.4. alatt meghatározottaktól eltérő ötvözetek, az alábbiak szerint

a. Alumíniumötvözetek, amelyek rendelkeznek mindkét alábbi jellemzővel: 1. 293 K (20 °C) hőmérsékleten 460 MPa vagy nagyobb szakítószilárdságra ‘képesek'; és 2. 75 mm-nél nagyobb külső átmérőjű csövek vagy tömör hengerek formájában (beleértve kovácsdarabokat is);

b. Titán ötvözetek, amelyek rendelkeznek mindkét alábbi jellemzővel: 1. 293 K (20 °C) hőmérsékleten 900 MPa vagy nagyobb szakítószilárdságra ‘képesek'; és 2. 75 mm-nél nagyobb külső átmérőjű csövek, vagy tömör hengerek formájában (beleértve kovácsdarabokat is).

Műszaki megjegyzés :

A ‘képesek' kifejezés egyaránt vonatkozik a hőkezelés előtti, illetve utáni ötvözetre is.

1C210Az 1C010.a., b., vagy e. alatt meghatározottaktól eltérő ‘rostos vagy szálas anyagok' vagy prepregek, az alábbiak szerint:

a. Szén- vagy aramid-‘rostos vagy szálas anyagok', amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. A "fajlagos modulus" nagyobb, mint 12,7 × 106 m; vagy 2. A "fajlagos szakítószilárdság" meghaladja a 23,5 × 104 m-t; Megjegyzés : Az 1C210.a. nem vonja ellenőrzés alá az olyan aramid-‘rostos vagy szálas anyagokat', amelyekben 0,25 tömegszázalék vagy több észterbázisú szálfelület módosító van;

b. Üveg-‘rostos vagy szálas anyagok', amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. 3,18 × 106 m vagy nagyobb "fajlagos modulus"; és 2. A "fajlagos szakítószilárdság" meghaladja a 7,62 × 104 m-t;

c. Hőre keményedő gyantával impregnált, az 1C210.a., vagy b. alatt meghatározott szén-, vagy üveg-‘rostos vagy szálas anyagokból' készült folytonos "cérnák", "előfonatok", "kócok", vagy "szalagok", amelyek szélessége nem haladja meg a 15 mm-t (prepregek). Műszaki megjegyzés : A kompozit mátrixát a gyanta képezi. Megjegyzés : Az 1C210 alkalmazásában a ‘rostos vagy szálas anyagok' kizárólag folyamatos "monofil szálak", "cérnák", "előfonatok", "kócok", vagy "szalagok".

1C216Az 1C116 alatt meghatározott martenzites acél, amely 293 K (20 °C) hőmérsékleten 1 950 MPa vagy annál nagyobb szakítószilárdságra ‘képes',

Megjegyzés : Az 1C216 nem vonja ellenőrzés alá azokat a formákat, amelyekben egyetlen hosszirányú méret sem haladja meg a 75 mm-t.

Műszaki megjegyzés :

A ‘képes' fogalom egyaránt vonatkozik a hőkezelés előtti, illetve utáni martenzites acélra is.

1C225Bór-10 (10B) izotóppal dúsított bór, amelyben a természetes előfordulásnál nagyobb mértékben van az izotóp, az alábbiak szerint: bór és bórvegyületek, bórtartalmú keverékek, és ezekből gyártott termékek, a fentiek hulladéka vagy maradéka.

Megjegyzés : Az 1C225-ben a bór tartalmú keverék a bór betétes anyagokat is magában foglalja.

Műszaki megjegyzés :

A bór 10 izotóp természetes előfordulási mennyisége körülbelül 18,5 tömegszázalék (20 atomszázalék).

1C226Az 1C117 alatt meghatározottaktól eltérő volfrám, volfrám-karbid és volfrámötvözetek 90 %-nál nagyobb volfrámtartalommal, amelyek rendelkeznek mindkét alábbi jellemzővel:

a. Üreghengeres szimmetriájúak (beleértve a hengerszegmenseket is), belső átmérőjük 100 mm és 300 mm között van; és

b. Tömegük több, mint 20 kg.

Megjegyzés : Az 1C226 nem vonja ellenőrzés alá azokat a darabokat, amelyeket súlyként, vagy gamma-sugár kollimátorként terveztek.

1C227Kalcium, amely rendelkezik mindkét alábbi jellemzővel:

a. Tömeg szerint 1 000 ppm-nél kevesebb fémszennyeződést tartalmaz a magnézium kivételével; és

b. Tömeg szerint 10 ppm-nél kevesebb bórt tartalmaz.

1C228Magnézium, amely rendelkezik mindkét alábbi jellemzővel:

a. Tömeg szerint 200 ppm-nél kevesebb fémszennyeződést tartalmaz a kalcium kivételével; és

b. Tömeg szerint 10 ppm-nél kevesebb bórt tartalmaz.

1C229Bizmut, amely rendelkezik mindkét alábbi jellemzővel:

a. Tömeg szerint legalább 99,99 % tisztaságú; és

b. Tömeg szerint 10 ppm-nél kevesebb ezüstöt tartalmaz.

1C230Berillium fém, 50 tömegszázaléknál nagyobb berilliumtartalmú ötvözetek, berillium vegyületek és az ezekből készült termékek, illetve a fentiek hulladékai és maradékai, a katonai célú termékek ellenőrzési jegyzékében felsoroltak kivételével.

N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

Megjegyzés : Az 1C230 nem vonja ellenőrzés alá a következőket:

a. Fémablakok röntgenberendezésekhez vagy fúrólyuk mélyítő berendezésekhez;

b. Kifejezetten elektronikus alkatrészekhez vagy elektronikus áramkörökhöz alaplemezként való felhasználásra tervezett félkész, vagy késztermék oxid formák;

c. Berill (berillium- és alumínium-szilikát) smaragd és akvamarin formájában.

1C231Hafnium fém, 60 tömegszázaléknál nagyobb hafniumtartalmú ötvözetek és vegyületek, valamint az ezekből készült termékek, illetve a fentiek hulladékai és maradékai.

1C232Hélium-3 (3He), hélium-3-tartalmú keverékek, és termékek, vagy eszközök, amelyek a fentieket tartalmazzák.

Megjegyzés : Az 1C232 nem vonja ellenőrzés alá azokat a termékeket vagy eszközöket, amelyek 1 grammnál kevesebb hélium-3 izotópot tartalmaznak.

1C233Hatos izotóppal (6 Li) a természetes előfordulásnál nagyobb mértékben dúsított lítium, dúsított lítiumot tartalmazó termékek, illetve eszközök, az alábbiak szerint: elemi lítium, ötvözet, vegyület, lítium tartalmú keverék, ezekből gyártott termékek, és a fentiek hulladékai és selejtjei.

Megjegyzés : Az 1C233 nem vonja ellenőrzés alá a termolumineszcens dozimétereket.

Műszaki megjegyzés :

A lítiumban a hatos izotóp természetes előfordulása 6,5 tömegszázalék (7,5 atomszázalék).

1C234Hafniumtartalmú cirkónium, amelyben a hafnium-cirkónium tömegarány kisebb, mint 1:500, az alábbiak szerint: fém, 50 tömegszázaléknál nagyobb cirkóniumtartalmú ötvözetek, vegyületek, az ezekből gyártott termékek, és a fentiek hulladékai és selejtjei, az 0A001.f. pontban meghatározottak kivételével.

Megjegyzés : Az 1C234 nem vonja ellenőrzés alá a 0,10 mm vastagságot meg nem haladó cirkóniumfóliákat.

1C235Trícium, tríciumvegyületek és tríciumot tartalmazó keverékek, amelyekben a trícium és a hidrogénatomok számaránya meghaladja az 1: 1 000 -et, vagy az ezek bármelyikét tartalmazó termékek és eszközök.

Megjegyzés : Az 1C235 nem vonja ellenőrzés alá az olyan terméket vagy eszközt, amely nem tartalmaz 1,48 × 103 GBq (40 Ci) tríciumnál többet.

1C236A 0C001 és az 1C012.a. alatt meghatározottaktól eltérő, neutronforrások alfa-n reakción alapuló előállításához alkalmas ‘radionuklidok', az alábbi formákban:

a. Elemi;

b. Vegyületek, amelyek teljes aktivitása legalább 37 GBq/kg (1 Ci/kg);

c. Keverékek, amelyek teljes aktivitása legalább 37 GBq/kg (1 Ci/kg);

d. A fentiek bármelyikét tartalmazó termékek és eszközök.

Megjegyzés : Az 1C236 nem vonja ellenőrzés alá azokat az eszközöket vagy termékeket, amelyek 3,7 GBq-nél (100 millicurie) kisebb aktivitást mutatnak.

Műszaki megjegyzés :

Az 1C236. pontban a ‘radionuklidok' az alábbiak bármelyike lehetnek:

- Aktínium-225 (225Ac)

- Aktínium-227 (227Ac)

- Kalifornium-253 (253Cf)

- Kűrium-240 (240Cm)

- Kűrium-241 (241Cm)

- Kűrium-242 (242Cm)

- Kűrium-243 (243Cm)

- Kűrium-244 (244Cm)

- Einsteinium-253 (253Es)

- Einsteinium-254 (254Es)

- Gadolínium-148 (148Gd)

- Plutónium-236 (236Pu)

- Plutónium-238 (238Pu)

- Polónium-208 (208Po)

- Polónium-209 (209Po)

- Polónium-210 (210Po)

- Rádium-223 (223Ra)

- Tórium-227 (227Th)

- Tórium-228 (228Th)

- Urán-230 (230U)

- Urán-232 (232U)

1C237Rádium-226 (226Ra), rádium-226 ötvözetek, rádium-226 vegyületek, rádium-226-ot tartalmazó keverékek, vagy ezek gyártmányai, vagy ezek bármelyikét tartalmazó, termékek és eszközök.

Megjegyzés : Az 1C237 nem vonja ellenőrzés alá a következőket:

a. Orvosi applikátorok;

b. 0,37 GBq-nél (10 millicurie) nem több rádium-226-ot tartalmazó termék, vagy berendezés.

1C238Klór-trifluorid (ClF3).

1C239A katonai célú termékek ellenőrzési jegyzékében meghatározottaktól eltérő nagy hatású robbanószerek, vagy olyan anyagok vagy keverékek, amelyek ezekből 2 tömegszázaléknál nagyobb mennyiséget tartalmaznak, és amelyek kristálysűrűsége meghaladja az 1,8 g/cm3-t, detonációs sebessége pedig a 8 000 m/s-ot.

1C240A 0C005 alatt meghatározottaktól eltérő nikkelpor, vagy porózus nikkel, az alábbiak szerint:

a. Nikkel por, amely rendelkezik mindkét alábbi jellemzővel: 1. Tömeg szerinti tisztasága legalább 99,0 %; és 2. Az ASTM B330 szabvány szerint mért átlagos részecskeméret 10 μm-nél kisebb;

b. Az 1C240.a. alatt meghatározott anyagokból gyártott porózus nikkel.

Megjegyzés : Az 1C240 nem vonja ellenőrzés alá a következőket:

a. Szálszerű nikkelporok;

b. 1 000 cm2-nél kisebb lemezenkénti méretű egyedi porózus nikkellemezek.

Műszaki megjegyzés :

Az 1C240.b. olyan porózus fémre vonatkozik, amit az 1C240.a. által meghatározott anyagok tömörítésével és szinterezésével alakítottak ki annak érdekében, hogy olyan fémanyagot hozzanak létre, amely az egész szerkezetben összekapcsolódó finom pórusokat tartalmaz.

1C241Rénium és a legalább 90 tömegszázalék réniumot tartalmazó ötvözetek; valamint a rénium és volfrám bármilyen összetételét legalább 90 tömegszázalékban tartalmazó, az 1C226 alatt meghatározottaktól eltérő ötvözetek, amelyek rendelkeznek mindkét alábbi jellemzővel:

a. Üreghengeres szimmetriájúak (beleértve a hengerszegmenseket is), belső átmérőjük 100 mm és 300 mm között van; és

b. Tömegük több, mint 20 kg.

1C350Mérgező kémiai ágensekhez prekurzorként felhasználható vegyi anyagok, valamint az ezekből egy- vagy többfélét tartalmazó "kémiai elegyek", az alábbiak szerint:

N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE ÉS 1C450.

1. Tiodiglikol (CAS 111-48-8);

2. Foszfor-oxiklorid (CAS 10025-87-3);

3. Dimetil-metil-foszfonát (CAS 756-79-6);

4. A metil-foszfonil-difluorid (CAS 676-99-3) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE;

5. Metil-foszfonil-diklorid (CAS 676-97-1);

6. Dimetil-foszfit (DMP) (CAS 868-85-9);

7. Foszfor-triklorid (CAS 7719-12-2);

8. Trimetil-foszfit (TMP) (CAS 121-45-9);

9. Tionil-klorid (CAS 7719-09-7);

10. 3-hidroxi-1-metil-piperidin (CAS 3554-74-3);

11. N,N-Diizopropil-ß-aminoetil-klorid (CAS 96-79-7);

12. N,N-Diizopropil-ß-aminoetán-tiol (CAS 5842-07-9);

13. 3-kvinuklidinol (CAS 1619-34-7);

14. Kálium-fluorid (CAS 7789-23-3)

15. 2-klór-etanol (CAS 107-07-3);

16. Dimetil-amin (CAS 124-40-3);

17. Dietil-etil-foszfonát (CAS 78-38-6);

18. Dietil-N,N-dimetil-foszforamidát (CAS 2404-03-7);

19. Dietil-foszfit (CAS 762-04-9);

20. Dimetil-amin-hidroklorid (CAS 506-59-2);

21. Etil-foszfinil-diklorid (CAS 1498-40-4);

22. Etil-foszfonil-diklorid (CAS 1066-50-8);

23. Az etil-foszfonil-difluorid (CAS 753-98-0) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE;

24. Hidrogén-fluorid (CAS 7664-39-3);

25. Metil-benzilát (CAS 76-89-1);

26. Metil-foszfinil-diklorid (CAS 676-83-5);

27. N,N-Diizopropil-ß-amino-etanol (CAS 96-80-0);

28. Pinakolil-alkohol (CAS 464-07-3);

29. Az O-etilO-2-diizopropil-amino-etil-metil-foszfonit (QL) (CAS 57856-11-8) tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE;

30. Trietil-foszfit (CAS 122-52-1);

31. Arzén-triklorid (CAS 7784-34-1);

32. Benzilsav (CAS 76-93-7);

33. Dietil-metil-foszfonit (CAS 15715-41-0);

34. Dimetil-etil-foszfonát (CAS 6163-75-3);

35. Etil-foszfinil-difluorid (CAS 430-78-4);

36. Metil-foszfinil-difluorid (CAS 753-59-3);

37. 3-kvinuklidon (CAS 3731-38-2);

38. Foszfor-pentaklorid (CAS 10026-13-8);

39. Pinakolon (CAS 75-97-8);

40. Kálium-cianid (CAS 151-50-8);

41. Kálium-bifluorid (CAS 7789-29-9);

42. Ammónium-hidrogén-fluorid vagy ammónium-bifluorid (CAS 1341-49-7);

43. Nátrium-fluorid (CAS 7681-49-4);

44. Nátrium-bifluorid (CAS 1333-83-1);

45. Nátrium-cianid (CAS 143-33-9);

46. Trietanol-amin (CAS 102-71-6);

47. Foszfor-pentaszulfid (CAS 1314-80-3);

48. Diizopropil-amin (CAS 108-18-9);

49. Dietil-amino-etanol (CAS 100-37-8);

50. Nátrium-szulfid (CAS 1313-82-2);

51. Kén-monoklorid (CAS 10025-67-9);

52. Kén-diklorid (CAS 10545-99-0);

53. Trietanol-amin-hidroklorid (CAS 637-39-8);

54. N,N-Diizopropil-ß-aminoetil-klorid-hidroklorid (CAS 4261-68-1);

55. Metilfoszfonsav (CAS 993-13-5);

56. Dietil-metilfoszfonát (CAS 683-08-9);

57. N,N-Dimetilamino-foszforsav-diklorid (CAS 677-43-0);

58. Triizopropil-foszfit (CAS 116-17-6);

59. Etil-dietanol-amin (CAS 139-87-7);

60. O,O-dietil-tiofoszforsav (CAS 2465-65-8);

61. O,O-dietil-ditiofoszforsav (CAS 298-06-6);

62. Nátrium-szilícium-hexafluorid (CAS 16893-85-9);

63. Metil-diklór-tiofoszfát (CAS 676-98-2);

64. Dietil-amin (CAS 109-89-7);

65. N,N-diizopropil-amino-etántiol-hidroklorid (CAS 41480-75-5).

66. Metil-diklór-foszfát (CAS 677-24-7);

67. Etil-diklór-foszfát (CAS 1498-51-7);

68. Metil-difluor-foszfát (CAS 22382-13-4);

69. Etil-difluor-foszfát (CAS 460-52-6);

70. Dietil-klórfoszfit (CAS 589-57-1);

71. Metil-klorofluor-foszfát (CAS 754-01-8);

72. Etil-klorofluor-foszfát (CAS 762-77-6);

73. N,N-dimetil-formamidin (CAS 44205-42-7);

74. N,N-dietil-formamidin (CAS 90324-67-7);

75. N,N-dipropil-formamidin (CAS 48044-20-8);

76. N,N-diizopropil-formamidin (CAS 857522-08-8);

77. N,N-dimetil-acetamidin (CAS 2909-14-0);

78. N,N-dietil-acetamidin (CAS 14277-06-6);

79. N,N-dipropil-acetamidin (CAS 1339586-99-0);

80. N,N-dimetil-propánamidin (CAS 56776-14-8);

81. N,N-dietil-propánamidin (CAS 84764-73-8);

82. N,N-dipropil-propánamidin (CAS 1341496-89-6);

83. N,N-dimetil-butánamidin (CAS 1340437-35-5);

84. N,N-dietil-butánamidin (CAS 53510-30-8);

85. N,N-dipropil-butánamidin (CAS 1342422-35-8);

86. N,N-diizopropil-butánamidin (CAS 1315467-17-4);

87. N,N-dimetil-izobutánamidin (CAS 321881-25-8);

88. N,N-dietil-izobutánamidin (CAS 1342789-47-2);

89. N,N-dipropil-izobutánamidin (CAS 1342700-45-1).

1. megjegyzés : "A Vegyifegyver-tilalmi Egyezményhez nem csatlakozó államokba" történő kivitel esetében az 1C350 nem vonja ellenőrzés alá az olyan "kémiai elegyeket", amelyek egy vagy több vegyszert tartalmaznak az alábbi bekezdésekben meghatározottak közül: 1C350.1, .3, .5, .11, .12, .13., .17, .18, .21,. 22, .26, .27, .28, .31, .32, .33, .34, .35, .36, .54, .55, .56, .57, .63 és .65, és amelyekben egyik önállóan meghatározott vegyszer sem képvisel 10 tömegszázaléknál nagyobb arányt az elegyben.

2. megjegyzés : "A Vegyifegyver-tilalmi Egyezményhez csatlakozó államokba" történő kivitel esetében az 1C350 nem vonja ellenőrzés alá az olyan "kémiai elegyeket", amelyek egy vagy több vegyszert tartalmaznak az alábbi bekezdésekben meghatározottak közül: 1C350.1, .3, .5, .11, .12, .13., .17, .18, .21,. 22, .26, .27, .28, .31, .32, .33, .34, .35, .36, .54, .55, .56, .57, .63 és .65, és amelyekben egyik önállóan meghatározott vegyszer sem képvisel 30 tömegszázaléknál nagyobb arányt az elegyben.

3. megjegyzés : Az 1C350 nem vonja ellenőrzés alá az olyan "kémiai elegyeket", amelyek egy vagy több vegyszert tartalmaznak az alábbi bekezdésekben meghatározottak közül: 1C350.2, .6, .7, .8, .9, .10, .14, .15, .16, .19, .20, .24, .25, .30, .37, .38, .39, .40, .41, .42, .43, .44, .45, .46, .47, .48, .49, .50, .51, .52, .53, .58, .59, .60, .61, .62, .64, .66, .67, .68, .69, .70, .71, .72, .73, .74, .75, .76, .77, .78, .79, .80, .81, .82, .83, .84, .85, .86, .87, .88 és .89, amelyekben egyik önállóan meghatározott vegyszer sem képvisel 30 tömegszázaléknál nagyobb arányt az elegyben.

4. megjegyzés : Az 1C350 nem vonja ellenőrzés alá a fogyasztási cikkeknek minősített, kiskereskedelmi csomagolásban kiszerelt személyes használatra szánt, vagy önálló használatra csomagolt termékeket.

1C351Humán és állati patogének és "toxinok", az alábbiak szerint

a. Természetes, tenyésztett vagy módosított vírusok, "izolált élő kultúrák" vagy ilyen kultúrákkal szándékosan beoltott, vagy szennyezett élő anyagot tartalmazó anyagok - beleértve az élő anyagokat - formájában, az alábbiak szerint: 1. Afrikai lópestis vírus; 2. Afrikai sertéspestis vírus; 3. Andes vírus; 4. Madárinfluenza vírus, amely: a. Nem karakterizált; vagy b. A 2005/94/EK irányelv (HL L 10, 2006.1.14., 16. o.) I. mellékletének 2. pontjában magas patogenitásúként van meghatározva, az alábbiak szerint: 1. "A" típusú vírusok, amelyeknek IVPI-je (intravénás patogenitási index) 6 hetesnél idősebb csirkék esetén meghaladja az 1,2-t; vagy 2. "A" típusú, a megfigyelt többi magas patogenitású madárinfluenza vírushoz hasonló, a hemagglutinin molekula hasadási helyén többszörösen bázisos aminosavakat kódoló genomszekvenciával rendelkező H5 vagy H7 altípusú madárinfluenza vírusok, jelezve, hogy a hemagglutinin molekulát hasíthatja egy mindenütt jelenlévő gazdaproteáz; 5. Kéknyelv-betegség vírus; 6. Chapare vírus; 7. Chikungunya vírus; 8. Choclo vírus; 9. Krími-kongói haemorrhagias láz vírus; 10. Nem használt; 11. Dobrava-Belgade vírus; 12. Keleti ló-encephalitis vírus; 13. Ebola vírus: az ebola vírus nemhez tartozó valamennyi vírus; 14. Ragadós-száj- és körömfájás vírus; 15. Kecskehimlő vírus; 16. Guanarito vírus; 17. Hantaan vírus; 18. Hendra vírus (ló-morbillivirus); 19. SuHV1 herpesvírus (pszeudoveszettség-vírus, Aujeszky-betegség); 20. Klasszikus sertéspestis vírus (Hog cholera vírus); 21. Japán encephalitis vírus; 22. Junin vírus; 23. Kyasanur Forest vírus; 24. Laguna Negra vírus; 25. Lassa láz vírus; 26. Louping-ill vírus; 27. Lujo vírus; 28. Bőrcsomósodáskór vírusa; 29. Lymphocytás choriomeningitis vírus; 30. Machupo vírus; 31. Marburg vírus: a Marburg vírus nemzetséghez tartozó valamennyi vírus; 32. Majomhimlő vírus; 33. Murray-völgyi encephalitis vírus; 34. Baromfipestis vírus (Newcastle-betegség vírus); 35. Nipah vírus; 36. Omszki haemorrhagias láz vírus; 37. Oropouche vírus; 38. Kiskérődzők pestisének vírusa; 39. Sertések hólyagos betegségének vírusa; 40. Powassan vírus; 41. Veszettségvírus és a Lyssa-vírus nemzetség minden más tagja 42. Riftvölgyi láz vírus; 43. Keleti marhavész vírusa; 44. Rocio vírus; 45. Sabia vírus; 46. Seoul vírus; 47. Juhhimlő vírusa; 48. Sin Nombre vírus; 49. St. Louis encephalitis vírus; 50. Fertőző sertésbénulás vírusa; 51. Kullancs encephalitis vírus (távol-keleti altípus); 52. Himlővírus; 53. Venezuelai ló-encephalitis vírus; 54. Hólyagos szájgyulladás vírusa; 55. Nyugati ló-encephalitis vírus; 56. Sárgaláz vírus; 57. Súlyos akut légzőszervi szindróma koronavírusa (SARS-koronavírus); 58. Rekonstruált 1918-as influenza vírus; 59. Közel-keleti, légzőszervi tünetegyüttest okozó koronavírus (MERS-CoV);

b. Nem használt;

c. Természetes, tenyésztett, vagy módosított baktériumok, "izolált élő kultúrák", vagy ilyen kultúrákkal szándékosan beoltott, vagy szennyezett élő anyagot tartalmazó anyagok formájában, az alábbiak szerint: 1. Bacillus anthracis; 2. Brucella abortus; 3. Brucella melitensis; 4. Brucella suis; 5. Burkholdeia mallei (Pseudomonas mallei); 6. Burkholderia pseudomallei (Pseudomonas pseudomallei); 7. Chlamydia psittaci (Chlamydophila psittaci); 8. Clostridium argentinense (korábban Clostridium botulinum G típus néven ismert), botulinum neurotoxint termelő törzsek; 9. Clostridium baratii, botulinum neurotoxint termelő törzsek; 10. Clostridium botulinum; 11. Clostridium butyricum, botulinum neurotoxint termelő törzsek; 12. Clostridium perfringens epszilon toxint termelő típusok; 13. Coxiella burnetii; 14. Francisella tularensis; 15. Mycoplasma capricolum capripneumoniae alfaj (F38 törzs); 16. Mycoplasma mycoides alfaj SC (kis kolóniájú) 17. Rickettsia prowazekii; 18. Salmonella enterica subspecies enterica serovar Typhi (Salmonella typhi); 19. Az O26, O45, O103, O104, O111, O121, O145, O157 szerocsoportokhoz és más shigatoxint termelő szerocsoportokhoz tartozó shigatoxint termelő Escherichia coli (STEC); Megjegyzés : A shigatoxint termelő Escherichia coli (STEC) magában foglalja többek között az enterohemorrhagiás - E. colit (EHEC), a verotoxint termelő E. colit (VTEC) vagy a verocitotoxint termelő E. colit (VTEC). 20. Shigella dysenteriae; 21. Vibrio cholerae; 22. Yersinia pestis;

d. "Toxinok" és "toxinok alegységei", az alábbiak szerint: 1. Botulinum toxinok; 2. Clostridium perfringens alfa, béta 1, béta 2, epszilon és iota toxinok; 3. Conotoxin; 4. Ricin; 5. Saxitoxin; 6. Shigatoxin (shiga-szerű toxin, verotoxin és verocitotoxin) 7. Staphylococcus aureus enterotoxin, hemolizin alfa toxin és toxikus sokk szindrómát okozó toxin (korábban Staphylococcus enterotoxin F néven ismert); 8. Tetrodotoxin; 9. Nem használt; 10. Microcystin (Cyanginosin); 11. Aflatoxinok 12. Abrin; 13. Nem használt; 14. Diacetoxiscirpenol; 15. T-2 toxin; 16. HT-2 toxin; 17. Modeccin; 18. Volkensin; 19. Viscumin (Viscum album Lektin-1); 20. Brevetoxinok; 21. Gonyautoxinok; 22. Nodularinok; 23. Palytoxin. Megjegyzés: Az 1C351.d. nem vonja ellenőrzés alá az összes következő feltételnek megfelelő termékekben lévő botulinum toxinokat: 1. Gyógyászati eljárások keretében humán felhasználásra tervezett gyógyszerkészítmény; 2. Gyógyászati termékként való terjesztéshez előre csomagoltak; 3. Gyógyászati termékként történő forgalmazását állami hatóságok engedélyezik.

e. Természetes, tenyésztett vagy módosított gombák, "izolált élő kultúrák" vagy ilyen kultúrákkal szándékosan beoltott, vagy szennyezett élő anyagot tartalmazó anyagok - beleértve az élő anyagokat - formájában, az alábbiak szerint: 1. Coccidioides immitis; 2. Coccidioides posadasii.

Megjegyzés : Az 1C351 nem vonja ellenőrzés alá az "oltóanyagokat" és "immunotoxinokat".

1C353‘Genetikai elemek' és ‘géntechnológiával módosított szervezetek', az alábbiak szerint:

a. Az alábbiak bármelyikét tartalmazó ‘géntechnológiával módosított szervezetek' vagy az alábbiak bármelyikét kódoló ‘genetikai elem': 1. Az 1C351.a. vagy az 1C354.a. alatt meghatározott bármely vírusra jellemző bármilyen gén, gének, átfordítással (transzláció) létrejött termék vagy termékek; 2. Az 1C351.c. vagy az 1C354.b. alatt meghatározott bármely baktériumra, illetve az 1C351.e. vagy az 1C354.c. alatt meghatározott gombára jellemző bármilyen gén vagy gének, melyek az alábbi tulajdonságok valamelyikével rendelkeznek: a. Önmagában, illetve génátírással (transzkripció) vagy átfordítással (transzláció) létrejött termékei révén az emberek, állatok vagy növények egészségére nézve jelentős veszélyt jelent; vagy b. ‘Patogénné tehet vagy patogenitásnövelő hatású'; vagy 3. Az 1C351.d. alatt meghatározott "toxinok" vagy e "toxinok alegységei";

b. Nem használt.

Műszaki megjegyzések :

1. A ‘géntechnológiával módosított szervezetek' olyan organizmusokat foglalnak magukban, amelyekben a nukleinsavszakaszokat szándékos molekuláris manipuláció révén hozták létre vagy változtatták meg.

2. A ‘genetikai elemek' közé tartoznak többek között a géntechnológiával módosított vagy módosítatlan, vagy részben vagy egészében vegyi úton szintetizált kromoszómák, genomok, plazmidok, transzpozonok, vektorok és visszanyerhető nukleinsav-fragmentumokat tartalmazó inaktivált organizmusok. A genetikai elemek ellenőrzése céljából az inaktivált organizmusból, vírusból vagy mintából származó nukleinsavak visszanyerhetőnek tekintendők, ha az anyag inaktiválása és előkészítése azt célozza vagy arról az ismert, hogy megkönnyíti a nukleinsavak izolálását, tisztítását, amplifikációját, kimutatását vagy azonosítását.

3. ‘Patogénné tehet vagy patogenitásnövelő hatású' azt jelenti, hogy a nukleinsavszakasz vagy -szakaszok beillesztése vagy beépítése lehetővé teszi vagy lehetővé teheti vagy növeli vagy növelheti a fogadó szervezet alkalmasságát a betegség vagy halál szándékos előidézésére való felhasználásra. Ide tartozhatnak többek között a következők megváltoztatásai: virulencia, átvihetőség, stabilitás, fertőzés útja, gazdaszervezetek köre, reprodukálhatóság, a gazdaszervezet immunitásának kikerülése vagy elnyomása, egészségügyi ellenintézkedésekkel szembeni rezisztencia, vagy kimutathatóság.

1. megjegyzés : Az 1C353 nem vonja ellenőrzés alá az O26, O45, O103, O104, O111, O121, O145, O157 szerocsoportokhoz tartozó, shigatoxint termelő Escherichia coli és más shigatoxint termelő szerocsoportok nukleinsavszakaszait, kivéve a shigatoxint vagy az annak alegységeit kódoló genetikai elemeket.

2. megjegyzés : Az 1C353 nem vonja ellenőrzés alá a "vakcinákat".

1C354Növényi patogének, az alábbiak szerint:

a. Természetes, tenyésztett vagy módosított vírusok, "izolált élő kultúrák" vagy ilyen kultúrákkal szándékosan beoltott, vagy szennyezett élő anyagot tartalmazó anyagok - beleértve az élő anyagokat - formájában, az alábbiak szerint: 1. Burgonya andeszi látens vírus (Potato Andean latent tymovirus); 2. Burgonya gumóorsósodás viroid (Potato spindle tuber viroid);

b. Természetes, tenyésztett vagy módosított baktériumok, "izolált élő kultúrák" vagy ilyen kultúrákkal szándékosan beoltott vagy szennyezett élő anyagot tartalmazó anyagok formájában, az alábbiak szerint: 1. Xanthomonas albilineans; 2. Xanthomonas citri pv. citri (Xanthomonas axonopodis pv. citri, Xanthomonas campestris pv. citri); 3. Xanthomonas oryzae pv. oryzae (Pseudomonas campestris pv. oryzae); 4. Clavibacter michiganensis subsp. sepedonicus (Clavibacter sepedonicus, Clavibacter michiganense subsp. sepedonicus, Corynebacterium michiganensis subsp. sepedonicum vagy Corynebacterium sepedonicum); 5. Ralstonia solanacearum 3. fajta, 2. biovariáns;

c. Természetes, tenyésztett, vagy módosított gombák, "izolált élő kultúrák", vagy ilyen kultúrákkal szándékosan beoltott, vagy szennyezett anyagok formájában, az alábbiak szerint: 1. Colletotrichum kahawae (Colletotrichum coffeanum var. virulans); 2. Bipolaris oryzae (Cochliobolus miyabeanus, Helminthosporium oryzae); 3. Pseudocercospora ulei (Microcyclus ulei, Dothidella ulei); 4. Puccinia graminis ssp. graminis var. graminis / Puccinia graminis ssp. graminis var. stakmanii (Puccinia graminis [syn. Puccinia graminis f. sp. tritici]); 5. Puccinia striiformis (syn. Puccinia glumarum); 6. Magnaporthe oryzae (Pyricularia oryzae); 7. Peronosclerospora philippinensis (Peronosclerospora sacchari); 8. Sclerophthora rayssiae var. zeae; 9. Synchytrium endobioticium; 10. Tilletia indica; 11. Thecaphora solani.

1C450Mérgező vegyületek és mérgező vegyületek prekurzorai, és az ezekből egy- vagy többfélét tartalmazó "kémiai elegyek", az alábbiak szerint:

N.B. LÁSD MÉG 1C350, 1C351.d. ÉS A KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

a. Mérgező vegyületek az alábbiak szerint: 1. Amiton: O,O-dietil-S-[2-(dietil-amino)-etil] foszfor-tiolát (CAS 78-53-5) és a megfelelő alkilezett vagy protonált sók; 2. PFIB: 1,1,3,3,3-pentafluor-2-(trifluor-metil)-1-propén (CAS 382-21-8); 3. A BZ TEKINTETÉBEN LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE: 3-kvinuklidinil-benzilát (CAS 6581-06-2); 4. Foszgén: Karbonil-diklorid (CAS 75-44-5); 5. Cianogén-klorid (CAS 506-77-4); 6. Hidrogén-cianid (CAS 74-90-8); 7. Klórpikrin: Triklór-nitro-metán (CAS 76-06-2); 1. megjegyzés : "A Vegyifegyver-tilalmi Egyezményhez nem csatlakozó államokba" történő export esetében az 1C450 nem vonja ellenőrzés alá az olyan "kémiai elegyeket", amelyek egy vagy több vegyszert tartalmaznak az alábbi bekezdésekben meghatározottak közül: 1C450.a.1 és .a.2, és amelyekben egyik önállóan meghatározott vegyszer sem képvisel 1 tömegszázaléknál nagyobb arányt az elegyben. 2. megjegyzés : "A Vegyifegyver-tilalmi Egyezményhez csatlakozó államokba" történő kivitel esetében az 1C450 nem vonja ellenőrzés alá az olyan "kémiai elegyeket", amelyek egy vagy több vegyszert tartalmaznak az alábbi bekezdésekben meghatározottak közül: 1C450.a.1 és .a.2, és amelyekben egyik önállóan meghatározott vegyszer sem képvisel 30 tömegszázaléknál nagyobb arányt az elegyben. 3. megjegyzés : Az 1C450 nem vonja ellenőrzés alá az olyan "kémiai elegyeket", amelyek egy vagy több vegyszert tartalmaznak az alábbi bekezdésekben meghatározottak közül: 1C450.a.4, .a.5, .a.6 és .a.7, amelyekben egyik önállóan meghatározott vegyszer sem képvisel 30 tömegszázaléknál nagyobb arányt az elegyben. 4. megjegyzés : Az 1C450 nem vonja ellenőrzés alá a fogyasztási cikkeknek minősített, kiskereskedelmi csomagolásban kiszerelt személyes használatra szánt, vagy önálló használatra csomagolt termékeket.

b. Mérgező vegyületek prekurzorai, az alábbiak szerint: 1. A katonai célú termékek ellenőrzési jegyzékében és az 1C350 alatt meghatározottaktól eltérő olyan vegyületek, amelyek tartalmaznak egy olyan foszforatomot, amihez egy (normál- vagy izo-) metil-, etil- vagy propil- csoport kötődik, de további szénatomok nem Megjegyzés : Az 1C450.b.1. nem vonja ellenőrzés alá a Fonofoszt: O-etil-S-fenil-etil-ditiofoszfonát (CAS 944-22-9); 2. N,N-Dimetilamino-foszforsav-dikloridtól eltérő N,N-dialkil-(metil, etil, propil [normál- vagy izo-])-foszforamido-dihalidok; N.B. A N,N-Dimetilamino-foszforsav-diklorid vonatkozásában lásd az 1C350.57. pontot. 3. Az 1C350 alatt meghatározott dietil-N,N-dimetil-foszforamidáttól eltérő dialkil-(metil, etil vagy propil [normál- vagy izo-]) N,N-dialkil-(metil, etil vagy propil [normál- vagy izo-])-foszforamidátok 4. Az 1C350 alatt meghatározott N,N-di-izopropil-béta-amino-etil-kloridtól, vagy N,N-di-izopropil-béta-amino-etil-klorid-hidrokloridtól eltérő N,N-dialkil-(metil, etil vagy propil [normál- vagy izo-])-aminoetil-2-kloridok és a megfelelő protonált sók 5. Az 1C350 alatt meghatározott N,N-di-izopropil-béta-amino-etanoltól (CAS 96-80-0) és N,N-dietil-amino-etanoltól (CAS 100-37-8) eltérő N,N-dialkil-(metil, etil vagy propil [normál- vagy izo-])-amino-etán-2-olok és a megfelelő protonált sók; Megjegyzés : Az 1C450.b.5. nem vonja ellenőrzés alá az alábbiakat: a. N,N-dimetil-amino-etanol (CAS 108-01-0) és a kapcsolódó protonált sók; b. N,N-dietil-amino-etanol (CAS 100-37-8) protonált sói; 6. Az 1C350 alatt meghatározott N,N-di-izopropil-béta-amino-etán-tioltól (CAS 5842-07-9) és N,N-di-izopropil-amino-etán-tiol-hidrokloridtól (CAS 41480-75-5) eltérő N,N-dialkil-(metil, etil vagy propil [normál- vagy izo-])-amino-etán-2-tiolok és a megfelelő protonált sók; 7. Az etil-dietanol-amin tekintetében lásd: 1C350 (CAS 139-87-7); 8. Metil-dietanol-amin (CAS 105-59-9). 1. megjegyzés : "A Vegyifegyver-tilalmi Egyezményhez nem csatlakozó államokba" történő kivitel esetében az 1C450 nem vonja ellenőrzés alá az olyan "kémiai elegyeket", amelyek egy vagy több vegyszert tartalmaznak az alábbi bekezdésekben meghatározottak közül: 1C450.b.1, .b.2., .b.3., .b.4., .b.5. és .b.6., és amelyekben egyik önállóan meghatározott vegyszer sem képvisel 10 tömegszázaléknál nagyobb arányt az elegyben. 2. megjegyzés : "A Vegyifegyver-tilalmi Egyezményhez csatlakozó államokba" történő kivitel esetében az 1C450 nem vonja ellenőrzés alá az olyan "kémiai elegyeket", amelyek egy vagy több vegyszert tartalmaznak az alábbi bekezdésekben meghatározottak közül: 1C450.b.1, .b.2., .b.3., .b.4., .b.5. és .b.6., és amelyekben egyik önállóan meghatározott vegyszer sem képvisel 30 tömegszázaléknál nagyobb arányt az elegyben. 3. megjegyzés : Az 1C450 nem vonja ellenőrzés alá az olyan "kémiai elegyeket", amelyek egy vagy több vegyszert tartalmaznak az 1C450.b.8. bekezdésben meghatározottak közül, amelyekben egyik önállóan meghatározott vegyszer sem képvisel 30 tömegszázaléknál nagyobb arányt az elegyben. 4. megjegyzés : Az 1C450 nem vonja ellenőrzés alá a fogyasztási cikkeknek minősített, kiskereskedelmi csomagolásban kiszerelt személyes használatra szánt, vagy önálló használatra csomagolt termékeket.

1DSzoftver

1D001Kifejezetten az 1B001-1B003 alatt meghatározott berendezések "kifejlesztésére", "gyártására" és "felhasználására" tervezett vagy módosított "szoftver".

1D002A szerves "mátrix", fém "mátrix" vagy szén "mátrix" rétegelt anyagok vagy "kompozitok" "kifejlesztésére" szolgáló "szoftver".

1D003A kifejezetten az 1A004.c. vagy 1A004.d. pontban meghatározott berendezések funkcióinak elvégzésére tervezett vagy módosított "szoftver".

1D101Kifejezetten az 1B101, 1B102, 1B115, 1B117, 1B118 vagy 1B119 alatt meghatározott termékek "felhasználására" tervezett vagy módosított "szoftverek".

1D103Kifejezetten a csökkentett észlelhetőség - úgymint radarvisszaverő-képesség, ibolyántúli/infravörös és akusztikus jelek - elemzésére tervezett "szoftver".

1D201Kifejezetten az 1B201 alatt meghatározott termékek "felhasználására" tervezett "szoftver".

1ETechnológia

1E001Az általános technológiai megjegyzés szerinti "technológia" az 1A002-1A005, az 1A006.b., az 1A007, az 1B vagy az 1C alatt meghatározott berendezések vagy anyagok "kifejlesztésére" vagy "gyártására".

1E002Egyéb "technológia", az alábbiak szerint:

a. A polibenzo-tiazolok vagy polibenzo-oxazolok "kifejlesztésére" vagy "gyártására" szolgáló "technológia";

b. A legalább egy vinil-éter monomert tartalmazó fluoroelasztomer vegyületek "kifejlesztésére" vagy "gyártására" szolgáló "technológia";

c. A következő kerámiaporok vagy nem-"kompozit" kerámiaanyagok tervezésére vagy "gyártására" szolgáló "technológia": 1. A következő tulajdonságok mindegyikével rendelkező kerámiaporok: a. A következő összetételek bármelyike: 1. Egyszerű vagy komplex cirkónium-oxidok és szilícium vagy alumínium komplex oxidjai; 2. Egyszerű bór-nitridek (köbkristályos forma); 3. Egyszerű vagy komplex szilícium- vagy bór-karbidok; vagy 4. Egyszerű vagy komplex szilícium-nitridek; b. A fémes szennyezők összmennyisége (a szándékosan bevitt adalékanyagok kivételével) kevesebb, mint: 1. Kevesebb mint 1 000 ppm az egyszerű oxidoknál vagy karbidoknál; vagy 2. Kevesebb mint 5 000 ppm a komplex vegyületeknél vagy az egyszerű nitrideknél; és c. Az alábbiak bármelyike: 1. A cirkónium (CAS 1314-23-4) átlagos részecskemérete legfeljebb 1 μm és legfeljebb 10 %-ban fordulhatnak elő 5 μm-nél nagyobb részecskék; vagy 2. A többi kerámiapor átlagos részecskemérete legfeljebb 5 μm és legfeljebb 10 %-ban fordulhatnak elő 10 μm-nél nagyobb részecskék; 2. Az 1E002.c.1.-ben meghatározott anyagokból álló, nem-"kompozit" kerámiaanyagok; Megjegyzés : Az 1E002.c.2. pont nem vonja ellenőrzés alá a csiszolóanyagok tervezésére vagy gyártására szolgáló "technológiát".

d. Nem használt;

e. Az 1C001 alatt meghatározott anyagok beépítésére, karbantartására vagy javítására szolgáló "technológia";

f. Az 1A002 vagy az 1C007.c. alatt meghatározott "kompozit" szerkezetek, rétegek vagy anyagok javítására szolgáló "technológia". Megjegyzés : Az 1E002.f. nem vonja ellenőrzés alá a "polgári légi jármű" szerkezetek javításának azon "technológiáját", amely a repülőgépgyártók kézikönyvében feltüntetett szén-"rostos vagy szálas anyagokat" és epoxigyantát alkalmaz.

g. A kifejezetten az 1A004.c. vagy 1A004.d. pontban meghatározott berendezések funkcióinak elvégzésére tervezett vagy módosított "könyvtár".

1E101Az 1A102, 1B001, 1B101, 1B102, 1B115-1B119, 1C001, 1C101, 1C107, 1C111-1C118, 1D101, vagy 1D103 alatt meghatározott termékek "felhasználására" vonatkozó Általános technológiai megjegyzés szerinti "technológia".

1E102Az 1D001, 1D101 vagy 1D103 alatt meghatározott "szoftver" "kifejlesztésére" vonatkozó Általános technológiai megjegyzés szerinti "technológia".

1E103"Kompozitok", vagy részlegesen feldolgozott "kompozitok" "gyártásakor" az alkalmazott autoklávokban, vagy hidroklávokban levő hőmérséklet, nyomás és atmoszféra szabályozására szolgáló "technológia".

1E104Az 1 573 K (1 300 °C) és 3 173 K (2 900 °C) közötti hőmérséklet-tartományban, valamint a 130 Pa és 20 kPa közötti nyomástartományban elbomló prekurzor gázokból öntőformán, tüskén vagy más alaplemezen, pirolízis útján nyert származék anyagok "gyártásához" kapcsolódó "technológia".

Megjegyzés : Az 1E104 magában foglalja a prekurzor gázok összetételére, az áramlási sebességekre, valamint a folyamatszabályozás programjára és paramétereire vonatkozó "technológiát".

1E201Az 1A002, 1A007, 1A202, 1A225-1A227, 1B201, 1B225-1B235, 1C002.b.3. vagy b.4., 1C010.b., 1C202, 1C210, 1C216, 1C225-1C241 vagy 1D201 alatt meghatározott termékek "felhasználására" vonatkozó Általános technológiai megjegyzés szerinti "technológia".

1E202Az 1A007, 1A202 vagy 1A225-1A227 alatt meghatározott termékek "kifejlesztésére", vagy "gyártására" vonatkozó Általános technológiai megjegyzés szerinti "technológia".

1E203Az 1D201 alatt meghatározott "szoftver" "kifejlesztésére" vonatkozó Általános technológiai megjegyzés szerinti "technológia".

IV. RÉSZ

2. kategória

2. KATEGÓRIA - ANYAGFELDOLGOZÁS

2ABerendezések, részegységek és alkatrészek

N.B. A csendes futású csapágyak tekintetében lásd a katonai célú termékek ellenőrzési jegyzékét.

2A001Súrlódásmentes gördülőcsapágyak és csapágyrendszerek és alkatrészeik, az alábbiak szerint:

N.B. LÁSD MÉG: 2A101.

a. Golyóscsapágyak és görgőscsapágyak, amelyek tűrését a gyártó az ISO 492 szabvány 4. vagy 2. tűrési osztályába (vagy más nemzeti szabványokba) tartozónak vagy jobbnak minősítette és ‘gyűrűi', ‘görgői' monelből, vagy berilliumból készültek; Megjegyzés : 2A001.a. alpont nem vonja ellenőrzés alá a kúpgörgős csapágyakat. Műszaki megjegyzések : 1. ‘Gyűrű' - sugaras görgőcsapágyak gyűrűs része, amely egy vagy több futóhornyot foglal magában (ISO 5593:1997). 2. ‘Görgőscsapágyak' - golyók vagy görgők, amelyek futóhornyok között gurulnak (ISO 5593:1997).

b. Nem használt;

c. Az alábbiak bármelyikét felhasználó aktív mágneses csapágyrendszerek, valamint a kifejezetten ezek számára tervezett alkatrészek: 1. 2,0 T, vagy afeletti fluxussűrűségű és 414 MPa-t meghaladó folyáshatású anyagok; 2. Összelektromágneses 3D homopoláris előmágnesezésű konstrukciók működtető-szerkezetekhez; vagy 3. Magas hőmérsékletű (450K [177 °C] vagy afeletti) pozícióérzékelők.

2A101A 2A001. pontban meghatározottaktól eltérő golyóscsapágyak, amelyeknél az összes tűrés az ISO 492 szabvány 2. tűrési osztályába (vagy az ANSI/ABMA 20 szabvány ABEC-9 tűrési osztályába, vagy más nemzeti szabványokba) tartozó vagy jobb minősítést kapott, és amelyek az alábbi tulajdonságok mindegyikével rendelkeznek:

a. A belső gyűrűfurat 12 mm és 50 mm közötti átmérőjű;

b. A külső gyűrűfurat 25 mm és 100 mm közötti átmérőjű; és

c. Szélessége 10 mm és 20 mm közötti.

2A225Folyékony aktinoida fémeknek ellenálló anyagból készült olvasztótégelyek, az alábbiak szerint:

a. Olvasztótégelyek, amelyek rendelkeznek mindkét alábbi jellemzővel: 1. 150 cm3 és 8 000 cm3 közötti űrtartalom; és 2. A következő legfeljebb 2 tömegszázalékos teljes szennyeződéstartalmú anyagok bármelyikéből vagy azok kombinációjából készültek, illetve azzal vonták be őket: a. Kalcium-fluorid (CaF2); b. Kalcium-cirkonát (metacirkonát) (CaZrO3); c. Cérium-szulfid (Ce2S3); d. Erbium-oxid (erbia) (Er2O3); e. Hafnium-oxid (hafnia) (HfO2); f. Magnézium-oxid (MgO); g. Nitridált nióbium-titán-volfrám ötvözet (kb. 50 % Nb, 30 % Ti, 20 % W); h. Ittrium-oxid (ittria) (Y2O3); vagy i. Cirkónium-oxid (cirkónia) (ZrO2);

b. Olvasztótégelyek, amelyek rendelkeznek mindkét alábbi jellemzővel: 1. 50 cm3 és 2 000 cm3 közötti űrtartalom; és 2. 99,9 % vagy nagyobb tisztaságú tantálból készültek vagy azzal bélelték ki;

c. Olvasztótégelyek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. 50 cm3 és 2 000 cm3 közötti űrtartalom; 2. 98 % vagy nagyobb tisztaságú tantálból készültek vagy azzal bélelték ki; és 3. Tantál-karbiddal, -nitriddel vagy -boriddal vagy ezek bármilyen kombinációjával vonták be.

2A226Szelepek, amelyek rendelkeznek az alábbi jellemzők mindegyikével:

a. 5 mm vagy nagyobb ‘névleges méret';

b. Csőmembrános tömítésű; és

c. Teljes egészében alumíniumból, alumíniumötvözetekből, nikkelből, illetve 60 % vagy annál nagyobb nikkeltartalmú ötvözetekből készült, vagy ezekkel vonták be.

Műszaki megjegyzés :

A 2A226. pontban a ‘névleges méret' az eltérő kimeneti és bemeneti átmérőjű szelepek esetében a legkisebb átmérőre vonatkozik.

2BVizsgáló-, ellenőrző és gyártó berendezések

Műszaki megjegyzések :

1. A szekunder párhuzamos kontúrozó tengelyek (azaz a horizontális fúró-marómű w-tengelye, vagy a szekunder forgótengely, amelynek középvonala párhuzamos a primer forgótengellyel) nem számítanak bele a kontúrozó tengelyek összmennyiségébe. A forgótengelyeknek nem feltétlenül kell 360o-os szögben forogniuk. A forgótengely lineáris eszközzel (pl. csavarral vagy fogasléccel) is meghajtható.

2. A 2B. szakasz alkalmazásában a "kontúrvezérlésre" egyidejűleg koordinálható tengelyek száma azoknak a tengelyeknek a száma, amelyek mentén vagy amelyek körül a munkadarab előállítása során egyidejű vagy egymással összefüggő mozgások jönnek létre a munkadarab és a szerszám között. Nem tartoznak ide azok a kiegészítő tengelyek, amelyek mentén vagy amelyek körül a gépben megvalósuló egyéb relatív mozgások létrejönnek, mint például:

a. Korong-élező rendszerek köszörűgépekben;

b. Különálló munkadarabok összeszerelésére tervezett párhuzamos rotációs tengelyek;

c. A munkadarab különböző végeit egy tokmányba befogva ugyannak a munkadarabnak a manipulálására tervezett kolineáris rotációs tengelyek.

3. A tengely nómenklatúrája feleljen meg az ISO 841:2001, - Ipari automatizálási rendszerek és integráció - Számjegyvezérlésű gépek - Koordináta-rendszer és mozgásnómenklatúra nemzetközi szabványnak.

4. A 2B001-2B009. pont alkalmazásában a "billenő orsó" forgótengelynek számít;

5. Az egyedi teszt protokollok alternatívájaként a "garantált 'egyirányú pozicionálási ismételhetőség"' használható minden szerszámgépmodell esetében, az alábbiak szerint:

a. Egy modellből öt gépet ki kell választani értékelésre;

b. Az ISO 230-2:2014 szerint mérje meg a hossztengelyi visszaállási pontosságot (R↑,R↓), és értékelje mind az öt gép mindegyik tengelyének "egyirányú pozicionálási ismételhetőségét".

c. Határozza meg mind az öt gép minden tengelyén mért "egyirányú pozicionálási ismételhetőség" értékek számtani középértékét. Az "egyirányú pozicionálási ismételhetőség" ( ) értékeinek így kapott számtani középértékei lesznek a modell egyes tengelyeire vonatkozó garantált értékek ( , , ...);

d. Mivel a 2. kategória minden hossztengelyre utal, ezért annyi garantált "egyirányú pozicionálási ismételhetőségi" érték van, ahány hossztengely;

e. Ha a 2B001.a.-2B001.c. alpontban nem meghatározott szerszámgéptípus bármelyik tengelyének "garantált 'egyirányú pozicionálási ismételhetősége"' az egyes szerszámgépmodellek 0,7 μm-rel megnövelt, meghatározott "egyirányú pozicionálási ismételhetőségével" megegyezik vagy annál kisebb, a gyártónak a pontossági szintet tizennyolc havonta meg kell erősítenie.

6. A 2B001.a.-2B001.c. alpont alkalmazásában, az ISO 230-2:2014 vagy nemzetközi szabvány vagy azzal egyenértékű nemzeti szabvány szerint meghatározott, a szerszámgépek "egyirányú pozicionálási ismételhetőségére" vonatkozó mérési bizonytalanságot nem kell figyelembe venni.

7. A 2B001.a.-2B001.c. alpont alkalmazásában a tengelyek mérését az ISO 230-2:2014 5.3.2. pontjában leírt teszteljárásoknak megfelelően kell elvégezni. A 2 méternél hosszabb tengelyekre vonatkozó teszteket 2 m feletti szegmenseken kell végezni. A 4 méternél hosszabb tengelyek esetében több tesztre van szükség (pl. két teszt a 4 méternél hosszabb, de legfeljebb 8 méteres tengelyek esetében, három teszt a 8 méternél hosszabb, de legfeljebb 12 méteres tesztek esetében), minden esetben 2 méternél nagyobb szegmenseken, a tengely hosszán egyenlő távolságonként elosztva. A tesztszegmensek a teljes tengelyhossz mentén egyenlő távolságra helyezkednek el, a hossztöbbletet pedig szintén el kell osztani a tesztszegmensek elején, közepén és végén. Az összes tesztszegmens tekintetében mért legkisebb "egyirányú pozicionálási ismételhetőség" értéket kell jelenteni.

2B001Szerszámgépek és azok bármely kombinációja fémek, kerámiák, vagy "kompozitok" eltávolítására (vagy vágására), amelyek a gyártó műszaki specifikációja szerint "számjegyvezérlés" céljából elektronikus eszközökkel felszerelhetők, az alábbiak szerint:

N.B. LÁSD MÉG: 2B201.

1. megjegyzés : A 2B001. pont nem vonja ellenőrzés alá a kifejezetten fogaskerekek gyártására tervezett szerszámgépeket. Ilyen gépekhez lásd a 2B003. pontot.

2. megjegyzés : A 2B001. pont nem vonja ellenőrzés alá a kifejezetten az alábbiak bármelyikének gyártására tervezett szerszámgépeket:

a. Forgattyústengelyek vagy bütyköstengelyek;

b. Szerszámok vagy vágógépek;

c. Sajtoló csigák;

d. Vésett vagy csiszolt ékszerdarabok; vagy

e. Fogászati protézisek.

3. megjegyzés : Az olyan szerszámgépet, amely az eszterga-, maró- vagy köszörűgép funkciók közül legalább kettővel rendelkezik (pl.: maró funkcióval rendelkező esztergagép), az alkalmazandó 2B001.a., b. vagy c. alpont mindegyike alapján értékelni kell.

4. megjegyzés : Az olyan szerszámgépet, amely az eszterga-, maró- vagy köszörűgép funkciókon felül további additív gyártási funkcióval rendelkezik, az alkalmazandó 2B001.a., b. vagy c. alpont mindegyike alapján értékelni kell.

N.B. Az optikai megmunkálógépek tekintetében lásd a 2B002. pontot.

a. "Kontúrvezérlésre" egyidejűleg koordinálható kettő vagy több tengellyel rendelkező esztergagépek, amelyek rendelkeznek az alábbi jellemzők valamelyikével: 1. Az "egyirányú pozicionálási ismételhetőség" egy vagy több hossztengely mentén 0,9 μm-rel egyenlő vagy annál kisebb (jobb), 1,0 m-nél kisebb bejárási úthossz esetén; vagy 2. Az "egyirányú pozicionálási ismételhetőség" egy vagy több hossztengely mentén 1,1 μm-rel egyenlő vagy annál kisebb (jobb), legalább 1,0 m-es bejárási úthossz esetén; 1. megjegyzés : A 2B001.a. alpont nem vonja ellenőrzés alá a kifejezetten kontaktlencsék gyártására tervezett, az alábbi jellemzők mindegyikével rendelkező esztergagépeket: a. A gépkezelő kizárólag szemészeti alkalmazású szoftvert használ az adatbevitel programozására; és b. Nem használ vákuumos befogót. 2. megjegyzés : 2B001.a.alpontba nem tartoznak bele a hosszesztergálásra alkalmas/hosszirányban dolgozó rúdesztergák (Swissturn), amennyiben a legnagyobb rúdátmérő nem haladja meg a 42 mm-t, és tokmány felszerelésére nincs lehetőség. A gépek 42 mm-t nem meghaladó átmérőjű alkatrészek előállításához szükséges fúró-, illetve maróteljesítménnyel rendelkezhetnek.

b. Marógépek az alábbi jellemzők bármelyikével: 1. Három hossztengely, plusz egy forgótengely, amelyek egyidejűleg koordinálhatók "kontúrvezérlésre" és rendelkeznek a következők valamelyikével: a. Az "egyirányú pozicionálási ismételhetőség" egy vagy több hossztengely mentén 0,9 μm-rel egyenlő vagy annál kisebb (jobb), 1,0 m-nél kisebb bejárási úthossz esetén; vagy b. Az "egyirányú pozicionálási ismételhetőség" egy vagy több hossztengely mentén 1,1 μm-rel egyenlő vagy annál kisebb (jobb), legalább 1,0 m-es bejárási úthossz esetén; 2. Öt, vagy több tengely, amelyek egyidejűleg koordinálhatók "kontúrvezérlésre" és rendelkeznek az alábbi jellemzők bármelyikével: a. Az "egyirányú pozicionálási ismételhetőség" egy vagy több hossztengely mentén 0,9 μm-rel egyenlő vagy annál kisebb (jobb), 1,0 m-nél kisebb bejárási úthossz esetén; b. Az "egyirányú pozicionálási ismételhetőség" egy vagy több hossztengely mentén 1,4 μm-rel egyenlő vagy annál kisebb (jobb), 1 m-es vagy annál hosszabb, de 4 m-nél rövidebb bejárási úthossz esetén; vagy c. Az "egyirányú pozicionálási ismételhetőség" egy vagy több hossztengely mentén 6,0 μm-rel egyenlő vagy annál kisebb (jobb), 4 m-es vagy annál nagyobb bejárási úthossz esetén; 3. Koordináta fúrógépek esetében az "egyirányú pozicionálási ismételhetőség" egy vagy több hossztengely mentén 1,1 μm-rel egyenlő vagy annál kisebb (jobb); vagy 4. A következők mindegyikével rendelkező egyfogú marógépek: a. Az orsó "kiesése a beállításból" és "excentere" kisebb (jobb) mint 0,0004 mm TIR; és b. A csúszómozgás szögeltérése (oldalirányú kitérése, emelkedése és elfordulása) 300 mm-es úton kisebb (jobb) mint 2 ívmásodperc TIR;

c. Köszörűgépek, amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. Rendelkezik a következők mindegyikével: a. Az "egyirányú pozicionálási ismételhetőség" egy vagy több hossztengely mentén 1,1 μm-rel egyenlő vagy annál kisebb (jobb); és b. Három vagy négy tengely, amelyek egyidejűleg koordinálhatók "kontúrvezérlésre"; vagy 2. Öt, vagy több tengely, amelyek egyidejűleg koordinálhatók "kontúrvezérlésre" és rendelkeznek az alábbi jellemzők bármelyikével: a. Az "egyirányú pozicionálási ismételhetőség" egy vagy több hossztengely mentén 1,1 μm-rel egyenlő vagy annál kisebb (jobb), 1 m-nél kisebb bejárási úthossz esetén; b. Az "egyirányú pozicionálási ismételhetőség" egy vagy több hossztengely mentén 1,4 μm-rel egyenlő vagy annál kisebb (jobb), 1 m-es vagy annál hosszabb, de 4 m-nél rövidebb bejárási úthossz esetén; vagy c. Az "egyirányú pozicionálási ismételhetőség" egy vagy több hossztengely mentén 6,0 μm-rel egyenlő vagy annál kisebb (jobb), 4 m-es vagy annál nagyobb bejárási úthossz esetén; Megjegyzés : A 2B001.c. alpont nem vonja ellenőrzés alá a következő köszörűgépeket: a. Külső, belső és külső-belső palástköszörűgépek, amelyek rendelkeznek az alábbiak mindegyikével: 1. Kizárólag palástköszörülésre szolgálnak; és 2. A munkadarab maximális külső átmérője vagy hossza 150 mm. b. Kifejezetten koordinátaköszörűnek tervezett gépek, amelyek nem rendelkeznek Z-tengellyel vagy W-tengellyel, és "egyirányú pozicionálási ismételhetőségük" 1,1 μm-nél kisebb (jobb) c. Felületköszörűk.

d. Nem-vezetékes típusú villamos kisülésű gépek (EDM), amelyek két vagy több olyan forgótengellyel rendelkeznek, amelyek egyidejűleg koordinálhatók "kontúrvezérlésre".

e. Fémek, kerámiák, vagy "kompozitok" eltávolítására szolgáló szerszámgépek, amelyek rendelkeznek a következő tulajdonságok mindegyikével: 1. Az anyageltávolítás a következő módszerek bármelyikével történik: a. Víz, vagy egyéb folyadéksugarak, beleértve a koptatóanyagot alkalmazókat is; b. Elektronsugár; vagy c. "Lézer"-sugár; és 2. Legalább két forgótengely, amelyek az alábbi jellemzők mindegyikével rendelkeznek: a. Egyidejűleg koordinálhatók "kontúrvezérlésre"; és b. 0,003 o-nál kisebb (jobb) pozicionálási "pontosság";

f. Mélylyukfúrógépek és a mélylyukfúrásra módosított esztergagépek 5 m-t meghaladó lyukmélység kapacitással.

2B002Számjegyvezérlésű, nem gömbölyű optikai felület kialakítása céljából szelektív anyagleválasztásra alkalmas, az alábbi tulajdonságok mindegyikével rendelkező optikai megmunkálógépek:

a. A forma 1,0 μm-nél vékonyabb (jobb) megmunkálása;

b. 100 nm négyzetes középértéknél (rms) kisebb (jobb) egyenetlenségű megmunkálás.

c. Legalább négy, "kontúrvezérlés" céljából egyidejűleg koordinálható tengely; és

d. Működése során az alábbi eljárások valamelyikét alkalmazza: 1. magnetoreológiai megmunkálás (‘MRF'); 2. elektroreológiai megmunkálás (‘ERF'); 3. ‘energia részecske sugaras felület megmunkálás'; 4. ‘rugalmas membrán-eszközös megmunkálás'; vagy 5. ‘folyadéksugaras megmunkálás',

Műszaki megjegyzések :

A 2B002. pont alkalmazásában:

1. Az ‘MRF' olyan anyagleválasztó eljárás, amelynek során olyan abrazív mágneses folyadékot használnak, amelynek viszkozitását mágneses mező vezérli.

2. Az ‘ERF' olyan anyagleválasztó eljárás, amelynek során olyan abrazív folyadékot használnak, amelynek viszkozitását elektromos mező vezérli.

3. Az ‘energia részecske sugaras felület megmunkálás' reaktív atomplazmát (RAP) vagy ionsugarakat használ fel szelektív anyagleválasztás céljára.

4. A ‘rugalmas membrán-eszközös megmunkálás' olyan eljárás, amelynek során a nyomás alatt álló membrán oly módon deformálódik, hogy kis területen érintkezzen a munkadarabbal.

5. A ‘folyadéksugaras megmunkálás' folyadéksugarat használ anyagleválasztás céljára.

2B003"Számjegyvezérlésű" szerszámgépek, amelyeket kifejezetten edzett (Rc=40 vagy nagyobb) homlokfogaskerekek, ferde fogazású és kettős ferde fogazású fogaskerekek marására, megmunkálására, köszörülésére vagy hónolására terveztek, és amelyek rendelkeznek az alábbi jellemzők mindegyikével:

a. a fogosztás átmérője meghaladja az 1 250 mm-t;

b. a homlokszélesség az osztásátmérő 15 %-a vagy annál nagyobb; és

c. az AGMA 14-nél jobb minőségűre kikészített (ami az ISO 1328 3. osztályának felel meg).

2B004"Izosztatikus melegsajtolók" és a kifejezetten ezekhez tervezett tartozékok, amelyek rendelkeznek a következők mindegyikével:

N.B. LÁSD MÉG: 2B104 ÉS 2B204.

a. A zárt térben, szabályozott hőmérsékletű környezetben működő, és 406 mm vagy annál nagyobb belső átmérőjű kamrával rendelkező berendezések; és

b. Rendelkeznek az alábbiak bármelyikével: 1. 207 MPa-t meghaladó maximális üzemi nyomás; 2. 1 773 K (1 500 °C) fölötti ellenőrzött hőmérsékleti környezet; vagy 3. A szénhidrogénes impregnálásra és a keletkező gáznemű bomlástermékek eltávolítására szolgáló berendezések.

Műszaki megjegyzés :

A belső kamra mérete annak a kamrának a mérete, amelyben mind az üzemi hőmérséklet, mind az üzemi nyomás elérhető, és nem foglalja magában a rögzítőelemeket. Ez a méret a nyomáskamra belső átmérője vagy a szigetelt kemence belső átmérője közül a kisebbnek a mérete lesz, attól függően, hogy a két kamra közül melyik helyezkedik el a másikban.

N.B. A külön tervezett sajtolótömbökkel, formákkal és szabályozókkal kapcsolatban lásd az 1B003 és 9B009 pontot, valamint a katonai célú termékek ellenőrzési jegyzékét.

2B005A 2E003.f. alpontot követő táblázat 1. oszlopában meghatározott folyamatok révén, kifejezetten szervetlen borításoknak, bevonatoknak és felületmódosításoknak a 2. oszlopban meghatározott alaplemezekre történő felvitelére, megmunkálására és folyamat közbeni ellenőrzésére tervezett berendezések, és a kifejezetten ezekhez tervezett automatizált kezelő, pozicionáló, manipuláló és ellenőrző alkatrészek, ideértve a következőket:

a. Kémiai gőzfázisú leválasztó (CVD) gyártó berendezések, amelyek rendelkeznek a következő jellemzők mindegyikével: N.B. LÁSD MÉG: 2B105. 1. A következők egyike céljából módosított folyamat: a. Pulzáló CVD; b. Ellenőrzött magformálásos termikus bontás (CNTD); vagy c. Plazmadúsításos vagy plazmasegítéses CVD; és 2. Rendelkeznek az alábbi jellemzők bármelyikével: a. Nagyvákuumú (egyenlő vagy kisebb, mint 0,01 Pa) forgó tömítést tartalmaznak; vagy b. In situ bevonatvastagság-ellenőrzést alkalmaz;

b. Ionimplantációs gyártó berendezés, amelynek sugárárama 5 mA, vagy nagyobb;

c. Elektronsugaras fizikai gőzleválasztásos (EB-PVD) gyártó berendezés 80 kW feletti névleges táprendszerrel, amely rendelkezik az alábbi jellemzők bármelyikével: 1. "Lézeres" folyadékszint-ellenőrző berendezés, amely pontosan szabályozza a tömbelőtolási sebességet; vagy 2. Számítógéppel szabályozott sebesség-ellenőrző rendszer, amely a két vagy több elemet tartalmazó bevonat leválasztási sebességének szabályozására az elgőzölögtetett áramban lévő ionizált atomok fotolumineszcenciájának elvét alkalmazza;

d. Plazmaszórásos gyártó berendezés, amely rendelkezik az alábbi jellemzők bármelyikével: 1. Ellenőrzött, csökkentett nyomású atmoszférában működik (a fúvóka belépőnyílásában és 300 mm-rel fölötte mérve ez 10 kPa vagy annál kevesebb), olyan vákuumkamrában, amely képes 0,01 Pa alatti légritkítás elérésére a szórási folyamatot megelőzően; vagy 2. In situ bevonatvastagság-ellenőrzést alkalmaz;

e. Katódporlasztásos gyártó berendezés, amely 15 μm/óra, vagy nagyobb rétegépülési sebességnél képes 0,1 mA/mm2 vagy nagyobb áramsűrűség létesítésére;

f. Katódív-depozíciós gyártó berendezés, amely tartalmazza a katódon lévő ív helyzetének szabályozására szolgáló elektromágnesek rácsát;

g. Ionbevonat-készítő berendezés, amely alkalmas a következők bármelyikének in situ mérésére: 1. Bevonatvastagság a szubsztrátumon és a sebesség szabályozása; vagy 2. Optikai jellemzők;

Megjegyzés : A 2B005. pont nem vonja ellenőrzés alá a kifejezetten a vágó, vagy szerszámgépekhez tervezett kémiai gőzfázisú, katódív- és katódporlasztásos, valamint ionbevonat-készítő és ionbeültető berendezéseket.

2B006Méretvizsgáló vagy mérőrendszerek, berendezések, helyzetvisszajelző egységek és "elektronikus részegységek", az alábbiak szerint:

a. Számítógép-vezérlésű, vagy "számjegyvezérlésű" koordinált mérőgépek (CMM), amelyek ISO 10360-2:2009 szerint ellenőrzött háromdimenziós (térfogati) maximális megengedhető hosszmérési hibája (E0,MPE) a gép működési tartományának (azaz a tengelyek hosszán belüli) bármely pontján egyenlő vagy kisebb (jobb) mint (1,7 + L/1 000) μm (L a mért hossz mm-ben); Műszaki megjegyzés : A CMM-nek a gyártó által meghatározott legpontosabb beállítása (pl. az alábbiak mindegyikéből a legjobb: érzékelő, a tű hosszúsága, mozgási paraméterek, környezet), valamint az "összes rendelkezésre álló kompenzáció" melletti E0,MPE-t az 1,7 + L/1 000-es határértékkel kell összevetni. N.B. LÁSD MÉG: 2B206.

b. ‘Lineáris elmozdulást' mérő eszközök vagy berendezések, lineáris helyzetvisszajelző egységek és "elektronikus részegységek", az alábbiak szerint: Megjegyzés : A "lézert" tartalmazó interferométerből és optikai kódolóból álló elmozdulásmérő rendszereket csak a 2B006.b.3 és 2B206.c. pont határozza meg. 1. ‘Nem érintkező típusú mérési rendszerek', amelyek ‘felbontóképessége' 0,2 μm vagy annál kisebb (jobb) legfeljebb 0-0,2 mm ‘mérési tartományban'; Műszaki megjegyzések : A 2B006.b.1. pont alkalmazásában: 1. a ‘nem érintkező típusú mérési rendszereket' arra tervezték, hogy egyetlen vektor mentén mérje az érzékelő és a mért tárgy közötti távolságot úgy, hogy az érzékelő és a mért tárgy is mozgásban van. 2. ‘mérési tartomány' a minimális és maximális működési távolság közötti távolság. 2. Kifejezetten szerszámgépekhez tervezett lineáris helyzetvisszajelző egységek, melyek általános "pontossága" kisebb (jobb), mint (800 + (600 × L/1 000)) nm ("L" a mm-ben mért tényleges hosszúság); 3. Mérőrendszerek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: a. "Lézert" tartalmaznak; b. A ‘felbontóképesség' a teljes skálán 0,200 nm vagy annál kisebb (jobb); valamint c. A levegő törésmutatójának kompenzálása esetén és 30 másodperces mérési időtartam alatt 20± 0,01 °C hőmérsékleten (1,6 + L/2 000) μm vagy annál kisebb (jobb) "mérési bizonytalanság" elérésre képes ("L" a mm-ben mért hosszúság) a mérési tartomány bármely pontján; vagy 4. A 2B006.b.3. pontban meghatározott rendszerekben kifejezetten a visszacsatolási képesség biztosítására kialakított "elektronikus részegységek". Műszaki megjegyzés : A 2B006.b pont alkalmazásában a ‘felbontóképesség' a mérőeszköz legkisebb növekménye; digitális műszereken a legkisebb szignifikáns bit.

c. Kifejezetten szerszémgépekhez tervezett forgatási helyzetvisszajelző egységek vagy szögeltérést mérő eszközök, melyek szögpozíció meghatározási "pontossága" 0,9 ívmásodperc vagy annaál kisebb (jobb); Megjegyzés : A 2B006.c. alpont nem vonja ellenőrzés alá az olyan optikai eszközöket, mint például az autokollimátorok, amelyek párhuzamosított fényt ("lézert") használnak a tükör szögeltérésének érzékelésére.

d. A felületi egyenetlenség (ideértve a felületi hibákat is) mérésére szolgáló berendezés, amely az optikai szórást 0,5 nm vagy annál kisebb (jobb) érzékenységgel méri. Megjegyzés : A 2B006. pont a 2B001. pontban meghatározottaktól eltérő azon szerszámgépekre is kiterjed, amelyek mérőberendezésként is felhasználhatók, feltéve hogy megfelelnek a mérőberendezés funkcióval szemben támasztott követelményeknek, vagy azokat meghaladják.

2B007"Robotok" és a kifejezetten ezekhez tervezett vezérlő- és "működtető egységek", amelyek rendelkeznek az alábbi jellemzők bármelyikével::

N.B. LÁSD MÉG: 2B207.

a. Nem használt;

b. Kifejezetten a potenciális robbanóanyagok környezetében történő felhasználásra alkalmazandó nemzeti biztonsági szabványoknak megfelelően tervezték; Megjegyzés : A 2B007 b. alpont nem vonja ellenőrzés alá a kifejezetten a festékszóró kamrákba tervezett "robotokat".

c. Sugárzással szemben ellenállóvá tervezték és méretezték, annak érdekében, hogy a működés romlása nélkül ellenálljon 5 × 103 Gy (szilícium), vagy annál nagyobb sugárzásnak; vagy Műszaki megjegyzés : A Gy (szilícium) mértékegység árnyékolatlan szilícium minta Joule per kilogrammban megadott energiaelnyelésére vonatkozik, ha azt ionizáló sugárzásnak teszik ki.

d. Kifejezetten 30 000 m-t meghaladó magasságokban történő üzemelésre tervezték.

2B008Kifejezetten szerszámgépekhez tervezett ‘kompozit forgóasztal' és "billenő orsó" a következők szerint:

a. Nem használt;

b. Nem használt;

c. ‘Kompozit forgóasztal', amely az alábbi jellemzők mindegyikével rendelkezik: 1. Esztergáló, maró, vagy köszörülő szerszámgépekhez tervezték; és 2. Két tengelye egyidejűleg koordinálható "kontúrvezérlés" céljából; Műszaki megjegyzés : A ‘kompozit forgóasztal' olyan asztal, melyen a megmunkált darab két nem párhuzamos tengely mentén forgatható és dönthető

d. "Billenő orsók", amelyek rendelkeznek a következő jellemzők mindegyikével: 1. Esztergáló, maró, vagy köszörülő szerszámgépekhez tervezték; és 2. Egyidejűleg koordinálhatók "kontúrvezérlés" céljából.

2B009Centrifugális és megfolyatásos elven működő formázógépek, amelyek a gyártó műszaki specifikációi szerint felszerelhetők "számjegyvezérlő" egységgel, vagy számítógép vezérléssel, és rendelkeznek az alábbi összes jellemzővel:

N.B. LÁSD MÉG: 2B109 ÉS 2B209.

a. Három vagy több tengely, amelyek egyidejűleg koordinálhatók "kontúrvezérlésre"; és

b. A görgőerő több, mint 60 kN.

Műszaki megjegyzés :

A 2B009. pont alkalmazásában a centrifugális és a megfolyatásos formázás funkcióját kombináló gépeket megfolyatásos formázógépeknek kell tekinteni.

2B104A 2B004. pont alatt szabályozottaktól eltérő "izosztatikus prések", amelyek rendelkeznek az alábbi jellemzők mindegyikével:

N.B. LÁSD MÉG: 2B204.

a. 69 MPa vagy annál nagyobb maximális üzemi nyomás;

b. 873 K (600 °C) vagy annál magasabb szabályozott hőmérsékletű környezet létrehozására és fenntartására tervezték; és

c. 254 mm, vagy azt meghaladó belső átmérőjű kamraüreggel rendelkeznek.

2B105Szén-szén kompozitok tömörítésére tervezett vagy módosított, a 2B005.a. alpont alatt meghatározottaktól eltérő kémiai gőzfázisú leválasztó CVD kemencék.

2B109A 2B009. pont alatt meghatározottaktól eltérő, megfolyatásos elven működő formázógépek, melyeket "rakéták" meghajtó alkatrészeinek és berendezéseinek (pl. motorházak és közbülső fokozatok) "gyártásában" alkalmazhatók, és a kifejezetten azokhoz tervezett alkatrészek, az alábbiak szerint:

N.B. LÁSD MÉG: 2B209.

a. Megfolyatásos elven működő formázógépek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. A gyártó műszaki specifikációja alapján felszereltek vagy felszerelhetők "számjegyvezérlő" egységgel, vagy számítógépes vezérléssel; és 2. Több mint két tengellyel rendelkeznek, amelyek egyidejűleg koordinálhatók "kontúrvezérlésre".

b. Kifejezetten a 2B009. pont vagy 2B109.a. alpont alatt meghatározott megfolyatásos elven működő formázógépekhez tervezett alkatrészek.

Műszaki megjegyzés :

A centrifugális és a megfolyatásos formázás funkcióját kombináló gépeket a 2B109. pont alkalmazásában megfolyatásos formázógépeknek kell tekinteni.

2B116Rázóvizsgálati rendszerek, berendezések és azok alkatrészei, az alábbiak szerint:

a. Digitális szabályozóval rendelkező, visszacsatolást, vagy zárthurkú technikát alkalmazó rázóvizsgálati rendszerek, amelyek képesek valamely rendszert 10 g rms-nek megfelelő vagy azt meghaladó effektív gyorsulással a 20 Hz és 2 kHz közötti teljes tartományban rázni, míg ‘csupasz asztalon' mérve képesek 50 kN-nak megfelelő vagy azt meghaladó erő közlésére;

b. A 2B116.a. alpont alatt meghatározott rázóvizsgálati rendszerekkel történő felhasználásra tervezett digitális szabályozók, a kifejezetten az 5 kHz-et meghaladó ‘valós idejű szabályozási sávszélességre' tervezett rázóvizsgálati szoftverekkel. Műszaki megjegyzés : A 2B116.b. alpontban szereplő ‘valós idejű szabályozási sávszélesség' azt a maximális sebességet jelenti, amellyel a szabályozó mintavételezés, adatfeldolgozás és vezérlőjel-továbbítás teljes ciklusait képes végrehajtani.

c. A 2B116.a. alpont alatt meghatározott rázóvizsgálati rendszerekben használható rázóberendezések (rázóegységek) kapcsolódó erősítővel vagy anélkül, amelyek ‘csupasz asztalon' mérve képesek 50 kN-nak megfelelő vagy azt meghaladó erő közlésére;

d. A 2B116.a. alpont alatt meghatározott rázóvizsgálati rendszerekben használható teszt darab tartószerkezetek és elektronikus egységek, amelyeket arra terveztek, hogy a többszörös rázóegységeket olyan rendszerben kombinálják, amely ‘csupasz asztalon' mérve képes 50 kN-nak megfelelő vagy azt meghaladó effektív kombinált erő közlésére.

Műszaki megjegyzés :

A 2B116. pont alkalmazásában a ‘csupasz asztal' tartozékok, vagy rögzítők nélküli sima asztalt vagy felületet jelent.

2B117A 2B004., 2B005.a., 2B104. vagy 2B105. pont alatt meghatározottaktól eltérő berendezés- és folyamatszabályzók, amelyeket szerkezeti kompozit rakéta fúvókák és visszatérő egységek orrcsúcsainak tömörítésére és pirolízisére terveztek vagy módosítottak.

2B119Kiegyensúlyozó gépek és kapcsolódó berendezések, az alábbiak szerint:

N.B. LÁSD MÉG: 2B219.

a. Kiegyensúlyozó gépek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. Nem képesek 3 kg-nál nagyobb tömegű rotorok/szerelvények kiegyensúlyozására; 2. Képesek 12 500 ford./percnél nagyobb fordulatszámon rotorokat/szerelvényeket kiegyensúlyozni; 3. Képesek a kiegyensúlyozatlanságot két vagy több síkban kijavítani; és 4. Képesek a rotort annak tömegére vonatkoztatott 0,2 g mm/kg mértékű fajlagos megmaradó kiegyensúlyozatlansági hibáig kiegyensúlyozni; Megjegyzés : A 2B119.a. alpont nem vonja ellenőrzés alá a fogorvosi vagy egyéb gyógyászati berendezésekhez tervezett vagy módosított kiegyensúlyozó gépeket.

b. A 2B119.a. alpont alatt meghatározott gépek használtára tervezett vagy módosított kijelzőfejek. Műszaki megjegyzés : A kijelzőfejeket sokszor kiegyensúlyozó műszerként ismerik.

2B120Mozgásszimulátorok vagy forgóasztalok, amelyek rendelkeznek az alábbi jellemzők mindegyikével:

a. Két vagy több tengely;

b. Elektromos táplálás vagy információs jelek vagy mindkettő továbbítására képes csúszógyűrűk vagy integrált érintésmentes eszközök beillesztésére tervezeték vagy alakították át őket; és

c. Rendelkeznek az alábbi jellemzők bármelyikével: 1. Bármelyik tengelye: a. Képes 400 fok/s vagy nagyobb sebességre, illetve 30 fok/s vagy kisebb sebességre; és b. A sebességfelbontás kisebb, mint 6 fok/s, és a pontosság 0,6 fok/s vagy kevesebb; 2. A legrosszabb eset szerinti sebességstabilitás, 10 fok vagy annál nagyobb alatti átlagban egyenlő vagy jobb (kisebb), mint plusz vagy mínusz 0,05 %; vagy 3. A pozicionálási "pontosság" 5 ívmásodperc vagy annál kevesebb (jobb).

1. megjegyzés : A 2B120. pont nem vonja ellenőrzés alá a szerszámgépekhez vagy gyógyászati berendezésekhez tervezett vagy módosított forgóasztalokat. A szerszámgépek forgóasztalai tekintetében lásd: 2B008. pont.

2. megjegyzés : A 2B120. pontban meghatározott mozgásszimulátorok vagy forgóasztalok továbbra is ellenőrzés alatt maradnak, függetlenül attól, hogy a kivitel idején van-e rögzítve hozzájuk csúszógyűrű vagy integrált érintésmentes eszköz vagy sem.

2B121A 2B120. pont alatt meghatározottaktól eltérő pozícionáló asztalok (olyan berendezések, amelyek bármely tengely mentén képesek precíz fogatási pozícionálásra), amelyek rendelkeznek az alábbi jellemzők mindegyikével:

a. Két vagy több tengely; és

b. A pozicionálási "pontosság" 5 ívmásodperc vagy annál kevesebb (jobb).

Megjegyzés : A 2B121. pont nem vonja ellenőrzés alá a szerszámgépekhez vagy gyógyászati berendezésekhez tervezett vagy módosított forgóasztalokat. A szerszámgépek forgóasztalai tekintetében lásd: 2B008. pont.

2B122Centrifugák, amelyek 100 g feletti gyorsítást képesek átadni, és amelyeket elektromos táplálás vagy információs jelek vagy mindkettő továbbítására képes csúszógyűrűk vagy integrált érintésmentes eszközök beillesztésére tervezetek vagy alakítottak át.

Megjegyzés : A 2B122. pontban meghatározott centrifugák továbbra is ellenőrzés alatt maradnak, függetlenül attól, hogy az export idején van-e rögzítve hozzájuk csúszógyűrű vagy integrált érintésmentes eszköz vagy sem.

2B201Fémek, kerámiák, vagy "kompozitok" eltávolítására vagy vágására szolgáló, a 2B001. pont alatt meghatározottaktól eltérő szerszámgépek és azok bármely kombinációja, amelyek a gyártó műszaki specifikációja szerint elektronikus eszközökkel szerelhetők fel a két, vagy több tengelyen, egyidejűleg történő "kontúrvezérlés" céljából, az alábbiak szerint:

Műszaki megjegyzés :

Az egyéni géptesztek helyett minden szerszámgépmodell esetében fel lehet használni a garantált pozicionálási pontosság ISO 230-2:1988 ( 9 )vagy azzal egyenértékű nemzeti szabványok szerint végzett mérésekből, az alábbi eljárások alapján kapott szintjeit, amennyiben azokat a nemzeti hatóságok rendelkezésére bocsátják és azok elfogadják. A garantált pozicionálási pontosság meghatározása: A garantált pozicionálási pontosság meghatározása:

a. Egy modellből öt gépet ki kell választani értékelésre;

b. Meg kell mérni a lineáristengely-pontosságot az ISO 230-2:1988curacies according to ISO 230-2:1988 (9) szerint;

c. Mindegyik gép, mindegyik tengelyére meg kell határozni a pontosságot (A). A pontossági érték kiszámításának módszerét az ISO 230-2:1988 (9) szabvány ismerteti;

d. Mindegyik tengelyre meg kell határozni az átlagos pontosságot. Ezek az átlagértékek lesznek az adott típus egyes tengelyekre vonatkozó garantált pozicionálási pontosságai (Âx Ây...);

e. Mivel a 2B201. pont minden hossztengelyre utal, ezért annyi garantált pozicionálási pontosság van, ahány hossztengely;

f. Ha a 2B201.a., 2B201.b. vagy 2B201.c. alpont alatt nem meghatározott szerszámgép bármelyik tengelyének garantált pozicionálási pontossága köszörűgépek esetén 6 μm vagy jobb (kevesebb), maró- és forgácsológépek esetén pedig 8 μm vagy jobb (kevesebb), mindkettő az ISO 230-2:1988 (9) szerint, a gyártónak a pontossági szintet tizennyolc havonta meg kell erősítenie.

a. Marógépek, amelyek rendelkeznek a következő jellemzők bármelyikével: 1. Az ISO 230-2:1988 (9) vagy az annak megfelelő nemzeti szabvány szerint mért pozicionálási pontosság bármely lineáris tengely mentén az "összes rendelkezésre álló kompenzációval" kisebb (jobb), mint 6 μm; 2. Két vagy annál több forgó kontúrtengely; vagy 3. Öt vagy annál több tengely, amelyek egyidejűleg koordinálhatók "kontúrvezérlésre"; Megjegyzés : A 2B201.a. alpont nem vonja ellenőrzés alá a következő jellemzőkkel rendelkező marógépeket: a. Az X-tengely lökethossza meghaladja a 2 m-t; és b. A teljes pozicionálási pontosság az X-tengelyen nagyobb (rosszabb), mint 30 μm.

b. Köszörűgépek, amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. Az ISO 230-2:1988 (9) vagy az annak megfelelő nemzeti szabvány szerint mért pozicionálási pontosság bármely lineáris tengely mentén az "összes rendelkezésre álló kompenzációval" kisebb (jobb), mint 4 μm; 2. Két vagy annál több forgó kontúrtengely; vagy 3. Öt vagy annál több tengely, amelyek egyidejűleg koordinálhatók "kontúrvezérlésre"; Megjegyzés : A 2B201.b. alpont nem vonja ellenőrzés alá a következő köszörűgépeket: a. Külső, belső és külső-belső palástköszörűgépek, amelyek rendelkeznek a következő jellemzők mindegyikével: 1. 150 mm maximális külső átmérőjű, vagy hosszúságú munkadarab előállítására korlátozottak; és 2. x, z és c tengelyre korlátozottak; b. Z vagy w tengellyel nem rendelkező koordináta köszörűk, az ISO 230-2:1988 (9) vagy az annak megfelelő nemzeti szabvány szerint 4 μm-nél kisebb (jobb) pozícionálási pontossággal.

c. 35 mm-nél nagyobb átmérő megmunkálására alkalmas olyan esztergagépek, amelyek ISO 230-2:1988 (9) vagy az annak megfelelő nemzeti szabvány szerint mért pozicionálási pontossága az "összes rendelkezésre álló kompenzációval" bármely hossztengely mentén jobb (kisebb), mint 6 μm; Megjegyzés : 2B201.c.alpontba nem tartoznak bele a hosszesztergálásra alkalmas/hosszirányban dolgozó rúdesztergák (Swissturn), amennyiben a legnagyobb rúdátmérő nem haladja meg a 42 mm-t, és tokmány felszerelésére nincs lehetőség. A gépek 42 mm-t nem meghaladó átmérőjű alkatrészek előállításához szükséges fúró-, illetve maróteljesítménnyel rendelkezhetnek.

1. megjegyzés : A 2B201. pont nem vonja ellenőrzés alá azokat a különleges szerszámgépeket, amelyek kifejezetten az alábbi alkatrészek előállítására szolgálnak:

a. Fogaskerekek;

b. Forgattyústengelyek vagy bütyköstengelyek;

c. Szerszámok vagy vágógépek;

d. Sajtoló csigák.

2. megjegyzés : Az olyan szerszámgépet, amely az eszterga-, maró- vagy köszörűgép funkciók közül legalább kettővel rendelkezik (pl.: maró funkcióval rendelkező esztergagép), az alkalmazandó 2B201.a., b. vagy c. pont mindegyike alapján értékelni kell.

3. megjegyzés : A 2B201.a.3. és a 2B201.b.3. pont azokat a (párhuzamos és lineáris) kinematikus tervezésű gépeket (pl. a hexapodokat) is magában foglalja, amelyek 5 vagy több olyan tengellyel rendelkeznek, melyek egyike sem forgótengely.

2B204A 2B004. vagy a 2B104. pont alatt meghatározottaktól eltérő "izosztatikus prések" és kapcsolódó berendezések, az alábbiak szerint:

a. "Izosztatikus prések", amelyek rendelkeznek az alábbi mindkét jellemzővel: 1. Képesek 69 MPa vagy annál nagyobb maximális üzemi nyomás elérésére; és 2. Kamraterük belső átmérője meghaladja a 152 mm-t;

b. Kifejezetten a 2B204.a. alpont alatt meghatározott "izosztatikus sajtókhoz" tervezett sajtolótömbök, formák és szabályozók.

Műszaki megjegyzés :

A 2B204. pont alkalmazásában a belső kamra mérete annak a kamrának a mérete, amelyben mind az üzemi hőmérséklet, mind az üzemi nyomás elérhető, és nem foglal magában rögzítőelemeket. Ez a méret a nyomáskamra belső átmérője vagy a szigetelt kemence belső átmérője közül a kisebbnek a mérete lesz, attól függően, hogy a két kamra közül melyik helyezkedik el a másikban.

2B206A 2B006. pont alatt meghatározottaktól eltérő méretellenőrző gépek, műszerek vagy rendszerek, az alábbiak szerint:

a. Számítógép-, vagy számjegy-vezérlésű koordinált mérőgépek (CMM), amelyek rendelkeznek az alábbi jellemzők egyikével: 1. Csak két tengellyel rendelkeznek és az ISO 10360-2:2009 szerint az E0x,MPE, E0y,MPE, vagy E0z,MPE bármelyikének kombinációjaként azonosított (egydimenziós) tengely mentén végzett hosszmérés legnagyobb megengedett mérési bizonytalansága a gép működési tartományának bármely pontján (azaz a tengely teljes hosszán) egyenlő, vagy kisebb (jobb), mint (1,25 + L/1 000) μm (L a mért hossz mm-ben); vagy 2. Három vagy több tengellyel rendelkezik, és az ISO 10360-2:2009 szerint ellenőrzött háromdimenziós (térfogati) maximális megengedhető hosszmérési hibája (E0,MPE) a gép működési tartományának (azaz a tengelyek hosszán belüli) bármely pontján egyenlő vagy kisebb (jobb) mint (1,7 + L/800) μm (L a mért hossz mm-ben); Műszaki megjegyzés : A CMM-nek a gyártó által az ISO 10360-2:2009 szerint meghatározott legpontosabb beállítása (pl. az alábbiak mindegyikéből a legjobb: érzékelő, a tű hosszúsága, mozgási paraméterek, környezet), valamint az összes rendelkezésre álló kompenzáció melletti E0,MPE-t az 1,7 + L/800 μm-es határértékkel kell összevetni.

b. Féltengelyek egyidejű lineáris-szög ellenőrzésére szolgáló rendszerek, amelyek rendelkeznek mindkét alábbi jellemzővel: 1. A "mérési bizonytalanság" bármely lineáris tengely mentén egyenlő, vagy kisebb (jobb), mint 3,5 μm/5 mm; és 2. 0,02 o, vagy az alatti "szögeltérés";

c. ‘Lineáris elmozdulást' mérő rendszerek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: Műszaki megjegyzés : A 2B206.c. alpont alkalmazásában a ‘lineáris elmozdulás' a mérőszonda és a mért tárgy közötti távolság változását jelenti. 1. "Lézert" tartalmaznak; és 2. ± 1 K (± 1 °C) hőmérséklet-tartományban, szabványos hőmérséklet és nyomás mellett legalább 12 órán át az alábbiak mindegyikét képesek megtartani: a. a 0,1 μm-es vagy annál jobb ‘felbontóképességet' a teljes mérési skálájukon; valamint Műszaki megjegyzés : A 2B206.c.2.a. alpont alkalmazásában a ‘felbontóképesség' a mérőeszköz legkisebb növekménye; digitális műszereken a legkisebb szignifikáns bit. b. (0,2 + L/2 000) μm vagy annál jobb (kisebb) "mérési bizonytalanság" elérésre képes ("L" a mm-ben mért hosszúság). Megjegyzés : A 2B206.c. alpont nem vonja ellenőrzés alá az olyan - zárt- vagy nyílthurkú visszacsatolásos technikák nélküli - interferométer mérőrendszereket, amelyek a szerszámgépek, méretellenőrző gépek vagy egyéb berendezések elcsúszási hibájának mérésére "lézert" alkalmaznak.

d. Lineáris változódifferenciáló transzformátor-rendszerek (LVDT), amelyek rendelkeznek mindkét alábbi jellemzővel: Műszaki megjegyzés : A 2B206.d. alpont alkalmazásában a ‘lineáris elmozdulás' a mérőszonda és a mért tárgy közötti távolság változását jelenti. 1. Rendelkeznek az alábbi jellemzők bármelyikével: a. 0,1 % vagy annál kisebb (jobb) "linearitás", amelyet a legfeljebb ± 5 mm teljes működési tartománnyal rendelkező LVDT-k esetében 0-tól a teljes működési tartományig mérnek; vagy b. 0,1 %-os vagy annál kisebb (jobb) "linearitás", amelyet az 5 mm-nél nagyobb teljes működési tartománnyal rendelkező LVDT-k esetében 0-tól 5 mm-ig mérnek; és 2. Szabványos környezeti vizsgálati hőmérsékleten ± 1 K (± 1 °C) 0,1 %/nap vagy annál jobb (kisebb) drift.

1. megjegyzés : A mérőberendezésként is felhasználható szerszámgépek akkor esnek ellenőrzés alá, ha megfelelnek a szerszámgép funkcióval, vagy a mérőberendezés funkcióval szemben támasztott követelményeknek vagy meghaladják azokat.

2. megjegyzés : A 2B206. pont alatt leírt gép ellenőrzés alá tartozónak minősül, ha működési tartományában bárhol átlépi az ellenőrzési küszöböt.

Műszaki megjegyzések :

A 2B206. pont szerinti összes mérési értékparamétert plusz/mínusz értékként kell kezelni, azaz nem teljes sávként.

2B207A 2B007. pont alatt meghatározottaktól eltérő "robotok", "működtető egységek" és vezérlőegységek, az alábbiak szerint:

a. "Robotok" vagy "működtető egységek", amelyeket kifejezetten úgy terveztek, hogy megfeleljenek a nagy erejű robbanóanyagok kezelésével kapcsolatos nemzeti biztonsági szabványoknak (például megfelelnek a nagy erejű robbanóanyagokra vonatkozó villamos szabvány besorolásnak);

b. Kifejezetten a 2B207.a. alpont alatt meghatározott "robotok" vagy "végeffektorok" részére tervezett vezérlőegységek.

2B209A 2B009. vagy a 2B109. pont alatt meghatározottaktól eltérő, megfolyatásos alakítási funkciókra képes megfolyatásos vagy centrifugális formázógépek és gömbölyítőhengeres gépek, az alábbiak szerint:

a. Gépek, amelyek rendelkeznek mindkét alábbi jellemzővel: 1. Három vagy annál több görgő (aktív, vagy vezető); és 2. A gyártó műszaki specifikációja alapján felszerelhetők "számjegyvezérlő" egységgel, vagy számítógépes vezérléssel;

b. 75 és 400 mm közötti belső átmérőjű hengeres rotorok készítésére tervezett rotoralakító gömbölyítőhengeres gépek.

Megjegyzés : A 2B209.a. alpont magában foglalja azokat a gépeket, amelyeknek csak egy, fém deformálására szolgáló görgővel plusz két olyan kiegészítő görgővel rendelkeznek, amely a gömbölyítőhengert megtámasztja, de a deformálási eljárásban közvetlenül nem vesz részt.

2B219Centrifugális többsíkú kiegyensúlyozó, állandó telepítésű vagy mozgatható, vízszintes vagy függőleges elrendezésű gépek, az alábbiak szerint:

a. Centrifugális kiegyensúlyozó gépek, amelyeket legalább 600 mm hosszú flexibilis rotorok kiegyensúlyozására terveztek, és rendelkeznek az alábbi jellemzők mindegyikével: 1. 75 mm-nél nagyobb henger- vagy csapátmérő; 2. 0,9 és 23 kg közötti teherbírás; és 3. 5 000 fordulat/percnél nagyobb forgási sebességnél is képes kiegyensúlyozásra;

b. Centrifugális kiegyensúlyozó gépek, amelyeket üreges hengeres rotor alkatrészek kiegyensúlyozására terveztek, és rendelkeznek az alábbi jellemzők mindegyikével: 1. 75 mm-nél nagyobb csapátmérő; 2. 0,9 és 23 kg közötti teherbírás; 3. Képes síkonként 10 g × mm/kg vagy kisebb maradék kiegyensúlyozatlansági hibáig kiegyensúlyozni; és 4. Szíjhajtásos típusú.

2B225Távirányítású manipulátorok, amelyek alkalmasak radiokémiai elválasztási műveletekben és forró kamrákban végzett távirányítású tevékenységre, az alábbiak szerint:

a. Képesek benyúlni 0,6 m-re vagy mélyebbre a kamrába (falon keresztüli művelet); vagy

b. Képesek átnyúlni 0,6 m vagy annál vastagabb kamrafalú forró kamrába a tetőn keresztül (át a fal felett művelet).

Műszaki megjegyzés :

A távmanipulátorok az emberi műveletet viszik át egy távoli karra és végszerelvényre. Ezek lehetnek ‘mester/szolga' típusúak, és működhetnek botkormánnyal vagy billentyűzettel.

2B226A 9B001. és a 3B001. pont alatt meghatározottaktól eltérő, ellenőrzött környezetű (vákuum vagy inert gáz) indukciós kemencék és azok tápegységei, ideértve a következőket:

N.B. LÁSD MÉG: 3B001 ÉS 9B001.

a. Kemencék, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. Alkalmasak 1 123 K (850 °C) feletti üzemelésre; 2. 600 mm vagy annál kisebb átmérőjű indukciós tekerccsel rendelkeznek; és 3. Bemeneti teljesítményük 5 kW, vagy annál nagyobb; Megjegyzés : A 2B226.a. alpont nem vonja ellenőrzés alá a félvezető szeletek feldolgozására tervezett kemencéket.

b. Kifejezetten a 2B226.a. alpont alatt meghatározott kemencékhez tervezett tápegységek, amelyek meghatározott teljesítmény kimenete 5 kW vagy több.

2B227Vákuum és szabályozott atmoszférájú fémkohászati olvasztó- és öntőkemencék és kapcsolódó berendezések, az alábbiak szerint:

a. Ívújraolvasztó kemencék, ívolvasztó kemencék és olvasztó-öntőkemencék, amelyek rendelkeznek mindkét alábbi jellemzővel: 1. 1 000 cm3 és 20 000 cm3 közötti felhasználható elektródakapacitás; és 2. Alkalmasak 1 973 K (1 700 °C) olvasztási hőmérséklet feletti üzemelésre;

b. Elektronsugaras olvasztókemencék, valamint plazmaatomizáló-kemencék és planzmaolvasztó-kemencék, amelyek rendelkeznek mindkét alábbi jellemzővel: 1. 50 kW vagy annál nagyobb teljesítmény; és 2. Alkalmasak 1 473 K (1 200 °C) olvasztási hőmérséklet feletti üzemelésre;

c. Számítógépes vezérlő és megfigyelő rendszerek, amelyeket kifejezetten a 2B227.a. vagy 2B227.b. alpont alatt meghatározott kemencékhez konfiguráltak.

d. Kifejezetten a 2B227.b. alpont alatt meghatározott kemencékhez tervezett plazmafáklyák, amelyek rendelkezek mindkét alábbi jellemzővel: 1. 50 kW-ot meghaladó teljesítménnyel működnek; és 2. Alkalmasak 1 473 K (1 200 °C) hőmérséklet feletti üzemelésre;

e. 50 kW-ot meghaladó teljesítménnyel működő, kifejezetten a 2B227.b. alpontban meghatározott kemencékhez tervezett elektronsugár-ágyúk.

2B228Rotorgyártó és szerelő berendezések, rotoregyengető berendezések, csőrugó kialakító tüskék és alaknyomók, az alábbiak szerint:

a. Rotorszerelő berendezés, gázcentrifuga rotorcső darabok, terelőlapok és zárósapkák összeállításához; Megjegyzés : A 2B228.a. alpont precíziós tüskéket, szorítóbilincseket és zsugorító illesztőgépeket foglal magában.

b. Rotoregyengető berendezések a gázcentrifuga rotorcsöveinek közös tengelyre történő beállításához. Műszaki megjegyzés : A 2B228.b. alpont alatt meghatározott berendezések általában olyan precíziós mérőszondákat tartalmaznak, amelyek egy olyan számítógéphez vannak csatlakoztatva, amely ellenőrzi pl. a rotorcső darabok beállításához használt pneumatikus nyomófejek tevékenységét.

c. Csőrugó-kialakító tüskék és alaknyomók, egymenetű csőrugók gyártásához. Műszaki megjegyzés : A 2B228.c. alpont alkalmazásában a csőrugó rendelkezik a következő jellemzők mindegyikével: 1. 75 mm és 400 mm közötti belső átmérő; 2. 12,7 mm, vagy nagyobb hosszúság; 3. 2 mm-nél nagyobb bordamélység; és 4. nagy szilárdságú alumíniumötvözetekből, martenzites acélból, vagy nagy szilárdságú "szálas vagy rostos anyagból" készült.

2B230Mindenféle ‘nyomás távadó', amely képes az abszolút nyomás mérésére, és rendelkezik az alábbi összes jellemzővel:

a. Alumíniumból, alumíniumötvözetből, alumínium-oxidból (timföld vagy zafír), nikkelből, legalább 60 tömegszázalékban nikkelt tartalmazó nikkelötvözetből vagy teljesen fluorozott szénhidrogén-polimerekből készült vagy ilyen anyagokkal védett nyomásérzékelő elemek;

b. Alumíniumból, alumíniumötvözetből, alumínium-oxidból (timföld vagy zafír), nikkelből, legalább 60 tömegszázalékban nikkelt tartalmazó nikkelötvözetből vagy teljesen fluorozott szénhidrogén-polimerekből készült vagy ilyen anyagokkal védett, a nyomásérzékelő elem lezárásához elengedhetetlen, és a folyamatmédiummal közvetlen érintkező szigetelések, amennyiben van ilyen; és

c. Rendelkeznek az alábbi jellemzők valamelyikével: 1. 13 kPa alatti teljes mérési skála, és a teljes skálára vetítve + 1 %-nál jobb ‘pontosság'; vagy 2. 13 kPa vagy afeletti teljes mérési skála, és 13 kPa-on való mérésnél 130 Pa-nál nagyobb ‘pontosság'.

Műszaki megjegyzések :

1. A 2B230. pont alatt szereplő ‘nyomásátalakító transzduktor' olyan eszköz, amely a nyomásértéket jellé alakítja át.

2. A 2B230. pont alkalmazásában a ‘pontosság' magában foglalja a nem-linearitást, a hiszterézist és a környezeti hőmérsékleten való ismételhetőséget.

2B231Vákuumszivattyúk, amelyek rendelkeznek az alábbi jellemzők mindegyikével:

a. 380 mm vagy nagyobb bemeneti csonk méret;

b. 15 m3/s vagy nagyobb szívási kapacitás; és

c. Képes 13 mPa-nál jobb végső vákuumot létrehozni.

Műszaki megjegyzések :

1. A szivattyúzási sebességet a mérési pontnál, nitrogéngázzal vagy levegővel kell meghatározni.

2. A végső vákuumot a szivattyú bemeneténél a bemeneti csonkot elzárva kell meghatározni.

2B232Nagy sebességű ágyúrendszerek (hajtóanyag, gáz, tekercses, elektromágneses, elektrotermikus vagy más fejlett rendszerek), amelyek képesek a lövedéket 1,5 km/s vagy nagyobb sebességre gyorsítani.

N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

2B233Csőmembrános tömítésű csigakompresszor és csőmembrános tömítésű vákuumos csigaszivattyúk, amelyek rendelkeznek a következő tulajdonságok mindegyikével:

N.B. LÁSD MÉG: 2B350.i.

a. Képesek 50 m3/h vagy nagyobb bemeneti térfogatáramra;

b. Képesek 2:1 vagy nagyobb nyomásarányra; és

c. A folyamatgázzal kapcsolatba kerülő valamennyi felületük az alábbi anyagok valamelyikéből készült: 1. Alumínium vagy alumíniumötvözet; 2. Alumínium-oxid; 3. Rozsdamentes acél; 4. Nikkel vagy nikkelötvözet; 5. Foszforbronz; vagy 6. Fluort tartalmazó polimerek.

2B350Vegyipari gyártó létesítmények, berendezések és alkatrészek, az alábbiak szerint:

a. 0,1 m3-nél (100 l) nagyobb, de 20 m3-nél (20 000 l) kisebb teljes belső (geometrikus) térfogatú, keverővel ellátott, vagy keverő nélküli reaktoredények vagy reaktorok, ahol a feldolgozott vagy a jelen levő vegyszerrel (vegyszerekkel) közvetlenül érintkező valamennyi felület az alábbi anyagok bármelyikéből készült: N.B. A javításhoz előregyártott szerelvények tekintetében lásd a 2B350.k. alpontot. 1. 25 tömegszázaléknál több nikkelt és 20 tömegszázaléknál több krómot tartalmazó ‘ötvözetek'; 2. Fluort tartalmazó polimerek (35 tömegszázaléknál több fluort tartalmazó polimerikus vagy elasztomerikus anyagok); 3. Üveg (beleértve a vitrit vagy zománc bevonatot vagy az üvegbélést); 4. Nikkel vagy 40 tömegszázaléknál több nikkelt tartalmazó ‘ötvözetek'; 5. Tantál vagy tantál'ötvözetek'; 6. Titán vagy titán'ötvözetek'; 7. Cirkónium, vagy cirkónium'ötvözetek'; vagy 8. Nióbium (kolumbium) vagy nióbium-‘ötvözetek';

b. A 2B350.a. alatt meghatározott reaktoredényekben, vagy reaktorokban használatos keverők; továbbá a kifejezetten ilyen keverőkhöz tervezett keverőlapátok, lapátok vagy tengelyek ahol a keverőnek a bevitt, vagy a feldolgozott vegyszerrel (vegyszerekkel) érintkező valamennyi felülete az alábbi anyagok bármelyikéből készült: 1. 25 tömegszázaléknál több nikkelt és 20 tömegszázaléknál több krómot tartalmazó ‘ötvözetek'; 2. Fluort tartalmazó polimerek (35 tömegszázaléknál több fluort tartalmazó polimerikus vagy elasztomerikus anyagok); 3. Üveg (beleértve a vitrit, vagy zománcozott bevonatot, vagy az üvegbevonatot); 4. Nikkel vagy 40 tömegszázaléknál több nikkelt tartalmazó ‘ötvözetek'; 5. Tantál vagy tantál'ötvözetek'; 6. Titán vagy titán'ötvözetek'; 7. Cirkónium, vagy cirkónium'ötvözetek'; vagy 8. Nióbium (kolumbium) vagy nióbium-‘ötvözetek';

c. 0,1 m3-nél (100 liter) nagyobb teljes belső (geometrikus) térfogatú tárolótartályok, konténerek és gyűjtőtartályok, ahol a feldolgozott vagy a jelen levő vegyszerrel (vegyszerekkel) közvetlenül érintkező valamennyi felület az alábbi anyagok bármelyikéből készült: N.B. A javításhoz előregyártott szerelvények tekintetében lásd a 2B350.k. alpontot. 1. 25 tömegszázaléknál több nikkelt és 20 tömegszázaléknál több krómot tartalmazó ‘ötvözetek'; 2. Fluort tartalmazó polimerek (35 tömegszázaléknál több fluort tartalmazó polimerikus vagy elasztomerikus anyagok); 3. Üveg (beleértve a vitrit, vagy zománcozott bevonatot, vagy az üvegbevonatot); 4. Nikkel vagy 40 tömegszázaléknál több nikkelt tartalmazó ‘ötvözetek'; 5. Tantál vagy tantál'ötvözetek'; 6. Titán vagy titán'ötvözetek'; 7. Cirkónium, vagy cirkónium'ötvözetek'; vagy 8. Nióbium (kolumbium) vagy nióbium-‘ötvözetek';

d. 0,15 m2-nél nagyobb, de 20 m2-nél kisebb hőátadó felülettel rendelkező hőcserélők vagy kondenzátorok; továbbá az ilyen hőcserélőkhöz vagy kondenzátorokhoz tervezett csövek, lemezek, tekercsek vagy blokkok (magok), ahol a feldolgozott vegyszerrel (vegyszerekkel) közvetlenül érintkező valamennyi felület az alábbi anyagok bármelyikéből készült: 1. 25 tömegszázaléknál több nikkelt és 20 tömegszázaléknál több krómot tartalmazó ‘ötvözetek'; 2. Fluort tartalmazó polimerek (35 tömegszázaléknál több fluort tartalmazó polimerikus vagy elasztomerikus anyagok); 3. Üveg (beleértve a vitrit, vagy zománcozott bevonatot, vagy az üvegbevonatot); 4. Grafit vagy ‘szén-grafit'; 5. Nikkel vagy 40 tömegszázaléknál több nikkelt tartalmazó ‘ötvözetek'; 6. Tantál vagy tantál'ötvözetek'; 7. Titán vagy titán'ötvözetek'; 8. Cirkónium, vagy cirkónium'ötvözetek'; 9. Szilíciumkarbid; 10. Titánkarbid; vagy 11. Nióbium (kolumbium) vagy nióbium-‘ötvözetek';

e. 0,1 m-nél nagyobb belső átmérőjű desztilláló, vagy abszorpciós oszlopok; továbbá az ilyen desztilláló vagy abszorpciós oszlopokhoz tervezett folyadékelosztók, gőzelosztók vagy folyadékgyűjtők, ahol a feldolgozott vegyszerrel (vegyszerekkel) közvetlenül érintkező valamennyi felület az alábbi anyagok bármelyikéből készült: 1. 25 tömegszázaléknál több nikkelt és 20 tömegszázaléknál több krómot tartalmazó ‘ötvözetek'; 2. Fluort tartalmazó polimerek (35 tömegszázaléknál több fluort tartalmazó polimerikus vagy elasztomerikus anyagok); 3. Üveg (beleértve a vitrit, vagy zománcozott bevonatot, vagy az üvegbevonatot); 4. Grafit vagy ‘szén-grafit'; 5. Nikkel vagy 40 tömegszázaléknál több nikkelt tartalmazó ‘ötvözetek'; 6. Tantál vagy tantál'ötvözetek'; 7. Titán vagy titán'ötvözetek'; 8. Cirkónium, vagy cirkónium'ötvözetek'; vagy 9. Nióbium (kolumbium) vagy nióbium-‘ötvözetek';

f. Távirányított töltőberendezések, amelyeknek valamennyi, a feldolgozott vegyszerrel (vegyszerekkel) közvetlenül érintkező felülete az alábbi anyagok bármelyikéből készült: 1. 25 tömegszázaléknál több nikkelt és 20 tömegszázaléknál több krómot tartalmazó ‘ötvözetek'; vagy 2. Nikkel vagy 40 tömegszázaléknál több nikkelt tartalmazó ‘ötvözetek';

g. Szelepek és alkatrészek, ideértve a következőket: 1. Szelepek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: a. DN 10-nél vagy NPS 3/8-nál nagyobb ‘névleges méretű'; és b. Az előállítandó, a feldolgozandó vagy a jelen levő vegyszerrel (vegyszerekkel) közvetlenül érintkező valamennyi felület ‘korrózióálló anyagból' készült; 2. A 2B350.g.1. pont alatt meghatározottaktól eltérő szelepek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: a. Legalább DN 25 vagy NPS 1 és legfeljebb DN 100 vagy NPS 4 ‘névleges méret'; b. Házak (szelepházak) vagy előformázott szelepbetétek; c. Cserélhetőnek tervezett záróelem; és d. A házaknak (szelepházak) vagy előformázott szelepbetéteknek az előállítandó, a feldolgozandó vagy a jelen levő vegyszerrel (vegyszerekkel) közvetlenül érintkező valamennyi felülete ‘korrózióálló anyagból' készült; 3. A 2B350.g.1. vagy 2B350.g.2. pontban meghatározott szelepekhez tervezett alkatrészek, amelyekben az előállított, a feldolgozott vagy a jelen levő vegyszerrel (vegyszerekkel) közvetlenül érintkező valamennyi felület ‘korrózióálló anyagból' készült, az alábbiak szerint: a. Házak (szelepházak); b. Előformázott szelepbetétek: Műszaki megjegyzések : 1. A 2B350.g. alpont alkalmazásában, ‘korrózióálló anyag': az alábbi anyagok egyike: a. Nikkel vagy 40 tömegszázaléknál több nikkelt tartalmazó ‘ötvözetek'; b. Tömegük szerint 25 %-nál több nikkelt és 20 %-nál több krómot tartalmazó ötvözetek; c. Fluort tartalmazó polimerek (35 tömegszázaléknál több fluort tartalmazó polimerikus vagy elasztomerikus anyagok); d. Üveg vagy üvegbélés (beleértve a vitrit, vagy zománc bevonatot); e. Tantál vagy tantál'ötvözet'; f. Titán vagy titán'ötvözetek'; g. Cirkónium, vagy cirkónium'ötvözetek'; h. Nióbium (kolumbium) vagy nióbium-‘ötvözetek'; vagy i. Kerámiaanyagok, az alábbiak szerint: 1. Legalább 80 tömegszázalék tisztaságú szilícium-karbid; 2. Legalább 99,9 tömegszázalék tisztaságú alumínium-oxid (timföld); 3. Cirkónium-oxid (cirkónia). 2. A ‘névleges méret' a legkisebb bemeneti és kimeneti átmérőre vonatkozik. 3. A szelepek névleges méretei (DN) megfelelnek az ISO 6708:1995 szabványnak. A névleges csőméretek (NPS) megfelelnek az ASME B36.10 vagy B36.19 vagy annak megfelelő nemzeti szabványnak.

h. Többszörös falú csövek szivárgásdetektáló egységgel, ahol a feldolgozott, vagy bennük levő vegyszerrel (vegyszerekkel) közvetlenül érintkező valamennyi felület az alábbi anyagok bármelyikéből készült: 1. 25 tömegszázaléknál több nikkelt és 20 tömegszázaléknál több krómot tartalmazó ‘ötvözetek'; 2. Fluort tartalmazó polimerek (35 tömegszázaléknál több fluort tartalmazó polimerikus vagy elasztomerikus anyagok); 3. Üveg (beleértve a vitrit, vagy zománcozott bevonatot, vagy az üvegbevonatot); 4. Grafit vagy ‘szén-grafit'; 5. Nikkel vagy 40 tömegszázaléknál több nikkelt tartalmazó ‘ötvözetek'; 6. Tantál vagy tantál'ötvözetek'; 7. Titán vagy titán'ötvözetek'; 8. Cirkónium, vagy cirkónium'ötvözetek'; vagy 9. Nióbium (kolumbium) vagy nióbium-‘ötvözetek';

i. A 2B233. pontban meghatározottaktól eltérő többszörös szigetelésű szivattyúk és szigetelés nélküli szivattyúk, amelyeknél a gyártó által meghatározott maximális térfogatáram nagyobb, mint 0,6 m3/h, vagy vákuumszivattyúk, amelyeknél a gyártó által meghatározott legnagyobb térfogatáram nagyobb, mint 5 m3/h (normál körülmények [273 K (0 °C) hőmérséklet és 101,3 kPa nyomás] között), továbbá az ilyen szivattyúkhoz tervezett házak (szivattyúházak), előformált szivattyúbélések, keverőlapátok, rotorok vagy sugárszivattyú fúvókák, amelyekben a feldolgozott vegyszerrel (vegyszerekkel) közvetlenül érintkező valamennyi felület a következő anyagok bármelyikéből készült: 1. 25 tömegszázaléknál több nikkelt és 20 tömegszázaléknál több krómot tartalmazó ‘ötvözetek'; 2. Kerámiák; 3. Ferroszilícium (magas szilíciumtartalmú szilícium-vas ötvözetek);; 4. Fluort tartalmazó polimerek (35 tömegszázaléknál több fluort tartalmazó polimerikus vagy elasztomerikus anyagok); 5. Üveg (beleértve a vitrit, vagy zománcozott bevonatot, vagy az üvegbevonatot); 6. Grafit vagy ‘szén-grafit'; 7. Nikkel vagy 40 tömegszázaléknál több nikkelt tartalmazó ‘ötvözetek'; 8. Tantál vagy tantál'ötvözetek'; 9. Titán vagy titán'ötvözetek'; 10. Cirkónium, vagy cirkónium'ötvözetek'; vagy 11. Nióbium (kolumbium) vagy nióbium-‘ötvözetek'; Műszaki megjegyzés : A 2B350.i. alpontban szereplő "szigetelés" kifejezés csak azokra a szigetelésekre vonatkozik, amelyek közvetlenül érintkeznek a feldolgozás alatt álló vegyi anyagokkal (vagy azokkal közvetlen érintkezésre tervezték őket), valamint olyan konstrukció szigetelését biztosítják, ahol a forgó- vagy dugattyús tengely áthalad a szivattyútesten.

j. Az 1C350. pont alatt meghatározott vegyi anyagok megsemmisítésére tervezett, különleges hulladékbetápláló rendszerrel és kezelő-berendezésekkel ellátott hulladékégetők, amelyeknél az égetőkamra átlagos hőmérséklete meghaladja az 1 273 K-t (1 000 °C), és amelyekben a betápláló rendszernek a hulladékkal közvetlenül érintkező valamennyi felülete az alábbi anyagok bármelyikéből készült, vagy azok bármelyikével vonták be: 1. 25 tömegszázaléknál több nikkelt és 20 tömegszázaléknál több krómot tartalmazó ‘ötvözetek'; 2. Kerámiák; vagy 3. Nikkel vagy 40 tömegszázaléknál több nikkelt tartalmazó ‘ötvözetek';

k. Javításhoz előregyártott szerelvények, amelyeknek a vegyszerrel (vegyszerekkel) közvetlenül érintkező valamennyi fém felülete tantálból vagy a következő tantálötvözetekből készült, és amelyek külön erre a célra tervezett alkatrészekkel rendelkeznek: 1. A 2B350.a. alpontban meghatározott üvegbélésű reaktoredényekhez vagy reaktorokhoz történő mechanikus csatlakoztatásra tervezték; vagy 2. A 2B350.c. alpontban meghatározott üvegbélésű tárolótartályokhoz, konténerekhez vagy gyűjtőtartályokhoz történő mechanikus csatlakoztatásra tervezték.

Megjegyzés : A 2B350. pont alkalmazásában, a tömítések, töltőanyagok, szigetelések, csavarok, alátétek vagy más szigetelő funkciót betöltő anyagokhoz használt anyagok nem határozzák meg az ellenőrzés állását, amennyiben az ilyen alkatrészeket cserélhetőnek tervezték.

Műszaki megjegyzések :

1. A ‘szén-grafit' amorf szén és grafit olyan keveréke, amelynek a grafittartalma legalább 8 tömegszázalék.

2. A fenti bekezdésekben felsorolt anyagok esetében az ‘ötvözet' kifejezés, amennyiben nincs feltüntetve mellette konkrét elemi koncentráció, olyan ötvözetekre vonatkozik, amelyek a mellettük feltüntetett fémet nagyobb tömegszázalékban tartalmazzák, mint bármely más elemet.

2B351Toxikus gázoknak az 1A004. pontban meghatározottaktól eltérő jelzői és megfigyelőrendszerei és az ezekhez való detektoregységek, az alábbiak szerint, továbbá azok detektorai, szenzorai és cserélhető szenzorbetétei:

a. Folyamatos üzemre tervezték és alkalmasak az 1C350. pont alatt meghatározott vegyszerek vagy vegyi fegyver anyagok kimutatására, 0,3 mg/m3-nél kisebb koncentrációnál; vagy

b. Kolinészteráz-gátló hatás detektálására tervezték.

2B352Biológiai ágenseket előállító és kezelő berendezések, az alábbiak szerint:

a. Biztonságos létesítmények és kapcsolódó berendezések, az alábbiak szerint: 1. A WHO Laboratory Biosafety kézikönyve (3. kiadás, Genf, 2004) szerint meghatározott P3 vagy P4 (BL3, BL4, L3, L4) biztonsági szint kritériumainak megfelelő teljesen biztonságos létesítmények. 2. A 2B352.a. alpontban meghatározott biztonságos létesítmények rögzített berendezéseihez tervezett felszerelés az alábbiak szerint: a. Kétoldalt nyitható fertőtlenítő autokláv; b. Levegőellátásos védőruházat fertőtlenítésére szolgáló zuhany; c. Légmentesen záródó ajtók mechanikus vagy felfúvódó tömítéssel;

b. Fermentorok és alkatrészek, ideértve a következőket: 1. Az aeroszol szaporítása nélkül a "mikroorganizmusok", vírusok tenyésztésére vagy toxintermelésre képes fermentorok 20 l vagy afeletti belső össztérfogattal; 2. A 2B352.b.1. pontban meghatározott fermentorokhoz tervezett alkatrészek az alábbiak szerint: a. In situ sterilizálásra vagy fertőtlenítésre tervezett tenyésztőkamrák; b. Tenyésztőkamrát tartó eszközök; c. Olyan folyamatvezérlő egységek, amelyek képesek a fermentációs rendszer két vagy több paraméterének (pl. hőmérséklet, pH, tápanyagtartalom, erjesztőkád keverése, oldott oxigén mennyisége, levegőáram, habzásellenőrzés) egyidejű figyelemmel kísérésére és ellenőrzésére; Műszaki megjegyzések : 1. A 2B352.b. alpont alkalmazásában, a fermentorok közé tartoznak a bioreaktorok, egyszer használatos (eldobható) bioreaktorok, a kemosztátok és a folyamatos áramú rendszerek is. 2. A 2B352.b. alpont alkalmazásában, a tenyésztőkamrát tartó eszközök közé tartoznak a merev falú, egyszer használatos tenyésztőkamrák.

c. Centrifugális szeparátorok, amelyek aeroszolok terjedése nélkül képesek folyamatos elválasztásra és rendelkeznek az alábbi jellemzők mindegyikével: 1. 100 l/h-nál nagyobb térfogatáram; 2. Polírozott rozsdamentes acélból vagy titánból készült alkatrészek; 3. A gőzt tartalmazó területen belüli egy vagy több szigetelő csatlakozás; és 4. Zárt állapotban képesek in-situ gőzsterilizálásra; Műszaki megjegyzés : A centrifugális szeparátorok magukban foglalják a dekantereket is.

d. A következő keresztáramú szűrőberendezések és alkatrészek: 1. Keresztáramú szűrőberendezések, amelyek képesek "mikroorganizmusok", vírusok, toxinok és sejtkultúrák elválasztására, és amelyek rendelkeznek valamennyi alábbi jellemzővel: a. 1 m2 vagy annál nagyobb teljes szűrőfelület; és b. Rendelkeznek az alábbi jellemzők bármelyikével: 1. lehetséges azok in situ "sterilizálása" vagy "fertőtlenítése"; vagy 2. eldobható vagy egyszer használatos alkatrészeket használnak; Műszaki megjegyzés : A 2B352.d.1.b. pontban a sterilizálás a berendezésben található összes életképes mikroba eltávolítását jelenti fizikai (pl. gőz) vagy kémiai úton. A "fertőtlenítés" azt a folyamatot jelenti, amelynek célja a mikroorganizmusok - de általában nem a baktériumspórák - számának kémiai anyagok használatával történő csökkentése, anélkül, hogy szükségszerűen elpusztítanák vagy eltávolítanák az összes organizmust. Megjegyzés : A 2B352.d. alpont nem vonja ellenőrzés alá - a gyártó minősítése szerint - fordított ozmózis és hemodialízis elvén működő berendezést. 2. A keresztáramú szűrőberendezések alkatrészei (pl. modulok, elemek, kazetták, szűrőbetétek, egységek és lemezek), amelyek szűrőfelülete egyenként 0,2 m2 vagy annál nagyobb, és a 2B352.d. alpontban meghatározott keresztáramú szűrőberendezések használatához terveztek.

e. Gőzzel, gázzal vagy párával sterilizálható fagyasztva szárító berendezések, amelyek kondenzáló kapacitása legalább 10 kg jég/nap és kisebb, mint 1 000 kg jég/nap;

f. Védő és izoláló berendezések, az alábbiak szerint: 1. Független levegőellátású fél, vagy egész védőöltözékek, vagy hozzákapcsolt külső levegőellátástól függő és pozitív nyomás alatt működő sisakok; Megjegyzés : A 2B352.f.1. pont nem vonja ellenőrzés alá az olyan öltözékeket, amelyeket úgy terveztek, hogy független levegőztető berendezéssel együtt viseljék. 2. Biológiai elszigetelési kamrák, elkülönítők vagy biológiai biztonsági kabinok, amelyek a rendes üzemeltetéshez rendelkeznek az alábbi összes jellemzővel: a. Teljesen zárt munkavégzési helyszín, amelyben a dolgozót fizikai akadály választja el a munkától; b. Negatív nyomáson üzemképes; c. Eszközök biztosítottak a tárgyak munkavégzési helyszínen történő biztonságos kezeléséhez; d. A munkavégzés helyszínének levegővel való ellátása és a levegő onnan történő kivezetése HEPA-szűrőn keresztül történik; 1. megjegyzés : A 2B352.f.2. pont magában foglalja a WHO Laboratóriumi biológiai biztonsági kézikönyvének legújabb kiadásában leírtak szerinti és a nemzeti szabványoknak, szabályozásoknak vagy iránymutatásoknak megfelelően létrehozott, III. osztályba sorolt biológiai biztonsági kabinokat. 2. megjegyzés : A 2B352.f.2. pont magában foglal minden, a fent említett összes jellemzővel rendelkező izolátort függetlenül annak tervezett felhasználásától és rendeltetésétől, a kifejezetten a betegizolációra (barrier nursing) vagy a fertőzött betegek szállítására tervezett orvosi izolátorok kivételével.

g. "Mikroorganizmusokkal", vírusokkal vagy "toxinokkal" történő tesztelésre tervezett, aeroszolhoz használt, az alábbiaknak megfelelő inhalációs berendezés: 1. Legalább 1 m3-es kapacitással rendelkező, egész testen keresztüli expozíciót lehetővé tevő kamrák; 2. Irányított aeroszolbeáramlást alkalmazó, csak orron keresztüli expozíciót lehetővé tevő berendezések, amelyek rendelkeznek az alábbi expozíciókhoz szükséges kapacitással: a. 12 vagy több rágcsáló; vagy b. 2 vagy több - nem rágcsáló - állat; 3. Irányított aeroszolbeáramlást alkalmazó, csak orron keresztüli expozíciót lehetővé tevő berendezésekhez használt, állatok lefogására szolgáló zárt csövek;

h. A toxinok és kórokozó "mikroorganizmusok" szárítására alkalmas porlasztva szárító berendezés, amely rendelkezik az alábbi összes jellemzővel: 1. Vízpárologtatási kapacitása ≥ 0,4 kg/h és ≤ 400 kg/h; 2. Képes arra, hogy a kívánt részecskeméret generálását lehetővé tevő porlasztó szórófejekkel ≤ 10 μm tipikus átlagos részecskeméretet generáljon a meglévő szerelvényekkel vagy a porlasztva szárító berendezés minimális módosításával; és 3. in situ lehetséges azok sterilizálása vagy fertőtlenítése;

i. Nukleinsav-összeállítók vagy szintetizálók, amelyek részben vagy teljesen automatizáltak, és amelyeket arra terveztek, hogy képesek legyenek egy menetben 1,5 kilobázisnál hosszabb folyamatos nukleinsavak előállítására, 5 %-nál kisebb hibaarány mellett.

2CAnyagok

Nincsenek.

2DSzoftver

2D001A 2D002. pont alatt meghatározottaktól eltérő "szoftver" az alábbiak szerint:

a. Kifejezetten a 2A001. vagy 2B001-2B009. pont által ellenőrzés alá vont berendezések "kifejlesztésére" vagy "gyártására" tervezett vagy átalakított "szoftver".

b. Kifejezetten a 2A001.c., 2B001. vagy 2B003-2B009. pont alatt meghatározott berendezések "felhasználásához" tervezett vagy átalakított "szoftver".

Megjegyzés : A 2D001. pont nem vonja ellenőrzés alá az alkatrészek programozását végző olyan "szoftvert", amely "számjegyvezérlésű" kódokat generál a különféle részek megmunkálására.

2D002"Szoftver" elektronikus eszközökhöz, még akkor is, ha elektronikus eszközbe, vagy rendszerbe építették be, lehetővé téve, hogy az ilyen rendszerek "számjegyvezérlésű" egységként működjenek, és amely képes több mint négy tengely egyidejű koordinálása "kontúrvezérlésre".

1. megjegyzés : A 2D002. pont nem vonja ellenőrzés alá a kifejezetten a 2. kategória alatt nem meghatározott tételek működtetésére tervezett, vagy módosított "szoftvert".

2. megjegyzés : A 2D002. pont nem vonja ellenőrzés alá a 2B002. pontban meghatározott termékekhez tartozó "szoftvert". A 2B002. pontban meghatározott termékekhez tartozó "szoftver" tekintetében lásd: 2D001 és 2D003.

3. megjegyzés : A 2D002. pont nem vonja ellenőrzés alá a 2. kategóriában meg nem határozott cikkekkel exportált és azok működéséhez minimálisan szükséges "szoftvert".

2D003A 2B002. pont alatt meghatározott berendezések működéséhez tervezett vagy módosított olyan "szoftver", amely a kívánt munkadarabforma elérése érdekében az optikai kialakítást, a munkadarab mérési értékeit és az anyageltávolítási funkciókat "számjegyvezérlésű" parancsokká alakítja át.

2D101Kifejezetten a 2B104., 2B105., 2B109., 2B116., 2B117. vagy 2B119-2B122. pont alatt meghatározott berendezések "felhasználására" tervezett "szoftver".

N.B. LÁSD MÉG: 9D004.

2D201Kifejezetten a 2B204., 2B206., 2b207., 2b209., 2B219. vagy a 2B227. pont alatt meghatározott berendezések "felhasználására" tervezett "szoftver".

2D202Kifejezetten a 2B201. pont alatt meghatározott berendezések "kifejlesztésére", "gyártására", vagy "felhasználására" tervezett "szoftver".

Megjegyzés : A 2D202. pont nem vonja ellenőrzés alá az alkatrészek programozását végző olyan "szoftvert", amely "számjegyvezérlésű" parancskódokat generál, de nem teszi lehetővé a különféle részek megmunkálására szolgáló berendezések közvetlen felhasználását.

2D351Az 1D003. pont alatt meghatározottól eltérő, kifejezetten a 2B351. pont alatt meghatározott berendezés "felhasználására" tervezett "szoftver".

2D352Kifejezetten a 2B352.i pont alatt meghatározott nukleinsav-összeállítókhoz és szintetizálókhoz tervezett olyan "szoftver", amely alkalmas funkcionális genetikai elemek digitális szekvenciaadatokból való tervezésére és konstruálására.

2ETechnológia

2E001A berendezések "fejlesztésére" szolgáló, az általános technológiai megjegyzés szerinti "technológia" vagy "szoftver" a 2A., 2B vagy 2D. szakaszban meghatározottak szerint.

Megjegyzés : A 2E001. pont magában foglalja a próbarendszereknek a 2B006.a. pontban meghatározott koordinált mérőgépekbe történő integrálására szolgáló "technológiát".

2E002A 2A. vagy 2B. által ellenőrzés alá vont berendezések "gyártására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

2E003Egyéb "technológia", az alábbiak szerint:

a. Nem használt;

b. "Technológia" fémmegmunkáló gyártási eljárásokhoz, az alábbiak szerint: 1. Kifejezetten az alábbi eljárások bármelyikéhez tervezett szerszámok, matricák, tartozékok tervezésére szolgáló "technológia": a. "Szuperképlékeny alakítás"; b. "Diffúziós kötés"; vagy c. ‘Közvetlen hidraulikus sajtolás'; Műszaki megjegyzés : ‘Közvetlen hidraulikus sajtolás' (direct-acting hydraulic pressing): olyan deformációs eljárás, amelynél a munkadarabbal közvetlenül érintkező, folyadékkal töltött rugalmas tömlőt alkalmaznak. 2. Nem használt; N.B. A gázturbinás sugárhajtóművek és alkatrészek fémmegmunkáló gyártási eljárásaira szolgáló "technológiát" lásd a 9E003 pontban és a katonai célú termékek ellenőrzési jegyzékében.

c. Repülőgép-szerkezetek gyártásához használt, hidraulikus nyújtó-formázó gépek és szerszámaik "kifejlesztésére" vagy "gyártására" szolgáló "technológia";

d. Nem használt;

e. Műhelytevékenység korszerű döntéstámogatási rendszeréhez szükséges szakértői rendszert "számjegyvezérlő egységbe" integráló "szoftver" "kifejlesztésére" szolgáló "technológia";

f. Szervetlen fedőrétegeknek vagy szervetlen felületmódosító burkolatoknak (amelyeket következő táblázat 3. oszlopa határoz meg) a nem-elektronikus alaplemezekre (amelyeket a következő táblázat 2. oszlopa határoz meg) történő alkalmazásának "technológiája", a következő táblázat 1. oszlopában meghatározott és a Műszaki megjegyzésben meghatározott eljárásokkal. Megjegyzés : A táblázat és a Műszaki megjegyzések a 2E301. pont után találhatók. N.B. Ezt a táblázatot egy adott bevonási eljárás "technológiájának" meghatározásához csak abban az esetben kell figyelembe venni, amikor a 3. oszlopban található keletkezett bevonat abban a bekezdésben szerepel, amely pontosan szemben helyezkedik el a 2. oszlopban található vonatkozó alaplemezzel. Például a gőzfázisú kémiai leválasztás (CVD) bevonási eljárás műszaki adatai a szilicideknek szén-szén, kerámia és fém-"mátrix" "kompozitok" hordozókra való alkalmazása esetében vannak feltüntetve, nincsenek azonban feltüntetve a szilicideknek a ‘cementált volfrám-karbid' (16) és ‘szilícium-karbid' (18) alaplemezekre történő alkalmazására. A második esetben a keletkezett bevonat nem szerepel abban a 3. oszlopban található bekezdésben, amelyik pontosan szemben helyezkedik el a 2. oszlopnak azzal a bekezdésével, amely a ‘cementált volfrám-karbid' (16) és ‘szilícium-karbid' (18) hordozókat tünteti fel.

2E101A 2B004., 2B009., 2B104., 2B109., 2B116., 2B119-2B122. vagy 2D101. pont alatt meghatározott berendezés vagy "szoftver" "felhasználására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

2E201A 2A225., 2A226., 2B001., 2B006., 2B007.b., 2B007.c., 2B008., 2B009., 2B201., 2B204., 2B206., 2B207., 2B209., 2B225-2B233., 2D201. vagy 2D202. pont alatt meghatározott berendezés, vagy "szoftver" "felhasználására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

2E301A 2B350-2B352 alatt meghatározott termékek "felhasználására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

Táblázat

Anyagleválasztó eljárások

1. Bevonási eljárás (1) (1)2. Alaplemez3. Keletkezett bevonat
A. Gőzfázisú kémiai leválasztás (CVD)"Szuperötvözetek"Aluminidek belső felületekhez
Kerámia (19) és alacsony tágulású üvegek (14)Szilicidek
Karbidok
Dielektromos rétegek (15)
Gyémánt
Gyémántszerű szén (17)
Szén-szén, Kerámia és Fém-"mátrix" "kompozitok"Szilicidek
Karbidok
Tűzálló fémek
Ezek keverékei (4)
Dielektromos rétegek (15)
Aluminidek
Ötvözött aluminidek (2)
Bór-nitrid
Cementált volfrámkarbid (16), Szilícium-karbid (18)Karbidok
Volfrám
Ezek keverékei (4)
Dielektromos rétegek (15)
Molibdén és molibdénötvözetekDielektromos rétegek (15)
Berillium és berilliumötvözetekDielektromos rétegek (15)
Gyémánt
Gyémántszerű szén (17)
Szenzorablak-anyagok (9)Dielektromos rétegek (15)
Gyémánt
Gyémántszerű szén (17)
B. Termikus párologtatásos fizikai gőzfázisú leválasztás/vákuumpárologtatás (TE-PVD)
B.1. Fizikai gőzfázisú leválasztás (PVD): elektronsugaras (EB-PVD)"Szuperötvözetek"Ötvözött szilicidek
Ötvözött aluminidek (2)
MCrAlX (5)
Módosított cirkónium-oxid (12)
Szilicidek
Aluminidek
Ezek keverékei (4)
Kerámia (19) és alacsony tágulású üvegek (14)Dielektromos rétegek (15)
Korrózióálló acél (7)MCrAlX (5)
Módosított cirkónium-oxid (12)
Ezek keverékei (4)
Szén-szén, Kerámia és Fém-"mátrix" "kompozitok"Szilicidek
Karbidok
Tűzálló fémek
Ezek keverékei (4)
Dielektromos rétegek (15)
Bór-nitrid
Cementált volfrámkarbid (16), Szilícium-karbid (18)Karbidok
Volfrám
Ezek keverékei (4)
Dielektromos rétegek (15)
Molibdén és molibdénötvözetekDielektromos rétegek (15)
Berillium és berilliumötvözetekDielektromos rétegek (15)
Boridok
Berillium
Szenzorablak-anyagok (9)Dielektromos rétegek (15)
Titánötvözetek (13)Boridok
Nitridek
B.2. Ion-támogatású ellenállás-fűtésű Fizikai gőzfázisú leválasztás (PVD) (ionplattírozás)Kerámia (19) és Alacsony tágulású üvegekDielektromos rétegek (15)
Gyémántszerű szén (17)
Szén-szén, Kerámia és Fém-"mátrix" "kompozitok"Dielektromos rétegek (15)
Cementált volfrámkarbid (16), SzilíciumkarbidDielektromos rétegek (15)
Molibdén és molibdénötvözetekDielektromos rétegek (15)
Berillium és berilliumötvözetekDielektromos rétegek (15)
Szenzorablak-anyagok (9)Dielektromos rétegek (15)
Gyémántszerű szén (17)
B.3. Fizikai gőzfázisú leválasztás (PVD): "Lézer" elpárologtatásKerámia (19) és alacsony tágulású üvegek (14)Szilicidek
Dielektromos rétegek (15)
Gyémántszerű szén (17)
Szén-szén, Kerámia és Fém-"mátrix" "kompozitok"Dielektromos rétegek (15)
Cementált volfrámkarbid (16), SzilíciumkarbidDielektromos rétegek (15)
Molibdén és molibdénötvözetekDielektromos rétegek (15)
Berillium és berilliumötvözetekDielektromos rétegek (15)
Szenzorablak-anyagok (9)Dielektromos rétegek (15)
Gyémántszerű szén (17)
B.4. Fizikai gőzfázisú leválasztás (PVD): katódív kisülés"Szuperötvözetek"Ötvözött szilicidek
Ötvözött aluminidek (2)
MCrAlX (5)
Polimerek (11) és szerves "mátrix" "kompozitok"Boridok
Karbidok
Nitridek
Gyémántszerű szén (17)
C. Pack-cementálás (a "nem-pack" cementálás tekintetében lásd a fenti "A." szakaszt) (10)Szén-szén, Kerámia és Fém-"mátrix" "kompozitok"Szilicidek
Karbidok
Ezek keverékei (4)
Titánötvözetek (13)Szilicidek
Aluminidek
Ötvözött aluminidek (2)
Tűzálló fémek és ötvözetek (8)Szilicidek
Oxidok
D. Plazmaszórás"Szuperötvözetek"MCrAlX (5)
Módosított cirkónium-oxid (12)
Ezek keverékei (4)
Csiszolható nikkel-grafit
Csiszolható Ni-Cr-Al tartalmú anyagok
Csiszolható Al-Si-Poliészter
Ötvözött aluminidek (2)
Alumíniumötvözetek (6)MCrAlX (5)
Módosított cirkónium-oxid (12)
Szilicidek
Ezek keverékei (4)
Tűzálló fémek és ötvözetek (8)Aluminidek
Szilicidek
Karbidok
Korrózióálló acél (7)MCrAlX (5)
Módosított cirkónium-oxid (12)
Ezek keverékei (4)
Titánötvözetek (13)Karbidok
Aluminidek
Szilicidek
Ötvözött aluminidek (2)
Csiszolható nikkel-grafit
Csiszolható Ni-Cr-Al tartalmú anyagok
Csiszolható Al-Si-Poliészter
E. Szuszpenziós bevonatképzésTűzálló fémek és ötvözetek (8)Ömlesztett szilicidek
Ömlesztett aluminidek, kivéve az ellenállásos fűtőelemeket
Szén-szén, Kerámia és Fém-"mátrix" "kompozitok"Szilicidek
Karbidok
Ezek keverékei (4)
F. Katódporlasztás"Szuperötvözetek"Ötvözött szilicidek
Ötvözött aluminidek (2)
Nemesfémmel módosított aluminidek (3)
MCrAlX (5)
Módosított cirkónium-oxid (12)
Platina
Ezek keverékei (4)
Kerámia és alacsony tágulású üvegek (14)Szilicidek
Platina
Ezek keverékei (4)
Dielektromos rétegek (15)
Gyémántszerű szén (17)
Titánötvözetek (13)Boridok
Nitridek
Oxidok
Szilicidek
Aluminidek
Ötvözött aluminidek (2)
Karbidok
Szén-szén, Kerámia és Fém-"mátrix" "kompozitok"Szilicidek
Karbidok
Tűzálló fémek
Ezek keverékei (4)
Dielektromos rétegek (15)
Bór-nitrid
Cementált volfrámkarbid (16), Szilícium-karbid (18)Karbidok
Volfrám
Ezek keverékei (4)
Dielektromos rétegek (15)
Bór-nitrid
Molibdén és molibdénötvözetekDielektromos rétegek (15)
Berillium és berilliumötvözetekBoridok
Dielektromos rétegek (15)
Berillium
Szenzorablak-anyagok (9)Dielektromos rétegek (15)
Gyémántszerű szén (17)
Tűzálló fémek és ötvözetek (8)Aluminidek
Szilicidek
Oxidok
Karbidok
G. IonbeültetésMagashőmérsékletű csapágyacélokKróm, Tantál, vagy Nióbium (kolumbium)-adalékok
Titánötvözetek (13)Boridok
Nitridek
Berillium és berilliumötvözetekBoridok
Cementált volfrám-karbid (16)Karbidok
Nitridek
(1)
A zárójelben szereplő számok az e táblázat utáni Megjegyzésekre vonatkoznak.

TÁBLÁZAT - ANYAGLEVÁLASZTÓ ELJÁRÁSOK - MEGJEGYZÉSEK

1. ‘Bevonási eljáráson' egyaránt értendő a felületen végzett javítás, a felület korábbi állapotának visszaállítása, illetve az eredeti bevonási folyamat is.

2. Az ‘ötvözött aluminid-bevonat' kifejezés vonatkozik az egy vagy több lépcsőben előállított bevonatokra, amelyekben egy vagy több elemet az aluminid-bevonat felvitele előtt helyeztek el, még akkor is, ha ez egy más bevonatolási folyamattal történt. Nem vonatkozik azonban az egylépéses pack-cementálás ötvözött aluminidek előállítása céljából végzett ismételt alkalmazására.

3. A ‘nemesfémmel módosított aluminid' kifejezés arra a többlépcsős bevonási folyamatra vonatkozik, amelynek során az aluminid-bevonatolás alkalmazása előtt valamilyen más bevonási folyamattal nemesfémet vagy nemesfémeket visznek fel.

4. Az ‘ezek keverékei' kifejezés diffúz anyagokra, szemcsés kompozitokra, ko-depozitokra és többrétegű depozitokra vonatkozik, és azok a táblázatban szereplő bevonási folyamatok egyszeri vagy többszöri alkalmazásával állíthatók elő.

5. Az ‘MCrAlX' olyan bevonó ötvözeteket jelent, amelyekben az "M" kobaltnak, vasnak, nikkelnek vagy ezek valamilyen kombinációjának felel meg, az "X" hafniumot, ittriumot, szilíciumot, tantált jelent, bármely mennyiségben vagy egyéb különböző arányokban és kombinációkban szándékosan bevitt adalékanyagot 0,01 tömegszázalék fölött, kivéve: a. A CoCrAlY-bevonat, amely 22 tömegszázaléknál kevesebb krómot, kevesebb, mint 7 tömegszázalék alumíniumot és 2 tömegszázaléknál kevesebb ittriumot tartalmaz; b. A CoCrAlY-bevonat, amely 22-24 tömegszázalék krómot, 10-12 tömegszázalék alumíniumot és 0,5-0,7 tömegszázalék ittriumot tartalmaz; vagy c. A NiCrAlY-bevonat, amely 21-23 tömegszázalék krómot, 10-12 tömegszázalék alumíniumot és 0,9-1,1 tömegszázalék ittriumot tartalmaz.

6. Az ‘alumíniumötvözetek' olyan ötvözeteket jelentenek, amelyek 293 K (20 °C) hőmérsékleten mért maximális szakítószilárdsága legalább 190 MPa.

7. A ‘korrózióálló acél' kifejezés olyan acélokra vonatkozik, mint például az AISI (American Iron and Steel Institute - Amerikai Vas- és Acélintézet) 300-as sorozata vagy az ezzel egyenértékű nemzeti szabvány szerinti acélok.

8. A ‘tűzálló fémek és ötvözetek' az alábbi fémekből és ötvözeteikből állnak: nióbium (kolumbium), molibdén, volfrám és tantál.

9. A ‘szenzorablakanyagok' a következők: alumínium-oxid, szilícium, germánium, cink-szulfid, cink-szelenid, gallium-arzenid, gyémánt, gallium-foszfid, zafír és a következő fémhalogenidek: a 40 mm-nél nagyobb átmérőjű érzékelő üveganyagok esetén cirkónium-fluorid és hafnium-fluorid.

10. A 2. kategória nem vonja ellenőrzés alá a repülőgépek szilárd szárnyszelvényeinek egylépcsős pack-cementálására szolgáló "technológiát".

11. ‘Polimerek', a következők szerint: polimidek, poliészterek, poliszulfidok, polikarbonátok és poliuretánok.

12. A ‘módosított cirkónium-oxid' más fémoxidok adalékaira vonatkozik (pl. kalcium, magnézium, ittrium, hafnium, ritkaföldfémek oxidjai stb.), amelyeket azért adagolnak a cirkóniumhoz, hogy stabilizálják a krisztallográfiai fázisokat és a fázisösszetételeket. Az ellenőrzés nem terjed ki a kalciummal vagy a magnéziummal történő keverés vagy fúzió útján módosított cirkóniumból készült hőgát bevonatokra.

13. A ‘titánötvözetek' azokra az űrhajózási ötvözetekre utalnak, amelyek 293 K (20 °C) hőmérsékleten mért maximális szakítószilárdsága 900 MPa vagy annál több.

14. Az ‘alacsony tágulású üvegek' olyan üvegekre vonatkoznak, amelyek 293 K (20 °C) hőmérsékleten mért hőtágulási együtthatója 1 × -7 K-1 vagy annál kevesebb.

15. A ‘dielektromos rétegek' többrétegű szigetelőanyagból készült bevonatok, amelyekben a különböző törésmutatójú anyagokból álló modell interferencia-jellemzőit használják fel a különböző hullámhosszúságú sávok visszaverésére, átvitelére vagy elnyelésére. A dielektromos rétegek négynél több dielektromos rétegre vagy szigetelő/fém "kompozit" rétegre vonatkoznak.

16. A ‘cementált volfrám-karbid' nem foglalja magában a volfrám-karbid/(kobalt, nikkel), titán-karbid/(kobalt, nikkel), króm-karbid/nikkel- króm és króm-karbid/nikkel vágó és forgácsoló-szerszám anyagokat.

17. Az ellenőrzés nem terjed ki a kifejezetten a következő anyagokon gyémántszerű szén bevonatok létrehozására tervezett "technológiára": mágneses lemezmeghajtók és fejek, eldobható termékek gyártására szolgáló berendezések, vízcsap szelepek, hangszórómembrán, gépjárművek motor része, vágószerszámok, lyukasztó süllyesztékei, iroda-automatizálási berendezések, mikrofonok és gyógyászati eszközök vagy a műanyagok öntésére vagy formázására használt, kevesebb mint 5 % berilliumot tartalmazó ötvözetekből gyártott formák.

18. A ‘szilícium-karbid' nem foglalja magába a vágó- és forgácsoló-szerszám anyagokat.

19. A kerámia hordozóanyagok kifejezés e tétel alkalmazásában nem foglalja magába az 5 % vagy nagyobb tömegben agyagot vagy cementet - akár különálló komponensek, akár kombinációban szerepelnek - tartalmazó kerámiákat.

TÁBLÁZAT - ANYAGLEVÁLASZTÓ ELJÁRÁSOK - MŰSZAKI MEGJEGYZÉSEK

A táblázat 1. oszlopában szereplő eljárások meghatározásai:

a. Gőzfázisú kémiai leválasztás (Chemical Vapour Deposition - CVD) olyan rétegfelviteli vagy felületmódosítási bevonási folyamat, amelynek során fémet, ötvözetet, "kompozitot" vagy kerámiát visznek fel hevített hordozó felületére. A hordozó közelében kiválasztott vagy elegyített gázok reakciója eredményezi a kívánt elemek, ötvözetek vagy vegyületek leválasztását. A bomláshoz vagy a vegyi reakcióhoz szükséges energiát a hordozó hője, plazmakisülés vagy "lézer" sugárzás szolgáltatja. N.B.1. A CVD-eljárások közé tartoznak a következők is: nem-pack (out-of-pack) irányított gázáram, pulzáló CVD, szabályozott nukleidos termikus leválasztás (controlled nucleation thermal decomposition - CNTD), plazmagerjesztésű vagy plazmát alkalmazó CVD-eljárások. N.B.2. A pack porkeverékbe merített hordozót jelent. N.B.3. A nem-pack eljárásokban használt gázhalmazállapotú anyagok ugyanannak az alapreakciónak során ugyanolyan paraméterekkel jönnek létre, mint a pack-cementálás eljárás paraméterei, kivéve, hogy a bevonandó hordozó nem kerül kapcsolatba a porkeverékkel.

b. Termikus gőzölögtetésű-fizikai gőzfázisú leválasztás (TE-PVD) olyan bevonatkezelési eljárás, amelyet 0,1 Pa-nál kisebb nyomású vákuumban végeznek el, úgy, hogy a bevonóanyag elgőzölögtetésére hőenergiát használnak fel. Az eljárás eredményeként az elgőzölögtetett anyag kicsapódik, illetve lerakódik a megfelelően elhelyezett hordozóra. Az eljárás szokásos módosítási eszköze az, hogy kompaund bevonatok szintetizálása céljából a bevonási eljárás során gázt adagolnak be a vákuumkamrába. Ion- vagy elektronsugarak, illetve plazma alkalmazása a bevonási eljárás aktiválására vagy előmozdítására szintén e technikai eljárás szokásos módosítását képezi. E folyamatokat jellemezheti továbbá az, hogy az optikai jellemzőknek és a bevonatok vastagságának mérésére az eljárás során monitorokat használnak. A speciális TE-PVD eljárások az alábbiak: 1. Az elektronsugaras PVD a bevonatot képező anyag hevítésére és elgőzölögtetésére elektronsugarat alkalmaz; 2. Az ion-támogatású ellenállás-fűtésű PVD villamosan ellenálló hőforrások és visszaverődő ionsugarak kombinációját alkalmazza, amelyek képesek biztosítani az elgőzölögtetett bevonóanyagok ellenőrzött és egységes áramát; 3. A "lézer" elgőzölögtetés vagy pulzáló vagy folytonos hullámú "lézer"sugarakat alkalmaz a bevonóanyag elpárologtatására; 4. A katódíves bevonás a bevonóanyagnak olyan fogyó katódját használja, amelynek felszínén egy földelt érintkezővel történő rövid idejű érintkezés során ívkisülés keletkezik. Az ív ellenőrzött mozgása erodálja a katód felületét, s ezzel intenzív ionizált plazmaáramot hoz létre. Az anód lehet egy kúp, amely a katód felszínéhez egy szigetelőn keresztül csatlakozik, vagy a kamrát lehet anódként használni. A "non line-of-sight" bevonásnál alaplemez-eltolást alkalmaznak; N.B. Ez a meghatározás nem tartalmazza a nem-előfeszített alaplemezek esetén alkalmazott random katódsugaras bevonást. 5. Az ionbeültetés az általános TE-PVD eljárás speciális módosítása, amelyben a plazmát vagy az ionforrást használnak a létrehozandó bevonat anyagának ionizálására, és a plazmából leválasztandó anyagok kinyerésének megkönnyítésére a hordozóhoz negatív előfeszítést alkalmaznak. Ezen eljárások szokásos módosításait képezik: a reaktív anyagok bevezetése, a szilárd anyagoknak a kamrában történő elgőzölögtetése, és monitorok alkalmazása az optikai jellemzők eljárás közbeni mérésére és a bevonatok vastagságának ellenőrzésére.

c. A pack-cementálás olyan felületmódosító bevonási vagy rétegfelviteli eljárás, amelynek során az alaplemezt porkeverékbe (az ún. pack) merítik, amely a következőkből áll: 1. A felvitelre szánt fémek pora (általában alumínium, króm, szilícium vagy ezek kombinációi); 2. Aktivátor (általában egy halogénsó); valamint 3. Egy semleges por, általában timföld. Az alaplemezt és a porkeveréket egy retortában helyezik el, amelyet a bevonóanyag leválásához szükséges időtartamra 1 030 K (757 °C) -1 375 K (1 102 °C) közötti hőmérsékletre fűtenek fel.

d. A plazmaszórás olyan rétegfelviteli eljárás, amely során a plazmát egy szórófej állítja elő és szabályozza; a porított vagy huzalos bevonóanyag a szórófejbe kerül be, amely azt megolvasztja, és ezt szórja ki a hordozó felé, ahol az teljes mértékben tapadó bevonatot képez. A plazmaszórás vagy kisnyomású plazmaszórásból vagy víz alatti, nagy sebességű plazmaszórásból áll. N.B.1. A kis nyomás a környezeti, légköri nyomásnál kisebb nyomást jelent. N.B.2. A nagy sebesség azt jelenti, hogy a fúvókából eltávozó gáz sebessége 0,1 MPa nyomásnál 293 K-en (20 °C) meghaladja a 750 m/s-ot.

e. A szuszpenziós bevonatképzés az a felületmódosító bevonási vagy rétegfelviteli eljárás, amelynek során a kívánt bevonat elérése érdekében a hordozóra folyadékban feloldott szerves kötőanyaggal kevert fém- vagy kerámiaport visznek fel szórással, bemerítéssel vagy festéssel, az azt követő levegőn vagy kemencében történő szárítással, illetve hőkezeléssel.

f. A katódporlasztás olyan rétegfelviteli folyamat, amelyben pozitív töltésű részecskéket gyorsítanak és mozgatnak elektromos térben a céltárgy (bevonóanyag) felszíne felé. A becsapódó ionok kinetikus energiája elegendő ahhoz, hogy a céltárgy felületéből atomok váljanak ki, és a megfelelően elhelyezett hordozón kiváljanak. N.B.1. A táblázat csak a triódás, magnetronos vagy reaktív katódporlasztásra vonatkozik, amelyekkel a bevonóanyag tapadásának növelését és a leválasztás sebességét kívánják növelni, valamint a megnövelt nagyfrekvenciás (NF) porlasztásra vonatkozik, amelyet a nemfémes bevonóanyagok elgőzölögtetésére használnak. N.B.2. Az alacsony energiájú (5 keV-nál kisebb) ionsugarakat a leválasztás aktiválására lehet használni.

g. Az ionbeültetés az a felületmódosító bevonási eljárás, amelynek során az ötvözőelemet ionizálják, erőtérben felgyorsítják és a hordozó felületének meghatározott részébe ültetik. Ez magában foglalja azokat az eljárásokat, amelyek során az ionbeültetés az elektronsugaras fizikai gőzfázisú leválasztással vagy katódporlasztással egyidejűleg történik.

V. RÉSZ

3. kategória

3. KATEGÓRIA - ELEKTRONIKA

3ABerendezések, részegységek és alkatrészek

1. megjegyzés : A 3A001.a.3-3A001.a.10. vagy a 3A001.a.12-3A001.a.14. vagy a 3A001.b.12. pont alatt meghatározottaktól eltérő, a 3A001, vagy 3A002. pont alatt ismertetett berendezések és alkatrészek - amelyeket más berendezésekhez speciálisan terveztek, illetve amelyek ugyanolyan funkcionális jellemzőkkel rendelkeznek, mint a többi berendezés - ellenőrzési státusát a többi berendezés ellenőrzési státusa határozza meg.

2. megjegyzés : A 3A001.a.3-3A001.a.9. vagy a 3A001.a.12- 3A001.a.14. pont alatt ismertetett integrált áramkörök ellenőrzési státusát - amelyeket megváltoztathatatlan módon programoztak vagy más berendezéshez egyedi funkcióra terveztek - a többi berendezés ellenőrzési státusa határozza meg.

N.B. Amikor a gyártó vagy a felhasználó nem tudja meghatározni a többi berendezés ellenőrzési státuszát, akkor az integrált áramkörök ellenőrzési státuszát a 3A001.a.3-3A001.a.9. és a 3A001.a.12.-3A001.a.14. pont határozza meg.

3. megjegyzés : Azoknak a (befejezett vagy be nem fejezett) lapkáknak, amelyeken a funkciót meghatározták, a státusát a 3A001.a., a 3A001.b., a 3A001.d., a 3A001.e.4., a 3A001.g., a 3A001.h. vagy a 3A001.i. pont alatti paraméterek szerint kell értékelni.

3A001Elektronikai termékek az alábbiak szerint:

a. Általános célú integrált áramkörök, az alábbiak szerint: Megjegyzés : Integrált áramkörök alatt a következő típusokat értjük: - "monolit integrált áramkörök"; - "hibrid integrált áramkörök"; - "multichip integrált áramkörök"; - "film típusú integrált áramkörök", beleértve a szilícium/zafír integrált áramköröket is; - "optikai integrált áramkörök"; - "háromdimenziós integrált áramkörök"; - "monolitikus, mikrohullámú integrált áramkörök" ("MMIC"). 1. A sugárzásállónak tervezett vagy minősített integrált áramkörök, melyek ellenállnak a következők bármelyikének: a. 5 × 103 Gy (Si) vagy ennél nagyobb teljes dózis; b. 5 × 106 Gy (Si)/s vagy magasabb dózisintenzitás-változás; vagy c. 5 × 1013 n/cm2 vagy magasabb neutronfolyam (integrált fluxus) (1 MeV ekvivalens) szilíciumon, vagy ennek megfelelője más anyagon; Megjegyzés : A 3A001.a.1.c. alpont nem vonja ellenőrzés alá a Fém Szigetelő Félvezetőket (MIS). 2. "Mikroprocesszor mikroáramkörök", "mikroszámítógép mikroáramkörök", mikrovezérlő mikroáramkörök, vegyes félvezetőből gyártott tároló integrált áramkörök, analóg-digitális átalakítók, analóg-digitális átalakítókat tartalmazó és ditiális adatokat tároló vagy feldolgozó integrált áramkörök, digitális-analóg átalakítók, elektro-optikai, vagy "jelfeldolgozásra" tervezett "optikai integrált áramkörök", felhasználó által programozható logikai eszközök, egyedi integrált áramkörök, amelyek funkciója vagy annak a berendezésnek, amelyben az integrált áramkört fel fogják használni az ellenőrzési státusa ismeretlen, gyors Fourier transzformáló (FFT) processzorok, statikus véletlen elérésű memóriák (SRAM-ok) vagy ‘nem felejtő memóriák', amelyek rendelkeznek az alábbi jellemzők bármelyikével: a. 398 K (125 °C) feletti környezeti hőmérsékleten történő működésre méretezték; b. 218 K (- 55 °C) alatti környezeti hőmérsékleten történő működésre méretezték; vagy c. A 218 K (- 55 °C) és a 398 K (+ 125 °C) közötti hőmérséklet-tartományban történő működésre méretezték; Megjegyzés : A 3A001.a.2. alpont nem vonja ellenőrzés alá a polgári gépjárművekhez vagy a vasútivonat-alkalmazásokhoz tervezett integrált áramköröket. Műszaki megjegyzés : ‘Nem felejtő memória': az áramkimaradást követően adott időtartamon belül adatmegőrző funkcióval rendelkező memória. 3. "Mikroprocesszor mikroáramkörök", "mikroszámítógép mikroáramkörök" és mikrovezérlő mikroáramkörök, amelyek vegyes félvezetőből készültek, és 40 MHz-et meghaladó órajel frekvencián működnek; Megjegyzés : A 3A001.a.3 pont magában foglalja a digitális jelfeldolgozókat, a digitális tömbprocesszorokat és a digitális társprocesszorokat. 4. Nem használt; 5. Analóg-digitális (AD) és digitális-analóg (DA) átalakító integrált áramkörök, az alábbiak szerint: a. AD átalakítók, amelyek rendelkeznek az alábbi jellemzők bármelyikével: N.B. LÁSD MÉG: 3A101. 1. felbontásuk legalább 8 bit, de 10 bitnél kevesebb, 1,3 giga minta/másodpercnél (GSPS) nagyobb "mintabeviteli gyakorisággal"; 2. felbontásuk legalább 10 bit, de 12 bitnél kevesebb, 600 mega minta/másodpercnél (MSPS) nagyobb "mintabeviteli gyakorisággal"; 3. felbontásuk legalább 12 bit, de 14 bitnél kevesebb, 400 mega minta/másodpercnél (MSPS) nagyobb "mintabeviteli gyakorisággal"; 4. felbontásuk legalább 14 bit, de 16 bitnél kevesebb, 250 mega minta/másodpercnél (MSPS) nagyobb "mintabeviteli gyakorisággal"; vagy 5. felbontásuk legalább 16 bit, legalább 65 MSPS-nél nagyobb "mintabeviteli gyakorisággal"; N.B. Az analóg-digitális átalakítókat tartalmazó és digitális adatokat tároló vagy feldolgozó integrált áramköröket illetően lásd a 3A001.a.14. pontot. Műszaki megjegyzések : 1. Az "n" bit felbontás a 2n szintű kvantálásra vonatkozik. 2. Az AD átalakítók felbontása a mért analóg inputot képviselő digitális kimenet bitjeinek száma. A bitek tényleges számát (ENOB) nem használják az AD átalakítók felbontásának meghatározásához. 3. "Többcsatornás AD átalakítók" esetében a "mintabeviteli gyakoriságok" nem adódnak össze, és a "mintabeviteli gyakoriság" az egyes csatornák bármelyikének maximális mintavételi aránya. 4. "Közvetett AD átalakítók" vagy olyan "többcsatornás AD átalakítók" esetében, amelyek leírásuk szerint szektorfésüléses (interleaved) móddal is rendelkeznek, a "mintabeviteli gyakoriságok" összeadódnak, és a "mintabeviteli gyakoriság" nem más, mint az összes szektorfésüléses csatorna maximális összevont összteljesítménye. b. Digitális-analóg (DA) átalakítók, amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. Felbontásuk legalább 10 bit, de 12 bitnél kevesebb, 3 500 mega minta/másodpercet (MSPS) meghaladó ‘kiigazított adatfrissítési gyakoriság'; vagy 2. Felbontásuk legalább 12 bit, és rendelkeznek az alábbi jellemzők bármelyikével: a. 1 250 mega minta/másodpercet (MSPS) meghaladó, de 3 500 mega minta/másodpercet (MSPS) meg nem haladó ‘kiigazított adatfrissítési gyakoriság' mellett, és rendelkezik az alábbi jellemzők bármelyikével: 1. 9 ns-nél kisebb beállási idő a digitális bemenetben történő változástól a kimeneti végérték 0,024 %-os hibasávon belüli eléréséig; vagy 2. 100 MHz-es teljes kivezérlésű analóg jel vagy 100 MHz alatt meghatározott legmagasabb teljes kivezérlésű analógjel-frekvencia szintetizálásakor 68 dBc-nél (ahol c = carrier, vivő) nagyobb ‘Torzítás feletti dinamikatartomány' (SFDR); vagy b. 3 500 mega minta/másodpercet (MSPS) meghaladó ‘kiigazított adatfrissítési gyakoriság'; Műszaki megjegyzések : 1. ‘Torzítás feletti dinamikatartomány' (SFDR, Spurious Free Dynamic Range): A kimeneti jel legnagyobb teljesítményű zavarjel-komponensének vagy harmonikus torzítási komponensének négyzetes átlagértéke (RMS), a bemeneti vivőfrekvencia (legnagyobb frekvenciájú jelkomponensének) négyzetes átlagértéke (RMS) arányában. 2. Az SFDR közvetlenül a specifikációs táblázat alapján vagy az SFDR és a frekvencia összefüggését ábrázoló karakterizációs plot függvényekből határozható meg. 3. A jel akkor minősül teljes kivezérlésűnek, ha amplitudója meghaladja a - 3 dBfs (ahol fs = full scale, kivezérlési tartomány). 4. ‘Kiigazított adatfrissítési gyakoriság' DA átalakítók esetében: a. A hagyományos (nem interpoláló) DA átalakítók esetében a ‘kiigazított adatfrissítési gyakoriság' az a teljesítmény-frekvencia, amellyel a DA átalakító a digitális jelet analóg jellé alakítja, illetve a kimeneti analóg értékeket átváltja. Azok a DA átalakítók, amelyeknél az interpolációs üzemmód kiiktatható (az interpolációs faktor eggyel egyenlő), hagyományos (nem interpoláló) DA átalakítónak tekintendők. b. Interpoláló (túlmintavételező) DA átalakítók esetében a ‘kiigazított adatfrissítési gyakoriság' a DA átalakító adatfrissítési gyakoriságának és a legkisebb interpolációs faktornak a hányadosa. Interpoláló DA átalakítók esetében a ‘kiigazított adatfrissítési gyakoriság'-ra más formában is történhet utalás, így például az alábbi kifejezésekkel: - adatbeviteli gyakoriság - szóbeviteli gyakoriság - mintabeviteli gyakoriság - maximális összesített beviteli busz teljesítmény - a DAC maximális órajel-gyakorisága az órajel-bevitel során. 6. "Jelfeldolgozáshoz" tervezett elektro-optikai és "optikai integrált áramkörök", amelyek rendelkeznek az alábbi jellemzők mindegyikével: a. egy vagy több belső "lézer"dióda; b. egy vagy több belső fényérzékelő elem; és c. optikai hullámvezetők; 7. Felhasználó által programozható logikai eszközök, amelyek rendelkeznek az alábbi jellemzők bármelyikével: a. az egyvégű digitális bemenetek/kimenetek maximális száma nagyobb, mint 700; vagy b. a ‘soros adó-vevő legnagyobb összesített egyirányú adatsebessége' 500 Gb/s vagy nagyobb; Megjegyzés: A 3A001.a.7 pont magában foglalja az alábbiakat: - komplex programozható logikai eszközök (CPLD) - felhasználó által programozható kapu tömbök (FPGA) - felhasználó által programozható logikai tömbök (FPLA) - felhasználó által programozható összekapcsolók (FPIC) N.B. A felhasználó által programozható logikai eszközökkel rendelkező, analóg-digitális átalakítóval kombinált integrált áramköröket illetően lásd a 3A001.a.14. pontot. Műszaki megjegyzések : 1. A digitális bemenetek/kimenetek 3A001.a.7.a. pontban említett maximális számára maximális felhasználói bemenetként/kimenetként vagy maximálisan rendelkezésre álló bemenetként/kimenetként is szoktak hivatkozni, attól függően, hogy az integrált áramkör tokozott áramkör-e vagy pedig tokozatlan áramkör. 2. ‘A soros adó-vevő legnagyobb összesített egyirányú adatsebessége' a soros adó-vevő legnagyobb egyirányú adatsebességének és az FPGA-hoz csatlakozó adó-vevők számának a szorzata. 8. Nem használt; 9. Neurális hálózati integrált áramkörök; 10. Egyedi integrált áramkörök, melyeknél vagy a funkció ismeretlen, vagy az integrált áramkört felhasználó berendezés ellenőrzési státusa a gyártó számára ismeretlen, és amelyek rendelkeznek a következő jellemzők bármelyikével: a. több mint 1 500 terminál; b. a tipikus "alapkapu késleltetési idő" kevesebb, mint 0,02 ns; vagy c. az üzemi frekvencia meghaladja a 3 GHz-et; 11. Bármely vegyes félvezetőn alapuló, a 3A001.a.3.-3A001.a.10. és a 3A001.a.12. alatt meghatározottaktól eltérő digitális integrált áramkörök, amelyek rendelkeznek a következő jellemzők bármelyikével: a. az ekvivalens kapuszám meghaladja a 3 000 -et (2 bemeneti kapu); vagy b. Az átbillenési frekvencia meghaladja az 1,2 GHz-et; 12. Gyors Fourier Transzformáló (FFT) processzorok, amelyek minősített végrehajtási ideje egy N-pontú komplex FTT-re kisebb, mint (N log2 N)/20 480 ms, ahol N a pontok száma; Műszaki megjegyzés : Ha N=1 024 pont, a 3A001.a.12. szerinti képlettel számítva a végrehajtási idő kevesebb, mint 500 μs; 13. Közvetlen digitális szintetizátor (DDS) integrált áramkörök, amelyek rendelkeznek az alábbiak valamelyikével: a. digitális-analóg (DAC) átalakító-óra frekvenciája 3,5 GHz vagy annál nagyobb, a DAC-felbontás pedig 10 bit vagy annál nagyobb, de 12 bitnél kevesebb; vagy b. a DAC-óra frekvenciája 1,25 GHz vagy nagyobb, a DAC-felbontás pedig 12 bit vagy nagyobb; Műszaki megjegyzés : A DAC frekvenciáját főóra frekvenciaként vagy bemenetióra-frekvenciaként is meg lehet határozni. 14. Olyan integrált áramkörök, amelyek képesek a következők mindegyikét végrehajtani vagy azok végrehajtására programozhatók: a. Analóg-digitális átalakítások, amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. felbontásuk legalább 8 bit, de 10 bitnél kevesebb, 1,3 giga minta/másodpercnél (GSPS) nagyobb "mintabeviteli gyakorisággal"; 2. felbontásuk legalább 10 bit, de 12 bitnél kevesebb, 1,0 giga minta/másodpercnél (GSPS) nagyobb "mintabeviteli gyakorisággal"; 3. felbontásuk legalább 12 bit, de 14 bitnél kevesebb, 1,0 giga minta/másodpercnél (GSPS) nagyobb "mintabeviteli gyakorisággal"; 4. felbontásuk legalább 14 bit, de 16 bitnél kevesebb, 400 mega minta/másodpercnél (MSPS) nagyobb "mintabeviteli gyakorisággal"; vagy 5. felbontásuk legalább 16 bit, legalább 180 MSPS-nél nagyobb "mintabeviteli gyakorisággal"; és b. Az alábbiak bármelyike: 1. a digitalizált adatok tárolása; vagy 2. a digitalizált adatok feldolgozása; N.B.1. Az analóg-digitális átalakítóval rendelkező integrált áramköröket illetően lásd a 3A001.a.5.a. pontot. N.B.2. A felhasználó által programozható logikai eszközöket illetően lásd a 3A001.a.7. pontot. Műszaki megjegyzések : 1. Az "n" bit felbontás a 2n szintű kvantálásra vonatkozik. 2. Az AD átalakítók felbontása a mért analóg inputot képviselő AD átalakító digitális kimeneti bitjeinek száma. A bitek tényleges számát (ENOB) nem használják az AD átalakítók felbontásának meghatározásához. 3. A nem szektorfésüléses "többcsatornás AD átalakítókkal" rendelkező integrált áramkörök esetében a "mintabeviteli gyakoriságok" nem adódnak össze, és a "mintabeviteli gyakoriság" az egyes csatornák bármelyikének maximális mintavételi aránya. 4. A "közvetett AD átalakítókkal" vagy olyan "többcsatornás AD átalakítókkal" rendelkező integrált áramkörök esetében, amelyek leírásuk szerint szektorfésüléses (interleaved) móddal is rendelkeznek, a "mintabeviteli gyakoriságok" összeadódnak, és a "mintabeviteli gyakoriság" nem más, mint az összes szektorfésüléses csatorna maximális összevont összteljesítménye.

b. Mikrohullámú vagy milliméteres hullámú termékek, az alábbiak szerint: Műszaki megjegyzés: A 3A001.b. alpont alkalmazásában a termékek adatlapjain a maximális kimeneti telítési teljesítmény paraméter kimenőteljesítményként, kimeneti telítési teljesítményként, maximális kimenőteljesítményként, kimenő csúcsteljesítményként vagy modulációs csúcsteljesítményként is szerepelhet. 1. "Vákuumos elektronikus eszközök" és katódok az alábbiak szerint: 1. megjegyzés : A 3A001.b.1. pont nem vonja ellenőrzés alá az alábbi jellemzők mindegyikével rendelkező bármilyen frekvenciasávban történő működésre tervezett vagy minősített "vákuumos elektronikus eszközöket": a. nem haladja meg a 31,8 GHz-et; és b. az "ITU által" rádió-kommunikációs szolgáltatóknak, de nem rádió-meghatározásra "kiosztott". 2. megjegyzés : A 3A001.b.1. pont nem vonja ellenőrzés alá a nem "űrminősítésű", és az alábbi jellemzők mindegyikével rendelkező "vákuumos elektronikus eszközöket": a. átlagos kimeneti teljesítménye legfeljebb 50 W; és b. az alábbi jellemzők mindegyikével rendelkező bármilyen frekvenciasávban történő működésre tervezett vagy minősített csöveket: 1. nagyobb, mint 31,8 GHz, de nem haladja meg a 43,5 GHz-et; és 2. az "ITU által" rádió-kommunikációs szolgáltatóknak, de nem rádió-meghatározásra "kiosztott". a. impulzusüzemre vagy folyamatos hullámüzemre szánt haladó hullámú "vákuumos elektronikus eszközök", az alábbiak szerint: 1. 31,8 GHz-nél magasabb frekvencián üzemelő eszközök; 2. katód fűtővel rendelkező eszközök, amelyek esetében a névleges RF teljesítmény elérésének ideje kevesebb, mint 3 másodperc; 3. csatolt üregeszközök, vagy származékaik, melyek "relatív sávszélessége" meghaladja a 7 %-ot, vagy amelyek csúcsteljesítménye több, mint 2,5 kW; 4. spirális, hajlított vagy szerpentines hullámvezetős áramkörön alapuló eszközök vagy azok származékai, amelyek az alábbi jellemzők bármelyikével: a. a "pillanatnyi sávszélesség" több, mint egy oktáv, az átlagos teljesítmény (kW) és a maximális üzemi frekvencia (GHz) szorzata nagyobb, mint 0,5; b. a "pillanatnyi sávszélesség" legfeljebb egy oktáv, az átlagos kimenő teljesítmény (kW) és a maximális üzemi frekvencia (GHz) szorzata pedig nagyobb 1-nél; c. "űrminősítésű"; vagy d. rácsozott elektronágyúval rendelkezik; 5. 10 %-nál nagyobb "relatív sávszélességgel" és az alábbiak valamelyikével rendelkező eszközök: a. gyűrűs elektronsugár; b. a tengellyel nem szimmetrikus elektronsugár; vagy c. többszörös elektronsugár; b. több mint 17 dB erősítésű keresztmezős erősítő "vákuumos elektronikus eszközök"; c. "vákuum elektronikus eszközökhöz" tervezett termionikus katódok a névleges üzemi feltételek mellett 5 A/cm2-t meghaladó emissziós áramsűrűséggel vagy a névleges üzemi feltételek mellett 10 A/cm2-t meghaladó impulzusos (nem folyamatos) emissziós áramsűrűséggel; d. ‘kettős üzemmódú' üzemelésre képes "vákuumos elektronikus eszközök". Műszaki megjegyzés : A ‘kettős üzemmódú' azt jelenti, hogy a "vákuumos elektronikus eszköz" sugáráramának üzemmódja egy rács használatával szándékosan folyamatos hullámüzemről impulzusüzemre változtatható, és impulzusüzemben a kimenő csúcsteljesítmény meghaladja a folyamatos hullámüzemben elérhető kimenő teljesítményt. 2. "Monolitikus, mikrohullámú integrált áramkörű" ("MMIC") erősítők, amelyek az alábbi kategóriák valamelyikébe esnek: N.B. Az integrált fáziseltolóval rendelkező "monolitikus, mikrohullámú integrált áramkörű" (MMIC) erősítőket illetően lásd a 3A001.b.12. pontot. a. 2,7 GHz-nél nagyobb, de legfeljebb 6,8 GHz-es frekvencián való működésre méretezettek, "relatív sávszélességük" 15 %-nál nagyobb, és rendelkeznek az alábbiak valamelyikével: 1. 2,7 GHz-nél nagyobb és legfeljebb 2,9 GHz nagyságú frekvencián 75 W-nál (48,75 dBm) nagyobb maximális kimeneti telítési teljesítmény; 2. 2,9 GHz-nél nagyobb és legfeljebb 3,2 GHz nagyságú frekvencián 55 W-nál (47,4 dBm) nagyobb maximális kimeneti telítési teljesítmény; 3. 3,2 GHz-nél nagyobb és legfeljebb 3,7 GHz nagyságú frekvencián 40 W-nál (46 dBm) nagyobb maximális kimeneti telítési teljesítmény; vagy 4. 3,7 GHz-nél nagyobb és legfeljebb 6,8 GHz nagyságú frekvencián 20 W-nál (43 dBm) nagyobb maximális kimeneti telítési teljesítmény; b. 6,8 GHz-nél nagyobb, de legfeljebb 16 GHz-es frekvencián való működésre méretezettek, "relatív sávszélességük" 10 %-nál nagyobb, és rendelkeznek az alábbiak valamelyikével: 1. 6,8 GHz-nél nagyobb és legfeljebb 8,5 GHz nagyságú frekvencián 10 W-nál (40 dBm) nagyobb maximális kimeneti telítési teljesítmény; vagy 2. 8,5 GHz-nél nagyobb és legfeljebb 16 GHz nagyságú frekvencián 5 W-nál (37 dBm) nagyobb maximális kimeneti telítési teljesítmény; c. 16 GHz-nél nagyobb és legfeljebb 31,8 GHz közötti bármilyen frekvencián 3 W-nál (34,77 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek, és "relatív sávszélességük" 10 %-nál nagyobb; d. 31,8 GHz-nél nagyobb és legfeljebb 37 GHz közötti bármilyen frekvencián 0,1 nW-nál (- 70 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek; e. 37 GHz-nél nagyobb és legfeljebb 43,5 GHz közötti bármilyen frekvencián 1 W-nál (30 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek, és "relatív sávszélességük" 10 %-nál nagyobb; f. 43,5 GHz-nél nagyobb és legfeljebb 75 GHz közötti bármilyen frekvencián 31,62 mW-nál (15 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek, és "relatív sávszélességük" 10 %-nál nagyobb; g. 75 GHz-nél nagyobb és legfeljebb 90 GHz közötti bármilyen frekvencián 10 mW-nál (10 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek, és "relatív sávszélességük" 5 %-nál nagyobb; vagy h. Bármilyen 90 GHz-t meghaladó frekvencián 0,1 nW-nál (- 70 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek; 1. megjegyzés : Nem használt. 2. megjegyzés : Az olyan "MMIC" ellenőrzési státusát, amelynek névleges működési frekvenciája a 3A001.b.2.a-3A001.b.2.h pontban megadott, egynél több frekvenciatartományban szereplő frekvenciákat tartalmaz, a legalacsonyabb átlagos maximális kimeneti telítési teljesítményre vonatkozó ellenőrzési küszöb határozza meg. 3. megjegyzés : A 3A-ban található 1. és 2. megjegyzés azt jelenti, hogy a 3A001.b.2. pont nem vonja ellenőrzés alá az olyan "MMIC"-ket, amelyeket kifejezetten más jellegű alkalmazáshoz terveztek, pl.: telekommunikációhoz, radarhoz, gépkocsihoz. 3. Diszkrét mikrohullámú tranzisztorok, amelyek az alábbi kategóriák valamelyikébe esnek: a. 2,7 GHz-nél nagyobb, de legfeljebb 6,8 GHz-es frekvencián való működésre méretezettek, és rendelkeznek az alábbiak valamelyikével: 1. 2,7 GHz-nél nagyobb és legfeljebb 2,9 GHz nagyságú frekvencián 400 W-nál (56 dBm) nagyobb maximális kimeneti telítési teljesítmény; 2. 2,9 GHz-nél nagyobb és legfeljebb 3,2 GHz nagyságú frekvencián 205 W-nál (53,12 dBm) nagyobb maximális kimeneti telítési teljesítmény; 3. 3,2 GHz-nél nagyobb és legfeljebb 3,7 GHz nagyságú frekvencián 115 W-nál (50,61 dBm) nagyobb maximális kimeneti telítési teljesítmény; vagy 4. 3,7 GHz-nél nagyobb és legfeljebb 6,8 GHz nagyságú frekvencián 60 W-nál (47,78 dBm) nagyobb maximális kimeneti telítési teljesítmény; b. 6,8 GHz-nél nagyobb, de legfeljebb 31,8 GHz-es frekvencián való működésre méretezettek, és rendelkeznek az alábbiak valamelyikével: 1. 6,8 GHz-nél nagyobb és legfeljebb 8,5 GHz nagyságú frekvencián 50 W-nál (47 dBm) nagyobb maximális kimeneti telítési teljesítmény; 2. 8,5 GHz-nél nagyobb és legfeljebb 12 GHz nagyságú frekvencián 15 W-nál (41,76 dBm) nagyobb maximális kimeneti telítési teljesítmény; 3. 12 GHz-nél nagyobb és legfeljebb 16 GHz nagyságú frekvencián 40 W-nál (46 dBm) nagyobb maximális kimeneti telítési teljesítmény; vagy 4. 16 GHz-nél nagyobb és legfeljebb 31,8 GHz nagyságú frekvencián 7 W-nál (38,45 dBm) nagyobb maximális kimeneti telítési teljesítmény; c. 31,8 GHz-nél nagyobb és legfeljebb 37 GHz nagyságú frekvencián 0,5 W-nál (27 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek; d. 37 GHz-nél nagyobb és legfeljebb 43,5 GHz nagyságú frekvencián 1 W-nál (30 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek; e. Bármilyen 43,5 GHz-t meghaladó frekvencián 0,1 nW-nál (- 70 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek; vagy f. A 3A001.b.3.a.-3A001.b.3.e. pontban meghatározottaktól eltérő és az összes, 8,5 GHz-nél nagyobb és legfeljebb 31,8 GHz nagyságú frekvencián 5 W-nál (37,0 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek; 1. megjegyzés : Az olyan, a 3A001.b.3.a.-3A001.b.3.e. pontban meghatározott tranzisztor ellenőrzési státusát, amelynek névleges működési frekvenciája a 3A001.b.3.a-3A001.b.3.e. pontban megadott, egynél több frekvenciatartományban szereplő frekvenciákat tartalmaz, a legalacsonyabb átlagos maximális kimeneti telítési teljesítményre vonatkozó ellenőrzési küszöb határozza meg. 2. megjegyzés : A 3A001.b.3. pont magában foglalja a tokozatlan, a hordozóra szerelt és a tokozott chipeket. Egyes diszkrét tranzisztorok más néven teljesítményerősítőkként is szerepelhetnek, de e diszkrét tranzisztorok státusát a 3A001.b.3. határozza meg. 4. Szilárdtest mikrohullámú erősítők és szilárdtest mikrohullámú erősítőket tartalmazó mikrohullámú részegységek/modulok, amelyek az alábbi kategóriák valamelyikébe esnek: a. 2,7 GHz-nél nagyobb, de legfeljebb 6,8 GHz-es frekvencián való működésre méretezettek, "relatív sávszélességük" 15 %-nál nagyobb, és rendelkeznek az alábbiak valamelyikével: 1. 2,7 GHz-nél nagyobb és legfeljebb 2,9 GHz nagyságú frekvencián 500 W-nál (57 dBm) nagyobb maximális kimeneti telítési teljesítmény; 2. 2,9 GHz-nél nagyobb és legfeljebb 3,2 GHz nagyságú frekvencián 270 W-nál (54,3 dBm) nagyobb maximális kimeneti telítési teljesítmény; 3. 3,2 GHz-nél nagyobb és legfeljebb 3,7 GHz nagyságú frekvencián 200 W-nál (53 dBm) nagyobb maximális kimeneti telítési teljesítmény; vagy 4. 3,7 GHz-nél nagyobb és legfeljebb 6,8 GHz nagyságú frekvencián 90 W-nál (49,54 dBm) nagyobb maximális kimeneti telítési teljesítmény; b. 6,8 GHz-nél nagyobb, de legfeljebb 31,8 GHz-es frekvencián való működésre méretezettek, "relatív sávszélességük" 10 %-nál nagyobb, és rendelkeznek az alábbiak valamelyikével: 1. 6,8 GHz-nél nagyobb és legfeljebb 8,5 GHz nagyságú frekvencián 70 W-nál (48,45 dBm) nagyobb maximális kimeneti telítési teljesítmény; 2. 8,5 GHz-nél nagyobb és legfeljebb 12 GHz nagyságú frekvencián 50 W-nál (47 dBm) nagyobb maximális kimeneti telítési teljesítmény; 3. 12 GHz-nél nagyobb és legfeljebb 16 GHz nagyságú frekvencián 30 W-nál (44,77 dBm) nagyobb maximális kimeneti telítési teljesítmény; vagy 4. 16 GHz-nél nagyobb és legfeljebb 31,8 GHz nagyságú frekvencián 20 W-nál (43 dBm) nagyobb maximális kimeneti telítési teljesítmény; c. 31,8 GHz-nél nagyobb és legfeljebb 37 GHz nagyságú frekvencián 0,5 W-nál (27 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek; d. 37 GHz-nél nagyobb és legfeljebb 43,5 GHz közötti bármilyen frekvencián 2 W-nál (33 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek, és "relatív sávszélességük" 10 %-nál nagyobb; e. 43,5 GHz-nél nagyobb frekvencián való működésre méretezettek, és rendelkeznek az alábbiak valamelyikével: 1. 43,5 GHz-nél nagyobb és legfeljebb 75 GHz nagyságú frekvencián 0,2 W-nál (23 dBm) nagyobb maximális kimeneti telítési teljesítmény, és 10 %-nál nagyobb "relatív sávszélesség"; 2. 75 GHz-nél nagyobb és legfeljebb 90 GHz nagyságú frekvencián 20 mW-nál (13 dBm) nagyobb maximális kimeneti telítési teljesítmény, és 5 %-nál nagyobb "relatív sávszélesség"; vagy 3. bármilyen 90 GHz-nél nagyobb frekvencián 0,1 nW-nál (- 70 dBm) nagyobb maximális kimeneti telítési teljesítmény; vagy f. nem használt N.B.1. Az "MMIC" erősítőket illetően lásd a 3A001.b.2. pontot. N.B.2. Az ‘adó/vevő modulok' és ‘adó modulok' esetében lásd a 3A001.b.12. pontot. N.B.3. A jelanalizátorok működtetésére vagy azok frekvenciatartományának kiterjesztésére tervezett átalakítók és harmonikus keverők, a jelgenerátorok, a hálózati analizátorok vagy a mikrohullámú mérő vevőkészülékeket illetően lásd a 3A001.b.7. pontot: 1. megjegyzés : Nem használt. 2. megjegyzés : Az olyan termék ellenőrzési státusát, amelynek névleges működési frekvenciája a 3A001.b.4.a-3A001.b.4.e. alpontban megadott, egynél több frekvenciatartományban szereplő frekvenciákat tartalmaz, a legalacsonyabb átlagos maximális kimeneti telítési teljesítményre vonatkozó ellenőrzési küszöb határozza meg. 5. Elektronikusan vagy mágnesesen hangolható sáváteresztő, vagy sávzáró szűrők, amelyeknek több mint 5 olyan hangolható rezonátoruk van, amely 10 μs-nál rövidebb idő alatt 1,5:1 frekvencia sávban (fmax/fmin) biztosítják a hangolást, és rendelkeznek az alábbi jellemzők bármelyikével: a. a sáváteresztő szűrő sávszélessége több, mint a középfrekvencia 0,5 %-a; vagy b. a sávzáró szűrő sávszélessége kisebb, mint a középfrekvencia 0,5 %-a; 6. Nem használt; 7. Átalakítók és harmonikus keverők, amelyek az alábbiak egyikét képezik: a. "jelanalizátorok" frekvenciatartományának 90 GHz-en túli kiterjesztésére tervezték őket; b. jelgenerátorok működési tartományának kiterjesztésére tervezték őket, az alábbiak szerint: 1. 90 GHz felett; 2. a 43,5 GHz-et meghaladó, de 90 GHz-nél kisebb frekvenciatartományban bárhol 100 mW-ot (20 dBm) meghaladó kimenőteljesítményhez; c. hálózati analizátorok működési tartományának kiterjesztésére tervezték őket, az alábbiak szerint: 1. 110 GHz felett; 2. a 43,5 GHz-et meghaladó, de 90 GHz-nél kisebb frekvenciatartományban bárhol 31,62 mW-ot (15 dBm) meghaladó kimenőteljesítményhez; 3. a 90 GHz-et meghaladó, de 110 GHz-nél kisebb frekvenciatartományban bárhol 1 mW-ot (0 dBm) meghaladó kimenőteljesítményhez; vagy d. mikrohullámú mérő vevőkészülékek frekvenciatartományának 110 GHz-en túli kiterjesztésére tervezték őket; 8. A 3A001.b.1. pont alatt meghatározott "vákuumos elektronikus eszközöket" tartalmazó mikrohullámú teljesítményerősítők, amelyek rendelkeznek az alábbi jellemzők mindegyikével: a. 3 GHz feletti üzemi frekvencia; b. a tömegarányhoz viszonyított, 80 W/kg-ot meghaladó átlagos kimeneti teljesítmény; és c. 400 cm3-nél kisebb térfogat; Megjegyzés : A 3A001.b.8. pont nem vonja ellenőrzés alá az "ITU által" rádió-kommunikációs szolgáltatóknak, de nem rádió-meghatározásra "kiosztott" frekvenciákon történő működésre tervezett vagy minősített berendezéseket. 9. Legalább egy haladóhullámú "vákuum elektronikus eszközből", egy "monolitikus, mikrohullámú integrált áramkörből" ("MMIC)" és egy integrált elektronikus teljesítményszabályozóból álló mikrohullámú teljesítménymérők (MPM), amelyek rendelkeznek az alábbi jellemzők mindegyikével: a. 10 másodpercnél rövidebb ‘bekapcsolási idő', amely alatt kikapcsolt állapotból teljesen működképes állapot érhető el; b. a Wattban kifejezett maximális névleges teljesítmény 10 cm3/W szorzatánál kisebb térfogat; és c. egy oktávnál nagyobb (fmax > 2fmin) "pillanatnyi sávszélesség", és rendelkezik az alábbiak valamelyikével: 1. 18 GHz-cel egyenlő vagy annál kisebb frekvencia esetében a rádiófrekvencia kimenőteljesítménye 100 W-nál nagyobb; vagy 2. 18 GHz-nél nagyobb frekvencia. Műszaki megjegyzések : 1. A 3A001.b.9.b. alpont szerinti térfogat kiszámítására az alábbi példa szolgál: 20 W maximális névleges teljesítmény esetén a térfogat: 20 W × 10 cm3/W = 200 cm3. 2. A 3A001.b.9.a. alpont szerinti ‘bekapcsolási idő' az az időtartam, amely alatt kikapcsolt állapotból teljesen működőképes állapot érhető el, vagyis az magában foglalja a mikrohullámú teljesítménymérő bemelegedési idejét is. 10. Olyan egyoldalsávos (SBB) fáziszajjal működő oszcillátorok vagy oszcillátorszerelvények, amely a 10 Hz ≤ F ≤ 10 kHz közötti tartományban bárhol jobb, mint -(126 + 20log10F - 20log10f); Műszaki megjegyzés : A 3A001.b.10. pontban F a működési frekvenciától történő eltérés Hz-ben, f pedig a működési frekvencia MHz-ben kifejezve. 11. ‘Frekvenciaszintetizáló', "elektronikus részegységek", amelynek "frekvenciakapcsolási ideje" az alábbiak bármelyike: a. 143 ps-nél kevesebb; b. a 4,8 GHz-nél nagyobb, de legfeljebb 31,8 GHz közötti szintetizált frekvenciatartományban a 2,2 GHz-et meghaladó frekvenciaváltás esetén a frekvenciakapcsolási idő kevesebb, mint 100 μs; c. nem használt; d. a 31,8 GHz-nél nagyobb, de legfeljebb 37 GHz közötti szintetizált frekvenciatartományban az 550 MHz-et meghaladó frekvenciaváltás esetén a frekvenciakapcsolási idő kevesebb, mint 500 μs; e. a 37 GHz-nél nagyobb, de legfeljebb 75 GHz közötti szintetizált frekvenciatartományban a 2,2 GHz-et meghaladó frekvenciaváltás esetén a frekvenciakapcsolási idő kevesebb, mint 100 μs; f. a 75 GHz-nél nagyobb, de legfeljebb 90 GHz közötti szintetizált frekvenciatartományban az 5,0 GHz-et meghaladó frekvenciaváltás esetén a frekvenciakapcsolási idő kevesebb, mint 100 μs; vagy g. a 90 GHz-et meghaladó szintetizált frekvenciatartományban a frekvenciakapcsolási idő kevesebb, mint 1 ms; Műszaki megjegyzés : ‘Frekvenciaszintetizátor' (frequency synthesiser): tekintet nélkül a ténylegesen alkalmazott technikára, bármilyen fajta frekvenciaforrás, amely többszörös szimultán vagy alternatív kimeneti frekvenciát biztosít, egy vagy több kimenetről, és amelyet kevesebb számú standard (vagy mester) frekvencia vezérel, alakít, illetve amely ezekből ered. N.B. Az általános felhasználású független "jelanalizátorok", jelgenerátorok, hálózati analizátorok és mikrohullámú mérő vevőkészülékek a 3A002.c., a 3A002.d., a 3A002.e. és a 3A002.f. alpontban szerepelnek. 12. 2,7 GHz-nél nagyobb frekvencián való működésre méretezett ‘adó/vevő modulok', ‘adó/vevő MMIC-k', ‘adó modulok' és ‘adó MMIC-k', amelyek rendelkeznek az összes alábbi jellemzővel: a. bármely csatorna esetében az 505,62-nél nagyobb maximális kimeneti telítési teljesítmény (wattban), Psat, osztva a maximális működési frekvencia négyzetével (GHz-ben) [Psat>505,62 W*GHz2/fGHz 2]; b. "relatív sávszélességük" bármely csatorna esetében 5 %-nál nagyobb; c. bármely planáris, d (cm-ben megadott) hosszúságú oldala egyenlő vagy kisebb, mint 15 osztva a legalacsonyabb (GHz-ben megadott) üzemi frekvenciával [d ≤ 15cm*GHz*N/fGHz], ahol N az adó vagy adó/vevő csatornák száma; és d. csatornánként egy elektronikusan változtatható fáziseltoló. Műszaki megjegyzések : 1. ‘Adó/vevő modul': olyan többfunkciós "elektronikus részegység", amely kétirányú amplitúdó- és fázisellenőrzést biztosít jelek adásához és vételéhez. 2. ‘Adó modul': olyan "elektronikus részegység", amely amplitúdó- és fázisellenőrzést biztosít jelek adásához. 3. ‘Adó/vevő MMIC': olyan többfunkciós "MMIC", amely kétirányú amplitúdó- és fázisellenőrzést biztosít jelek adásához és vételéhez. 4. ‘Adó MMIC': olyan "MMIC", amely amplitúdó- és fázisellenőrzést biztosít jelek adásához. 5. A 2,7 GHz-ig terjedő vagy annál kisebb névleges működési tartományú [d ≤ 15 cm*GHz/2,7 GHz] adó/vevő modulok vagy adó modulok esetében a 3A001.b.12.c. pont képletében a 2,7 GHz-et kell a legalacsonyabb üzemi frekvenciaként (fGHz) alkalmazni. 6. A 3A001.b.12. pont a hőelnyelő nélküli ‘adó/vevő modulokra' vagy ‘adó modulokra' vonatkozik. A 3A001.b.12.c. alpontban a d értéke nem foglalja magában a hőelnyelőként működő ‘adó/vevő modul' vagy ‘adó modul' arányát. 7. Az ‘adó/vevő modulok', vagy ‘adó modulok', vagy ‘adó/vevő MMIC-k' vagy ‘adó MMIC-k' rendelkezhetnek N számú integrált sugárzó antenna elemmel, ahol N az adó vagy adó/vevő csatornák száma.

c. Akusztikai hullámeszközök, és a kifejezetten ezekhez tervezett alkatrészek, amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. Felületi akusztikai hullám és felületi terjedésű (shallow bulk) akusztikai hullámeszközök, amelyek rendelkeznek az alábbiak bármelyikével: a. A vivőfrekvencia meghaladja a 6 GHz-et; b. A vivőfrekvencia nagyobb, mint 1 GHz, de nem haladja meg a 6 GHz-et, és rendelkezik az alábbi jellemzők bármelyikével: 1. a ‘mellékhurok frekvencia elnyomása' meghaladja a 65 dB-t; 2. a maximális késleltetési idő és a sávszélesség szorzata (az időt s-ban (μs) és a sávszélességet MHz-ben mérve) több, mint 100; 3. a sávszélesség nagyobb, mint 250 MHz; vagy 4. a szórási késleltetés nagyobb, mint 10 μs; vagy c. 1 GHz vagy annál kisebb vivőfrekvencia, és az alábbi jellemzők bármelyike: 1. a maximális késleltetési idő és a sávszélesség szorzata (az időt s-ban (μs) és a sávszélességet MHz-ben mérve) több, mint 100; 2. a szórási késleltetés nagyobb, mint 10 μs; vagy 3. a ‘mellékhurok frekvencia elnyomása' meghaladja a 65 dB-t, a sávszélesség pedig nagyobb, mint 100 MHz; Műszaki megjegyzés : A ‘mellékhurok frekvenciaelnyomása' az adatlapon meghatározott legnagyobb frekvenciaelnyomási érték. 2. Tömb akusztikai hullámeszközök, amelyek lehetővé teszik a jelek közvetlen feldolgozását 6 GHz-et meghaladó frekvencián; 3. Akusztikai-optikai "jelfeldolgozó" eszközök, melyek az akusztikai hullámok (tömbhullám vagy felületi hullám) és a fényhullámok közötti kölcsönhatást használják fel, és lehetővé teszik jelek vagy képek közvetlen feldolgozását, beleértve a színképelemzést, a korrelációt és a konvolúciót is; Megjegyzés : A 3A001.c. alpont nem vonja ellenőrzés alá azokat az akusztikai hullámeszközöket, amelyek egyszűrős sáváteresztő, aluláteresztő, felüláteresztő vagy lyukszűrésre vagy rezonáló funkcióra korlátozódnak.

d. "Szupravezető" anyagokból gyártott alkatrészeket tartalmazó, kifejezetten legalább az egyik "szupravezető" alkotóelem "kritikus hőmérséklete" alatti hőmérsékleten történő működésre tervezett elektronikus berendezések vagy áramkörök, amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. "szupravezető" kapuval rendelkező digitális áramkörök áramkapcsolása, ha kapunként a késleltetési idő (másodperc) és kapunként a teljesítményveszteség (Watt) szorzata kisebb, mint 10-14 J; vagy 2. a frekvencia kiválasztása minden frekvencián 10 000 -nél nagyobb jósági tényezőjű rezgőkörökkel történik;

e. Nagy energiájú eszközök, az alábbiak szerint: 1. ‘Cellák', az alábbiak szerint: a. ‘primer cellák', amelyek 20 °C-on a következők bármelyikével rendelkeznek; 1. 550 Wh/kg-ot meghaladó ‘energiasűrűség' és 50 W/kg-ot meghaladó ‘folyamatos teljesítménysűrűség'; vagy 2. 50 Wh/kg-ot meghaladó ‘energiasűrűség' és 350 W/kg-ot meghaladó ‘folyamatos teljesítménysűrűség'; vagy b. 20 °C-on 350 Wh/kg-ot meghaladó ‘energiasűrűségű'‘másodlagos cellák'; Műszaki megjegyzések : 1. A 3A001.e.1. pont alkalmazásában az ‘energiasűrűséget' (Wh/kg) úgy kapjuk meg, hogy az átlagos feszültséget szorozzuk az amperórában (Ah) kifejezett névleges kapacitással, és osztjuk a kilogrammban mért tömeggel. Amennyiben a névleges kapacitás nem került meghatározásra, az energiasűrűséget úgy kapjuk meg, hogy a névleges feszültséget négyzetre emeljük és szorozzuk az órában kifejezett teljesítménnyel és osztjuk az ohmban kifejezett teljesítményterheléssel és a kilogrammban mért tömeggel. 2. A 3A001.e.1. pont alkalmazásában a ‘cella' olyan elektrokémiai eszköz, amely pozitív és negatív elektródákkal, valamint elektrolittal rendelkezik, és elektromos energia forrása. Ez a telepek alapvető építőeleme. 3. A 3A001.e.1.a. alpont alkalmazásában a ‘primer cella' olyan ‘cella', amelyet nem más források általi töltésre terveztek. 4. A 3A001.e.1.b. alpont alkalmazásában a ‘másodlagos cella' olyan ‘cella', amelyet külső elektromos forrás általi töltésre terveztek. 5. A 3A001.e.1.a. alpont alkalmazásában a ‘folyamatos teljesítménysűrűséget' (W/kg) úgy kapjuk meg, hogy az átlagos feszültséget szorozzuk az amperben (A) kifejezett meghatározott maximális folyamatos kisütési áramerősséggel, és osztjuk a kilogrammban mért tömeggel. A ‘folyamatos teljesítménysűrűség' más néven: meghatározott teljesítmény. Megjegyzés : A 3A001.e.1. pont nem vonja ellenőrzés alá a telepeket, így az egy cellából álló telepeket sem. 2. Nagy energiájú tárolókondenzátorok, az alábbiak szerint: N.B. LÁSD MÉG: 3A201.a. és katonai célú termékek ellenőrzési jegyzéke. a. Kondenzátorok, melyek ismétlési frekvenciája kisebb, mint 10 Hz (egytöltetű kondenzátorok), és amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. Legalább 5 kV névleges feszültség; 2. Legalább 250 J/kg energiasűrűség; és 3. Az összenergia legalább 25 kJ; b. Legalább 10 Hz ismétlési frekvenciájú kondenzátorok (ismétlő kondenzátorok), amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. Legalább 5 kV névleges feszültség; 2. Legalább 50 J/kg energiasűrűség; 3. Az összenergia legalább 100 J; és 4. Legalább 10 000 töltési/kisülési ciklus élettartam; 3. 1 másodpercnél rövidebb idejű teljes feltöltésre vagy kisütésre tervezett "szupravezető" elektromágnesek vagy mágnestekercsek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: N.B. LÁSD MÉG: 3A201.b Megjegyzés : A 3A001.e.3. pont nem vonja ellenőrzés alá a kifejezetten mágneses rezonancia képalkotó (MRI) orvosi berendezésekhez készített "szupravezető" elektromágneseket, illetve mágnestekercseket. a. a kisütés során szállított maximális energia az első másodpercben meghaladja a 10 kJ-t; b. az áram alatti tekercsek belső átmérője több, mint 250 mm; és c. a névleges mágneses indukció több, mint 8 T, vagy a tekercsben a "teljes áramsűrűség" több, mint 300 A/mm2; 4. "Űrminősítésű", 1 367 watt per négyzetméter (W/m2) szimulált ‘AM0' besugárzás esetén, 301 K (+ 28 °C) üzemi hőmérsékleten 20 %-ot meghaladó minimális átlagos hatékonyságú napelemek, cellás belső kapcsolású borító üveges (CIC) szerelt egységek, nappanelek és napkollektorok; Műszaki megjegyzés : Az ‘AM0' vagy ‘Air Mass Zero' (zéró légtömeg) a napfény spektrális sugárzására vonatkozik a Föld külső atmoszférájában, amikor a Föld és a Nap távolsága egy csillagászati egység (AU).

f. Forgóbemenet típusú tengely abszolútpozíció-kódolók, amelyek "pontossága" ± 1,0 ívmásodperc vagy kevesebb (jobb) annál;

g. Elektromos, optikai vagy elektronsugárzás-vezérlésű kapcsolási módozatú, szilárd test impulzusos áramkapcsoló tirisztorok és ‘tirisztor-modulok', amelyek rendelkeznek az alábbiak bármelyikével: 1. a maximális bekapcsolási áramváltozási meredekség (di/dt) több mint 30 000 A/μs, a pozitív zárófeszültség pedig több, mint 1 100 V; vagy 2. a maximális bekapcsolási áramváltozási meredekség (di/dt) több, mint 2 000 A/s, és az alábbiak mindegyike fennáll: a. A pozitív csúcszáró feszültség 3 000 V vagy annál nagyobb; és b. a csúcsáram meghaladja a 3 000 A-t vagy azzal egyenlő. 1. megjegyzés : A 3A001.g alpont magában foglalja az alábbiakat: - szilíciumvezérlésű egyenirányítók (SCR) - elektromos kapcsolású tirisztorok (ETT) - fény kapcsolású tirisztor (LTT) - integrált vezérlőelektródával szabályozott tirisztor (IGCT) - vezérlőelektródával kikapcsolható tirisztor (GTO) - MOS-vezérlésű tirisztor (MCT) - Szolidtron 2. megjegyzés : A 3A001.g. alpont nem vonja ellenőrzés alá a polgári vasúti közlekedés és a "polgári repülőgépek" általi felhasználás céljára tervezett berendezésekbe beépített tirisztorokat és ‘tirisztor modulokat'. Műszaki megjegyzés : A 3A001.g. alpont alkalmazásában a ‘tirisztor modul' egy vagy több tirisztort tartalmaz.

h. Szilárdtest alapú teljesítményelektronikai félvezető kapcsolók, diódák vagy ‘modulok', amelyek az alábbi jellemzők mindegyikével rendelkeznek: 1. 488 K (215 °C) feletti maximális pn-átmenet hőmérsékleten is működőképesek; 2. a pozitív ismétlődő csúcszáró feszültség (zárófeszültség) meghaladja a 300 V-ot; és 3. az egyenáram erőssége nagyobb, mint 1 A. 1. megjegyzés : A 3A001.h. alpontban említett pozitív ismétlődő csúcszáró feszültség magában foglalja a nyelő-forrás feszültséget, a kollektor-emitter feszültséget, a negatív ismétlődő csúcszáró feszültséget és a pozitív ismétlődő lezáró csúcsfeszültséget. 2. megjegyzés : A 3A001.h alpont magában foglalja az alábbiakat: - záróréteges térvezérlésű tranzisztorok (JFET) - záróréteges térvezérlésű vertikális tranzisztorok (VJFET) - fém-oxid-félvezető térvezérlésű tranzisztorok (MOSFET) - kétszeresen diffundáltatott, fém-oxid-félvezető térvezérlésű tranzisztorok (DMOSFET) - szigetelt vezérlőelektródos bipoláris tranzisztorok (IGBT) - nagy elektronmozgékonyságú tranzisztorok (HEMT) - bipoláris tranzisztorok (BJT) - tirisztorok és szilíciumvezérlésű egyenirányítók (SCR) - vezérlőelektródával kikapcsolható tirisztor (GTO) - emittorral kikapcsolható tirisztorok (ETO) - PiN-diódák - schottky-diódák 3. megjegyzés : A 3A001.h. pont nem vonja ellenőrzés alá a polgári gépkocsik, a polgári vasúti közlekedés és a "polgári légi járművek" általi felhasználás céljára tervezett berendezésekbe beépített kapcsolókat, diódákat vagy ‘modulokat'. Műszaki megjegyzés : A 3A001.h. alpont alkalmazásában a ‘modulok' magukban foglalnak egy vagy több, szilárdtest alapú teljesítményelektronikai félvezető kapcsolót vagy diódát.

i. Analóg jelekre tervezett intenzitás, amplitúdó vagy fázis elektro-optikai modulátorok, amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. 10 GHz-nél nagyobb, de 20 GHz-nél kisebb maximális működési frekvencia, optikai beiktatási csillapítása legfeljebb 3 dB, és rendelkezik az alábbi jellemzők bármelyikével: a. 2,7 V-nál kevesebb ‘félhullámú feszültség' (‘Vπ') 1 GHz vagy annál kisebb frekvencián mérve; vagy b. 4 V-nál kisebb ‘Vπ', több mint 1 GHz frekvencián mérve; vagy 2. Legalább 20 GHz vagy annál nagyobb maximális működési frekvencia, optikai beiktatási csillapítása legfeljebb 3 dB, és rendelkezik az alábbi jellemzők bármelyikével: a. 3,3 V-nál kisebb ‘Vπ', 1 GHz vagy annál kisebb frekvencián mérve; vagy b. 5 V-nál kisebb ‘Vπ', több mint 1 GHz frekvencián mérve. Megjegyzés : A 3A001.i. alpont magában foglalja az optikai bemeneti és kimeneti csatlakozóval (pl. optikai-szálkivezetés) rendelkező elektro-optikai modulátorokat. Műszaki megjegyzés : A 3A001.i. alpont alkalmazásában a ‘félhullámfeszültség' (‘Vπ'): az optikai modulátoron keresztül a fényforrás hullámhosszában bekövetkező 180 fokos fázisváltozás eléréséhez szükséges alkalmazott feszültség.

3A002Általános célú "elektronikus részegységek", modulok és berendezések az alábbiak szerint:

a. Rögzítőberendezések és oszcilloszkópok az alábbiak szerint: 1. Nem használt; 2. Nem használt; 3. Nem használt; 4. Nem használt; 5. Nem használt; 6. Az alábbi jellemzők mindegyikével rendelkező digitális adatrögzítők: a. lemezre vagy szilárdtestmeghajtó-memóriára való, tartós, több mint 6,4 Gbit/s ‘folyamatos átbocsátási sebesség'; és b. a rádiófrekvenciás jeladatok rögzítése közben történő "jelfeldolgozás"; Műszaki megjegyzések : 1. Párhuzamos buszfelépítésű rögzítők esetén a ‘folyamatos átbocsátási sebességet' a maximális szósebesség és a szó bitekben mért hosszának a szorzata adja. 2. A ‘folyamatos átbocsátási sebesség' a berendezésnek az a legnagyobb adatsebessége, amelynél a lemezre vagy szilárdtestmeghajtó-memóriára való rögzítéskor a digitálisadat-beviteli gyakoriság vagy digitalizáló átalakítási arány fenntartása mellett adatveszteség nem lép fel. 7. Valós idejű oszcilloszkópok, melyek zajfeszültsége a függőleges tengely teljes skálázása 2 %-ának felelő meg (rms, négyzetes középérték), ahol a 3dB-es sávszélességű inputok a 60 GHz-es és afeletti sávban csatornánként a legkevesebb zajt adják. Megjegyzés : A 3A002.a.7. pont nem vonja ellenőrzés alá az ekvivalens idejű mintavételezést alkalmazó oszcilloszkópokat.

b. Nem használt;

c. "Jelanalizátorok", az alábbiak szerint: 1. "Jelanalizátorok", amelyek a 31,8 GHz-et meghaladó, de 37 GHz-et meg nem haladó frekvenciatartományon belül bárhol 40 MHz-et meghaladó, 3 dB felbontási sávszélességgel (RBW) rendelkeznek; 2. "Jelanalizátorok", amelyek kijelzett átlagos zajszintje (DANL) a 43,5 GHz-et meghaladó, de 90 GHz-et meg nem haladó frekvenciatartományon belül bárhol alacsonyabb (jobb), mint - 150 dBm/Hz; 3. "Jelanalizátorok", amelyek frekvenciája meghaladja a 90 GHz-et; 4. "Jelanalizátorok", amelyek rendelkeznek az alábbi jellemzők mindegyikével: a. 170 MHz-et meghaladó ‘valós idejű sávszélesség'; és b. Rendelkeznek az alábbiak bármelyikével: 1. 100 % észlelési valószínűségű észlelés kevesebb, a teljes amplitúdóról kevesebb, mint 3 dB-es csökkenéssel hézagok vagy a 15 μs vagy rövidebb időtartamú jelek ablakhatása miatt; vagy 2. a 15 μs vagy rövidebb időtartamú jelek esetében 100 %-os triggerelési (fogási) valószínűségű ‘frekvenciamaszk-trigger' funkció; Műszaki megjegyzések : 1. ‘Valós idejű sávszélesség' (real-time bandwith): az a legszélesebb frekvenciasáv, amelyre az analizátor - a Fourier- vagy más olyan, időben diszkrét transzformáció felhasználásával, amely minden bemenő időadatot úgy dolgoz fel, hogy a mért amplitúdó ne csökkenjen több mint 3 dB-lel a tényleges jelamplitúdó alá lyukak vagy ablakhatás miatt - folyamatosan teljesen át tudja alakítani az időtartomány-adatokat frekvenciatartomány-adatokká, és kiadja vagy kijelzi a transzformált adatokat. 2. A 3A002.c.4.b.1. pontban szereplő észlelési valószínűség más néven elfogási valószínűség vagy befogási valószínűség. 3. A 3A002.c.4.b.1. pont alkalmazásában, a 100 %-os észlelési valószínűségre vonatkozó időtartam megegyezik a meghatározott szintű mérési bizonytalansághoz szükséges minimális jelidőtartammal. 4. ‘Frekvenciamaszk-trigger' (frequency mask trigger): olyan mechanizmus, amelyben a kioldó funkció ki tudja választani a kiváltandó frekvenciasávot a vételi sávszélesség részsávjában, ugyanakkor nem veszi figyelembe az ugyanazon vételi sávszélességen esetlegesen előforduló egyéb jeleket. A ‘frekvenciamaszk-trigger' egynél több független korlátozássort tartalmazhat. Megjegyzés : A 3A002.c.4. pont nem vonja ellenőrzés alá azokat a "jelanalizátorokat", amelyek csak állandó százalékú sávszélesség-szűrőket (más néven oktáv vagy törtoktáv szűrőket) használnak. 5. Nem használt;

d. Jelgenerátorok, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. Specifikációjuk szerint a 31,8 GHz-et meghaladó, de 37 GHz-nél nem nagyobb frekvenciatartományban bárhol az alábbiak mindegyikével rendelkező impulzusmodulált jelek generálására alkalmasak: a. az ‘impulzus-időtartama' kevesebb, mint 25 ns; és b. a be-/kikapcsolási arány 65 dB vagy annál nagyobb; 2. Kimenőteljesítményük a 43,5 GHz-et meghaladó, de 90 GHz-et meg nem haladó frekvenciatartományban bárhol meghaladja a 100 mW-ot (20 dBm); 3. Az alábbi jellemzők valamelyikével bíró "frekvenciakapcsolási idő": a. nem használt; b. a 4,8 GHz-et meghaladó, de legfeljebb 31,8 GHz közötti frekvenciatartományban a 2,2 GHz-et meghaladó frekvenciaváltás esetén a frekvenciakapcsolási idő kevesebb, mint 100 μs; c. nem használt; d. a 31,8 GHz és 37 GHz közötti frekvenciatartományban az 550 MHz-et meghaladó frekvenciaváltás esetén a frekvenciakapcsolási idő kevesebb, mint 500 μs; e. a 37 GHz-et meghaladó, de legfeljebb 75 GHz közötti frekvenciatartományban a 2,2 GHz-et meghaladó frekvenciaváltás esetén a frekvenciakapcsolási idő kevesebb, mint 100 μs; vagy f. nem használt; g. a 75 GHz-et meghaladó, de legfeljebb 90 GHz közötti frekvenciatartományban az 5,0 GHz-et meghaladó frekvenciaváltás esetén a frekvenciakapcsolási idő kevesebb, mint 100 μs; 4. Egyoldalsávos (SSB) fáziszaj dBc/Hz-ben, amely meghatározása szerint eleget tesz az alábbiak bármelyikének: a. a 10 Hz ≤ F ≤ 10 kHz közötti tartományban és a 3,2 GHz-nél nagyobb, de legfeljebb 90 GHz közötti frekvenciatartományban bárhol -(126 + 20log10F - 20log10f)-nél kisebb (jobb); vagy b. a 10 kHz < F ≤ 100 kHz közötti tartományban és a 3,2 GHz-nél nagyobb, de legfeljebb 90 GHz közötti frekvenciatartományban bárhol -(206 - 20log10f)-nél kisebb (jobb); Műszaki megjegyzés : A 3A002.d.4. pontban F a működési frekvenciától történő eltérés Hz-ben, f pedig a működési frekvencia MHz-ben kifejezve. 5. Az alábbi jellemzők valamelyike által meghatározott digitális alapsávjelek ‘RF modulációs sávszélessége': a. a 4,8 GHz-et meghaladó, de 31,8 GHz-et meg nem haladó frekvenciatartományban meghaladja a 2,2 GHz-et; b. a 31,8 GHz-et meghaladó, de 37 GHz-et meg nem haladó frekvenciatartományban meghaladja az 550 MHz-et; c. a 37 GHz-et meghaladó, de 75 GHz-et meg nem haladó frekvenciatartományban meghaladja a 2,2 GHz-et; vagy d. a 75 GHz-et meghaladó, de 90 GHz-et meg nem haladó frekvenciatartományban meghaladja az 5,0 GHz-et; vagy Műszaki megjegyzés : ‘RF-modulációs sávszélesség': rádiófrekvenciás jelre modulált, digitálisan kódolt alapsávjel által lefoglalt rádiófrekvenciás (RF) sávszélesség. Információs sávszélességnek vagy vektormodulációs sávszélességnek is nevezik. Az I/Q digitális moduláció vektormodulációs rádiófrekvenciás kimeneti jel előállítására szolgáló technikai módszer, és e kimeneti jelre kifejezetten jellemző, hogy ‘RF-modulációs sávszélességgel' rendelkezik. 6. A maximális frekvencia meghaladja a 90 GHz-et; 1. megjegyzés : A 3A002.d. alpont alkalmazásában a jelgenerátorok magukban foglalják a digitális hullámforma generátorokat és a funkciógenerátorokat is. 2. megjegyzés : A 3A002.d. alpont nem vonja ellenőrzés alá azokat a berendezéseket, amelyekben a kimenő frekvenciát két vagy több kristályoszcillátor frekvenciájának összegzése vagy kivonása, vagy pedig az összegzés, illetve kivonás utáni eredmény szorzata adja. Műszaki megjegyzések : 1. A digitális hullámforma generátorok és funkciógenerátorok maximális frekvenciájának kiszámításához a minta/másodpercben kifejezett mintarátát el kell osztani 2,5-tel. 2. A 3A002.d.1.a. alpont alkalmazásában az ‘impulzus-időtartam' az impulzus belépő élén mért, az impulzus amplitúdója 50 %-ának megfelelő pont és az impulzus kilépő élén mért, az impulzus amplitúdója 50 %-ának megfelelő pont közötti időintervallumot jelenti.

e. Az alábbi jellemzők bármelyikével rendelkező hálózati analizátorok: 1. Kimenőteljesítményük a 43,5 GHz-et meghaladó, de 90 GHz-et meg nem haladó működési frekvenciatartományban bárhol meghaladja a 31,62 mW-ot (15 dBm); 2. Kimenőteljesítményük a 90 GHz-et meghaladó, de 110 GHz-et meg nem haladó működési frekvenciatartományban bárhol meghaladja az 1 mW-ot (0 dBm); 3. ‘Nemlineáris vektoros mérési funkció' 50 GHz-nél nagyobb, de legfeljebb 110 GHz frekvencián; vagy Műszaki megjegyzés : A ‘nemlineáris vektoros mérési funkció' egy eszköz azon képessége, hogy elemezze a nagyjelű tartományban vagy a nemlineáris torzítási tartományban lévő eszközök teszteredményeit. 4. a maximális üzemi frekvencia meghaladja a 110 GHz-et;

f. Mikrohullámú mérő vevőkészülékek, amelyek rendelkeznek a következő jellemzők mindegyikével: 1. a maximális üzemi frekvencia meghaladja a 110 GHz-et; és 2. képes az amplitúdó és a fázis egyszerre történő mérésére;

g. Az alábbi atomfrekvencia-etalonok bármelyike: 1. "űrminősítésű"; 2. nem rubídium és a hosszú távú stabilitás kisebb (jobb), mint 1 × 10-11/hónap; vagy 3. nem "űrminősítésű", és rendelkezik az alábbi jellemzők mindegyikével: a. rubídium-etalon; b. a hosszú távú stabilitás kisebb (jobb), mint 1 × 10-11/hónap; és c. a teljes energiafogyasztás 1 W-nál kevesebb.

h. "Elektronikus részegységek", modulok és berendezések, az alábbiak mindegyikének elvégzésére: 1. Analóg-digitális átalakítások, amelyek rendelkeznek az alábbi jellemzők bármelyikével: a. felbontásuk legalább 8 bit, de 10 bitnél kevesebb, 1,3 giga minta/másodpercnél (GSPS) nagyobb "mintabeviteli gyakorisággal"; b. felbontásuk legalább 10 bit, de 12 bitnél kevesebb, 1,0 giga minta/másodpercnél (GSPS) nagyobb "mintabeviteli gyakorisággal"; c. felbontásuk legalább 12 bit, de 14 bitnél kevesebb, 1,0 giga minta/másodpercnél (GSPS) nagyobb "mintabeviteli gyakorisággal"; d. felbontásuk legalább 14 bit, de 16 bitnél kevesebb, 400 mega minta/másodpercnél (MSPS) nagyobb "mintabeviteli gyakorisággal"; vagy e. felbontásuk legalább 16 bit, legalább 180 MSPS-nél nagyobb "mintabeviteli gyakorisággal"; és 2. Az alábbiak bármelyike: a. a digitalizált adatok kivitele; b. a digitalizált adatok tárolása; vagy c. a digitalizált adatok feldolgozása; N.B. A digitális adatrögzítők, oszcilloszkópok, "jelanalizátorok", jelgenerátorok, hálózati analizátorok és mikrohullámú mérő vevőkészülékek a 3A002.a.6., a 3A002.a.7., a 3A002.c., a 3A002.d., a 3A002.e. és a 3A002.f. pontban szerepelnek. Műszaki megjegyzések : 1. Az "n" bit felbontás a 2n szintű kvantálásra vonatkozik. 2. Az AD átalakítók felbontása a mért analóg inputot képviselő AD átalakító digitális kimeneti bitjeinek száma. A bitek tényleges számát (ENOB) nem használják az AD átalakítók felbontásának meghatározásához. 3. A nem szektorfésüléses többcsatornás "elektronikus részegységek", modulok vagy berendezések esetében a "mintabeviteli gyakoriságok" nem adódnak össze, és a "mintabeviteli gyakoriság" az egyes csatornák bármelyikének maximális mintavételi aránya. 4. A többcsatornás "elektronikus részegységeken", modulokon vagy berendezéseken a szektorfésüléses csatornák esetében a "mintabeviteli gyakoriságok" összeadódnak, és a "mintabeviteli gyakoriság" valamennyi szektorfésüléses csatorna maximális összesített mintavételi aránya. Megjegyzés : A 3A002.h. alpont magában foglalja az AD átalakító kártyákat, hullámforma-digitalizálókat, adatgyűjtő kártyákat, jelgyűjtő kártyákat és tranziens rögzítőket.

3A003Permetező hűtéses hőkezelő rendszerek, amelyek zárt hurok rendszerű folyadékkezelő vagy regeneráló berendezéseket használnak olyan teljesen lezárt helyen, ahol az elektronikai alkatrészekre dielektromos folyadékot permeteznek olyan, kifejezetten erre a célra tervezett permetező szórófejjel, amely úgy van kialakítva, hogy üzemi hőmérséklettartományban tartsa az elektronikai alkatrészeket, és a kifejezetten ezekhez tervezett alkatrészek.

3A101A 3A001. pont alatt meghatározottaktól eltérő elektronikus berendezések, eszközök és alkatrészek, az alábbiak szerint:

a. "Rakétákban" felhasználható analóg-digitális átalakítók, amelyeket úgy terveztek, hogy megfeleljenek a megerősített konstrukciójú berendezésekre vonatkozó katonai előírásoknak;

b. Olyan gyorsítók, amelyek képesek 2 MeV vagy azt meghaladó energiájú, felgyorsított elektronokból származó "bremsstrahlung" (fékezési sugárzás) segítségével előállított elektromágneses sugárzást közvetíteni, valamint az ezeket a gyorsítókat tartalmazó rendszerek. Megjegyzés : A fenti 3A101.b. alpont nem vonja ellenőrzés alá a kifejezetten orvosi célra tervezett berendezéseket.

3A102‘Rakétákban' való felhasználás céljára tervezett vagy módosított ‘termikus telepek'.

Műszaki megjegyzések :

1. A 3A102 pont szerinti ‘termikus telepek' olyan egyszeri felhasználásra szánt telepek, amelyek elektrolitként szilárd nem vezető szervetlen sót tartalmaznak. Ezek a telepek olyan pirolitikus anyagot foglalnak magukban, amely gyújtásra megolvasztja az elektrolitot és aktiválja a telepet.

2. A 3A102. pont alatt a ‘rakéták' kifejezés olyan komplett rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent, melyek hatósugara legalább 300 km.

3A201A 3A001. pont alatt meghatározottaktól eltérő elektronikus alkatrészek, az alábbiak szerint:

a. Kondenzátorok, amelyek rendelkeznek az alábbi jellemzőcsoportok valamelyikével: 1. a. névleges feszültségük nagyobb, mint 1,4 kV; b. a tárolt energia több, mint 10 J; c. kapacitásuk nagyobb, mint 0,5 μF; és d. 50 nH-nél kisebb soros induktivitás; vagy 2. a. névleges feszültségük nagyobb, mint 750 V; b. kapacitásuk nagyobb, mint 0,25 μF; és c. 10 nH-nél kisebb soros induktivitás;

b. Szupravezető szolenoid elektromágnesek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. Képesek 2 T-nál nagyobb mágneses tér létrehozására; 2. L/D (hossz/belső átmérő) arány nagyobb, mint 2; 3. Belső átmérőjük 300 mm-nél nagyobb; és 4. A belső térfogat központi 50 %-ában a mágneses tér egyenletessége jobb, mint 1 %. Megjegyzés : A 3A201.b. alpont nem vonja ellenőrzés alá a kifejezetten orvosi mágneses magrezonancia (NMR) megjelenítő rendszerekhez tervezett mágneseket, amelyeket e rendszerek ‘részeként' kerülnek kivitelre. A ‘részeként' kifejezés úgy értendő, hogy az fizikailag nem feltétlenül képezi ugyanannak a szállítmánynak a részét. Lehetőség van különböző forrásokból származó részszállításokra, feltéve, hogy a vonatkozó kiviteli dokumentumokból egyértelműen kiderül, hogy a szállítmány a megjelenítő rendszer ‘részét' képezi.

c. Impulzus-röntgengenerátorok vagy impulzusos elektrongyorsítók, amelyek rendelkeznek a következő jellemzőcsoportok valamelyikével: 1. a. Az elektrongyorsító csúcsenergiája 500 keV vagy annál nagyobb, de 25 MeV-nál kisebb; és b. A (K) ‘jósági tényező' 0,25 vagy annál nagyobb; vagy 2. a. Az elektrongyorsító csúcsenergiája 25 MeV vagy annál nagyobb; és b. A ‘csúcsteljesítmény' 50 MW-nál nagyobb. Megjegyzés : A 3A201.c. alpont nem vonja ellenőrzés alá sem az olyan berendezések alkatrészeit, amelyeket nem elektronnyaláb- vagy röntgensugárzás céljaira (pl. elektronmikroszkópia), sem azokat, amelyeket orvosi célra terveztek. Műszaki megjegyzések : 1. A ‘K'‘jósági tényezőt' a következőképpen kell meghatározni: K = 1,7 × 103V2,65Q ahol V az elektron csúcsenergiája millió elektronvoltban, "Q" a teljes gyorsított töltés coulombban, ha a gyorsító nyaláb impulzus-időtartama legfeljebb 1 μs. Ha a gyorsító nyaláb impulzus-időtartama 1 μs-nál nagyobb, akkor "Q" az 1 μs alatti maximális gyorsított töltés. A "Q" egyenlő az "i"-nek "t" idő szerinti integráljával, 1 μs-ra vagy az impulzus időtartamára vonatkoztatva, attól függően, hogy melyik a kisebb, ahol "i" a nyaláb áramerőssége amperben, "t" az idő másodpercben (Q = ∫ idt). 2. ‘Csúcsteljesítmény' = (csúcspotenciál voltban) × (csúcs sugáráram amperben). 3. A sugárimpulzus időtartam mikrohullámú gyorsító üregrezonátorok elvén alapuló gépekben az 1 μs érték és az egy mikrohullámú modulátor impulzusból eredő nyaláb időtartama közül a kisebb értékkel egyezik meg. 4. Mikrohullámú gyorsító üregrezonátorok elvén alapuló gépekben a sugár csúcsáram a sugárnyaláb-csomag időtartama alatti átlagos árammal egyenlő.

3A225A 0B001.b.13. pont alatt meghatározottaktól eltérő, változtatható vagy rögzített frekvenciájú motormeghajtóként használható frekvenciaváltók vagy generátorok, amelyek rendelkeznek az alábbi valamennyi jellemzővel:

N.B.1. A kifejezetten a frekvenciaváltó vagy generátor teljesítményének - a 3A225. pont alatt szereplő jellemzőknek való megfelelés érdekében történő - fokozására vagy felszabadítására tervezett "szoftvert" a 3D225. pont határozza meg.

N.B.2. A kifejezetten egy frekvenciaváltó vagy generátor teljesítményének - a 3A225. pont alatt szereplő jellemzőknek való megfelelés érdekében történő - megerősítését vagy kiaknázását célzó, kódok és kulcsok formájában megadott "technológiát" a 3E225. pont határozza meg.

a. többfázisú kimenet 40 VA vagy annál nagyobb teljesítménnyel;

b. működés 600 Hz vagy magasabb frekvencián; és

c. a frekvenciastabilitás jobb (kisebb), mint 0,2 %.

Megjegyzés : A 3A225. pont nem vonja ellenőrzés alá azon frekvenciaváltókat vagy generátorokat, amelyek a teljesítményt a fent meghatározottaknál kisebbre korlátozó hardver, "szoftver" vagy "technológiai" megszorításokkal rendelkeznek, feltéve, hogy eleget tesznek az alábbiak valamelyikének:

1. A teljesítménynövelés vagy a korlátozások feloldása érdekében vissza kell őket juttatni eredeti gyártójukhoz;

2. A 3A225. pont alatt szereplő jellemzőknek való megfelelés érdekében a 3D225. pont alatt meghatározottak szerinti "szoftvert" igényelnek a teljesítmény javításához vagy kiaknázásához; vagy

3. A 3A225. pont alatt szereplő jellemzőknek való megfelelés érdekében a 3E225. pont alatt meghatározottak szerinti, kódok és kulcsok formájában megadott "technológiát" igényelnek a teljesítmény javításához vagy kiaknázásához.

Műszaki megjegyzések :

1. A 3A225. pont szerinti frekvenciaváltók konverter, illetve inverter néven is ismertek.

2. A 3A225. pont alatt szereplő frekvenciaváltókat generátorokként, elektronikus tesztberendezésként, AC tápegységként, Variable Speed Motors Drives, változó sebességű meghajtóként (VSD), változtatható frekvenciájú meghajtóként (VFD), kiigazítható frekvenciájú meghajtóként (AFD), vagy kiigazítható sebességű meghajtóként (ASD) helyezhetik forgalomba.

3A226A 0B001.j.6. pont alatt meghatározottaktól eltérő egyenáramú, nagyteljesítményű tápegységek, amelyek az alábbi mindkét jellemzővel rendelkeznek:

a. képesek 8 óra időtartamon át folyamatosan 100 V vagy annál nagyobb feszültségű, 500 A vagy annál nagyobb áramerősségű kimeneti áram előállítására; és

b. áramerősség- vagy feszültségstabilitásuk 8 óra időtartam alatt jobb, mint 0,1 %.

3A227A 0B001.j.5. pont alatt meghatározottaktól eltérő nagyfeszültségű, egyenáramú tápegységek, amelyek az alábbi mindkét jellemzővel rendelkeznek:

a. képesek 8 óra időtartamon át folyamatosan 20 kV vagy annál nagyobb feszültségű, 1 A vagy annál nagyobb áramerősségű kimeneti áram előállítására; és

b. áramerősség- vagy feszültségstabilitásuk 8 óra időtartam alatt jobb, mint 0,1 %.

3A228Kapcsoló-berendezések, az alábbiak szerint:

a. Hideg katódcsövek - függetlenül attól, hogy gázzal töltöttek-e vagy sem - amelyek a szikraközhöz hasonlóan működnek, és rendelkeznek az alábbi jellemzők mindegyikével: 1. három vagy annál több elektródát tartalmaznak; 2. névleges anódcsúcsfeszültség 2,5 kV vagy annál nagyobb; 3. névleges anód-csúcsáramerősség 100 A vagy annál nagyobb; és 4. 10 μs vagy annál kisebb anód-késleltetési idő; Megjegyzés : A 3A228.a pont magában foglalja a gázkritron- és a vákuumspritron-csöveket is.

b. Kioldó szikraközök, amelyek rendelkeznek az alábbi mindkét jellemzővel: 1. 15 μs vagy annál kisebb anód-késleltetési idő; és 2. 500 A vagy nagyobb névleges csúcsáramerősség;

c. A 3A001.g. vagy a 3A001.h. pontban meghatározottaktól eltérő, gyorskapcsoló funkcióval rendelkező modulok vagy részegységek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. 2 kV-nél nagyobb névleges anód csúcsfeszültség; 2. névleges anód-csúcsáramerősség 500 A vagy annál nagyobb; és 3. 1 μs vagy annál kisebb kapcsolási idő.

3A229Nagy áramerősségű impulzusgenerátorok, az alábbiak szerint:

N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

a. Az 1A007.a. alatt meghatározottaktól eltérő, az 1A007.b. alatt meghatározott többszörös irányítású detonátor meghajtásához tervezett detonátor gyújtóegységek (indítórendszerek, tűzegységek), ideértve elektromos, a robbanó detonátoros és optikai vezérlésű gyújtóegységeket is;

b. moduláris elektromos impulzusgenerátorok (impulzusadó), amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. hordozható, mobil, vagy rezgésálló kivitelben készültek; 2. képesek energiájukat 15 μs-nál rövidebb idő alatt leadni 40 Ohmnál kisebb terhelésre; 3. kimeneti áramerősségük nagyobb, mint 100 A; 4. egyetlen méretük sem haladja meg a 30 cm-t; 5. tömegük kisebb, mint 30 kg; és 6. szélsőséges hőmérsékleti viszonyok - 223 K-től (- 50 °C) 373 K-ig (100 °C-ig) - közötti vagy világűrben történő használatra alkalmasnak minősítették. Megjegyzés : A 3A229.b. a xenon villanólámpa meghajtókat is magában foglalja.

c. mikro-gyújtóegységek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. egyetlen méretük sem haladja meg a 35 mm-t; 2. névleges feszültségük legalább 1 kV; és 3. kapacitásuk legalább 100 nF.

3A230Nagy sebességű impulzusgenerátorok és azokhoz való ‘impulzusfejek', amelyek rendelkeznek mindkét alábbi jellemzővel:

a. 55 ohmnál kisebb rezisztív terhelésre 6 V-nál nagyobb kimenő feszültség; és

b. Az ‘impulzus felfutási idő' 500 ps-nél kevesebb. Műszaki megjegyzések : 1. A 3A230 szerinti ‘impulzus felfutási idő' az az idő, ami alatt a feszültség amplitúdója 10 %-ról 90 %-ra növekedik. 2. Az ‘impulzusfejek' olyan impulzusalakító hálózatok, amelyeket arra terveztek, hogy feszültséglépcső-funkciót tegyenek lehetővé, és hogy azt különféle impulzusformákká (négyszög, háromszög, lépés, impulzus, exponenciális vagy egyciklusú típusok) alakítsák át. Az ‘impulzusfejek' képezhetik az impulzusgenerátorok szerves részét, lehetnek az eszközhöz tartozó plug-in modulok, vagy pedig kívülről is lehet őket csatlakoztatni az eszközhöz.

3A231Neutrongenerátor-rendszerek, beleértve a csöveket is, amelyek rendelkeznek mindkét alábbi jellemzővel:

a. külső vákuumrendszer nélküli üzemelésre tervezték őket; és

b. az alábbiak bármelyikét hasznosítják: 1. a trícium-deutérium magreakciót elektrosztatikus gyorsítás alkalmazásával idézik elő; vagy 2. a deutérium-deutérium magreakciót elektrosztatikus gyorsítással idézik elő, és 3 × 109 neutron/s vagy nagyobb output kapacitásra képesek.

3A232Az 1A007. pontban meghatározottól eltérő, többpontos indítórendszerek, az alábbiak szerint:

N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

N.B. A detonátorok tekintetében lásd az 1A007.b. pontot.

a. nem használt;

b. egyszeres vagy többszörös detonátorral működő rendszerek, amelyeket arra terveztek, hogy egyetlen tűzjelre közel egyidejűleg iniciáljanak 5 000 mm2-nél nagyobb területen robbanási felületet úgy, hogy a berobbantás idejének átfutása a felületen kevesebb, mint 2,5 μs. Megjegyzés : A 3A232. pont nem vonja ellenőrzés alá a csak primer robbanóanyagokat, pl. az ólomazidot alkalmazó detonátorokat.

3A233A 0B002.g. alpont alatt meghatározottaktól eltérő tömegspektrométerek, amelyek képesek 230 u vagy annál nagyobb tömegű ionok mérésére, és felbontóképességük jobb, mint 2 rész a 230-ban, valamint a hozzájuk tartozó ionforrások, az alábbiak szerint:

a. induktív csatolású plazma-tömegspektrométerek (ICP/MS);

b. parázsfénykisüléses tömegspektrométerek (GDMS);

c. hőionizációs tömegspektrométerek (TIMS);

d. elektronbombázásos tömegspektrométerek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. olyan molekulárissugár-bemeneti rendszer, amely analitmolekulák párhuzamos sugarát injektálja az ionforrás olyan környezetébe, ahol a molekulákat elektronsugárral ionizálják; és 2. egy vagy több, 193 K (- 80 °C) hőmérsékletre hűthető ‘hidegcsapda';

e. nem használt;

f. aktinidákkal, vagy aktinida-fluoridokkal történő működésre tervezett mikrofluorozó ionforrással ellátott tömegspektrométerek.

Műszaki megjegyzések :

1. A 3A233.d. pontban szereplő elektronbombázásos tömegspektrométerek elektronbecsapódásos tömegspektrométerként vagy elektronionizációs tömegspektrométerként is ismertek.

2. A 3A233.d.2. pontban szereplő ‘hidegcsapda' olyan eszköz, amely hideg felületen való kondenzálással vagy fagyasztással kapja el a gázmolekulákat. A 3A233.d.2. pont alkalmazásában a zárt ciklusú héliumgázos kriogén vákuumszivattyú nem számít ‘hidegcsapdának'.

3A234Szalagvezetékek, amelyek alacsony induktivitású útvonalat biztosítanak olyan detonátorokhoz, amelyeket:

a. névleges feszültségük nagyobb, mint 2 kV; és

b. induktivitásuk kisebb, mint 20 nH.

3BVizsgáló-, ellenőrző és gyártó berendezések

3B001Félvezető eszközök vagy anyagok gyártására szolgáló berendezések, valamint a kifejezetten ezekhez tervezett alkatrészek és tartozékok, az alábbiak szerint:

N.B. LÁSD MÉG: 2B226.

a. Epitaxiális növesztéshez használt berendezés, az alábbiak szerint: 1. minimum 75 mm-es távolságon ± 2,5 %-nál jobb tűrésű, bármilyen, a szilíciumtól eltérő anyag rétegvastagság előállítására képes berendezés; Megjegyzés : A 3B001.a.1. pontba beletartozik az atomréteg-epitaxiához (Atomic Layer Epitaxy, ALE) használt berendezés is. 2. fémorganikus gőzfázisú kémiai leválasztásra szolgáló (MOCVD) reaktorok, amelyeket az alumínium, gallium, indium, arzén, foszfor, antimon vagy nitrogén elemek közül kettőt vagy többet tartalmazó vegyület-félvezetők epitaxiás növesztésére terveztek; 3. gáz vagy szilárd forrásokat alkalmazó molekuláris sugár epitaxiális növesztő berendezés;

b. Ionbeültetésre tervezett berendezés, amely rendelkezik az alábbi jellemzők bármelyikével: 1. nem használt; 2. 20 keV vagy magasabb sugárnyaláb energián - hidrogén, deutérium vagy hélium implantációk esetén pedig 10 mA vagy nagyobb sugáráramon - történő működésre terveztek és optimalizáltak; 3. közvetlen írási lehetőség; 4. a hevített félvezető anyagú "egykristályba" (szubsztrátum) történő nagy energiájú oxigénimplantációra használt legalább 65 keV nagyságú sugárnyaláb energia és legalább 45 mA nagyságú sugáráram; vagy 5. 20 keV vagy magasabb sugárnyaláb energián - 600 °C-ra vagy magasabb hőmérsékletre hevített félvezető anyagú "alaplemezbe" implantált szilícium esetén pedig 10 mA vagy nagyobb sugáráramon - történő működésre terveztek és optimalizáltak;

c. Nem használt;

d. Nem használt;

e. Automata töltésű többkamrás központi szeletkezelő rendszerek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. A szeletek be- és kivitelére interfészeket használnak, amelyekhez több mint két funkcionálisan eltérő - a 3B001.a.1., a 3B001.a.2., a 3B001.a.3. vagy a 3B001.b. alpont alatt meghatározott - ‘félvezető-feldolgozó eszköz' csatlakoztatható; és 2. ‘Szekvenciális többszörös szeletfeldolgozás' céljából, integrált rendszer vákuumkörnyezetben történő kialakítására tervezték; Megjegyzés : A 3B001.e. alpont nem vonja ellenőrzés alá a kifejezetten párhuzamos szeletfeldolgozásra tervezett automata robot szeletkezelő rendszereket. Műszaki megjegyzések : 1. A 3B001.e. alpont alkalmazásában a ‘félvezető-feldolgozó eszköz' olyan moduláris eszközre vonatkozik, amely a félvezető-előállítás során funkcionálisan eltérő fizikai folyamatokat biztosít, mint pl. a depozíció, beültetés és hőkezelés. 2. A 3B001.e. alpont alkalmazásában a ‘szekvenciális többszörös szeletfeldolgozás' azt jelenti, hogy az egyes szeleteket különböző ‘félvezető-feldolgozó eszközökkel' tudják feldolgozni, például az automata töltésű többkamrás központi szeletkezelő rendszerek segítségével az egyes szeleteknek az egyik eszközből egy másik eszközbe, majd egy harmadik eszközbe történő áthelyezése révén.

f. Litográfiai berendezés, az alábbiak szerint: 1. A fotóoptikai vagy röntgen módszerrel történő szeletfeldolgozásra szolgáló irányzó, exponáló és ismétlő (közvetlen szeletre fotózás) vagy exponáló és letapogató (letapogatás) berendezés, amely rendelkezik az alábbi jellemzők bármelyikével: a. a fényforrás hullámhosszúsága rövidebb, mint 193 nm; vagy b. képes 45 nm, vagy annál kisebb ‘minimális felbontási méretű' (MRF) minta létrehozására. Műszaki megjegyzés : A ‘minimális felbontási méret' (MRF) kiszámítása a következők szerint történik: ahol a "K" faktor = 0,35 2. 45 nm vagy annál kisebb felbontási méretű minta létrehozására képes imprinting litográfiai berendezés; Megjegyzés : A 3B001.f.2. pont magában foglalja az alábbiakat: - mikrokontaktus-nyomtatók - forró dombornyomásra szolgáló eszközök - nano-imprinting litográfiai eszközök - Step and Flesh imprinting litográfiai (S-FIL) eszközök 3. Kifejezetten maszkkészítésre tervezett berendezés, amely rendelkezik az alábbiak mindegyikével: a. eltérített fókuszált elektronsugár, ionsugár, vagy "lézer"sugár; és b. rendelkeznek az alábbiak bármelyikével: 1. a félértékszélességű sugárpont mérete kisebb, mint 65 nm és a képelhelyezés kisebb, mint 17 nm (számtani közép + 3 szigma); vagy 2. nem használt; 3. a maszkon a második rétegi átfedési hibája kisebb, mint 23 nm (számtani közép + 3 szigma); 4. Eszköz gyártására tervezett berendezés, amely közvetlen írásos módszert alkalmaz, és amely rendelkezik az alábbi jellemzők mindegyikével: a. eltérített fókuszált elektronsugár; és b. rendelkeznek az alábbiak bármelyikével: 1. a sugár minimális mérete 15 nm vagy annál kisebb; vagy 2. az átfedési hiba kisebb, mint 27 nm (számtani közép + 3 szigma);

g. A 3A001 pontban meghatározott integrált áramkörökhöz tervezett maszkok és hajszálvonalas lemezek;

h. A 3B001.g. alpont alatt meg nem határozott fáziseltolásos réteggel ellátott többrétegű maszkok, amelyeket 245 nm-nél rövidebb fényforrás hullámhosszúsággal rendelkező litográfiai berendezések általi felhasználásra terveztek; Megjegyzés: A 3B001.h. alpont nem vonja ellenőrzés alá azokat a fáziseltolásos rétegekkel ellátott többrétegű maszkokat, amelyeket a 3A001. pontban meg nem határozott memóriaeszközök gyártására terveztek. N.B. Kifejezetten az optikai szenzorokhoz tervezett maszkok és hajszálvonalas lemezek esetében lásd a 6B002 pontot.

i. A 3A001. pontban meghatározott integrált áramkörökhöz tervezett imprinting litográfiai sablonok.

j. Molibdént és szilíciumot tartalmazó többrétegű fényvisszaverő szerkezettel rendelkező maszk "nyersalaplemezek", amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. kifejezetten az ‘extrém ultraibolya' (‘EUV') litográfiához tervezték; és 2. megfelelnek a SEMI P37 szabványnak. Műszaki megjegyzés : Az ‘extrém ultraibolya' (‘EUV') 5 nm-nél nagyobb és 124 nm-nél kisebb elektromágneses spektrumhullámhosszt jelent.

3B002Kifejezetten kész, vagy félkész félvezető eszközökhöz tervezett tesztberendezések, valamint a kifejezetten ezekhez tervezett alkatrészek és tartozékok, az alábbiak szerint:

a. a 3A001.b.3. pontban meghatározott elemek S-paramétereinek tesztelése céljából;

b. nem használt;

c. a 3A001.b.2. pontban meghatározott elemek tesztelése céljából;

3CAnyagok

3C001Több réteget tartalmazó hetero-epitaxiális anyagok, amelyeket a következő rétegek bármelyikéből epitaxiálisan növesztett "szubsztrátumokból" állnak:

a. szilícium (Si);

b. germánium (Ge);

c. szilíciumkarbid (SiC);

d. "III/V gallium- vagy indiumvegyületek";

e. gallium-oxid (Ga2O3); vagy

f. gyémánt.

Megjegyzés : A 3C001.d. alpont nem vonja ellenőrzés alá az egy vagy több - az elemek sorrendjétől függetlenül - GaN, InGaN, AlGaN, InAlN, InAlGaN, GaP, GaAs, AlGaAs, InP, InGaP, AlInP vagy InGaAlP P-típusú epitaxiális réteggel rendelkező "alaplemezeket", kivéve, ha a P-típusú epitaxiális réteg az N-típusú rétegek között helyezkedik el.

3C002Védőréteg anyagok és az alábbi védőanyagokkal bevont "szubsztrátumok":

a. védőréteg anyagok, amelyeket kifejezetten félvezető litográfiához igazítottak, az alábbiak szerint: 1. pozitív védőréteg anyagok, amelyeket kifejezetten 193 nm alatti, de legalább 15 nm hullámhosszúságon történő felhasználásra igazítottak ki (optimalizáltak); 2. védőréteg anyagok, amelyeket kifejezetten 15 nm alatti, de 1 nm-nél nagyobb hullámhosszúságon történő felhasználásra igazítottak ki (optimalizáltak);

b. 0,01 μcoulomb/mm2 vagy annál jobb érzékenységgel rendelkező valamennyi olyan védőréteg anyag, amelyeket elektronsugárral vagy ionsugárral történő alkalmazásra terveztek;

c. nem használt;

d. a felületi képalkotási technológiákhoz optimalizált összes védőréteg;

e. valamennyi olyan védőanyag, amelyet a 3B001.f.2. pontban meghatározott olyan imprinting litográfiai berendezésekhez terveztek vagy optimalizáltak, amelyek termikus vagy fotokémiai eljárást alkalmaznak.

3C003Szerves-szervetlen vegyületek, az alábbiak szerint:

a. Alumínium, gallium vagy indium fémorganikus vegyületei 99,999 %-nál nagyobb tisztasággal (fémbázison);

b. Szerves arzén-, antimon- vagy foszforvegyületek 99,999 %-nál nagyobb tisztasággal (szervetlen elem bázison).

Megjegyzés : A 3C003 pont csak azokat a vegyületeket vonja ellenőrzés alá, amelyek fémes, részben fémes és nemfémes eleme közvetlenül kapcsolódik a molekula szerves részében lévő szénatomhoz.

3C004Foszfor-, arzén- vagy antimon-hidridek, melyek tisztasága még semleges gázokban, vagy hidrogénben oldva is nagyobb, mint 99,999 %.

Megjegyzés : A 3C004. pont nem vonja ellenőrzés alá a semleges gázokat vagy hidrogént legalább 20 mólszázalék mennyiségben tartalmazó hidrideket.

3C005Nagy ellenállású anyagok az alábbiak szerint:

a. 20 °C-on 10 000 ohm-cm-t meghaladó ellenállású szilícium-karbid (SiC), gallium-nitrid (GaN), alumínium-nitrid (AlN), alumínium-gallium-nitrid (AlGaN), gallium-oxid (Ga2O3), vagy gyémánt félvezető "szubsztrátumok", vagy ezen anyagok öntecsei, monokristályai vagy egyéb előformái.

b. 20 °C-on 10 000 ohm-cm-t meghaladó ellenállású polikristályos "szubsztrátumok" vagy polikristályos kerámia "szubsztrátumok", amelyek legalább egy, nem epitaxiális szilíciumréteggel (Si), szilícium-karbid (SiC), gallium-nitrid (GaN), alumínium-nitrid (AlN), alumínium-gallium-nitrid (AlGaN), gallium-oxid (Ga2O3), vagy gyémánt réteggel rendelkeznek a "szubsztrátum" felületén.

3C006A 3C001. pontban nem szereplő anyagok, amelyek magukban foglalják a 3C005. pontban meghatározott "szubsztrátumot", amely legalább egy epitaxiális szilícium-karbid (SiC), gallium-nitrid (GaN), alumínium-nitrid (AlN), alumínium-gallium-nitrid (AlGaN), gallium-oxid (Ga2O3), vagy gyémánt réteggel rendelkezik.

3DSzoftver

3D001Kifejezetten a 3A001.b-3A002.h alpontban vagy a 3B. pontban meghatározott berendezések "kifejlesztésére" vagy "gyártására" tervezett "szoftver".

3D002Kifejezetten a 3B001.a.-f. alpontban, a 3B002. vagy a 3A225. pontban meghatározott berendezések "használatára" tervezett "szoftver".

3D003Kifejezetten EUV-litográfiai maszkokon vagy hajszálvonal-hálózatos lemezeken mintázatok "fejlesztésére" tervezett ‘számítógépes litográfiai' "szoftver".

Műszaki megjegyzés :

‘Számítógépes litográfia': számítógépes modellezés alkalmazása a litográfiai folyamat képalkotó teljesítményének előrejelzésére, javítására, optimalizálására és ellenőrzésére számos mintázat, folyamat és rendszerfeltétel révén.

3D004Kifejezetten a 3A003. pontban meghatározott berendezés "fejlesztésére" tervezett "szoftver".

3D005Kifejezetten egy mikroszámítógép, "mikroprocesszor mikroáramkör" vagy "mikroszámítógép mikroáramkör" rendes működésének egy elektromágneses impulzus (EMP) vagy elektrosztatikus kisülés (ESD) miatti zavart követően 1 ms-on belül történő helyreállítására tervezett "szoftver" a működés folyamatosságának biztosítása mellett.

3D006Kifejezetten az olyan integrált áramkörök "fejlesztésére" tervezett ‘elektronikus számítógépes tervezés'-i (‘ECAD') "szoftver", amelyek "nanohuzalos térvezérlésű tranzisztor" ("GAAFET") struktúrával és a következők bármelyikével rendelkeznek:

a. kifejezetten a ‘regiszter-transzfer szintnek' (‘RTL') a ‘Geometriai Adatbázis Szabvány II' (‘GDSII') vagy azzal ekvivalens szabvány szerinti alkalmazására tervezték; vagy

b. kifejezetten a teljesítményre vagy az időzítésre vonatkozó szabályok optimalizálására tervezték.

Műszaki megjegyzések :

1. Az ‘elektronikus számítógépes tervezés' (‘ECAD') az integrált áramkörök vagy az elektronikus nyomtatott áramkörök teljesítményének tervezéséhez, elemzéséhez, optimalizálásához és validálásához használt "szoftver" eszközök egyik kategóriája.

2. A ‘regiszter-transzfer szint' (‘RTL') egy olyan absztrakciós tervezés, amely a szinkron digitális áramkört modellezi a digitális jelek hardver regiszterek közötti áramlása, valamint az említett jeleken elvégzett logikai műveletek tekintetében.

3. ‘Geometriai Adatbázis Szabvány II' (‘GDSII') az integrált áramkörökkel vagy az integrált áramkörök elrendezésével kapcsolatos adatcserét szolgáló adatbázis fájl formátum.

3D101Kifejezetten a 3A101.b. alpont alatt meghatározott berendezések "használatához" tervezett vagy átalakított "szoftver".

3D225A kifejezetten a frekvenciaváltó vagy generátorok teljesítményének - a 3A225. pont alatt szereplő jellemzőknek való megfelelés érdekében történő - fokozására vagy felszabadítására tervezett "szoftver".

3ETechnológia

3E001A 3A, 3B, vagy 3C pont által ellenőrzés alá vont berendezések vagy anyagok "kifejlesztésére" vagy "gyártására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia";

1. megjegyzés : A 3E001. pont nem vonja ellenőrzés alá a 3A003. pont alá tartozó berendezésre vagy alkatrészekre vonatkozó "technológiát".

2. megjegyzés : A 3E001. pont nem vonja ellenőrzés alá a 3A001.a.3-3A001.a.12. pont alatt meghatározott, a következő jellemzők mindegyikével rendelkező integrált áramkörökre vonatkozó "technológiát":

a. 0 130 μm vagy a feletti "technológiát" alkalmaz; és

b. három vagy annál kevesebb fémrétegből álló többrétegű struktúrákat tartalmaznak.

3. megjegyzés : A 3E001. pont nem vonja ellenőrzés alá a ‘folyamattervezési készleteket' (‘Process Design Kits, PDK-k'), kivéve, ha a 3A001. pontban meghatározott elemeket illetően végrehajtó funkciókat vagy technológiákat alkalmazó könyvtárakat tartalmaznak.

Műszaki megjegyzés :

A folyamattervezési készlet (‘Process Design Kit, PDK') olyan, a félvezetőgyártó által biztosított szoftvereszköz, amely biztosítja, hogy az előírt tervezési gyakorlatokat és szabályokat egy speciális félvezető folyamatban egy speciális integrált áramkörterv sikeres előállítása érdekében, a technológiai és gyártási korlátoknak megfelelően figyelembe veszik (minden félvezető gyártási folyamat sajátos ‘PDK'-val rendelkezik).

3E002A 3E001 pontban meghatározottaktól eltérő, az Általános technológiai megjegyzés szerinti "technológia" olyan "mikroprocesszor mikroáramkörök", "mikroszámítógép mikroáramkörök" és "mikrovezérlő mikroáramkör" mag "kifejlesztésére" vagy "gyártására" szolgál, amelyek 32 bites elérési szélességű aritmetikai logikai egységgel, valamint az alábbi jellemzők vagy tulajdonságok valamelyikével rendelkeznek:

a. lebegőpontos vektorokon (32 bites vagy nagyobb számokból álló egydimenziós tömbök) kettőnél több számítás párhuzamos elvégzésének céljára tervezett ‘vektorprocesszor-egység'; Műszaki megjegyzés : A ‘vektorprocesszor-egység' a processzor olyan eleme, amelynek beépített utasításai szimultán módon több számítást végeznek el ‘lebegőpontos vektorokon' (32 bites vagy nagyobb számokból álló egydimenziós tömbök), és legalább egy vektrális aritmetikai logikai egységgel és olyan vektorregiszterekkel rendelkeznek, amelyek egyenként legalább 32 elemből állnak.

b. ciklusonként négynél több 64 bites vagy nagyobb ‘lebegőpontos-művelet' elvégzésére tervezték; vagy

c. ciklusonként nyolcnál több 16 bites ‘fixpont' szorzás-összeadás művelet elvégzésére tervezték (pl. korábban digitális formátumúvá átalakított analóg információ digitális manipulációja, vagy más néven "digitális jelfeldolgozás").

Műszaki megjegyzések :

1. A 3E002.a. és 3E002.b. alpont alkalmazásában a ‘lebegőpontot' az IEEE-754 határozza meg.

2. A 3E002.c. alpont alkalmazásában a ‘fixpont' olyan rögzített szélességű valós számra utal, amely rendelkezik egészrész- és törtrész-komponenssel is, és nem kizárólag egészszám-formátumú.

1. megjegyzés : A 3E002. pont nem vonja ellenőrzés alá a multimédia-kiterjesztésekre szolgáló "technológiát".

2. megjegyzés : A 3E002. pont nem vonja ellenőrzés alá az olyan mikroprocesszor-magokra vonatkozó "technológiát", amely mikroprocesszor-mag az alábbi tulajdonságok mindegyikével rendelkezik:

a. 0 130 μm vagy a feletti "technológiát" alkalmaz; és

b. öt vagy annál kevesebb fémrétegből álló többrétegű struktúrát foglal magában.

3. megjegyzés : A 3E002. pont magában foglalja a digitális jelfeldolgozókra és a digitális tömbprocesszorok "fejlesztésére" és "gyártására" szolgáló "technológiát" is.

3E003A következők "fejlesztésére" vagy "gyártására" szolgáló egyéb "technológia":

a. vákuum mikroelektronikai eszközök;

b. heterogén szerkezetű félvezető elektronikai eszközök, például nagy elektronmozgékonyságú tranzisztorok (HEMT), hetero-bipolár tranzisztorok (HBT), kvantumforrás vagy szuperrács-eszközök; Megjegyzés : A 3E003.b. alpont nem vonja ellenőrzés alá a 31,8 GHz-nél alacsonyabb frekvencián működő nagy elektronmozgékonyságú tranzisztorokra (HEMT) és a 31,8 GHz-nél alacsonyabb frekvencián működő hetero-bipoláris tranzisztorokra (HBT) vonatkozó "technológiákat".

c. "szupravezető" elektronikai eszközök;

d. gyémánt szubsztrátumok elektronikus alkatrészekhez;

e. szilícium-szigetelő szubsztrátum (SOI) olyan integrált áramkörökhöz amelyeknél a szigetelő szilícium-dioxid;

f. szilícium-karbid szubsztrátumok elektronikus alkatrészekhez;

g. legalább 31,8 GHz-es frekvencián működő "vákuumos elektronikai eszközök";

h. gallium-oxid szubsztrátumok elektronikus alkatrészekhez.

3E004300 mm átmérőjű szilíciumlapkák szeleteléséhez, köszörüléséhez és fényezéséhez "szükséges" "technológia" a lapkák elülső felületén bármely 26 mm × 8 mm-es helyen legfeljebb 20 nm-es ‘Site Front least négyzetek' (‘SFQR') elérése céljából, legfeljebb 2 mm-es élkizárással mérve.

Műszaki megjegyzés :

A 3E004 alkalmazásában: az ‘SFQR' az első referenciasíktól való legnagyobb és legkisebb eltérés tartománya, amelyet az összes elülső felületi adattal, beleértve az adott helyen belüli területhatárt is, a legkisebb négyzetes módszerrel kell kiszámítani.

3E101A 3A001.a.1. vagy 2., a 3A101., 3A102. vagy 3D101. pontban meghatározott berendezések, vagy "szoftverek" "használatára" vonatkozó, az Általános Technológiai Megjegyzés szerinti "technológia".

3E102A 3D101 alatt meghatározott "szoftver" "kifejlesztésére" vonatkozó Általános technológiai megjegyzés szerinti "technológia".

3E201A 3A001.e.2., a 3A001.e.3., a 3A001.g., a 3A201., a 3A225-3A234. pontban meghatározott berendezések "használatára" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

3E225A kifejezetten egy frekvenciaváltó vagy generátor teljesítményének - a 3A225. pont alatt szereplő jellemzőknek való megfelelés érdekében történő - megerősítését vagy kiaknázását célzó, kódok és kulcsok formájában megadott "technológia".

VI. RÉSZ

4. kategória

4. KATEGÓRIA - SZÁMÍTÓGÉPEK

1. megjegyzés : A távközlési vagy "helyi hálózati" funkciókat teljesítő számítógépeket, kapcsolódó berendezéseket vagy "szoftvert" az 5. kategória 1. rész (Távközlés) teljesítményjellemzői szerint is értékelni kell.

2. megjegyzés : Azokat a vezérlőegységeket, amelyek közvetlenül összekapcsolják a központi feldolgozó egységek, a ‘fő tároló' vagy a lemezvezérlők buszait vagy csatornáit, nem tekintjük az 5. kategória 1. részében (Távközlés) meghatározott távközlési berendezéseknek.

N.B. A kifejezetten csomagkapcsoláshoz tervezett "szoftver" ellenőrzési státusa tekintetében lásd: 5D001.

Műszaki megjegyzés :

‘Fő tároló': adatok vagy utasítások elsődleges tárolója, amely a központi feldolgozó egység által gyorsan hozzáférhető. A "digitális számítógép" belső tárolójából és az ahhoz tartozó bármilyen hierarchikus bővítésből áll, mint például a cache (gyorsítótár) vagy a nem szekvenciális elérésű bővített tároló.

4ABerendezések, részegységek és alkatrészek

4A001.Az alábbi jellemzők bármelyikével rendelkező elektronikus számítógépek és kapcsolódó berendezések, továbbá "elektronikus részegységek" és a kifejezetten ezekhez tervezett alkatrészek:

N.B. LÁSD MÉG: 4A101.

a. Kifejezetten úgy tervezték, hogy rendelkezzen az alábbi jellemzők bármelyikével: 1. 228 K (- 45 °C) alatti vagy 358 K (+ 85 °C) feletti környezeti hőmérsékletre méretezett; vagy Megjegyzés: A 4A001.a.1. pont nem vonja ellenőrzés alá a kifejezetten polgári gépkocsikhoz, vasúti felhasználásra vagy "polgári légi járművekhez" történő felhasználásra tervezett számítógépeket. 2. Sugárzással szemben ellenállóvá tett berendezések, amelyek meghaladják az alábbi jellemzők bármelyikét: a. Teljes dózis 5 × 103 Gy (szilícium); b. Dózisintenzitás-változás 5 × 106 Gy (szilícium)/s; vagy c. Egyszeri esemény változás 1 × 10-8 hiba/bit/nap; Megjegyzés : A 4A001.a.2. pont nem vonja ellenőrzés alá a kifejezetten "polgári légi járművekhez" történő felhasználásra tervezett számítógépeket.

b. Nem használt.

4A003"Digitális számítógépek", "elektronikus részegységek" és kapcsolódó berendezéseik, valamint a kifejezetten ezekhez tervezett alkatrészek, az alábbiak szerint:

1. megjegyzés: A 4A003 a következőket foglalja magában:

- ‘Vektorprocesszorok';

- Tömbprocesszorok;

- Digitális jelfeldolgozók;

- Logikai processzorok;

- "Képminőség-javításra" tervezett berendezések.

2. megjegyzés: A 4A003 alatt meghatározott "digitális számítógépek" és a kapcsolódó berendezések ellenőrzési státusát a többi berendezés vagy rendszer ellenőrzési státusa határozza meg, feltéve, hogy:

a. A "digitális számítógépek" vagy a kapcsolódó berendezések a többi berendezés vagy rendszer működése szempontjából alapvető fontosságúak;

b. A "digitális számítógépek" vagy a kapcsolódó berendezések nem képezik más rendszer "alapvető elemét"; és N.B.1. A kifejezetten az egyéb berendezésekhez tervezett "jelfeldolgozó", vagy "képminőség-javító" berendezések - melyek funkciói az egyéb berendezésre megkövetelt funkciókra korlátozódnak - ellenőrzési státusát a másik berendezés ellenőrzési státusa határozza meg, még akkor is, ha ez meghaladja a "alapvető elem" kritériumot. N.B.2. A távközlési berendezésekhez alkalmazott "digitális számítógépek" vagy a kapcsolódó berendezések ellenőrzési státusát lásd az 5. kategória 1. részében (Távközlés).

c. A "digitális számítógépek" és a kapcsolódó berendezések "technológiáját" a 4E határozza meg.

a. Nem használt;

b. "Digitális számítógépek", amelyek "kiigazított csúcsteljesítménye" ("APP") nagyobb, mint 70 billió súlyozott lebegőpontos művelet másodpercenként (Weighted TeraFLOPS, WT);

c. "Elektronikus részegységek", amelyeket kifejezetten arra terveztek vagy úgy alakítottak át, hogy processzorok egyesítésével képesek legyenek a teljesítmény fokozására úgy, hogy az aggregátum "APP" értéke meghaladja a 4A003.b. pontban meghatározott paraméterhatárt; 1. megjegyzés : A 4A003.c. csak azokat az "elektronikus részegységeket" és programozható összekapcsolásokat vonja ellenőrzés alá, melyek nem haladják meg a 4A003.b. pontban meghatározott paraméterhatárt, amennyiben azokat nem-integrált "elektronikus részegységként" szállítják. 2. megjegyzés : A 4A003.c. nem vonja ellenőrzés alá a kifejezetten olyan termékhez, vagy termékcsaládhoz tervezett "elektronikus részegységeket", amelyek maximális konfigurációja nem haladja meg a 4A003.b. pontban meghatározott paraméterhatárt.

d. Nem használt;

e. Nem használt;

f. Nem használt;

g. Kifejezetten "digitális számítógépek" teljesítményének olyan külső összekapcsolás útján történő egyesítésére tervezett berendezések, amely kapcsolatonként 2,0 Gbyte/s-ot meghaladó egyirányú adatátviteli sebességet tesz lehetővé. Megjegyzés : A 4A003.g. nem vonja ellenőrzés alá a belső összekapcsoló berendezéseket (pl. csatlakozó tartópanel, buszok), a passzív összekapcsoló berendezéseket, a "hálózati hozzáférés-szabályozókat", illetve az "adatcsatorna-vezérlőegység kontrollereket".

4A004.Számítógépek, és a kifejezetten ezekhez tervezett kapcsolódó berendezések, "elektronikus részegységek" és alkatrészek, az alábbiak szerint:

a. ‘Szisztolés tömb számítógépek';

b. ‘Neurális számítógépek';

c. ‘Optikai számítógépek'.

Műszaki megjegyzések :

1. ‘Szisztolés tömb számítógépek': olyan számítógépek, amelyekben az adatok árama és módosítása a felhasználó által a logikai kapu szintjén dinamikusan ellenőrizhető.

2. ‘Neurális számítógépek': olyan számítástechnikai eszközök, amelyeket úgy terveztek vagy módosítottak, hogy utánozzák az idegsejt vagy az idegsejtek csoportjának viselkedését, vagyis olyan számítástechnikai eszközök, amelyek képesek arra, hogy korábbi adatok alapján modulálják a számítási adatsokaság összekapcsolódásának tömegét és számát.

3. ‘Optikai számítógépek': olyan számítógépek, amelyeket úgy tervezetek vagy módosítottak, hogy az adat megjelenítésére a fényt használják fel, és amelyek számítási logikai elemei közvetlenül összekapcsolt optikai eszközökön alapulnak.

4A005.Kifejezetten "támadószoftverek" létrehozásához, vezetéséhez és irányításához vagy célba juttatásához tervezett vagy módosított rendszerek, berendezések és azokhoz való alkatrészek.

4A101.A 4A001.a.1. alatt meghatározottaktól eltérő olyan analóg számítógépek, "digitális számítógépek", vagy digitális differenciál-analizátorok, amelyek megerősített kivitelűek és a 9A004 alatt meghatározott űrhajóhordozó eszközökhöz vagy 9A104 alatt meghatározott rakétaszondákon történő felhasználásra terveztek, vagy alakították át.

4A102.Kifejezetten a 9A004 alatt meghatározott űrhajóhordozó eszközök vagy 9A104 alatt meghatározott rakétaszondák modellezésére, szimulációjára, vagy tervezési integrációjára tervezett hibrid számítógépek.

Megjegyzés : Ez a pont csak akkor alkalmazandó, ha a berendezést a 7D103, vagy a 9D103 alatt meghatározott "szoftverrel" látják el.

4BVizsgáló-, ellenőrző és gyártó berendezések

Nincs.

4CAnyagok

Nincs.

4DSzoftver

Megjegyzés : Az egyéb kategóriákban meghatározott berendezésekhez szükséges "szoftver" ellenőrzési státusát a megfelelő kategória határozza meg.

4D001."Szoftver" az alábbiak szerint:

a. Kifejezetten a 4A001-4A004, vagy 4D pontban meghatározott berendezések vagy "szoftver" "fejlesztéséhez", "gyártásához" vagy "használatához" tervezett vagy módosított "szoftver".

b. Kifejezetten az alábbi berendezések "fejlesztésére" vagy "gyártására" tervezett vagy átalakított, a 4D001.a. pontban meghatározottaktól eltérő "szoftver": 1. "Digitális számítógépek", amelyek "kiigazított csúcsteljesítménye" ("APP") nagyobb, mint 15 billió súlyozott lebegőpontos művelet másodpercenként (Weighted TeraFLOPS, WT); 2. Processzorok aggregálása révén kifejezetten a teljesítmény növelésére tervezett vagy átalakított "elektronikus részegységek", ahol az aggregátum "APP"-je meghaladja a 4D001.b.1. alatt meghatározott határértéket;

4D002.Nem használt

4D003.Nem használt.

4D004.Kifejezetten "támadószoftverek" létrehozásához, vezetéséhez és irányításához vagy célba juttatásához tervezett vagy módosított "szoftver".

Megjegyzés : A 4D004. nem vonja ellenőrzés alá azt a "szoftvert", amelyet kifejezetten és kizárólag arra terveztek, hogy az alábbi feltételek együttes teljesülése mellett "szoftverek" frissített vagy továbbfejlesztett verzióját telepítse:

a. A frissített vagy továbbfejlesztett verzió telepítése kizárólag a fogadó rendszer tulajdonosának vagy rendszergazdájának engedélyével történik; és

b. A frissített vagy továbbfejlesztett verzió telepítése után a telepített "szoftver" nem: 1. A 4D004. alatt meghatározott "szoftver"; sem pedig 2. "Támadószoftver".

4ETechnológia

4E001.

a. A 4A, vagy 4D által ellenőrzés alá vont berendezések vagy "szoftver" "fejlesztésére", "gyártására", vagy "felhasználására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

b. A 4E001.a. pontban meghatározottaktól eltérő, az Általános technológiai megjegyzés szerinti "technológia" a következő berendezések "fejlesztésére" vagy "gyártására": 1. "Digitális számítógépek", amelyek "kiigazított csúcsteljesítménye" ("APP") nagyobb, mint 15 billió súlyozott lebegőpontos művelet másodpercenként (Weighted TeraFLOPS, WT); 2. Processzorok aggregálása révén kifejezetten a teljesítmény növelésére tervezett vagy átalakított "elektronikus részegységek", ahol az aggregátum "APP"-je meghaladja a 4E001.b.1. alatt meghatározott határértéket;

c. "Technológia" "támadószoftver" "fejlesztéséhez". 1. megjegyzés : A 4E001.a. és a 4E001.c. nem vonja ellenőrzés alá a "sebezhetőségfeltárást" és a "kiberbiztonsági esemény operatív kezelését". 2. megjegyzés : Az 1. megjegyzés nem korlátozza az exportőr letelepedési helye szerinti európai uniós tagállam illetékes hatóságának a 4E001.a. és a 4E001.c. teljesülésének ellenőrzésével kapcsolatos jogait.

MŰSZAKI MEGJEGYZÉS A "KIIGAZÍTOTT CSÚCSTELJESÍTMÉNY" ("APP") SZÁMÍTÁSÁHOZ

Az "APP" az a kiigazított csúcssebesség, amellyel a "digitális számítógépek" a 64 bites vagy annál nagyobb lebegőpont-összeadásokat és szorzásokat végzik.

Az "APP"-t WT-ben (Weighted TeraFLOPS), azaz másodpercenként 1012 kiigazított lebegőpontos műveletnek megfelelő egységekben fejezzük ki.

Az ebben a műszaki megjegyzésben alkalmazott rövidítések

n

a processzorok száma a "digitális számítógépben"

i

processzorszám (i,...n)

ti

processzor-ciklusidő (ti = 1/Fi)

Fi

processzorfrekvencia

Ri

lebegőpont-számítási csúcssebesség

Wi

architektúra-kiigazítási tényező

Az "APP" kiszámítási módszerének alapelvei

1. Minden i processzorra határozzuk meg a 64 bites vagy annál nagyobb lebegőpontos műveletek ciklusonként elvégzett legmagasabb számát (FPOi), a "digitális számítógép" valamennyi processzora esetében.

Megjegyzés : Az FPO meghatározásakor csak a 64 bites vagy annál nagyobb lebegőpontos összeadásokat vagy szorzásokat vegyük figyelembe. Minden lebegőpont-műveletet a processzorciklusonkénti műveletek számaként kell kifejezni; azok a műveletek, amelyekhez több ciklusra van szükség, ciklusonkénti törteredményként fejezhetők ki. Azon processzorok esetében, amelyek 64 bites vagy annál hosszabb lebegőpont-operandusokon nem képesek műveletek végzésére, az R effektív számítási sebesség nulla.

2. Minden processzorra számítsuk ki az R lebegőpont-sebességet Ri = FPOi/ti.

3. Számítsuk ki az "APP"-t a következő képlettel: "APP" = W1 × R1 + W2 × R2 + ... + Wn × Rn.

4. ‘Vektorprocesszorok' esetében Wi = 0,9. Nem ‘vektorprocesszorok' esetében Wi = 0,3.

1. megjegyzés : Azon processzorok esetében, amelyek egy cikluson belül összetett műveleteket hajtanak végre, mint például összeadást és szorzást, minden egyes műveletet külön be kell számítani.

2. megjegyzés : Futószalagos processzor esetében R effektív számítási sebesség a gyorsabbik futószalagos sebesség, amint a futószalag megtelt, vagy a nem futószalagos sebesség.

3. megjegyzés : Minden egyes részt vevő processzor R számítási sebességét a kombináció "APP"-jének kiszámítása előtti elméletileg lehetséges legmagasabb értéken kell számítani. Szimultán műveletek létezését lehet feltételezni, ha a számítógép gyártója a számítógép útmutatójában vagy tájékoztatójában konkurens, párhuzamos vagy szimultán működésre vagy végrehajtásra vonatkozó állítást tüntet fel.

4. megjegyzés : Az "APP" számításakor ne vegyük számításba azokat a processzorokat, amelyek működése a bevitelre/kivitelre és a periférikus funkciókra korlátozódik (pl. lemezmeghajtó, kommunikáció, kijelző).

5. megjegyzés : A "helyi hálózatokon", a "nagykiterjedésű hálózatokon", megosztott I/O kapcsolatokon/eszközökön, I/O-vezérlőkön és bármely, "szoftverrel" megvalósított kommunikációs kapcsolaton keresztül összekapcsolt processzorkombinációkra ne számítsunk "APP"-értékeket.

6. megjegyzés : "APP"-értékeket kell számítani olyan processzorkombinációk esetén, amelyek szimultán módon és memóriamegosztással működő, kifejezetten a teljesítmény egyesítéssel való növelésére tervezett processzorokat tartalmaznak;

Műszaki megjegyzések :

1. Aggregálja az egyidejűleg működő és ugyanazon lapkán elhelyezkedő összes processzort és gyorsítót.

2. Processzorkombinációk memóriát osztanak meg, amikor bármely processzor a rendszeren belül bármely memóriahelyet el tud érni cache sorok vagy memóriaszavak hardveres átadása révén, szoftvermechanizmus bevonása nélkül, amely a 4A003.c. pontban meghatározott "elektronikus részegységek" használatával érhető el.

7. megjegyzés : A ‘vektorprocesszor' olyan processzor, amelynek beépített utasításai szimultán módon több számítást végeznek el lebegőpontos vektorokon (64 bites vagy nagyobb számokból álló egydimenziós tömbök), és legalább két vektorfeldolgozó egységgel és legalább nyolc vektorregiszterrel rendelkeznek, amelyek egyenként legalább 64 elemből állnak.

VII. RÉSZ

5. kategória

5. KATEGÓRIA - TÁVKÖZLÉS ÉS "INFORMÁCIÓBIZTONSÁG"

1. rész - TÁVKÖZLÉS

1. megjegyzés : A kifejezetten távközlési berendezésekhez vagy rendszerekhez tervezett alkatrészek, tesztelő és "gyártó" berendezések, anyagok és az ezekhez szükséges "szoftver" ellenőrzési státuszát az 5. kategória 1. része határozza meg.

N.B. A kifejezetten távközlési berendezésekhez vagy rendszerekhez tervezett "lézerek" tekintetében lásd a 6A005 pontot.

2. megjegyzés : Az e kategória alatt ellenőrzés alá vont távközlési berendezések működtetéséhez és támogatásához lényeges "digitális számítógépek", kapcsolódó berendezések vagy "szoftverek" különlegesen tervezett alkatrésznek minősülnek, ha ezek a gyártó által hagyományosan szállított szabványos modellek. Ez tartalmazza a működtető, adminisztrálót, karbantartó, tervező vagy számlázó számítógép-rendszereket.

5A1Berendezések, részegységek és alkatrészek

5A001Távközlési rendszerek, berendezések, alkatrészek és tartozékok, az alábbiak szerint:

a. Bármely típusú, a következő jellemzők, funkciók, vagy tulajdonságok bármelyikével rendelkező távközlési berendezés: 1. Kifejezetten arra tervezték, hogy a nukleáris robbanásból eredő tranziens elektromos hatásoknak vagy elektromágneses impulzusoknak ellenálljon; 2. Gamma-, neutron- és ionizáló sugárzással szemben speciálisan ellenállóvá tették; 3. Kifejezetten 218 K (- 55 °C) hőmérséklet alatti működésre tervezték; vagy 4. Kifejezetten 397 K (124 °C) hőmérséklet feletti működésre tervezték; 1. megjegyzés : Az 5A001.a.3. és az 5A001.a.4. kizárólag elektronikus berendezéseket von ellenőrzés alá. 2. megjegyzés : Az 5A001.a.2., az 5A001.a.3. és az 5A001.a.4. nem vonja ellenőrzés alá a műholdak fedélzetén történő használatra tervezett vagy módosított berendezéseket.

b. Távközlési rendszerek és berendezések, és a kifejezetten ezekhez tervezett alkatrészek és tartozékok, amelyek rendelkeznek a következő jellemzők, funkciók vagy tulajdonságok bármelyikével: 1. Víz alatti, kábellel nem összekötött kommunikációs rendszerek, amelyek rendelkeznek a következő jellemzők bármelyikével: a. 20-60 kHz frekvencia-tartományon kívüli akusztikus vivőfrekvencia; b. 30 kHz alatti elektromágneses vivőfrekvencia használata; c. Vezetősugár irányítási technikák alkalmazása; vagy d. 400 nm és 700 nm közötti kimeneti hullámhosszú "lézer" vagy fénykibocsátó dióda (LED) alkalmazása "helyi hálózatban"; 2. 1,5-87,5 MHz frekvenciatartományban működő rádióátviteli berendezések, amelyek rendelkeznek a következő jellemzők mindegyikével: a. Az átvitel optimalizálására automatikusan előre jelzik és kiválasztják a frekvenciákat és a csatornánkénti "teljes digitális adatátviteli sebességeket"; és b. Olyan lineáris teljesítményerősítőt tartalmaznak, amely képes biztosítani több jel egyidejű feldolgozását, kimeneti teljesítménye legalább 1 kW az 1,5-30 MHz, illetve legalább 250 W a 30-87,5 MHz frekvencia-tartományban, legalább 1 oktáv "pillanatnyi sávszélességben" és - 80 dB-nél jobb kimeneti felharmonikus és torzítási tartalommal; 3. Az 5A001.b.4. pontban meghatározottaktól eltérő,"kiterjesztett spektrumú", többek között a "frekvenciaugrásos" (frequency hopping) technikákat alkalmazó rádióberendezések, amelyek rendelkeznek a következő jellemzők bármelyikével: a. A felhasználó által programozható szórási kódok; vagy b. A teljes átviteli sávszélesség legalább 100-szor nagyobb, mint bármelyik információs csatorna sávszélessége, és meghaladja az 50 kHz-et; Megjegyzés : Az 5A001.b.3.b. nem vonja ellenőrzés alá az alábbiak bármelyikével történő használatra tervezett rádióberendezéseket: a. Polgári sávokon történő használatra tervezett celluláris rádió-berendezések; vagy b. Rögzített vagy mobil műholdas földi állomások kereskedelmi, polgári távközléshez. Megjegyzés : Az 5A001.b.3. nem vonja ellenőrzés alá az 1 W vagy annál kisebb kimeneti teljesítménnyel működő berendezéseket. 4. Ultra-szélessávú modulációs technikát alkalmazó rádióberendezés, a felhasználó által programozható csatornákra osztó kódokkal, rejtjelező kódokkal vagy hálózatazonosító kódokkal, amely rendelkezik az alábbi jellemzők bármelyikével: a. 500 MHz-et meghaladó sávszélesség; vagy b. 20 %-os vagy nagyobb "relatív sávszélesség"; 5. Digitális vezérlésű rádióvevők, amelyek rendelkeznek az alábbi jellemzők mindegyikével: a. Több mint 1 000 csatorna; b. 1 ms alatti ‘csatornakapcsolási idő'; c. Az elektromágneses spektrum egy részének automatikus keresése vagy letapogatása; és d. A vett jelek, vagy az adó típusának azonosítása; vagy Megjegyzés : Az 5A001.b.5. nem vonja ellenőrzés alá a kifejezetten a polgári sávokon történő használatra tervezett celluláris rádió-berendezéseket. Műszaki megjegyzés : A ‘csatornakapcsolási idő' az egyik vevőfrekvenciáról a másikra történő átváltáshoz szükséges idő (azaz késleltetés), a megadott végső vételi frekvencia vagy az attól ± 0,05 %-ra lévő tartomány elérése céljából. Azok a termékek, amelyek a központi frekvenciájuk körül ± 0,05 %-nál kisebb frekvenciatartománnyal rendelkeznek, csatornafrekvencia-kapcsolásra alkalmatlannak minősülnek. 6. Digitális "jelfeldolgozási" funkciót alkalmaz a 700 bit/s alatti ‘hangkódolási' sebesség elérésére. Műszaki megjegyzések : 1. A változtatható sebességű ‘hangkódoláshoz' az 5A001.b.6. pont a folyamatos beszéd hangkódoló kimenetére vonatkozik. 2. Az 5A001.b.6. pont alkalmazásában a ‘hangkódolás' meghatározása: olyan technika, amelynek során emberi hangmintákat készítenek, majd ezeket a mintákat digitális jellé alakítják, figyelembe véve az emberi beszéd meghatározott jellegzetességeit.

c. 500 m-nél hosszabb optikai szálak, amelyek a gyártó minősítése szerint képesek 2 × 109 N/m2 vagy annál nagyobb ‘szakítószilárdság-vizsgálatnak' ellenállni; N.B. A víz alatti köldökzsinór kábelek tekintetében lásd: 8A002.a.3. Műszaki megjegyzés : ‘Szakítószilárdság-vizsgálat': olyan online, vagy offline termékvizsgálat, amelynek során egy 0,5-3 m hosszúságú kábeldarabra, 2-5 m/s sebességgel egy adott húzófeszültséget dinamikusan alkalmaznak, miközben a befogó csévék átmérője kb. 150 mm. A környezeti hőmérséklet 293 K (20 °C), a relatív páratartalom 40 %. A szakítószilárdság vizsgálat végrehajtására a megfelelő nemzeti szabvány is használható.

d. ‘Elektronikusan forgatható többfázisú antennarendszerek' a következők szerint: 1. 31,8 GHz-nél nagyobb, de legfeljebb 57 GHz-es frekvencián való működésre alkalmasnak vannak minősítve, és effektív kisugárzott teljesítményük (ERP) eléri vagy meghaladja a + 20 dBm-t (22,15 dBm tényleges izotróp kisugárzott teljesítmény (EIRP)); 2. 57 GHz-nél nagyobb, de legfeljebb 66 GHz-es frekvencián való működésre alkalmasnak vannak minősítve, és effektív kisugárzott teljesítményük eléri vagy meghaladja a + 24 dBm-t (26,15 dBm tényleges izotróp kisugárzott teljesítmény); 3. 66 GHz-nél nagyobb, de legfeljebb 90 GHz-es frekvencián való működésre alkalmasnak vannak minősítve, és effektív kisugárzott teljesítményük eléri vagy meghaladja a + 20 dBm-t (22,15 dBm tényleges izotróp kisugárzott teljesítmény); 4. 90 GHz-nél nagyobb frekvencián való működésre alkalmasnak vannak minősítve; 1. megjegyzés : Az 5A001.d. nem vonja ellenőrzés alá az ICAO mikrohullámú leszállító rendszerekre (MLS) vonatkozó szabványainak megfelelő eszközöket tartalmazó leszállító rendszerekhez tervezett ‘elektronikusan forgatható többfázisú antennarendszereket'. 2. megjegyzés : Az 5A001.d. nem vonja ellenőrzés alá az alábbiak bármelyikével történő használatra tervezett antennákat: a. Polgári sávokon történő használatra tervezett celluláris rádió-berendezések vagy WLAN-rádióberendezések; b. IEEE 802.15-re alapuló vagy vezeték nélküli HDMI; vagy c. Rögzített vagy mobil műholdas földi állomások kereskedelmi, polgári távközléshez. Műszaki megjegyzés : Az 5A001.d. pont alkalmazásában az ‘elektronikusan forgatható többfázisú antennarendszer' (electronically steerable phased array antenna) olyan antenna, amely a sugarat fázisvezérléssel képzi (vagyis a sugár irányát a sugárzó elemek komplex gerjesztési koefficienseivel szabályozza) és e sugár iránya elektromos jellel megváltoztatható (jeladás és -vétel során egyaránt) oldalszögben vagy célhelyszögben, vagy oldal- és célhelyszögben.

e. 30 MHz feletti frekvenciákon üzemelő rádióirány-mérő berendezések és a kifejezetten ezekhez tervezett alkatrészek, amelyek rendelkeznek a következő jellemzők mindegyikével: 1. 10 MHz, vagy nagyobb "pillanatnyi sávszélesség"; és 2. Képes megtalálni a kevesebb mint 1 ms-ig tartó jelet sugárzó, együtt nem működő rádióadók irányát (LOB);

f. Mobil telekommunikációs szolgáltatások lehallgatására vagy zavarására szolgáló berendezések, és azokhoz tartozó monitoring berendezések, és a kifejezetten ezekhez tervezett alkatrészek: 1. Rádióinterfészen keresztül továbbított hangok vagy adatok kigyűjtésére tervezett lehallgató berendezés; 2. Az 5A001.f.1. pontban nem meghatározott, a rádióinterfészen keresztül továbbított klienseszköz, illetve előfizetői azonosítók (pl. IMSI, TIMSI vagy IMEI), jelzésátvitel vagy egyéb metaadatok kigyűjtésére tervezett lehallgató berendezés; 3. Az alábbiakban felsoroltak bármelyikét végrehajtó, kifejezetten a mobil telekommunikációs szolgáltatások szándékos és szelektív zavarása, letiltása, akadályozása, gyengítése vagy csökkentése céljára tervezett vagy módosított zavaróberendezések, valamint az e célra tervezett alkatrészek: a. RAN (Radio Access Network, rádió-hozzáférési hálózat)-berendezés funkcióinak szimulálása; b. Az alkalmazott mobil telekommunikációs protokoll (pl. GSM) egyedi jellemzőinek észlelése és kihasználása; vagy c. Az alkalmazott mobil telekommunikációs protokoll (pl. GSM) egyedi jellemzőinek kihasználása; 4. Az 5A001.f.1., az 5A001.f.2. vagy az 5A001.f.3. pontban meghatározott termékek működésének azonosítására tervezett vagy módosított RF monitoring berendezés; Megjegyzés : Az 5A001.f.1. és 5A001.f.2. nem vonja ellenőrzés alá az alábbiakat: a. Kifejezetten az analóg magán mobil rádiórendszer (PMR), IEEE 802.11 WLAN lehallgatására tervezett berendezés; b. A mobil telekommunikációs hálózatok üzemeltetői számára tervezett berendezés; vagy c. Mobil telekommunikációs berendezések vagy hálózatok "fejlesztésére" vagy "gyártására" tervezett berendezés. N.B.1. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE. N.B.2. A rádióvevők tekintetében lásd az 5A001.b.5. pontot.

g. Passzív koherens helymeghatározó (Passive Coherent Location, PCL) rendszerek vagy kifejezetten mozgó tárgyaknak a nem radaralapú adók általi környezeti rádiófrekvencia-kibocsátások visszaverésének mérésével való felderítésére és nyomon követésére tervezett berendezések; Műszaki megjegyzés : A nem radaralapú adók magukban foglalhatják a kereskedelmi rádió-, televízió- vagy digitális távközlési bázisállomásokat. Megjegyzés: Az 5A001.g. nem vonja ellenőrzés alá az alábbiakat: a. Rádióasztronómiai berendezések; vagy b. A céltárgyból származó rádiójeleket igénylő rendszerek vagy berendezések.

h. Rögtönzött robbanószerkezetek (IED) elleni tevékenységhez való berendezés és kapcsolódó berendezések, az alábbiak szerint: 1. A rögtönzött robbanószerkezetek (IED) idő előtti aktiválására vagy az indítás megakadályozására tervezett vagy e célra átalakított, az 5A001.f. pontban meg nem határozott rádiófrekvenciás (RF) adó-vevő készülékek/berendezések; 2. Olyan technikákat alkalmazó berendezés, amelyeket arra terveztek, hogy lehetővé tegyék a rádiókommunikációt ugyanazon frekvenciákon, mint amelyeken az 5A001.h.1. pontban meghatározott, ugyanott elhelyezett berendezés közvetít. N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

i. Nem használt;

j. Internetprotokoll (IP) alapú hálózati kommunikációfigyelő rendszerek és berendezés, és a kifejezetten ezekhez tervezett alkatrészek, amelyek rendelkeznek az alábbi összes jellemzővel: 1. Szolgáltatói szintű internetprotokoll (IP) alapú hálózatban (pl. nemzeti szintű IP-gerinchálózatban) az alábbiak mindegyikét ellátja: a. Elemzés az alkalmazási rétegben (pl. a nyíltrendszer-összekapcsolási (OSI) modell (ISO/IEC 7498-1) 7. rétege); b. Kiválasztott metaadatok és alkalmazástartalom (pl. hang, videó, üzenetek, csatolmányok) kinyerése; és c. A kinyert adatok indexálása; és 2. Kifejezetten arra tervezték, hogy ellássa az alábbiak mindegyikét: a. Keresések végzése "erős szelektorok" alapján; és b. Egy egyén vagy személyek csoportja kapcsolati hálózatának feltérképezése. Megjegyzés: Az 5A001.j. nem vonja ellenőrzés alá az alábbiak bármelyikével történő használatra tervezett rendszereket vagy berendezéseket: a. Marketing cél; b. Hálózati szolgáltatásminőség (QoS); vagy c. Felhasználói élmény (QoE).

5A101‘Rakétákhoz' tervezett vagy módosított telemetrikus és távvezérlő rendszerek, beleértve a szárazföldi rendszereket.

Műszaki megjegyzés :

Az 5A101 alkalmazásában ‘rakétának' minősül minden olyan teljes rakétarendszer és pilóta nélküli légijármű, amelynek hatótávolsága meghaladja a 300 km-t.

Megjegyzés : Az 5A101 nem vonja ellenőrzés alá:

a. A pilótával rendelkező légi járműhöz vagy műholdakhoz tervezett vagy módosított rendszereket;

b. A szárazföldi vagy tengeri alkalmazásra tervezett vagy módosított szárazföldi rendszereket;

c. A kereskedelmi, polgári vagy 'életbiztonsági' (pl. adatintegritási, repülésbiztonsági) GNSS szolgáltatásokat;

5B1Vizsgáló-, ellenőrző és gyártó berendezések

5B001Távközlési vizsgáló-, ellenőrző és gyártó berendezések, alkatrészek és tartozékok, az alábbiak szerint:

a. A kifejezetten az 5A001 által meghatározott berendezések, jellemzők vagy funkciók "fejlesztésére" vagy "gyártására" tervezett berendezések, és a kifejezetten ezekhez tervezett alkatrészek és tartozékok; Megjegyzés : Az 5B001.a. nem vonja ellenőrzés alá az optikai szálakat karakterizáló berendezéseket.

b. Kifejezetten a következő távközlési átviteli vagy kapcsoló berendezés "fejlesztéséhez" készült berendezések, és a kifejezetten ezekhez tervezett alkatrészek vagy tartozékok: 1. Nem használt; 2. "Lézert" alkalmazó berendezés, amely a következők bármelyikével rendelkezik: a. 1 750 nm-nél nagyobb átviteli hullámhossz; vagy b. Nem használt; c. Nem használt; d. Analóg technikát alkalmaz, és a sávszélessége 2,5 GHz-nél nagyobb; vagy Megjegyzés : Az 5B001.b.2.d. nem vonja ellenőrzés alá a kifejezetten a kereskedelmi TV rendszerek "fejlesztésére" tervezett berendezéseket. 3. Nem használt; 4. 1 024 -es szint feletti kvadratúra amplitúdó modulációt (QAM) alkalmazó rádió berendezések; 5. Nem használt.

5C1Anyagok

Nincs.

5D1Szoftver

5D001"Szoftver" az alábbiak szerint:

a. Kifejezetten az 5A001 alatt meghatározott berendezések, funkciók vagy tulajdonságok "fejlesztésére", "gyártására" vagy "felhasználására" tervezett vagy módosított "szoftver";

b. Nem használt;

c. Kifejezetten az 5A001 vagy 5B001 alatt meghatározott berendezések jellemzőinek, funkcióinak, vagy tulajdonságainak biztosítására tervezett vagy módosított egyedi "szoftver";

d. "Szoftver", amelyet kifejezetten az alábbi távközlési átviteli vagy kapcsoló berendezések bármelyikének "fejlesztéséhez" tervezetek vagy alakítottak át: 1. Nem használt; 2. "Lézert" alkalmazó berendezés, amely a következők bármelyikével rendelkezik: a. 1 750 nm-nél nagyobb átviteli hullámhossz; vagy b. Analóg technikát alkalmaz, és a sávszélessége 2,5 GHz-nél nagyobb; vagy Megjegyzés : Az 5D001.d.2.b. nem vonja ellenőrzés alá a kifejezetten a kereskedelmi TV rendszerek "fejlesztéséhez" tervezett vagy átalakított "szoftvereket". 3. Nem használt; 4. 1 024 -es szint feletti kvadratúra amplitúdó modulációt (QAM) alkalmazó rádió berendezések.

e. Kifejezetten a rendvédelmi szervek általi nyomon követésre vagy elemzésre tervezett vagy átalakított, az 5D001.a. vagy az 5D001.c. pontban meghatározottaktól eltérő "szoftver" amely rendelkezik az alábbi jellemzők mindegyikével: 1. Keresések végzése ‘átviteli interfész' használatával a hírközlési szolgáltatótól szerzett kommunikációs tartalom vagy metaadatok "erős szelektorai" alapján; és 2. A kapcsolati háló feltérképezése vagy a célszemélyek mozgásának nyomon követése az 5D001.e.1. pontban leírt kommunikációs tartalmon vagy metaadatokon vagy kereséseken végzett keresések eredményei alapján. Műszaki megjegyzések : 1. Az 5D001.e. alkalmazásában az ‘átviteli interfész' olyan fizikai és logikai interfész, amelyet felhatalmazott bűnüldöző hatóság általi használatra terveztek, és amelyen keresztül célzott lehallgatási intézkedéseket kérnek a hírközlési szolgáltatótól, a lehallgatás eredményeit pedig a hírközlési szolgáltató továbbítja a megkereső hatóságnak. Az ‘átviteli interfész' olyan rendszereken vagy berendezéseken (pl. közvetítő eszközökön) belül valósítják meg, amelyek fogadják és hitelesítik a lehallgatás iránti megkeresést, és a megkereső hatóságnak csak a hitelesített megkeresésnek eleget tevő lehallgatási eredményeket küldik meg. 2. ‘Átviteli interfészeket' nemzetközi szabványok (beleértve, de nem kizárólagosan az ETSI TS 101 331 , ETSI TS 101 671 és a 3GPP TS 33.108 szabványokat) vagy annak megfelelő nemzeti szabványok határozhatnak meg. Megjegyzés : Az 5D001.e. nem vonja ellenőrzés alá az alábbiak bármelyikével történő használatra tervezett vagy módosított "szoftvereket": a. Számlázási célok; b. Hálózati szolgáltatásminőség (QoS); c. Felhasználói élmény (QoE); d. Közvetítő eszközök; vagy e. Mobil fizetés vagy banki felhasználás.

5D101Kifejezetten az 5A101 pontban meghatározott berendezés "felhasználásához" tervezett vagy módosított "szoftver".

5E1Technológia

5E001"Technológia", az alábbiak szerint:

a. Az 5A001 pontban meghatározott berendezések, funkciók vagy tulajdonságok, vagy az 5D001.a. vagy az 5D001.e. pontban meghatározott "szoftver" "fejlesztésére", "gyártására" vagy "felhasználására" (kivéve az üzemeltetést) vonatkozó, az Általános technológiai megjegyzés szerinti "technológia";

b. Különleges "technológia", az alábbiak szerint: 1. Kifejezetten műholdak fedélzetén történő alkalmazásra tervezett távközlési berendezések "fejlesztéséhez" vagy "gyártásához" "szükséges" "technológia"; 2. "Technológia" az olyan "lézer" hírközlő technikák "fejlesztésére" vagy "alkalmazására", amelyek légkörön kívüli vagy felszín alatti (víz alatti) közegben történő hírközlés esetén lehetővé teszik a jelek automatikus vételét és nyomon követését, valamint a kommunikáció fenntartását; 3. Olyan digitális celluláris bázisállomások "fejlesztésére" szolgáló "technológia", amelynek többsávos, többcsatornás, több kódoló algoritmusos vagy többprotokollos üzemmódot is lehetővé tevő vételi képessége "szoftveres" változtatás révén módosítható; 4. "Technológia" "kiterjesztett spektrumú" technikák "fejlesztésére", a "frekvenciaugrásos" technikát is beleértve; Megjegyzés : Az 5E001.b.4. nem vonja ellenőrzés alá az alábbiak bármelyikének "fejlesztésére" tervezett "technológiákat": a. Polgári sávokon történő használatra tervezett celluláris rádió-berendezések; vagy b. Rögzített vagy mobil műholdas földi állomások kereskedelmi, polgári távközléshez.

c. Az Általános technológiai megjegyzések szerinti, a következők bármelyikének "kifejlesztésére" vagy "gyártására" szolgáló "technológia": 1. Nem használt; 2. "Lézert" alkalmazó berendezés, amely a következők bármelyikével rendelkezik: a. 1 750 nm-nél nagyobb átviteli hullámhossz; vagy b. Nem használt; c. Nem használt; d. 100 GHz-nél kisebb frekvenciaközű optikai vivőket használó hullámhosszosztásos multiplex technikát alkalmaz; vagy e. Analóg technikát alkalmaz, és a sávszélessége 2,5 GHz-nél nagyobb; Megjegyzés : Az 5E001.c.2.e. pont nem vonja ellenőrzés alá a kereskedelmi TV rendszereket szolgáló "technológiát". N.B. A lézert alkalmazó nem távközlési berendezések "fejlesztésének" vagy "gyártásának" "technológiája" tekintetében lásd a 6E. pontot. 3. "Optikai kapcsolást" alkalmazó berendezés, amelynek kapcsolási ideje kevesebb, mint 1 ms; 4. Rádió berendezés, amely rendelkezik az alábbi jellemzők bármelyikével: a. 1 024 -es szint feletti kvadratúra-amplitúdó modulációs (QAM) technika; b. 31,8 GHz-nél nagyobb bemeneti vagy kimeneti frekvencián történő üzemelés; vagy Megjegyzés : Az 5E001.c.4.b. nem vonja ellenőrzés alá az "ITU által kiosztott", rádió-kommunikációs szolgáltatóknak, de nem rádió-meghatározásra odaítélt frekvenciákon történő működésre tervezett vagy módosított berendezéseket szolgáló "technológiát". c. az 1,5 MHz és 87,5 MHz közötti frekvenciatartományban működik, és olyan adaptív technikákat alkalmazó berendezéseket foglal magában, amelyek zavarójel-elnyomása jobb, mint 15 dB; vagy 5. Nem használt; 6. Mobil berendezés, amely az alábbi jellemzők mindegyikével rendelkezik: a. legalább 200 nm és legfeljebb 400 nm optikai hullámhosszon működik; és b. "helyi hálózatként" működik;

d. A kifejezetten távközlési célra tervezett, olyan "monolitikus, mikrohullámú integrált áramkör" ("MMIC") erősítők "fejlesztésére" vagy "gyártására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia", amelyek rendelkeznek az alábbi jellemzők bármelyikével: Műszaki megjegyzés : A 5E001.d. alpont alkalmazásában a termékek adatlapjain a maximális kimeneti telítési teljesítmény paraméter kimenőteljesítményként, kimeneti telítési teljesítményként, maximális kimenőteljesítményként, kimenő csúcsteljesítményként vagy modulációs csúcsteljesítményként is szerepelhet. 1. 2,7 GHz-nél nagyobb, de legfeljebb 6,8 GHz-es frekvencián való működésre méretezettek, "relatív sávszélességük" 15 %-nál nagyobb, és rendelkeznek az alábbiak valamelyikével: a. 2,7 GHz-nél nagyobb és legfeljebb 2,9 GHz nagyságú frekvencián 75 W-nál (48,75 dBm) nagyobb maximális kimeneti telítési teljesítmény; b. 2,9 GHz-nél nagyobb és legfeljebb 3,2 GHz nagyságú frekvencián 55 W-nál (47,4 dBm) nagyobb maximális kimeneti telítési teljesítmény; c. 3,2 GHz-nél nagyobb és legfeljebb 3,7 GHz nagyságú frekvencián 40 W-nál (46 dBm) nagyobb maximális kimeneti telítési teljesítmény; vagy d. 3,7 GHz-nél nagyobb és legfeljebb 6,8 GHz nagyságú frekvencián 20 W-nál (43 dBm) nagyobb maximális kimeneti telítési teljesítmény; 2. 6,8 GHz-nél nagyobb, de legfeljebb 16 GHz-es frekvencián való működésre méretezettek, "relatív sávszélességük" 10 %-nál nagyobb, és rendelkeznek az alábbiak valamelyikével: a. 6,8 GHz-nél nagyobb és legfeljebb 8,5 GHz nagyságú frekvencián 10 W-nál (40 dBm) nagyobb maximális kimeneti telítési teljesítmény; vagy b. 8,5 GHz-nél nagyobb és legfeljebb 16 GHz nagyságú frekvencián 5 W-nál (37 dBm) nagyobb maximális kimeneti telítési teljesítmény; 3. 16 GHz-nél nagyobb és legfeljebb 31,8 GHz közötti bármilyen frekvencián 3 W-nál (34,77 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek, és "relatív sávszélességük" 10 %-nál nagyobb; 4. 31,8 GHz-nél nagyobb és legfeljebb 37 GHz közötti bármilyen frekvencián 0,1 nW-nál (- 70 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek; 5. 37 GHz-nél nagyobb és legfeljebb 43,5 GHz közötti bármilyen frekvencián 1 W-nál (30 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek, és "relatív sávszélességük" 10 %-nál nagyobb; 6. 43,5 GHz-nél nagyobb és legfeljebb 75 GHz közötti bármilyen frekvencián 31,62 mW-nál (15 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek, és "relatív sávszélességük" 10 %-nál nagyobb; 7. 75 GHz-nél nagyobb és legfeljebb 90 GHz közötti bármilyen frekvencián 10 mW-nál (10 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek, és "relatív sávszélességük" 5 %-nál nagyobb; vagy 8. Bármilyen 90 GHz-t meghaladó frekvencián 0,1 nW-nál (- 70 dBm) nagyobb maximális kimeneti telítési teljesítménnyel való működésre méretezettek;

e. A kifejezetten távközlési célra tervezett, "szupravezető" anyagokból gyártott alkatrészeket tartalmazó, kifejezetten legalább ez egyik "szupravezető" alkotóelem "kritikus hőmérséklete" alatti hőmérsékleten történő működésre tervezett olyan elektronikus eszközök vagy áramkörök "fejlesztésére" vagy "gyártására"vonatkozó, az Általános technológiai megjegyzés szerinti "technológia", amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. "szupravezető" kapuval rendelkező digitális áramkörök áramkapcsolása, ha kapunként a késleltetési idő (másodperc) és kapunként a teljesítményveszteség (Watt) szorzata kisebb, mint 10-14 J; vagy 2. a frekvencia kiválasztása minden frekvencián 10 000 -nél nagyobb jósági tényezőjű rezgőkörökkel történik.

5E101Az 5A101 alatt meghatározott berendezések "fejlesztésére", "gyártására" vagy "felhasználására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

2. rész - "INFORMÁCIÓBIZTONSÁG"

1. megjegyzés : Nem használt.

2. megjegyzés : Az 5. kategória 2. része nem vonja ellenőrzés alá a terméket, ha az a felhasználó személyes használatában van.

3. megjegyzés : Rejtjelezési megjegyzés

Az 5A002., 5D002.a.1., 5D002.b. és 5D002.c.1. nem vonja ellenőrzés alá az alábbiak szerinti termékeket:

a. Az alábbi összes követelményt teljesítő termékek: 1. A nyilvánosság számára általánosan, korlátozás nélkül, a kiskereskedelmi elárusító helyeken, készletből, vásárlás útján a következő módokon hozzáférhető: a. Közvetlenül az üzletben; b. Postai rendelés útján; c. Elektronikus tranzakcióval; vagy d. Telefonos rendelés útján; 2. A rejtjelezési funkcionalitást a felhasználó nem tudja könnyen megváltoztatni; 3. Úgy tervezték, hogy a felhasználó a szállító további számottevő segítsége nélkül üzembe helyezhesse; és 4. Amennyiben szükséges, az áru részletes adatai hozzáférhetők, és kérésre azokat biztosítani kell az alapítás (bejegyezés) helye szerinti uniós tagállamok illetékes hatóságai számára, hogy a fenti 1-3. pontoknak történő megfelelés megállapítható legyen;

b. Az e megjegyzés a. pontjában ismertetett már létező termékek olyan hardver komponensei vagy ‘végrehajtandó szoftverei', amelyeket e már létező termékekhez terveztek, és amelyek az alábbi összes jellemzőnek eleget tesznek: 1. A komponensnek vagy ‘végrehajtandó szoftvernek' nem elsődleges funkciója vagy funkcióköre az "információbiztonság"; 2. A komponens vagy ‘végrehajtandó szoftver' nem változtatja meg a már létező termékek rejtjelezési funkcionalitását és nem új rejtjelezési funkcionalitást a már létező termékekhez; 3. A komponens vagy ‘végrehajtandó szoftver' jellemzőinek sora meghatározott, és nem fogyasztói specifikáció szerint tervezett vagy módosított; és 4. Amennyiben az exportőr letelepedési helye szerinti uniós tagállam illetékes hatósága szükségesnek ítélik, a komponens vagy ‘végrehajtandó szoftver' részleteit és a releváns végtermékek részleteit elérhetővé teszik és kérés esetén az illetékes hatóság rendelkezésére bocsátják a fent ismertetett feltételeknek való megfelelés bizonyítása céljából. Műszaki megjegyzés : A rejtjelezési megjegyzés alkalmazásában, a ‘végrehajtandó szoftver' végrehajtható formájú "szoftvert" jelent a rejtjelezési megjegyzés által az 5A002 alól kizárt már létező hardver-komponensről. Megjegyzés : A ‘végrehajtandó szoftver' nem foglalja magába a végterméken futó "szoftver" teljes bináris képeit.

Megjegyzés a rejtjelezési megjegyzéshez :

1. A 3. megjegyzés a. pontjának teljesítéséhez az alábbiak mindegyikének teljesülnie kell:

a. A termék potenciálisan egyének és vállalkozások széles körét érdekelheti; és

b. Az ár és a termék fő funkcionalitásával kapcsolatos információk anélkül is elérhetők a vásárlás előtt, hogy konzultálni kellene az eladóval vagy beszállítóval. Az árra vonatkozó megkeresést nem tekintik konzultációnak.

2. A 3. megjegyzés a. pontjának való megfelelőség megállapításához az illetékes hatóságok figyelembe vehetnek olyan releváns tényezőket, mint például a mennyiség, az ár, a szükséges technikai készség, létező értékesítési csatornák, tipikus fogyasztók, tipikus felhasználás vagy a beszállító esetleges versenykorlátozó gyakorlata.

5A2Berendezések, részegységek és alkatrészek

5A002"Információbiztonságot" szolgáló rendszerek, berendezések és ezek alkatrészei, az alábbiak szerint:

N.B. A dekódolást tartalmazó vagy alkalmazó "műholdas navigációs rendszer" vételére alkalmas berendezések ellenőrzése tekintetében lásd: 7A005, a kapcsolódó dekódolási "szoftver" és "technológia" tekintetében pedig lásd: 7D005 és 7E001.

a. ‘Az adatok bizalmassága érdekében történő rejtjelezéshez' való felhasználás céljára tervezték vagy módosították, ‘ismertetett biztonsági algoritmussal', amennyiben ez a rejtjelezési képesség használható, aktiválva van, vagy aktiválható a biztonsági "rejtjel-aktiválástól" eltérő bármely módon, a következők szerint: 1. Termékek, amelyek elsődleges funkciója az "információbiztonság"; 2. Az 5A002.a.1. pontban nem meghatározott digitális kommunikációs vagy hálózati rendszerek, berendezések vagy alkatrészek; 3. Az 5A002.a.1. vagy 5A002.a.2. pontban nem meghatározott számítógépek, más, elsődlegesen információtárolási vagy -feldolgozási funkciójú termékek és ezek alkatrészei; N.B. Az operációs rendszereket lásd még: 5D002.a.1. és 5D002.c.1. 4. Az 5A002.a.1.-5A002.a.3. pontban nem meghatározott termékek, amelyek esetében ‘az adatok bizalmassága érdekében történő rejtjelezéshez' használt ‘ismertetett biztonsági algoritmus' teljesíti az összes következő feltételt: a. A termék nem elsődleges funkcióját támogatja; és b. Olyan beépített berendezés vagy "szoftver" végzi a feladatot, amely önálló termékként az 5. kategória 2. része alá lenne sorolva. Műszaki megjegyzések : 1. Az 5A002.a. pont alkalmazásában ‘az adatok bizalmassága érdekében történő rejtjelezés' olyan "rejtjelezés", amely digitális technikákat alkalmaz és a következők bármelyikétől eltérő rejtjelezési funkciókat lát el: a. "Hitelesítés"; b. Digitális aláírás; c. Adatintegritás; d. Letagadhatatlanság; e. Digitális jogok kezelése, ideértve a másolásvédett "szoftver" futtatását; f. Rejtjelezés vagy dekódolás szórakoztatás, kereskedelmi műsorszolgáltatás vagy egészségügyidokumentáció-kezelés támogatása céljából; vagy g. Rejtjelkulcsok kezelése a fenti a.-f. pontokban leírt bármelyik funkció támogatása céljából. 2. Az 5A002.a. alpont alkalmazásában, ‘ismertetett biztonsági algoritmus' az alábbiak egyike: a. A paritás bit nélkül 56 bitnél hosszabb kulcsot használó "szimmetrikus algoritmus"; b. Olyan "aszimmetrikus algoritmus", amelynél az algoritmus biztonsága a következők bármelyikén alapul: 1. Egész számok tényezőkre bontása 512 bit felett (pl. RSA); 2. Diszkrét logaritmusok számítása 512 bitnél nagyobb véges mező multiplikatív csoportjában (pl. Diffie-Hellman Z/pZ felett); vagy 3. Diszkrét logaritmus a b.2. pontban említettől eltérő egyéb csoportban 112 bit felett (pl. Diffie-Hellman elliptikus görbe felett); vagy c. Olyan "aszimmetrikus algoritmus", amelynél az algoritmus biztonsága a következők bármelyikén alapul: 1. A legrövidebb vagy a legközelebbi rácsvektor problémája (pl. NewHope, Frodo, NTRUEncrypt, Kyber, Titanium); 2. Szuperszinguláris elliptikus görbék közötti izogéniák feltérképezése (pl. szuperszinguláris izogéniaalapú kulcsbeágyazás); vagy 3. Véletlenszerű kódok dekódolása (pl. McEliece, Niederreiter). Műszaki megjegyzés : A 2.c. műszaki megjegyzésben ismertetett algoritmusra posztkvantum, kvantumbiztos vagy kvantumrezisztens algoritmusként is történhet hivatkozás. 1. megjegyzés : Amennyiben az exportőr országa szerinti megfelelő hatóság szükségesnek ítéli, a termékek részleteit elérhetővé kell tenni és kérés esetén a hatóság rendelkezésére kell bocsátani, a következők bármelyikének megállapítása céljából: a. A termék megfelel-e az 5A002.a.1. - 5A002.a.4. pontokban szereplő kritériumoknak; vagy b. Használható-e az adatok bizalmasságát szolgáló, az 5A002.a. pontban meghatározott rejtjelezési képesség "rejtjel-aktiválás" nélkül. 2. megjegyzés: Az 5A002.a. nem vonja ellenőrzés alá az egyik következő terméket sem, sem a kifejezetten azokhoz tervezett "információbiztonsági" alkatrészeket: a. Az alábbiak szerinti intelligens kártyák és intelligenskártya-‘írók/olvasók': 1. Intelligens kártya vagy elektronikusan leolvasható személyes okmány (pl. jelérzékelő zseton, e-útlevél), amely rendelkezik az alábbi jellemzők bármelyikével: a. A rejtjelezési képességére érvényesül az alábbi kritériumok mindegyike: 1. A következők valamelyikében történő felhasználásra korlátozódik: a. Az 5A002.a.1. - 5A002.a.4. pontokban nem meghatározott berendezés vagy rendszer; b. ‘Ismertetett biztonsági algoritmussal rendelkező', ‘az adatok bizalmassága érdekében történő rejtjelezést' nem használó berendezés vagy rendszer; vagy c. E megjegyzés b.-f. pontja által az 5A002.a. alól kizárt berendezés vagy rendszerek; és 2. Más célú felhasználásra nem programozható át; vagy: b. Rendelkezik a következők mindegyikével: 1. Kifejezetten úgy tervezték és korlátozták, hogy biztosítsa a benne tárolt ‘személyes adatok' védelmét; 2. Kizárólag nyilvános vagy kereskedelmi ügyletek, illetve személyazonosítás céljára lett személyre szabva, vagy csak ilyen célra szabható személyre; és 3. A rejtjelezési képesség a felhasználó számára nem hozzáférhető; Műszaki megjegyzés : A ‘személyes adatok' magukban foglalnak bármilyen, az egy adott személyre vagy szervezetre vonatkozó adatot, mint például a tárolt pénzösszeg vagy a "hitelesítéshez" szükséges adatok. 2. Kifejezetten az e megjegyzés a.1. pontjában meghatározott termékek számára tervezett vagy módosított, illetve kizárólag az ilyen termékekkel használható ‘írók/olvasók', Műszaki megjegyzés : Az ‘írók/olvasók' az intelligens kártyákkal vagy elektronikusan leolvasható okmányokkal hálózaton keresztül kommunikáló berendezéseket foglalják magukban. b. Rejtjelező berendezés, amelyet kifejezetten és kizárólag banki felhasználásra vagy ‘pénzügyi tranzakcióhoz' terveztek; Műszaki megjegyzés : Az 5A002.a. pont 2.b megjegyzésében említett ‘pénzügyi tranzakció' magában foglalja díjak gyűjtését és elszámolását, valamint a hitelfunkciókat is. c. Polgári használatra készült hordozható vagy mobil rádiótelefonok (pl. polgári kereskedelmi mobil rádiókommunikációs rendszerekhez), amelyek nem képesek rejtjelezett adatok másik rádiótelefonhoz vagy (RAN (Radio Access Network, rádió-hozzáférési hálózat)-berendezéstől eltérő) berendezéshez való közvetlen továbbítására, sem rejtjelzett adatok RAN-berendezésen keresztüli továbbadására (pl. rádióhálózat-vezérlő (Radio Network Controller, RNC) vagy bázisállomás-vezérlő (Base Station Controller, BSC) berendezés); d. Vezeték nélküli telefonkészülékek, amelyek nem képesek végpont-végpont közötti rejtjelezésre, és amelyeknél a gyártó specifikációja szerint az átjátszó-erősítő nélküli maximális hatótávolság 400 m-nél kisebb; e. Polgári használatra készült hordozható vagy mobil rádiótelefonok, valamint ezekhez hasonló vezeték nélküli telefonkészülékek, amelyek kizárólag nyilvánosságra hozott vagy kereskedelmi rejtjelezési szabványokat alkalmaznak (a kalózkodás elleni (anti-piracy) funkciók kivételével, amelyek lehetnek nyilvánosságra nem hozottak is), valamint megfelelnek a Rejtjelezési megjegyzés (5. kategória, 2. rész, 3. megjegyzés) a.2.-a.4 pontjában foglaltaknak, amelyeket egy adott polgári ipari felhasználásra alakítottak ki olyan jellemzőkkel, amelyek nem érintik az eredeti, nem átalakított eszközök rejtjelezési tulajdonságait; f. Olyan, kizárólag nyilvánosságra hozott vagy kereskedelmi rejtjelezési szabványokat alkalmazó termékek, amelyek esetében az "információbiztonsági" funkcionalitás a vezeték nélküli "személyi hálózati" funkcionalitásra korlátozódik; g. Polgári felhasználásra tervezett, mobil telekommunikációs rádió-hozzáférési hálózat (RAN)- berendezés, amely a rejtjelezési megjegyzés a.2.-a.4. pontjainak (az 5. kategória 2. részének 3. megjegyzése) is megfelel, 0,1 W (20 dBm) vagy annál kevesebb rádiófrekvencia kimeneti teljesítménnyel rendelkezik, és 16 vagy kevesebb egyidejű felhasználót támogat. h. Routerek, kapcsolók, átjárók vagy relék, amelyek esetében az "információbiztonsági" funkcionalitás kizárólag a nyilvánosságra hozott vagy kereskedelmi rejtjelezési szabványokat alkalmazó "működési, adminisztrációs vagy karbantartási" ("OAM") feladatokra korlátozódik; vagy i. Általános célú informatikai berendezés vagy szerverek, amelyeknél az "információbiztonsági" funkcionalitás megfelel az összes alábbi kritériumnak: 1. Kizárólag nyilvánosságra hozott vagy kereskedelmi rejtjelezési szabványokat alkalmaz; és 2. Az alábbiak bármelyike: a. olyan központi feldolgozó egység szerves része, amely eleget tesz az 5. kategória, 2. rész, 3. megjegyzésében foglaltaknak; b. az 5D002 alatt nem meghatározott operációs rendszer szerves része; vagy c. a berendezés "OAM" feladataira korlátozódik. j. Kifejezetten ‘hálózatba kapcsolt polgári ipari alkalmazás' céljára tervezett termékek, amelyek az alábbi jellemzők mindegyikével rendelkeznek: 1. Az alábbiak bármelyike: a. hálózati csatlakozós végponti eszköz, amely rendelkezik az alábbi jellemzők bármelyikével: 1. az "információbiztonsági" funkció kizárólag a ‘nem tetszőleges adatok' biztosítására vagy a "működési, adminisztrációs vagy karbantartási" ("OAM") feladatokra korlátozódik; vagy 2. az eszköz egy kifejezetten ‘hálózatba kapcsolt polgári ipari alkalmazásra' korlátozódik; vagy b. hálózati berendezés, amely az alábbi jellemzők mindegyikével rendelkezik: 1. kifejezetten a fenti j.1.a. alpontban meghatározott termékekkel való kommunikációra fejlesztették ki; és 2. az "információbiztonsági" funkció a fenti j.1.a.pontban említett termékek ‘hálózatba kapcsolt polgári ipari alkalmazásának' támogatására, vagy e hálózati berendezés vagy az ezen megjegyzés j. pontjában szereplő más eszközök "OAM" feladataira korlátozódik; és 2. az "információbiztonsági" funkció kizárólag nyilvánosságra hozott vagy kereskedelmi rejtjelezési szabványokat alkalmaz, és a rejtjelezési funkciót a felhasználó nem képes könnyen megváltoztatni. Műszaki megjegyzések : 1. ‘Hálózatba kapcsolt polgári ipari alkalmazás': az "információbiztonságtól", a digitális kommunikációtól, az általános célú hálózati tevékenységtől és a számítástechnikától eltérő, hálózati kapcsolatot biztosító fogyasztói vagy polgári ipari alkalmazás; 2. ‘Nem tetszőleges adatok': valamely rendszer stabilitásához, teljesítményéhez vagy fizikai méréséhez közvetlenül kapcsolódó szenzor- vagy mérési adatok (pl. hőmérséklet, nyomás, térfogatáram, tömeg, térfogat, feszültség, fizikai hely stb.), amelyeket az eszköz felhasználója nem tud megváltoztatni.

b. ‘Rejtjelaktiválási token'; Műszaki megjegyzés : A ‘rejtjelaktiválási token' az alábbiakban felsorolt valamely célra tervezett vagy átalakított termék: 1. Az 5. kategória 2. részében nem meghatározott terméknek az 5A002.a. vagy 5D002.c.1. pontban meghatározott termékké - "rejtjel-aktiválással" - történő konvertálására tervezték vagy alakították át, és a kriptográfiai megjegyzés (5. kategória, 2. rész, 3. megjegyzés) nem vonja ki az ellenőrzés alól, vagy 2. Az 5. kategória 2. részében már meghatározott termék 5A002.a. pontban meghatározott kiegészítő funkcionalitásának - "rejtjel-aktiválással" - történő engedélyezésére tervezték vagy alakították át;

c. "Kvantum-kriptográfia" használatára vagy alkalmazására tervezték vagy alakították át; Műszaki megjegyzés : A "kvantum-kriptográfia" kvantum-kulcsszétosztás (quantum key distribution, QKD) néven is ismert.

d. Ultra-szélessávú modulációs technikákat alkalmazó rendszerekhez csatornákra osztó kódok, rejtjelező kódok vagy hálózatazonosító kódok előállítására szolgáló rejtjelezési technikák használatára tervezték vagy alakították át, és rendelkezik az alábbi jellemzők bármelyikével: 1. 500 MHz-et meghaladó sávszélesség; vagy 2. 20 %-os vagy nagyobb "relatív sávszélesség";

e. Az 5A002.d. pontban meghatározottaktól eltérő "kiterjesztett spektrumú" rendszerekhez szórási kód vagy a "frekvenciaugrásos" rendszerekhez ugrókód generálására szolgáló rejtjelező technikák alkalmazására tervezték vagy alakították át.

5A003Nem rejtjelezési "információbiztonsági" rendszerek, berendezések és alkatrészek, az alábbiak szerint:

a. Meg nem engedett behatolás érzékelésére mechanikai, elektromos vagy elektronikai eszközöket alkalmazó, e célra tervezett vagy átalakított kommunikációs kábelrendszerek; Megjegyzés : 5A003.a. csak a fizikai réteg biztonságát vonja ellenőrzés alá. Az 5A003.a. céljából a fizikai réteg magában foglalja a nyíltrendszer-összekapcsolási (OSI) modell (ISO/IEC 7498-1) 1. rétegét.

b. Az információhordozó jelek káros kisugárzásának az egészségügyi, biztonsági vagy elektromágneses interferencia szabványok által megkívánt érték alá történő csökkentése céljából tervezték vagy alakították át.

5A004.Az "információbiztonság" hatástalanítására, gyengítésére vagy kijátszására szolgáló rendszerek, berendezések és alkatrészek, az alábbiak szerint:

a. ‘Rejtjelfejtési funkciók' elvégzésére tervezték vagy alakították át. Megjegyzés : Az 5A004.a. magában foglalja a ‘rejtjelfejtési funkciók' műszaki visszafejtéssel történő elvégzésére tervezett vagy átalakított rendszereket vagy berendezést. Műszaki megjegyzés : A ‘rejtjelfejtési funkciók' olyan funkciók, amelyeket a rejtjelezési mechanizmusok hatálytalanítására terveztek a célból, hogy a bizalmas változókhoz vagy érzékeny adatokhoz - ideértve a tiszta szövegeket, jelszavakat vagy rejtjelezési kódokat - jussanak.

b. A 4A005 vagy az 5A004.a. pontban nem meghatározott termékek, amelyeket arra terveztek, hogy ellássát a következő feladatokra mindegyikét: 1. ‘Nyers adatok kinyerése' számítástechnikai vagy kommunikációs eszközből; és 2. Az eszköz általi "hitelesítés" vagy engedély-ellenőrzés kijátszása az 5A004.b.1. pontban leírt funkció elvégzése érdekében. Műszaki megjegyzés : ‘Nyers adatok kinyerése' számítástechnikai vagy kommunikációs eszközből: bináris adatoknak az eszköz tárolóeszközéből (pl. RAM, pendrive vagy merevlemez) az eszköz operációs rendszere vagy fájlrendszere általi értelmezés nélkül történő lehívása. 1. megjegyzés : Az 5A004.b nem vonja ellenőrzés alá a kifejezetten számítástechnikai vagy kommunikációs eszköz "fejlesztésére" vagy "gyártására" tervezett rendszereket vagy berendezéseket. 2. megjegyzés : Az 5A004.b. nem foglalja magába: a. a hibakereső programokat és hipervizorokat; b. a logikai adatok kinyerésére korlátozott termékeket; c. az eltávolított chipet vagy JTAG-et használó adatkinyerő termékeket; vagy d. a kifejezetten jail-breakelésre vagy rootolásra tervezett és korlátozott termékek.

5B2Vizsgáló-, ellenőrző és gyártó berendezések

5B002"Információbiztonsági" vizsgáló-, ellenőrző és "gyártó" berendezések, az alábbiak szerint:

a. Kifejezetten az 5A002, 5A003, 5A004 vagy 5B002.b. pontban meghatározott berendezések "fejlesztésére" vagy "gyártására" tervezett berendezések;

b. Kifejezetten az 5A002, 5A003 vagy 5A004 pontban meghatározott berendezés vagy az 5D002.a. vagy 5D002.c. pontban meghatározott "szoftver" "információbiztonsági" funkcióinak értékelésére és érvényesítésére tervezett mérőberendezés.

5C2Anyagok

Nincs.

5D2Szoftver

5D002"Szoftver" az alábbiak szerint:

a. Kifejezetten a következők valamelyikének "kifejlesztésére", "gyártására", vagy "felhasználására" tervezett "szoftver": 1. Az 5A002 pontban meghatározott berendezés vagy az 5D002.c.1. pontban meghatározott "szoftver"; 2. Az 5A003 pontban meghatározott berendezés vagy az 5D002.c.2. pontban meghatározott "szoftver"; vagy 3. Berendezés vagy "szoftver", a következők szerint: a. Az 5A004.a pontban meghatározott berendezés vagy az 5D002.c.3.a. pontban meghatározott "szoftver"; b. Az 5A004.b pontban meghatározott berendezés vagy az 5D002.c.3.b. pontban meghatározott "szoftver";

b. Az 5A002.b. alatt meghatározott ‘rejtjelaktiválási token' jellemzőivel rendelkező "szoftver";

c. A következők bármelyikének jellemzőivel rendelkező, vagy funkcióit megvalósító vagy szimuláló "szoftver": 1. Az 5A002.a, 5A002.c., 5A002.d. vagy 5A002.e. pontban meghatározott berendezés; Megjegyzés : Az 5D002.c.1. nem vonja ellenőrzés alá az "OAM" feladatokra korlátozott, kizárólag nyilvánosságra hozott vagy kereskedelmi rejtjelezési szabványokat végrehajtó "szoftvert". 2. Az 5A003. pontban meghatározott berendezés; vagy 3. Berendezés az alábbiak szerint: a. Az 5A004.a. pontban meghatározott berendezés; b. Az 5A004.b. pontban meghatározott berendezés. Megjegyzés : Az 5D002.c.3.b. nem vonja ellenőrzés alá a "behatoló szoftvereket".

d. Nem használt.

5E2Technológia

5E002"Technológia", az alábbiak szerint:

a. Az 5A002, 5A003, 5A004 vagy 5B002 pontban meghatározott berendezés vagy az 5D002.a. vagy 5D002.c. pontban meghatározott "szoftver" "fejlesztésére", "gyártására" vagy "felhasználására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia". Megjegyzés : Az 5E002.a. pont nem vonja ellenőrzés alá az 5A004.b., 5D002.c.3.b. vagy 5D002.c.3.b. pontban meghatározott termékekhez tartozó "technológiát".

b. Az 5A002.b. alatt meghatározott ‘rejtjelaktiválási token' jellemzőivel rendelkező "technológia".

Megjegyzés : Az 5E002 az 5. kategória 2. részében meghatározott funkciók, jellemzők vagy technikák végrehajtásának értékelése vagy meghatározás céljából végzett eljárásokból származó "információbiztonsági" műszaki adatokat foglal magában.

VIII. RÉSZ

6. kategória

6. KATEGÓRIA - SZENZOROK ÉS LÉZEREK

6ABerendezések, részegységek és alkatrészek

6A001Akusztikai rendszerek, berendezések és alkatrészek, az alábbiak szerint:

a. Hajózási akusztikai rendszerek, berendezések vagy a kifejezetten ezekhez tervezett alkatrészek, az alábbiak szerint: 1. Aktív (adó vagy adó és vevő) rendszerek, berendezések vagy a kifejezetten ezekhez tervezett alkatrészek, az alábbiak szerint: Megjegyzés : A 6A001.a.1. nem vonja ellenőrzés alá a következő berendezéseket: a. ± 20 o-ot meghaladó letapogatási pontossággal nem rendelkező, vertikálisan működő és kizárólag vízmélység-mérésre, az elsüllyedt vagy betemetett tárgyak távolságának mérésére vagy halászati célra alkalmazott mélységmérők. b. Akusztikus jelzők, az alábbiak szerint: 1. Akusztikus vészjelzők; vagy 2. Pingerek, amelyeket kifejezetten víz alatti pozíció újra beazonosítására, illetve az oda történő visszatérésre terveztek. a. Akusztikus tengerfenék-vizsgáló berendezések, az alábbiak szerint: 1. A tengerfenék topográfiai feltérképezésére szolgáló, felszíni hajókról működtethető vizsgálóberendezések, amelyek rendelkeznek az alábbi jellemzők mindegyikével: a. Arra tervezték, hogy függőlegestől 20o-ot meghaladóan eltérő szögben végezzenek mérést; b. Arra tervezték, hogy a tengerfenék topográfiáját 600 m-t meghaladó mélységekben mérje; c. 2-nél alacsonyabb ‘bemérési felbontás'; és d. A mélységmérés "pontosságának" ‘fokozása' az alábbi összes tényező kompenzálásával: 1. Az akusztikus szenzor mozgása 2. Terjedés a víz közegében, a szenzortól a tengerfenékig és vissza; és 3. Hangsebesség a szenzornál; Műszaki megjegyzések : 1. A ‘bemérési felbontás' a hangnyaláb (fokokban kifejezett) szélességének és a nyalábonkénti beméréseknek a hányadosa. 2. A ‘pontosságfokozás' a külső eszközökkel való kompenzálás képességét is magában foglalja. 2. A tengerfenék topográfiai feltérképezésére szolgáló, víz alatti vizsgálóberendezések, amelyek rendelkeznek az alábbi jellemzők valamelyikével: Műszaki megjegyzés : Az akusztikus szenzor nyomásbesorolása a 6A001.a.1.a.2. pontban meghatározott berendezés mélységbesorolását határozza meg. a. Rendelkezik a következők mindegyikével: 1. 300 m-nél nagyobb mélységben való működésre tervezték vagy módosították; és 2. ‘Bemérési teljesítményük' nagyobb, mint 3 800 m/s; vagy Műszaki megjegyzés : A ‘bemérési teljesítmény' 100 %-os lefedettséget feltételezve a szenzor maximális működési sebességének (m/s) és a nyalábonkénti bemérések maximális számának szorzata. A két irányban bemérő rendszerek (3D szonárok) esetében bármelyik irány maximális ‘bemérési teljesítményét' kell felhasználni. b. A 6A001.a.1.a.2.a. alatt nem meghatározott, az alábbi összes jellemzővel rendelkező vizsgálóberendezést: 1. 100 m-nél nagyobb mélységben való működésre tervezték vagy módosították; 2. Arra tervezték, hogy függőlegestől 20o-ot meghaladóan eltérő szögben végezzenek mérést; 3. Rendelkeznek az alábbiak bármelyikével: a. 350 kHz alatti üzemi frekvencia; vagy b. Arra tervezték, hogy a tengerfenék topográfiáját az akusztikus szenzortól 200 métert meghaladó tartományban mérje; és 4. A mélységmérés "pontosságának" ‘fokozása' az alábbi összes tényező kompenzálásával: a. Az akusztikus szenzor mozgása b. Terjedés a víz közegében, a szenzortól a tengerfenékig és vissza; és c. Hangsebesség a szenzornál; 3. Oldalirányban pásztázó szonárok (Side Scan Sonar, SSS) vagy szintetikus apertúrájú szonárok (Synthetic Aperture Sonar, SAS), amelyeket a tengerfenék képalkotó feltérképezésére terveztek, és rendelkeznek az alábbi jellemzők mindegyikével, és kifejezetten ezekhez tervezett adó és vevő akusztikai rendszerek: a. 500 m-nél nagyobb mélységben való működésre tervezték vagy módosították; b. 570 m2/s-nál nagyobb ‘területlefedési teljesítmény' a 15 cm-nél kisebb'pályairányú felbontást' lehetővé tevő maximális hatótávolság mellett; és c. 15 cm-nél kisebb ‘keresztirányú felbontás'; Műszaki megjegyzések : 1. A ‘területlefedési teljesítmény' (m2/s) a szonár hatótávolsága (m) és a szenzor adott hatósátávolság mellett lehetséges maximális sebessége (m/s) szorzatának a kétszerese. 2. A ‘pályairányú felbontás' (cm) - csak az SSS szonárok esetében - az azimut (horizontális) nyalábszélességnek (szögfok), a szonár hatótávolságának (m) és 0,873-nak a szorzata. 3. A ‘keresztirányú felbontás' (cm) 75-nek és a jel sávszélességének (kHz) a hányadosa. b. Tárgyészleléshez vagy helymeghatározáshoz tervezett rendszerek vagy adásra és vételre alkalmas rendszerek, amelyek rendelkeznek az alábbiak bármelyikével: 1. 10 kHz alatti átviteli frekvencia; 2. A 10 kHz-24 kHz üzemi frekvencia sávval rendelkező berendezések, amelyek hangnyomásszintje meghaladja a 224 dB-t (vonatkoztatási alap 1 μPa, 1 m-en); 3. A 24 kHz-30 kHz üzemi frekvencia sávval rendelkező berendezések, amelyek hangnyomásszintje meghaladja a 235 dB-t (vonatkoztatási alap 1 μPa, 1 m-en); 4. Bármely tengely mentén 1o-nál kisebb sugarak formálása és 100 kHz alatti üzemi frekvencia; 5. 5 120 m-t meghaladó hatótávolságon egyértelmű kijelzést biztosító működésre tervezett berendezés; vagy 6. Olyan berendezések, amelyeket úgy terveztek, hogy az 1 000 m-t meghaladó mélységben történő rendeltetésszerű üzemeltetés során fellépő nyomásnak ellenálljanak, és amelyek az alábbi jellemzőkkel bármelyikével rendelkező jelátalakítókkal vannak ellátva: a. Dinamikus nyomáskompenzáció; vagy b. Átalakító elemként nem ólom-cirkonát-titanátot alkalmaz; c. Akusztikai leképezők (beleértve az átalakítókat), amelyek piezoelektromos, magnetosztrikciós, elektrosztrikciós, elektrodinamikus vagy hidraulikus elemek felhasználásával egyedi vagy kombinált módon működnek, és az alábbiak bármelyikével rendelkeznek: 1. megjegyzés : A 6A001 alatt nem meghatározott egyéb berendezések számára speciálisan tervezett akusztikus leképezők - az átalakítókat is beleértve - ellenőrzési státusát az egyéb berendezés ellenőrzési státusa határozza meg. 2. megjegyzés : A 6A001.a.1.c nem vonja ellenőrzés alá a hangot csak vertikálisan irányító elektronikai eszközöket vagy a mechanikai (pl. légpuska vagy gőzlöketű puska), illetve kémiai (pl. robbanó) forrásokat. 3. megjegyzés : A 6A001.a.1.c. pontban meghatározott piezoelektromos elemek magukban foglalják azokat, amelyek a következőkből készültek: ólom-magnézium-niobát/ólom-titanát(Pb(Mg1/3Nb2/3)O3-PbTiO3, vagy PMN-PT) szilárd oldatból növesztett egykristályok vagy ólom-indium-niobát/ólom-magnézium niobát/ólom-titanát (Pb(In1/2Nb1/2)O3-Pb(Mg1/3Nb2/3)O3-PbTiO3, vagy PIN-PMN-PT) szilárd oldatból növesztett egykristályok. 1. 10 kHz alatti frekvencián üzemelnek, és rendelkeznek az alábbiak valamelyikével: a. Nem 100 %-os terhelési ciklusban való folyamatos működésre tervezték őket, és (10log(f) + 169,77) dB-t (referencia: 1 μPa 1 m-nél) meghaladó kisugárzott ‘szabadtéri hangforrásszinttel (SLRMS)' rendelkeznek, ahol f a sugárzott feszültségre adott legnagyobb válasz (Transmitting Voltage Response: TVR) Hertzben megadott frekvenciája 10kHz alatt van; vagy b. 100 %-os terhelési ciklusban való folyamatos működésre tervezték őket, és (10log(f) + 159,77) dB-t (referencia: 1 μPa 1 m-nél) meghaladó folyamatosan kisugárzott ‘szabadtári hangforrásszinttel (SLRMS)' rendelkeznek 100 %-os terhelési ciklusban, ahol f a sugárzott feszültségre adott legnagyobb válasz (TVR) Hertzben megadott frekvenciája 10kHz alatt van; vagy Műszaki megjegyzés : A ‘szabadtéri hangforrásszintet (SLRMS)' a maximális válaszadó tengely mentén határozzák meg, az akusztikus leképező távoli mezejében. A sugárzott feszültségre adott válaszból az alábbi egyenlettel lehet kiszámítani: SLRMS = (TVR + 20log VRMS) dB (ref: 1μPa 1 m-nél), ahol SLRMS a forrásszint, TVR a sugárzott feszültségre adott válasz és VRMS a leképező vezető feszültsége. 2. Nem használt; 3. 22 dB-nél nagyobb mellékhurok elnyomás; d. A vízfelszínen közlekedő hajók vagy a víz alatti úszó járművek helyzetének meghatározására szolgáló akusztikai rendszerek és berendezések, amelyek rendelkeznek az alábbi jellemzők mindegyikével, és a kifejezetten ezekhez tervezett alkatrészek: 1. A mérési távolság meghaladja az 1 000 métert; és 2. A meghatározott pozícióhiba 1 000 méteres tartományban 10 m effektív (négyzetes közép) értéknél jobb; Megjegyzés : A 6A001.a.1.d. magában foglalja a következőket: a. Olyan berendezések, amelyek két vagy több jelzőbója és a felszíni, valamint a víz alatti járművek hídrofon egységei között koherens "jelfeldolgozást" végeznek; b. Olyan berendezések, amelyek képesek az adott pont kiszámítása céljából a hangterjedési hibák automatikus korrigálására. e. Kifejezetten az úszók és búvárok felderítésére, helyük meghatározására és automatikus osztályozásukra tervezett önálló aktív hanglokátorok, amelyek rendelkeznek az alábbi jellemzők mindegyikével, és kifejezetten ezekhez tervezett adó és vevő akusztikai rendszerek: 1. A mérési távolság meghaladja az 530 métert; 2. A meghatározott pozícióhiba 530 méteres tartományban 15 m effektív (négyzetes közép) értéknél jobb; és 3. A továbbított impulzusjel sávszélessége meghaladja a 3 kHz-et; N.B. A kifejezetten katonai célra tervezett vagy módosított búvárfelderítő rendszerek tekintetében lásd a katonai célú termékek ellenőrzési jegyzékét. Megjegyzés : A 6A001.a.1.e. pont esetében, amikor a különböző környezeti feltételeket illetően több mérési távolság van megadva, a legnagyobb mérési távolságot kell figyelembe venni. 2. Passzív rendszerek, berendezések vagy a kifejezetten ezekhez tervezett alkatrészek, az alábbiak szerint: Megjegyzés : A 6A001.a.2. a vételi készülékeket is ellenőrzés alá vonja - függetlenül attól, hogy a rendeltetésszerű alkalmazás során külön aktív egység tartozik-e hozzájuk -, valamint a kifejezetten hozzájuk tervezett alkatrészeket is. a. Hidrofonok (víz alatti jelzések adására és vételére szolgáló elektroakusztikai készülékek), amelyek rendelkeznek az alábbi jellemzők bármelyikével: Megjegyzés : A kifejezetten egyéb berendezéshez tervezett hidrofonok ellenőrzési státusát az egyéb berendezés ellenőrzési státusa határozza meg. Műszaki megjegyzések : 1. A hidrofonok egyetlen akusztikus kimenőcsatornát létrehozó egy vagy több szenzorelemből állnak. A több elemet tartalmazókra hidrofoncsoportként is lehet hivatkozni. 2. A 6A001.a.2.a. alkalmazásában a passzív vevőkészülékként való működésre tervezett víz alatti akusztikai jelátalakítók hidrofonok. 1. Folytonos rugalmas szenzorelemeket tartalmaz; 2. Rugalmas diszkrét szenzorelemek részegységeit tartalmazza, amelyeknek mind az átmérője, mind hossza kevesebb, mint 20 mm, és az elemek egymás közötti távolsága kevesebb, mint 20 mm; 3. Rendelkezik az alábbi érzékelőelemek bármelyikével: a. Optikai szálak; b. ‘Piezoelektromos polimer filmek' a polivinidilén-fluoridon (PVDF) és kopolimerein {P(VDF-TrFE) és P(VDF-TFE)} kívül; c. ‘Flexibilis piezoelektromos kompozitok'; d. Ólom-magnézium-niobát/ólom-titanát (azaz Pb(Mg1/3Nb2/3)O3-PbTiO3, vagy PMN-PT) szilárd oldatból növesztett piezoelektromos egykristályok; vagy e. Ólom-indium-niobát/ólom-magnézium-niobát/ólom-titanát (azaz Pb(In1/2Nb1/2)O3-Pb(Mg1/3Nb2/3)O3-PbTiO3, vagy PIN-PMN-PT) szilárd oldatból növesztett piezoelektromos egykristályok; 4. A ‘hidrofon érzékenysége' gyorsuláskompenzálás nélkül bármely mélységben jobb, mint - 180 dB; 5. Gyorsuláskompenzálással rendelkező, 35 m-nél nagyobb mélységben történő működésre tervezett hidrofon; vagy 6. 1 000 m-nél nagyobb mélységben történő működésre tervezték, és a ‘hidrofon érzékenysége' jobb, mint - 230 dB 4 kHz alatt; Műszaki megjegyzések : 1. A ‘piezoelektromos polimer film' szenzorelemei polarizált polimer filmből állnak, amelyet kinyújtanak és feszítőkerethez vagy csévéhez (mandrelhez) csatolnak. 2. A ‘flexibilis piezoelektromos kompozitok' szenzorelemei piezoelektromos kerámia részecskéket vagy szálakat tartalmaznak elektromos szigeteléssel, akusztikailag átlátszó gumi-, polimer- vagy epoxi keverékkel kombinálva, ahol a komponens a szenzorelemek integráns része. 3. A ‘hidrofon érzékenysége' a következőképpen határozható meg: a kimenőfeszültség effektív értéke és az 1 V effektív értékű referenciafeszültség hányadosának 10-es alapú logaritmusa szorozva hússzal, ha az előerősítő nélküli hidrofon-szenzor 1 μPa effektív nyomású síkhullámú akusztikai mezőben helyezkedik el. Például a - 160 dB-es hidrofon (a referenciafeszültség 1 V/μPa) egy adott mezőben 10-8 V kimenőfeszültséget, míg egy - 180 dB érzékenységű hidrofon csak 10-9 V kimenőfeszültséget szolgáltat. Következésképpen a - 160 dB jobb, mint a - 180 dB. b. Vontatott akusztikus hidrofonrendszerek, amelyek rendelkeznek a következők bármelyikével: Műszaki megjegyzés : A hidrofonrendszerek több kimeneti akusztikus csatornát biztosító hidrofonokból állnak. 1. A hidrofoncsoport osztástávolsága kevesebb, mint 12,5 m vagy oly módon ‘átalakítható', hogy a hidrofoncsoport osztástávolsága kevesebb mint 12,5 m legyen; 2. A rendszert 35 m-t meghaladó mélységben történő működésre tervezték, vagy az ilyenre ‘átalakítható'; Műszaki megjegyzés : A 6A001.a.2.b.1. és 2.-ben az ‘átalakítható' azt jelenti, hogy ezeknél az eszközöknél a kábelezés, vagy a csatlakozások módosításával lehetővé válik a hidrofoncsoport osztástávolságának és az üzemi mélység korlátoknak a megváltoztatása. E lehetőségeket a következők biztosítják: a kábelek számának 10 %-át meghaladó pótkábelek, a hidrofoncsoport osztástávolságát szabályozó blokkok vagy beállítható belső mélység korlátozó eszközök, illetve több hidrofoncsoport vezérlése; 3. A 6A001.a.2.d. alatt meghatározott irányszenzorok; 4. Hosszanti irányban erősített tömlőrendszerek; 5. Az összeszerelt rendszer átmérője kevesebb, mint 40 mm; 6. Nem használt; 7. A 6A001.a.2.a alatt meghatározott hidrofonjellemzők; vagy 8. A 6A001.a.2.g. alatt meghatározott gyorsulásmérőn alapuló hidroakusztikai szenzorok; c. Kifejezetten a vontatott akusztikai hidrofonrendszerek számára tervezett "felhasználó által programozható" feldolgozóberendezés, amely rendelkezik idő- vagy frekvenciaosztásos feldolgozással és korrelációval, beleértve a spektrumelemzést, a gyors Fourier vagy más transzformáció vagy eljárások alkalmazásával végrehajtott digitális szűrést és sugáralakítást; d. Irányszenzorok, amelyek rendelkeznek a következő jellemzők mindegyikével: 1. 0,5o-ot meghaladó "pontosság"; és 2. Arra tervezték, hogy 35 m-t meghaladó mélységben üzemeljenek, vagy a 35 m-t meghaladó mélységekben történő üzemelés céljából egy beállítható, vagy eltávolítható mélységérzékelő berendezéssel rendelkeznek; N.B. Az inerciális irányrendszerekkel kapcsolatban lásd a 7A003.c. pontot. e. Tengerfenéki vagy sekélyvízi kábelrendszerrel működő hidrofonrendszerek, amelyek rendelkeznek a következők bármelyikével: 1. A 6A001.a.2.a. alatt meghatározott hidrofonokat tartalmaznak; 2. Multiplexelt hidrofoncsoport jelmodulokat tartalmaznak, amelyek rendelkeznek a következő jellemzők mindegyikével: a. Arra tervezték, hogy 35 m-t meghaladó mélységben üzemeljenek, vagy a 35 m-t meghaladó mélységekben történő üzemelés céljából egy beállítható, vagy eltávolítható mélységérzékelő berendezéssel rendelkeznek; és b. Üzemileg kicserélhető vontatott akusztikus hidrofonrendszer-modulokkal rendelkeznek; vagy 3. A 6A001.a.2.g. alatt meghatározott gyorsulásmérőn alapuló hidroakusztikai szenzorokat foglalnak magukban; f. Kifejezetten tengerfenékkábel-rendszerek számára tervezett "felhasználó által programozható" feldolgozó-berendezés, amely rendelkezik idő- vagy frekvenciaosztásos feldolgozással és korrelációval, beleértve a spektrumelemzést, a gyors Fourier vagy más transzformáció, illetve eljárások alkalmazásával végrehajtott digitális szűrést és sugáralakítást; g. Gyorsulásmérőn alapuló hidroakusztikai szenzorok, amelyek rendelkeznek az összes alábbi jellemzővel: 1. Három különálló tengely mentén elrendezett három gyorsulásmérőből áll; 2. Teljes ‘gyorsulásérzékenysége' 48 dB-nél jobb (referencia 1 000 mV rms/ 1g); 3. 35 méternél nagyobb mélységben történő működésre tervezték; és 4. 20 kHz alatti üzemi frekvencia; Megjegyzés : A 6A001.a.2.g. nem vonja ellenőrzés alá a részecskesebesség-szenzorokat vagy geofónokat. Műszaki megjegyzések : 1. A gyorsulásmérőn alapuló hidroakusztikai szenzorok vektorszenzor néven is ismertek. 2. A ‘gyorsulásérzékenység' a következőképpen határozható meg: a kimenőfeszültség effektív értéke és az 1 V effektív értékű referenciafeszültség hányadosának 10-es alapú logaritmusa szorozva hússzal, ha az előerősítő nélküli hidroakusztikai-szenzor 1 g (azaz, 9.81 m/s2) rms gyorsulású síkhullámú akusztikai mezőben helyezkedik el.

b. Korrelációs-sebességszonár log berendezés és Doppler-sebességszonár log berendezés, amelyeket arra terveztek, hogy mérjék a berendezéshordozónak a tengerfenékhez viszonyított horizontális sebességét, az alábbiak szerint: 1. Az alábbi jellemzők bármelyikével rendelkező korrelációs-sebességszonár log berendezés: a. A hordozó és a tengerfenék között az 500 m-t meghaladó távolságon való működésre tervezett berendezés; vagy b. Sebesség-"pontossága" a sebesség 1 %-ánál jobb; 2. A sebesség 1 %-ánál jobb sebesség-"pontosságal" rendelkező Doppler-sebességszonár log berendezés. 1. megjegyzés : A 6A001.b. pont nem vonja ellenőrzés alá az alábbiak bármelyikére korlátozott mélységmérőket: a. Vízmélység-mérés; b. Alámerült vagy betemetett tárgyak távolságának mérése; vagy c. Halászati célú felderítés. 2. megjegyzés : A 6A001.b. pont nem vonja ellenőrzés alá a kifejezetten a felszíni hajókon való használatra tervezett berendezéseket.

c. Nem használt.

6A002Optikai szenzorok vagy felszerelések és azok tartozékai, az alábbiak szerint:

N.B. LÁSD MÉG: 6A102.

a. Optikai érzékelők, az alábbiak szerint: 1. "Űrminősítésű" félvezető detektorok, az alábbiak szerint: Megjegyzés : A 6A002.a.1. alkalmazásában a félvezető detektorok közé tartoznak a "fókuszsíkban levő detektorsorok" is. a. "Űrminősítésű" félvezető detektorok, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. A legnagyobb válaszjel a 10-nm-nél nagyobb, de legfeljebb 300 nm közötti hullámhossztartományba esik; és 2. A válaszjel a legnagyobb válaszjelhez viszonyítva a 400 nm-t meghaladó hullámhosszúságon 0,1 %-nál kisebb; b. "Űrminősítésű" félvezető detektorok, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. A legnagyobb válaszjel a 900-nm-nél nagyobb, de legfeljebb 1 200 nm közötti hullámhossztartományba esik; és 2. A válasz "időállandója" legfeljebb 95 ns; c. "Űrminősítésű" félvezető detektorok, amelyek legnagyobb válaszjele az 1 200 nm-nél nagyobb, de legfeljebb 30 000 nm közötti hullámhossztartományba esik; d. "Űrminősítésű" "fókuszsíkban levő detektorsorok", rendszerenként több, mint 2 048 elemmel, amelyeknek legnagyobb válaszjele a 300 nm-nél nagyobb, de legfeljebb 900 nm közötti hullámhossztartományba esik; 2. Képerősítő csövek és a kifejezetten ezekhez tervezett alkatrészek, ideértve a következőket: Megjegyzés: A 6A002.a.2. pont nem vonja ellenőrzés alá az olyan nem képalkotó fotoelektron sokszorozó csöveket, amelyek a vákumtérben kizárólag az alábbiak valamelyikére korlátozott elektron-érzékelőeszközzel rendelkeznek: a. Monofém anód; vagy b. Központtól központig 500 μm-nél nagyobb osztástávolságú fém anód. Műszaki megjegyzés : A ‘töltet-sokszorosítás' az elektronikus képerősítés egyik formája, és az nem más, mint töltet-hordozók előállítása ütközéses-ionizációs gerjesztés eredményeként. ‘Töltet-sokszorosítású' érzékelők lehetnek képerősítő csövek, félvezető detektorok vagy "fókuszsíkban levő detektorsorok". a. Képerősítő csövek, amelyek rendelkeznek a következő jellemzők mindegyikével: 1. A legnagyobb válaszjel a 400-nm-nél nagyobb, de legfeljebb 1 050 nm közötti hullámhossztartományba esik; 2. Az alábbiak bármelyikét alkalmazó elektron-képerősítés: a. 12 μm-nél kisebb osztástávolságú (központtól központig) mikrocsatorna-lemez; vagy b. Legfeljebb 500 μm nem összevont pixel távolságú elektronérzékelő eszköz, amelyet kifejezetten - nem mikrocsatorna-lemez révén történő - ‘töltet-sokszorosítás' céljára terveztek vagy módosítottak; és 3. Az alábbi fotokatódok bármelyikével rendelkeznek: a. Multialkáli fotokatódok (pl. S-20 és S-25) 350 A/lm-t meghaladó fényérzékenységgel; b. GaAs vagy GaInAs fotokatódok; vagy c. Egyéb "III/V összetett" félvezető fotokatódok 10 mA/W-ot meghaladó maximális "sugárérzékenységgel"; b. Képerősítő csövek, amelyek rendelkeznek a következő jellemzők mindegyikével: 1. A legnagyobb válaszjel az 1 050 -nm-nél nagyobb, de legfeljebb 1 800 nm közötti hullámhossztartományba esik; 2. Az alábbiak bármelyikét alkalmazó elektron-képerősítés: a. 12 μm-nél kisebb osztástávolságú (központtól központig) mikrocsatorna-lemez; vagy b. Legfeljebb 500 μm nem összevont pixel távolságú elektronérzékelő eszköz, amelyet kifejezetten - nem mikrocsatorna-lemez révén történő - ‘töltet-sokszorosítás' céljára terveztek vagy módosítottak; és 3. "III/V összetett" félvezető (pl. GaAs vagy GaInAs) fotokatódok és kilökött elektron fotokatódok 15 mA/W-ot meghaladó maximális "sugárérzékenységgel". c. Speciális tervezésű alkatrészek, az alábbiak szerint: 1. Az elektron-képerősítés céljából 12 μm-nél kisebb osztástávolságú (központtól központig) mikrocsatorna-lemezek; 2. Legfeljebb 500 μm nem összevont pixel távolságú elektronérzékelő eszköz, amelyet kifejezetten - nem mikrocsatorna-lemez révén történő - ‘töltet-sokszorosítás' céljára terveztek vagy módosítottak; 3. "III/V összetett" félvezető (pl. GaAs vagy GaInAs) fotokatódok és kilökött elektron fotokatódok; Megjegyzés : A 6A002.a.2.c.3. nem vonja ellenőrzés alá az alábbi maximális "sugárérzékenységi" értékek bármelyikének elérésére tervezett összetett félvezető fotokatódokat: a. Legfeljebb 10 mA/W a 400 nm-nél nagyobb, de legfeljebb 1 050 nm közötti hullámhossztartományba eső legnagyobb válaszjel esetén; vagy b. Legfeljebb 15 mA/W az 1 050 nm-nél nagyobb, de legfeljebb 1 800 nm közötti hullámhossztartományba eső legnagyobb válaszjel esetén. 3. Nem "űrminősítésű" "fókuszsíkban levő detektorsorok", ideértve a következőket: N.B. A ‘mikrobolométeren' alapuló, nem "űrminősítésű" "fókuszsíkban levő detektorsorok"-at csak a 6A002.a.3.f. pont határozza meg. Műszaki megjegyzés : A "fókuszsíkban levő detektorsorok" lineáris vagy kétdimenziós többelemű detektorrendszerek. 1. megjegyzés : A 6A002.a.3. magában foglalja a fényelektromos vezető és a fényelem rendszereket. 2. megjegyzés : A 6A002.a.3. nem vonja ellenőrzés alá: a. A többelemű (az elemek száma nem haladhatja meg a 16-ot) akár ólom-szulfidot, akár ólom-szelenidet alkalmazó tokozott fényelektromos vezető cellákat; b. Piroelektromos detektorokat, amelyek a következők bármelyikét használják: 1. Triglicin-szulfát és változatai; 2. Ólom-lantán-cirkónium-titanát és változatai; 3. Lítium-tantalát; 4. Polivinilidén-fluorid és változatai; vagy 5. Stroncium-bárium-niobát és változatai. c. Kifejezetten ‘töltet-sokszorosítás' céljára tervezett vagy módosított "fókuszsíkban levő detektorsor", amelyet úgy terveztek meg, hogy 760 nm-t meghaladó hullámhossz esetén maximális "sugárérzékenysége" legfeljebb 10 mA/W legyen, és amely rendelkezik az alábbi jellemzők mindegyikével: 1. Nem eltávolítható és nem módosítható válaszjel-korlátozó mechanizmust tartalmaznak; és 2. Az alábbiak bármelyike: a. A válaszjel-korlátozó mechanizmus a detektor elem szerves része vagy azzal kombinált; vagy b. A "fókuszsíkban levő detektorsor" kizárólag a válaszjel-korlátozó eszköz megléte esetén működőképes. Műszaki megjegyzés : A detektor elem szerves részét képező válaszjel-korlátozó eszközt úgy tervezték meg, hogy annak eltávolítása vagy módosítása esetén az érzékelő működésképtelenné válik. d. Kevesebb mint 5 130 elemet tartalmazó hőelemoszlop rendszerek. Műszaki megjegyzés : A ‘töltet-sokszorosítás' az elektronikus képerősítés egyik formája, és az nem más, mint töltet-hordozók előállítása ütközéses-ionizációs gerjesztés eredményeként. ‘Töltet-sokszorosítású' érzékelők lehetnek képerősítő csövek, félvezető detektorok vagy "fókuszsíkban levő detektorsorok". a. Nem "űrminősítésű" "fókuszsíkban levő detektorsorok", amelyek rendelkeznek az alábbiak mindegyikével: 1. A legnagyobb válaszjel a 900 nm-nél nagyobb, de legfeljebb 1 050 nm közötti hullámhossztartományba esik; és 2. Az alábbiak bármelyike: a. A válasz "időállandója" 0,5 ns-nál kisebb; vagy b. Kifejezetten ‘töltet-sokszorosítás' céljára tervezték vagy módosították, és maximális "sugárérzékenysége" a 10 mA/W-ot meghaladja; b. Nem "űrminősítésű" "fókuszsíkban levő detektorsorok", amelyek rendelkeznek az alábbiak mindegyikével: 1. A legnagyobb válaszjel az 1 050 nm-nél nagyobb, de legfeljebb 1 200 nm közötti hullámhossztartományba esik; és 2. Az alábbiak bármelyike: a. A válasz "időállandója" legfeljebb 95 ns; vagy b. Kifejezetten ‘töltet-sokszorosítás' céljára tervezték vagy módosították, és maximális "sugárérzékenysége" a 10 mA/W-ot meghaladja; c. Nem "űrminősítésű", nem-lineáris (2 dimenziós) "fókuszsíkban levő detektorsorok", melyek egyedi elemeinek legnagyobb válaszjele az 1 200 nm-t meghaladó, de a 30 000 nm-t nem meghaladó hullámhossz-tartományba esik; N.B. A szilícium- és más anyag alapú ‘mikrobolométeren' alapuló, nem "űrminősítésű" "fókuszsíkban levő detektorsorok"-at csak a 6A002.a.3.f. pont határozza meg. d. Az alábbi jellemzők mindegyikével rendelkező, nem "űrminősítésű", lineáris (1 dimenziós) "fókuszsíkban levő detektorsorok": 1. A legnagyobb válaszjel az 1 200 nm-nél nagyobb, de legfeljebb 3 000 nm közötti hullámhossztartományba esik; és 2. Az alábbiak bármelyike: a. A detektorelem ‘pásztázási irányának' és a detektorelem ‘keresztpásztázási irányának' méretaránya kisebb, mint 3,8; vagy b. Jelfeldolgozás a detektor elemekben; Megjegyzés : A 6A002.a.3.d. pont nem vonja ellenőrzés alá a kizárólag germániumból készült detektor elemekből álló (legfeljebb 32 elemű) "fókuszsíkban levő detektorsorokat". Műszaki megjegyzés : A 6A002.a.3.d. pont alkalmazásában a ‘keresztpásztázási irány' a detektorelemek lineáris tömbjével párhuzamos tengely, a ‘pásztázási irány' pedig a detektorelemek lineáris tömbjére merőleges tengely. e. Nem "űrminősítésű", lineáris (1 dimenziós) "fókuszsíkban levő detektorsorok", melyek egyedi elemeinek legnagyobb válaszjele a 3 000 nm-nél nagyobb, de legfeljebb 30 000 nm közötti hullámhossztartományba esik; f. Nem "űrminősítésű", nem lineáris (2 dimenziós), olyan ‘mikrobolométer' anyagon alapuló infravörös "fókuszsíkban levő detektorsorok", amelyek egyedi elemeinek szűretlen válaszjele (unfiltered response) a 8 000 nm-t elérő és meghaladó, de legfeljebb 14 000 nm közötti hullámhossztartományba esik; Műszaki megjegyzés : A 6A002.a.3.f. alkalmazásában a ‘mikrobolométer' olyan termikus képérzékelő, amelyet az infravörös sugárzás elnyelése miatt a detektorban történt hőváltozás eredményeként valamilyen használható jel generálására alkalmaznak. g. Nem "űrminősítésű" "fókuszsíkban levő detektorsorok", amelyek rendelkeznek az alábbiak mindegyikével: 1. Az egyedi elemek legnagyobb válaszjele a 400 nm-t meghaladó, de a 900 nm-t nem meghaladó hullámhossztartományba esik; 2. Kifejezetten ‘töltet-sokszorosítás' céljára tervezett vagy módosított fókuszsíkban levő detektorsorok, amelynek maximális "sugárérzékenysége" 760 nm-t meghaladó hullámhossz esetén a 10 mA/W-ot meghaladja; és 3. 32-nél több elemből áll;

b. Távérzékelésre tervezett "monospektrális képérzékelők" és "multispektrális képérzékelők", amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. A pillanatnyi látómező (IFOV) legfeljebb 200 μrad (mikroradián); vagy 2. 400 nm-nél nagyobb, de legfeljebb 30 000 nm közötti hullámhossztartományban működnek, és rendelkeznek a következők mindegyikével: a. A kimenő képadatokat digitális formában adják meg; és b. Rendelkeznek az alábbi jellemzők bármelyikével: 1. "Űrminősítésű"; vagy 2. Repülőgép-fedélzeti műveletekre tervezett, nem szilícium-érzékelőkkel működő berendezések, amelyek 2,5 mrad-nál (milliradián) kisebb pillanatnyi látómezővel rendelkeznek; Megjegyzés : A 6A002.b.1. nem vonja ellenőrzés alá az olyan "monospektrális képérzékelőket", amelyek legnagyobb válaszjele a 300 nm-t meghaladó, de a 900 nm-t nem meghaladó hullámhossztartományba esik, és amelyek kizárólag az alábbi, nem "űrminősítésű" detektorok vagy nem "űrminősítésű" "fókuszsíkban levő detektorsorok" valamelyikét tartalmazzák: 1. nem ‘töltet-sokszorosítás' elérésére tervezett vagy átalakított töltéscsatolt eszközök (Charge Coupled Devices, CCD) vagy 2. nem ‘töltet-sokszorosítás' elérésére tervezett vagy átalakított komplementer fémoxid félvezetős (CMOS) eszközök.

c. ‘Közvetlen látást' biztosító képalkotó berendezés, amely tartalmazza a következők bármelyikét: 1. A 6A002.a.2.a. vagy a 6A002.a.2.b. pontban ellenőrzés alá vont képerősítő csövek; 2. A 6A002.a.3. pontban ellenőrzés alá vont "fókuszsíkban levő detektorsorok"; vagy 3. A 6A002.a.1. pontban meghatározott félvezető detektorok; Műszaki megjegyzés : A ‘közvetlen látás' olyan képalkotó berendezéseket jelöl, amelyek vizuális képet adnak az emberi megfigyelő számára anélkül, hogy a képet elektronikus jellé alakítanák át a tévémonitor számára, és amely berendezések a képet nem tudják fényképészeti, elektronikus vagy más módon rögzíteni vagy tárolni. Megjegyzés : A 6A002.c. nem vonja ellenőrzés alá a következő berendezéseket, amennyiben azok GaAs-tól vagy GaInAs-tól eltérő fotokatódot tartalmaznak: a. Ipari vagy polgári, behatolás ellen védő riasztóberendezés, forgalomirányító vagy ipari mozgásszabályozó- vagy számláló rendszerek; b. Orvosi műszerek; c. Az anyagok jellemzőinek vizsgálatára, osztályozására vagy elemzésére használt ipari berendezések; d. Lángdetektorok ipari kemencékhez; e. Kifejezetten laboratóriumi felhasználásra tervezett berendezések.

d. Speciális kiegészítő alkatrészek optikai érzékelőkhöz, az alábbiak szerint: 1. "Űrminősítésű" kriogénhűtők; 2. Nem "űrminősítésű" kriogénhűtők, 218 K (- 55 °C) alatti hűtőforrás hőmérséklettel, az alábbiak szerint: a. Zárt ciklusú, és a meghibásodásmentes átlagos üzemidő (MTTF) és a meghibásodások közötti átlagos üzemidő (MTBF) több, mint 2 500 óra; b. Joule-Thomson (JT) önszabályozó minihűtők kisebb, mint 8 mm (külső) furatátmérővel; 3. Optikai érzékelőszálak, amelyeket a gyártás során összetételük, szerkezetük, vagy bevonattal történt módosításuk révén kifejezetten az akusztikus, hő, tehetetlenségi, elektromágneses vagy nukleáris sugárzási hatásokkal szemben érzékennyé tettek. Megjegyzés : A 6A002.d.3. nem vonja ellenőrzés alá a kifejezetten a furatba süllyesztett érzékelő alkalmazásokhoz tervezett tokozott optikai érzékelőszálakat.

e. Nem használt.

f. Kifejezetten a 6A002.a.3. alatt meghatározott "fókuszsíkban levő detektorsorok" számára tervezett ‘kiolvasáshoz használt integrált áramkör'. Megjegyzés : A 6A002.f. pont nem vonja ellenőrzés alá a kifejezetten polgári gépjárművekhez történő felhasználásra tervezett ‘kiolvasáshoz használt integrált áramköröket'. Műszaki megjegyzés : A ‘kiolvasáshoz használt integrált áramkör' (ROIC) olyan integrált áramkör, amelyet arra terveztek, hogy a "fókuszsíkban levő detektorsor" alapját képezze vagy ahhoz rögzítsék, és kiolvassa (azaz kinyerje és rögzítse) a detektorelemek által kibocsátott jeleket. A ‘kiolvasáshoz használt integrált áramkör' kiolvassa a detektorelemek tölteteit azáltal, hogy kinyeri a töltetet és oly módon alkalmazza a multiplex funkciót, hogy megőrizze a detektorelemek relatív térbeli elhelyezkedésére és orientációjára vonatkozó információt a "fókuszsíkban levő detektorsorokon" belül vagy kívül történő feldolgozáshoz.

6A003Kamerák, rendszerek vagy berendezések, és azok alkatrészei, az alábbiak szerint:

N.B. LÁSD MÉG: 6A203.

a. Műszer-kamerák, és a kifejezetten ezekhez tervezett alkatrészek, az alábbiak szerint: Megjegyzés : A 6A003.a.3-6A003.a.5. alatt meghatározott moduláris felépítésű műszer-kamerákat a maximális képességeik alapján kell kiértékelni, a kamera gyártójának meghatározása szerinti plug-inek segítségével. 1. Nem használt; 2. Nem használt; 3. Elektronikus sáv (streak) kamerák 50 ns-nél jobb időbeli felbontással; 4. Elektronikus kockázókamerák 1 000 000 képkocka/s-ot meghaladó sebességgel; 5. Elektronikus kamerák, amelyek rendelkeznek a következők mindegyikével: a. Az elektronikus zár sebessége (kapuzó képesség) kisebb, mint 1 μs/teljes képkocka; és b. A kiolvasási idő másodpercenként több, mint 125 teljes képkocka sebességet tesz lehetővé; 6. Plug-inek, amelyek rendelkeznek a következők mindegyikével: a. Kifejezetten a 6A003.a. alatt meghatározott, moduláris szerkezetű műszer-kamerákhoz tervezték őket; és b. Biztosítják, hogy a kamerák a gyártói specifikációval összhangban megfeleljenek a 6A003.a.3., a 6A003.a.4. vagy a 6A003.a.5. alatt meghatározott paramétereknek;

b. Képalkotó kamerák, ideértve a következőket: Megjegyzés : A 6A003.b. nem vonja ellenőrzés alá a kifejezetten műsorszórási célokra tervezett tévé vagy videokamerákat. 1. A 10 nm és 30 000 nm közötti hullámhossztartományba eső csúcsérzékenységgel rendelkező szilárdtest-szenzorokat tartalmazó videokamerák, amelyek rendelkeznek a következő jellemzők mindegyikével: a. Rendelkeznek az alábbiak bármelyikével: 1. Monokróm (fekete-fehér) kamerák esetén érzékelőmátrixonként több, mint 4 × 106 "aktív képelem"; 2. Olyan színes kameráknál, amelyek három érzékelőmátrixot tartalmaznak érzékelőmátrixonként több, mint 4 × 106 "aktív képelem"; vagy 3. Olyan színes kameráknál, amelyekben egy érzékelőmátrix van érzékelőmátrixonként több, mint 12 × 106 "aktív képelem"; és b. Rendelkeznek az alábbiak bármelyikével: 1. A 6A004.a. pontban meghatározott optikai tükrök; 2. A 6A004.d. pontban meghatározott optikai szabályozó egység; vagy 3. A belsőleg generált ‘kamerahelyzet-követési adatok' megjegyzésekkel elláthatók. Műszaki megjegyzések : 1. E bekezdés alkalmazásában a digitális videokamerákat a mozgó képek felvételéhez használt "aktív képelemek" maximális száma alapján kell értékelni. 2. E bekezdés alkalmazásában a ‘kamerahelyzet-követési adatok' a kamera látótengelyének földhöz viszonyított iránya meghatározásához szükséges információkat jelenti. Ebbe tartozik: 1) az a vízszintes szög, amelyet a kamera látótengelye a föld mágneses terének irányával zár be; 2) a kamera látótengelye és a föld horizontja között bezárt függőleges szög. 2. Letapogató kamerák és letapogató kamerarendszerek, amelyek rendelkeznek a következő jellemzők mindegyikével: a. A legnagyobb válaszjel a 10-nm-nél nagyobb, de legfeljebb 30 000 nm közötti hullámhossztartományba esik; b. Több, mint 8 192 elemet tartalmazó lineáris detektorrendszer; és c. Egyirányú mechanikus letapogatás; Megjegyzés : A 6A003.b.2. nem vonja ellenőrzése alá a kifejezetten az alábbi célok egyikére tervezett letapogató kamerákat és letapogató kamerarendszereket: a. Ipari vagy polgári fénymásolók; b. Kifejezetten polgári, rögzített, kis távolságon működő letapogatási alkalmazások (pl. dokumentumokban lévő képek vagy nyomatok, illetve műalkotások vagy fényképek reprodukciója) céljára tervezett képolvasók; vagy c. Orvosi műszerek. 3. A 6A002.a.2.a. vagy a 6A002.a.2.b. pontban meghatározott képerősítő csövekkel felszerelt képalkotó kamerák; 4. A "fókuszsíkban levő detektorsorokkal" felszerelt képalkotó kamerák, amelyek rendelkeznek a következő jellemzők egyikével: a. A 6A002.a.3.a-6A002.a.3.e. pontban meghatározott "fókuszsíkban levő detektorsorok"-at tartalmaznak; b. A 6A002.a.3.f. pontban meghatározott "fókuszsíkban levő detektorsorok"-at tartalmaznak; vagy c. A 6A002.a.3.g. pontban meghatározott "fókuszsíkban levő detektorsorok"-at tartalmaznak; 1. megjegyzés : A 6A003.b.4. pontban meghatározott képalkotó kamerák a kiolvasáshoz használt integrált áramkörön túl olyan megfelelő "jelfeldolgozó" elektronikával is kombinált "fókuszsíkban levő detektorsorok"-at tartalmaznak, amely a kamera áramforrásra kapcsolásakor lehetővé teszi legalább az analóg vagy digitális jel létrehozását. 2. megjegyzés : A 6A003.b.4. nem vonja ellenőrzés alá a legfeljebb 12 elemmel rendelkező "fókuszsíkban levő detektorsorokkal" felszerelt, időkésleltetést és integrálást elemen belül nem alkalmazó olyan képalkotó kamerákat, amelyeket bármely alábbi célra terveztek: a. Ipari vagy polgári, behatolás ellen védő riasztóberendezés, forgalomirányító vagy ipari mozgásszabályozó- vagy számláló rendszerek; b. Épületekben, berendezésekben vagy ipari folyamatokban a hőáramlás felügyeletére vagy megfigyelésére szolgáló ipari berendezés; c. Az anyagok jellemzőinek vizsgálatára, osztályozására vagy elemzésére használt ipari berendezések; d. Kifejezetten laboratóriumi felhasználásra tervezett berendezések; vagy e. Orvosi műszerek. 3. megjegyzés : 6A003.b.4.b. nem vonja ellenőrzése alá azokat a képkamerákat, amelyek rendelkeznek a következő jellemzők valamelyikével: a. A maximális képváltási frekvencia legfeljebb 9 Hz; b. Rendelkezik a következők mindegyikével: 1. A minumum horizontális vagy vertikális ‘pillanatnyi látómező' (IFOV) legalább 2 mrad (milliradián); 2. Rendelkezik egy olyan rögzített fókusztávolságú lencsével, amelyet nem eltávolíthatónak terveztek; 3. Nem rendelkezik ‘közvetlen látás' kijelzővel, és 4. Rendelkeznek az alábbiak bármelyikével: a. Nincs lehetőség az érzékelt látómező látható képének megjelenítésére, vagy b. A kamerát egyetlen fajta alkalmazásra tervezték, és a felhasználó nem módosíthatja; vagy c. A kamerát kifejezetten civil szárazföldi személygépjárműbe történő beépítésre tervezték, és rendelkezik a következő jellemzők mindegyikével: 1. A járművön belül a kamerát csak úgy helyezik el és konfigurálják, hogy az segítse a vezetőt a jármű biztonságos működtetésében; 2. Csak abban az esetben működőképes, ha beépítik az alábbiak valamelyikébe: a. Abba a civil szárazföldi személygépjárműbe, amelyhez eredetileg tervezték, és a jármű 4 500 kg-nál kevesebb (a jármű teljes súlya); vagy b. Kifejezetten erre a célra tervezett, engedélyezett karbantartási tesztberendezésbe; és 3. Rendelkezik egy olyan aktív mechanizmussal, amely meggátolja a kamera működését abban az esetben, ha eltávolítják abból a járműből, amelyhez eredetileg tervezték. Műszaki megjegyzések : 1. A 6A003.b.4. 3.b. megjegyzésében meghatározott ‘pillanatnyi látómező' (IFOV) a ‘horizontális IFOV' és a ‘vertikális IFOV' közül az alacsonyabb értéke. ‘Horizontális IFOV' = horizontális látómező (FOV) / horizontális érzékelő elemek száma. ‘Vertikális IFOV' = vertikális látómező (FOV) / vertikális érzékelő elemek száma. 2. A 6A003.b.4. pont 3.b. megjegyzésében említett ‘közvetlen látás' az infravörös színképtartományban működő olyan képkamerákra vonatkozik, amelyek egy szemhez közeli, valamely fénnyel szembeni védőmechanizmussal ellátott mikrokijelző segítségével vizuális képet adnak az emberi megfigyelő számára. 4. megjegyzés : 6A003.b.4.c. nem vonja ellenőrzése alá azokat a képkamerákat, amelyek rendelkeznek a következő jellemzők valamelyikével: a. Rendelkezik a következők mindegyikével: 1. Amennyiben a kamerát kifejezetten beltéri és vezetékes árammal működő rendszerek vagy berendezések szerves részeként történő alkalmazásra, egyetlen alkalmazásra korlátozva tervezték, az alábbiak szerint: a. Ipari folyamatmegfigyelés, minőség-ellenőrzés vagy anyagok tulajdonságainak elemzése; b. Kifejezetten tudományos kutatás céljára tervezett laboratóriumi berendezés; c. Orvosi műszerek; d. Pénzügyi csalás felderítésére szolgáló berendezés; és 2. Csak abban az esetben működőképes, ha beépítik az alábbiak valamelyikébe: a. A rendeltetés szerinti rendszer(ek) vagy berendezés; vagy b. Kifejezetten erre a célra tervezett, engedélyezett karbantartási berendezésbe; és 3. Olyan aktív mechanizmussal rendelkezik, amely meggátolja a kamera működését, amennyiben azt a rendeltetés szerinti rendszer(ek)ből vagy berendezésből eltávolítják; b. Ha a kamerát kifejezetten civil szárazföldi személygépjárműbe vagy személy- és járműszállító kompba történő beépítésre tervezték, rendelkezik a következő jellemzők mindegyikével: 1. A járművön belül vagy a kompon a kamerát csak úgy helyezik el és konfigurálják, hogy az segítse a vezetőt a jármű vagy a komp biztonságos működtetésében; 2. Csak abban az esetben működőképes, ha beépítik az alábbiak valamelyikébe: a. Abba a civil szárazföldi személygépjárműbe, amelyhez eredetileg tervezték, és a jármű 4 500 kg-nál kevesebb (a jármű teljes súlya); b. Abba a személy- és járműszállító kompba, amelyhez eredetileg tervezték, és amelynek teljes hossza 65 m vagy annál nagyobb; vagy c. Kifejezetten erre a célra tervezett, engedélyezett karbantartási tesztberendezésbe; és 3. Olyan aktív mechanizmussal rendelkezik, amely meggátolja a kamera működését, amennyiben azt a rendeltetés szerinti járműből eltávolítják; c. Oly módon tervezték meg, hogy 760 nm-t meghaladó hullámhossz esetén legfeljebb 10 mA/W maximális "sugárérzékenységgel", és az alábbiak mindegyikével rendelkezzen: 1. Nem eltávolítható és nem módosítható válaszjel-korlátozó mechanizmust tartalmaznak; 2. Olyan aktív mechanizmus, amely meggátolja a kamera működését, amennyiben a válaszjel-korlátozó mechanizmust eltávolítják; és 3. Nem kifejezetten víz alatti felhasználásra tervezték vagy módosították; vagy d. Rendelkezik a következők mindegyikével: 1. Nem képes ‘közvetlen látásra' vagy elektronikus képmegjelenítésre; 2. Nincs lehetőség az érzékelt látómező látható képének megjelenítésére; 3. A "fókuszsíkban levő detektorsor" kizárólag a rendeltetés szerinti kamerába beszerelve működőképes; és 4. A "fókuszsíkban levő detektorsor" olyan aktív mechanizmussal rendelkezik, amely tartósan meggátolja annak működését, amennyiben azt a rendeltetés szerinti kamerából eltávolítják. 5. A 6A002.a.1. pontban meghatározott félvezető érzékelőket tartalmazó kamerák.

6A004Optikai berendezések és alkatrészek, az alábbiak szerint:

a. Optikai tükrök (reflektorok), az alábbiak szerint: Műszaki megjegyzés : A 6A004.a. alkalmazásában a lézer indukálta roncsolási küszöböt (Laser Induced Damage Threshold, LIDT) az ISO 21254-1:2011 szerint mérik. N.B. A kifejezetten litográfiai berendezésekre tervezett optikai tükrök tekintetében lásd: 3B001 1. 10 mm-nél nagyobb aktív optikai apertúrával rendelkező ‘deformálható tükrök', az alábbi tulajdonságok bármelyikével, és a kifejezetten ezekhez tervezett alkatrészek: a. Rendelkezik a következők mindegyikével: 1. Mechanikus rezonancia-frekvencia 750 Hz vagy magasabb; és 2. Több mint 200 aktuátor; vagy b. A lézer indukálta roncsolási küszöb (Laser Induced Damage Threshold, LIDT): 1. 1 kW/cm2-nél nagyobb, "folytonos lézer" (CW lézer) felhasználásával; vagy 2. 2 J/cm2-nél nagyobb, 20 Hz ismétlési frekvencián 20 ns "lézer"-impulzus felhasználásával; Műszaki megjegyzés : ‘Deformálható tükrök', amelyek rendelkeznek a következők bármelyikével: a. Olyan folytonos optikai visszaverő felület, amely az optikai hullám beesési szögei torzulásainak kiegyenlítésére egyedi torzítók vagy erők hatására dinamikusan deformálódik; vagy b. Többszörös optikai visszaverő elemek, amelyek az optikai hullám beesési szögei torzulásainak kiegyenlítésére egyedi torzítók vagy erők alkalmazásával egyedileg és dinamikusan újrapozícionálhatók. ‘Deformálható tükrök' adaptív optikai tükör néven is ismertek. 2. Könnyű monolit tükrök, amelyek átlagos "ekvivalens sűrűsége" kisebb, mint 30 kg/m2 és össztömege meghaladja a 10 kg-ot; Megjegyzés : A 6A004.a.2. nem vonja ellenőrzés alá a kifejezetten arra a célra tervezett tükröket, hogy a napsugárzást a naptükörrel felszerelt földfelszíni berendezések felé irányítsák. 3. Könnyű "kompozit" vagy hab tükörszerkezetek, amelyek átlagos "ekvivalens sűrűsége" kevesebb, mint 30 kg/m2 és össztömege meghaladja a 2 kg-ot; Megjegyzés : A 6A004.a.3. nem vonja ellenőrzés alá a kifejezetten arra a célra tervezett tükröket, hogy a napsugárzást a naptükörrel felszerelt földfelszíni berendezések felé irányítsák. 4. A 6A004.d.2.a. alatt meghatározott sugárterelő tükörszakaszokhoz tervezett tükrök λ/10 vagy jobb simasággal (λ = 633 nm), amelyek rendelkeznek az alábbi jellemzők bármelyikével: a. Az átmérő vagy a nagytengely hossza legalább 100 mm; vagy b. Rendelkezik a következők mindegyikével: 1. Az átmérő vagy a nagytengely hossza 50 mm-nél nagyobb, de 100 mm-nél kisebb; és 2. A lézer indukálta roncsolási küszöb (Laser Induced Damage Threshold, LIDT): a. 10 kW/cm2-nél nagyobb,"folytonos lézer" (CW lézer) felhasználásával; vagy b. 20 J/cm2-nél nagyobb, 20 Hz ismétlési frekvencián 20 ns "lézer"-impulzus felhasználásával;

b. Cink-szelenidből (ZnSe) vagy cink-szulfidból (ZnS) készült optikai alkatrészek, 3 000 -25 000 nm hullámhosszúság tartományban történő átvitellel, amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. 100 cm3-t meghaladó térfogat; vagy 2. Az átmérő vagy a nagytengely hossza meghaladja a 80 mm-t, a vastagság (mélység) pedig a 20 mm-t;

c. "Űrminősítésű" alkatrészek optikai rendszerekhez, az alábbiak szerint: 1. Az ugyanolyan apertúrájú és vastagságú szilárd lemezzel összehasonlítva az "ekvivalens sűrűség" kevesebb, mint 20 %-ára könnyített alkatrészek; 2. Nyers alaplemezek, felületi bevonattal (egy rétegben vagy több rétegben, fémmel vagy dielektrikummal, vezető, félvezető vagy szigetelőanyaggal), illetve védőfilmmel ellátott alaplemezek; 3. Tükörszegmensek vagy részegységek, amelyek gyűjtőapertúrája legalább akkora, mint az 1 m-es átmérőjű egyszerű optikáé, és amelyeket úgy terveztek, hogy optikai rendszerbe történő beszerelésük az űrben történik; 4. Bármilyen koordinátairányban legfeljebb 5 × 10-6/K lineáris hőtágulási együtthatójú "kompozit" anyagokból gyártott alkatrész;

d. Optikai szabályozó berendezés, az alábbiak szerint: 1. Kifejezetten a 6A004.c.1. vagy 6A004.c.3. alatt meghatározott "űrminősítésű" alkatrészek felületi formájának vagy orientáltságának fenntartására tervezett berendezés; 2. Vezérlő, követő, stabilizáló és rezonátorszabályozó berendezés az alábbiak szerint: a. 50 mm-nél nagyobb átmérőjű vagy nagytengely-hosszúságú tükrök szállítására tervezett sugárterelő tükörszakaszok, amelyek rendelkeznek az alábbi összes tulajdonsággal, és a kifejezetten ezekhez tervezett elektronikus vezérlőegység: 1. ± 26 mrad vagy annál nagyobb maximális szögmozgás; 2. Mechanikus rezonancia-frekvencia 500 Hz vagy magasabb; és 3. A "szögpontosság"; 10 μrad (mikroradián) vagy kevesebb (jobb); b. Rezonátorszabályozó legalább 100 Hz sávszélességgel és 10 μrad vagy kisebb "pontossággal" (jobb); 3. Kardánfelfüggesztések, amelyek rendelkeznek a következő jellemzők mindegyikével: a. 5o-ot meghaladó maximális elfordulás; b. Legalább 100 Hz sávszélesség; c. A szögpontozási hiba értéke legfeljebb 200 μrad (mikroradián); és d. Rendelkeznek az alábbiak bármelyikével: 1. Az átmérő vagy a nagytengely hossza meghaladja a 0,15 m-t, de nem éri el az 1 m-t, szöggyorsulási képesség pedig meghaladja a 2 radián/s2 értéket; vagy 2. Az átmérő vagy a nagytengely hossza meghaladja az 1 m-t, a szöggyorsulási képesség meghaladja a 0,5 radián/s2-t; 4. Nem használt

e. ‘Aszférikus optikai elemek', amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. Az optikai apertúra legnagyobb mérete 400 mm-nél nagyobb; 2. Legalább 1 mm-nél nagyobb mintavételi hullámhossznál a felületi egyenetlenség 1 nm-nél (effektív) kisebb; és 3. A lineáris hőtágulási együtthatójának abszolút értéke 25 °C-on kisebb, mint 3 × 10-6/K. Műszaki megjegyzések : 1. Az ‘aszférikus optikai elem' optikai rendszerben használt olyan elem, amelynek képalkotó felületét vagy felületeit az ideális gömbfelület alakjától eltérőre tervezték. 2. A gyártóknak csak akkor kell megmérniük a 6A004.e.2 pont alatt meghatározott felületi egyenetlenséget, ha az optikai elemet arra tervezték, illetve gyártották, hogy adott paraméternek megfeleljen, illetve túlteljesítse azt. Megjegyzés : A 6A004.e. nem vonja ellenőrzés alá azokat az ‘aszferikus optikai elemeket', amelyek rendelkeznek az alábbi jellemzők bármelyikével: a. A legnagyobb optikai apertúra méret 1 m-nél kisebb, és a fókusztávolság és a relatív apertúra aránya legalább 4,5:1; b. A legnagyobb optikai apertúra méret legalább 1 m, és a fókusztávolság és a relatív apertúra aránya legalább 7:1; c. Fresnel, flyeye, sáv, prizma vagy diffrakciós optikai elemnek tervezték; d. Olyan boroszilikát üvegből gyártották, amelynek a lineáris hőtágulási együtthatója 25 °C-on nagyobb, mint 2,5 × 10-6/K; vagy e. Belső tükrözőképességekkel rendelkező (pl. cső típusú tükrök) optikai elem röntgensugárhoz. N.B. A kifejezetten litográfiai berendezésekhez tervezett ‘aszferikus optikai elemek' tekintetében lásd: 3B001.

f. Dinamikus hullámfront mérő berendezés, amely az összes alábbi jellemzővel rendelkezik: 1. A ‘képváltási frekvencia' legalábbb 1 kHz; és 2. A hullámfront pontossága a tervezett hullámhosszúságon λ/20 vagy kevesebb (jobb). Műszaki megjegyzés : A 6A004.f. alkalmazásában a ‘képváltási frekvencia' az a gyakoriság, amellyel a "fókuszsíkban levő detektorsorokban" található "aktív képelemeket" integrálják a hullámfront érzékelő optika által kivetített képek rögzítése érdekében.

6A005A 0B001.g.5., vagy 0B001.h.6. alatt meghatározottaktól eltérő "lézerek", alkatrészek és optikai berendezések, az alábbiak szerint:

N.B. LÁSD MÉG: 6A205.

1. megjegyzés : Az impulzus "lézerek" magukban foglalják azokat a lézereket, amelyek folyamatos hullámüzemmódban (CW) működnek, szuperponált impulzusokkal.

2. megjegyzés : Az excimer, félvezető, vegyi, szén-monoxid (CO), szén-dioxid (CO2) és ‘nem ismétlődő impulzus' neodímium üveg "lézereket" csak a 6A005.d. határozza meg.

Műszaki megjegyzés :

A ‘nem ismétlődő impulzus' azokra a "lézerekre" utal, amelyek vagy egyetlen kimeneti impulzust bocsátanak ki, vagy az impulzusok közötti időtartam meghaladja az egy percet.

3. megjegyzés : A 6A005 magában foglalja a szál-"lézereket".

4. megjegyzés : Az egyik "lézer" másik "lézer" általi pumpálásától eltérő módon történő frekvenciakonverziót (azaz hullámhosszúság-váltást) magukban foglaló "lézerek" ellenőrzési státusát a forrás "lézer" kimenete és a frekvenciakonvertált optikai kimenet ellenőrzési paramétereinek alkalmazásával határozzák meg.

5. megjegyzés : A 6.A005 nem vonja ellenőrzés alá az alábbi "lézereket":

a. 20 J alatti kimenő energiával rendelkező rubin;

b. Nitrogén;

c. Kripton.

6. megjegyzés : A 6A005.a. és a 6A005.b. alkalmazásában az ‘egytranszverzális üzemmód' meghatározás az 1,3-nál kisebb M2-tényezőjű sugárprofillal rendelkező "lézerekre", míg a ‘többszörös transzverzális üzemmód' meghatározás a legalább 1,3 M2-tényezőjű sugárprofillal rendelkező "lézerekre" vonatkozik.

Műszaki megjegyzés :

A 6A005-ben az ‘operatív hatékonyság' a "lézer" kimenőteljesítmény (vagy "átlagos kimenőteljesítmény") és a "lézer" működtetéséhez szükséges teljes bemenő elektromos teljesítmény aránya, ideértve az áramellátást/szabályozást és a hőszabályozást/hőcserélőt.

a. Nem "hangolható" folytonos hullámú "(CW) lézerek", amelyek az alábbiak bármelyikével rendelkeznek: 1. A kimenő hullámhosszúság 150 nm-nél kisebb, a kimenőteljesítmény pedig meghaladja az 1W-ot; 2. A kimenő hullámhosszúság legalább 150 nm, de nem haladja meg az 510 nm-t, és a kimenőteljesítmény meghaladja a 30 W-ot; Megjegyzés: A 6.A005.a.2 nem vonja ellenőrzése alá azon argon "lézereket", amelyek kimenőteljesítménye 50 W vagy annál kisebb. 3. A kimenő hullámhosszúság több, mint 510 nm, de legfeljebb 540 nm, és rendelkezik az alábbiak bármelyikével: a. ‘Egytranszverzális üzemmódú' kimenet, 50 W-ot meghaladó kimenőteljesítménnyel; vagy b. ‘Többszörös transzverzális üzemmódú' kimenet, 150 W-ot meghaladó kimenő teljesítménnyel; 4. A kimenő hullámhosszúság meghaladja az 540 nm-t, de nem haladja meg a 800 nm-t, és a kimenő teljesítmény meghaladja a 30 W-ot; 5. A kimenő hullámhosszúság több, mint 800 nm, de legfeljebb 975 nm, és rendelkezik az alábbiak bármelyikével: a. ‘Egytranszverzális üzemmódú' kimenet, 50 W-ot meghaladó kimenőteljesítménnyel; vagy b. ‘Többszörös transzverzális üzemmódú' kimenet, 80 W-ot meghaladó kimenő teljesítménnyel; 6. A kimenő hullámhosszúság több, mint 975 nm, de legfeljebb 1 150 nm, és rendelkezik az alábbiak bármelyikével: a. ‘Egytranszverzális üzemmódú' kimenet, amely az alábbiak bármelyikével rendelkezik: 1. 1 000 W-ot meghaladó kimenő teljesítmény; vagy 2. Rendelkezik a következők mindegyikével: a. 500 W-ot meghaladó kimenő teljesítmény; és b. A spektrális sávszélesség 40 GHz-nél kevesebb; vagy b. ‘Többszörös transzverzális üzemmódú' kimenet, amely az alábbiak bármelyikével rendelkezik: 1. 18 %-ot meghaladó ‘operatív hatékonyság' és 1 000 W-ot meghaladó kimenő teljesítmény; vagy 2. 2 kW-ot meghaladó kimenő teljesítmény; 1. megjegyzés : A 6.A005.a.6.b. nem vonja ellenőrzése alá azon ‘többszörös transzverzális üzemmódú', ipari "lézereket", amelyek kimenőteljesítménye meghaladja a 2 kW-ot, de nem haladja meg a 6 kW-ot, és az össztömege nagyobb, mint 1 200 kg. E megjegyzés alkalmazásában az össztömeg magában foglalja a "lézer" működtetéséhez szükséges összes alkatrészt, pl. a "lézert", a tápegységet, a hőcserélőt, de nem foglalja magában a sugárszabályozásra és/ vagy -kibocsátásra szolgáló külső optikát. 2. megjegyzés : A 6A005.a.6.b. nem vonja ellenőrzés alá a ‘többszörös transzverzális üzemmódú', az alábbi jellemzők valamelyikével rendelkező ipari "lézereket": a. Nem használt; b. A kimenőteljesítmény meghaladja az 1 kW-ot, de nem haladja meg az 1,6 kW-ot, BPP-je pedig több, mint 1,25 mm•mrad; c. A kimenőteljesítmény meghaladja az 1,6 kW-ot, de nem haladja meg a 2,5 kW-ot, BPP-je pedig több, mint 1,7 mm•mrad; d. A kimenőteljesítmény meghaladja a 2,5 kW-ot, de nem haladja meg a 3,3 kW-ot, BPP-je pedig több, mint 2,5 mm•mrad; e. A kimenőteljesítmény meghaladja a 3,3 kW-ot, de nem haladja meg a 6 kW-ot, BPP-je pedig több, mint 3,5 mm•mrad; f. Nem használt; g. Nem használt; h. A kimenőteljesítmény meghaladja a 6 kW-ot, de nem haladja meg a 8 kW-ot, BPP-je pedig több, mint 12 mm•mrad; vagy i. A kimenőteljesítmény meghaladja a 8 kW-ot, de nem haladja meg a 10 kW-ot, BPP-je pedig több, mint 24 mm•mrad. 7. A kimenő hullámhosszúság több, mint 1 150 nm, de legfeljebb 1 555 nm, és rendelkezik az alábbiak bármelyikével: a. ‘Egytranszverzális üzemmód', 50 W-ot meghaladó kimenőteljesítménnyel; vagy b. ‘Többszörös transzverzális üzemmód', 80 W-ot meghaladó kimenőteljesítménnyel; 8. A kimenő hullámhosszúság meghaladja az 1 555 nm-t, de nem haladja meg az 1 850 nm-t, és a kimenőteljesítmény meghaladja az 1 W-ot; 9. A kimenő hullámhosszúság több, mint 1 850 nm, de legfeljebb 2 100 nm, és rendelkezik az alábbiak bármelyikével: a. ‘Egytranszverzális üzemmód', 1 W-ot meghaladó kimenőteljesítménnyel; vagy b. ‘Többszörös transzverzális üzemmódú' kimenet, 120 W-ot meghaladó kimenő teljesítménnyel; vagy 10. A kimenő hullámhosszúság meghaladja a 2 100 nm-t, és a kimenőteljesítmény meghaladja az 1 W-ot.

b. Nem "hangolható" "impulzuslézerek", amelyek az alábbiak bármelyikével rendelkeznek: 1. A kimenő hullámhosszúság kisebb, mint 150 nm, és az alábbiak bármelyikével rendelkezik: a. A kimenő energia meghaladja az 50 mJ/impulzus értéket és a "csúcsteljesítmény" meghaladja az 1 W-ot; vagy b. Az "átlagos kimenőteljesítmény" meghaladja az 1 W-ot; 2. A kimenő hullámhosszúság 150 nm vagy több, de nem haladja meg az 510 nm-t, és az alábbiak bármelyikével rendelkezik: a. A kimenő energia meghaladja az 1,5 J/impulzus értéket és a "csúcsteljesítmény" meghaladja a 30 W-ot; vagy b. Az "átlagos kimenőteljesítmény" meghaladja a 30 W-ot; Megjegyzés : A 6.A005.b.2.b. nem vonja ellenőrzése alá az 50 W vagy annál kisebb "átlagos kimenőteljesítménnyel" rendelkező argon "lézereket". 3. A kimenő hullámhosszúság több, mint 510 nm, de legfeljebb 540 nm, és rendelkezik az alábbiak bármelyikével: a. ‘Egytranszverzális üzemmódú' kimenet, amely az alábbiak bármelyikével rendelkezik: 1. A kimenő energia meghaladja az 1,5 J/impulzus értéket és a "csúcsteljesítmény" meghaladja az 50 W-ot; vagy 2. Az "átlagos kimenőteljesítmény" meghaladja az 50 W-ot; vagy b. ‘Többszörös transzverzális üzemmódú' kimenet, amely az alábbiak bármelyikével rendelkezik: 1. A kimenő energia meghaladja az 1,5 J/impulzus értéket és a "csúcsteljesítmény" meghaladja a 150 W-ot; vagy 2. Az "átlagos kimenőteljesítmény" meghaladja a 150 W-ot; 4. A kimenő hullámhosszúság több, mint 540 nm, de legfeljebb 800 nm, és rendelkezik az alábbiak bármelyikével: a. Az "impulzus-időtartama" kevesebb, mint 1 ps, és az alábbiak bármelyike teljesül: 1. A kimenő energia meghaladja a 0,005 J/impulzus értéket és a "csúcsteljesítmény" meghaladja az 5 GW-ot; vagy 2. Az "átlagos kimenőteljesítmény" meghaladja a 20 W-ot; vagy b. Az "impulzus-időtartam" legalább 1 ps, és az alábbiak bármelyike teljesül: 1. A kimenő energia meghaladja az 1,5 J/impulzus értéket és a "csúcsteljesítmény" meghaladja a 30 W-ot; vagy 2. Az "átlagos kimenőteljesítmény" meghaladja a 30 W-ot; 5. A kimenő hullámhosszúság több, mint 800 nm, de legfeljebb 975 nm, és rendelkezik az alábbiak bármelyikével: a. Az "impulzus-időtartama" kevesebb, mint 1 ps, és az alábbiak bármelyike teljesül: 1. A kimenő energia meghaladja a 0,005 J/impulzus értéket és a "csúcsteljesítmény" meghaladja az 5 GW-ot; vagy 2. ‘Egytranszverzális üzemmódú' kimenet, 20 W-ot meghaladó "átlagos kimenőteljesítménnyel"; b. Az "impulzus-időtartam" legalább 1 ps, de legfeljebb 1 μs-t, és az alábbiak bármelyike teljesül: 1. A kimenő energia meghaladja a 0,5 J/impulzus értéket és a "csúcsteljesítmény" meghaladja az 50 W-ot; 2. ‘Egytranszverzális üzemmódú' kimenet, 20 W-ot meghaladó "átlagos kimenőteljesítménnyel"; vagy 3. ‘Többszörös transzverzális üzemmódú' kimenet, amelynek "átlagos kimenőteljesítménye" meghaladja az 50 W-ot; vagy c. Az "impulzus-időtartam" több, mint 1 μs, és az alábbiak bármelyike teljesül: 1. A kimenő energia meghaladja a 2 J/impulzus értéket és a "csúcsteljesítmény" meghaladja az 50 W-ot; 2. ‘Egytranszverzális üzemmódú' kimenet, 50 W-ot meghaladó "átlagos kimenőteljesítménnyel"; vagy 3. ‘Többszörös transzverzális üzemmódú' kimenet, amelynek "átlagos kimenőteljesítménye" meghaladja a 80 W-ot; 6. A kimenő hullámhosszúság több, mint 975 nm, de legfeljebb 1 150 nm, és rendelkezik az alábbiak bármelyikével: a. Az "impulzus-időtartama" kevesebb, mint 1 ps, és az alábbiak bármelyike teljesül: 1. A kimenő "csúcsteljesítmény" meghaladja a 2 GW/impulzus értéket; 2. Az "átlagos kimenőteljesítmény" meghaladja a 30 W-ot; vagy 3. A kimenő energia meghaladja a 0,002 J/impulzus értéket; b. Az "impulzus-időtartam" legalább 1 ps, de legfeljebb 1 ns, és az alábbiak bármelyike teljesül: 1. A kimenő "csúcsteljesítmény" meghaladja az 5 GW/impulzus értéket; 2. Az "átlagos kimenőteljesítmény" meghaladja az 50 W-ot; vagy 3. A kimenő energia meghaladja a 0,1 J/impulzus értéket; c. Az "impulzus-időtartam" legalább 1 ns, de legfeljebb 1 μs-t, és az alábbiak bármelyike teljesül: 1. ‘Egytranszverzális üzemmódú' kimenet, amely az alábbiak bármelyikével rendelkezik: a. A "csúcsteljesítmény" meghaladja a 100 MW-ot; b. Az "átlagos kimenőteljesítmény" meghaladja a 20 W-ot, és tervezésénél fogva 1 kHz vagy annál kisebb maximális impulzusismétlési frekvenciára van korlátozva; c. Az ‘operatív hatékonyság' meghaladja a 12 %-ot, és az "átlagos kimenőteljesítmény" meghaladja a 100 W-ot, és képes 1 kHz-nél nagyobb impulzusismétlési frekvencián működni; d. Az "átlagos kimenőteljesítmény" meghaladja a 150 W-ot, és képes 1 kHz-nél nagyobb impulzusismétlési frekvencián működni; vagy e. A kimenő energia meghaladja a 2 J/impulzus értéket; vagy 2. ‘Többszörös transzverzális üzemmódú' kimenet, amely az alábbiak bármelyikével rendelkezik: a. A "csúcsteljesítmény" meghaladja a 400 MW-ot; b. Az ‘operatív hatékonyság' meghaladja a 18 %-ot, és az "átlagos kimenőteljesítmény" meghaladja az 500 W-ot; c. Az "átlagos kimenőteljesítmény" meghaladja a 2 kW-ot; vagy d. A kimenő energia meghaladja a 4 J/impulzus értéket; vagy d. Az "impulzus-időtartam" meghaladja az 1 μs-t, és rendelkezik az alábbiak bármelyikével: 1. ‘Egytranszverzális üzemmódú' kimenet, amely az alábbiak bármelyikével rendelkezik: a. A "csúcsteljesítmény" meghaladja az 500 kW-ot; b. Az ‘operatív hatékonyság' meghaladja a 12 %-ot, és az "átlagos kimenőteljesítmény" meghaladja a 100 W-ot; vagy c. Az "átlagos kimenőteljesítmény" meghaladja a 150 W-ot; vagy 2. ‘Többszörös transzverzális üzemmódú' kimenet, amely az alábbiak bármelyikével rendelkezik: a. A "csúcsteljesítmény" meghaladja az 1 MW-ot; b. Az ‘operatív hatékonyság' meghaladja a 18 %-ot, és az "átlagos kimenőteljesítmény" meghaladja az 500 W-ot; vagy c. Az "átlagos kimenőteljesítmény" meghaladja a 2 kW-ot; 7. A kimenő hullámhosszúság több, mint 1 150 nm, de legfeljebb 1 555 nm, és rendelkezik az alábbiak bármelyikével: a. Az "impulzus-időtartam" legfeljebb 1 μs, és az alábbiak bármelyike teljesül: 1. A kimenő energia meghaladja a 0,5 J/impulzus értéket és a "csúcsteljesítmény" meghaladja az 50 W-ot; 2. ‘Egytranszverzális üzemmódú' kimenet, 20 W-ot meghaladó "átlagos kimenőteljesítménnyel"; vagy 3. ‘Többszörös transzverzális üzemmódú' kimenet, amelynek "átlagos kimenőteljesítménye" meghaladja az 50 W-ot; vagy b. Az "impulzus-időtartam" több, mint 1 μs, és az alábbiak bármelyike teljesül: 1. A kimenő energia meghaladja a 2 J/impulzus értéket és a "csúcsteljesítmény" meghaladja az 50 W-ot; 2. ‘Egytranszverzális üzemmódú' kimenet, 50 W-ot meghaladó "átlagos kimenőteljesítménnyel"; vagy 3. ‘Többszörös transzverzális üzemmódú' kimenet, amelynek "átlagos kimenőteljesítménye" meghaladja a 80 W-ot; 8. A kimenő hullámhosszúság több, mint 1 555 nm, de legfeljebb 1 850 nm, és rendelkezik az alábbiak bármelyikével: a. A kimenő energia meghaladja a 100 mJ/impulzus értéket és a "csúcsteljesítmény" meghaladja az 1 W-ot; vagy b. Az "átlagos kimenőteljesítmény" meghaladja az 1 W-ot; 9. A kimenő hullámhosszúság több, mint 1 850 nm, de legfeljebb 2 100 nm, és rendelkezik az alábbiak bármelyikével: a. ‘Egytranszverzális üzemmódú' kimenet, amely az alábbiak bármelyikével rendelkezik: 1. A kimenő energia meghaladja a 100 mJ/impulzus értéket és a "csúcsteljesítmény" meghaladja az 1 W-ot; vagy 2. Az "átlagos kimenőteljesítmény" meghaladja az 1 W-ot; vagy b. ‘Többszörös transzverzális üzemmódú' kimenet, amely az alábbiak bármelyikével rendelkezik: 1. A kimenő energia meghaladja a 100 mJ/impulzus értéket és a "csúcsteljesítmény" meghaladja a 10 kW-ot; vagy 2. Az "átlagos kimenőteljesítmény" meghaladja a 120 W-ot; vagy 10. A kimenő hullámhosszúság meghaladja a 2 100 nm-t, és rendelkezik az alábbi jellemzők bármelyikével: a. A kimenő energia meghaladja a 100 mJ/impulzus értéket és a "csúcsteljesítmény" meghaladja az 1 W-ot; vagy b. Az "átlagos kimenőteljesítmény" meghaladja az 1 W-ot;

c. "Hangolható" "lézerek", amelyek rendelkeznek az alábbiak bármelyikével: 1. A kimenő hullámhosszúság kisebb, mint 600 nm, és rendelkezik az alábbi jellemzők bármelyikével: a. A kimenő energia meghaladja az 50 mJ/impulzus értéket és a "csúcsteljesítmény" meghaladja az 1 W-ot; vagy b. Az átlagos vagy CW kimenő teljesítmény meghaladja az 1 W-ot; Megjegyzés : A 6A005.c.1. nem vonja ellenőrzés alá a "festéklézereket" és egyéb "folyadéklézereket", amelyek multimodális kimenettel, legalább 150 nm-es, de 600 nm-t nem meghaladó hullámhosszúsággal, valamint az alábbi jellemzők mindegyikével rendelkeznek: 1. A kimenő energia nem éri el az 1,5 J/impulzus értéket, vagy a "csúcsteljesítmény" kisebb 20 W-nál; és 2. Az átlagos vagy CW kimenő teljesítmény kisebb, mint 20 W. 2. A kimenő hullámhosszúság legalább 600 nm, de legfeljebb 1 400 nm, és rendelkezik az alábbi jellemzők bármelyikével: a. A kimenő energia meghaladja az 1 J/impulzus értéket és a "csúcsteljesítmény" meghaladja a 20 W-ot; vagy b. Az átlagos vagy CW kimenő teljesítmény meghaladja a 20 W-ot; vagy 3. A kimenő hullámhosszúság meghaladja az 1 400 nm-t, és rendelkezik az alábbi jellemzők bármelyikével: a. A kimenő energia meghaladja az 50 mJ/impulzus értéket és a "csúcsteljesítmény" meghaladja az 1 W-ot; vagy b. Az átlagos vagy CW kimenő teljesítmény meghaladja az 1 W-ot;

d. Egyéb, a 6A005.a.-ban, a 6A005.b.-ben vagy a 6a005.c.-ben meg nem határozott "lézerek", az alábbiak szerint: 1. Félvezető "lézerek", az alábbiak szerint: 1. megjegyzés : 6A005.d.1. magában foglalja az optikai kimeneti csatlakozóval (optikai-szálkivezetés) rendelkező félvezető "lézereket". 2. megjegyzés : A kifejezetten az egyéb berendezések számára tervezett félvezető "lézerek" ellenőrzési státusát az egyéb berendezés ellenőrzési státusa határozza meg. a. Egyedi, egytranszverzális hullámtípusú félvezető "lézerek", amelyek rendelkeznek a következő jellemzők bármelyikével: 1. A hullámhosszúság legfeljebb 1 510 nm, és az átlagos vagy CW kimenő teljesítmény több, mint 1,5 W; vagy 2. A hullámhosszúság több, mint 1 510 nm, és az átlagos vagy CW kimenő teljesítmény több, mint 500 mW; b. Egyedi többszörös transzverzális félvezető "lézerek", amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. 1 400 nm-nél kisebb hullámhossz, és 25 W-ot meghaladó átlagos vagy CW kimenő teljesítmény; 2. A hullámhosszúság legalább 1 400 nm, de kevesebb, mint 1 900 nm és az átlagos vagy CW kimenő teljesítmény több, mint 2,5 W; vagy 3. 1 900 nm vagy azt meghaladó hullámhossz, és 1 W-ot meghaladó átlagos vagy CW kimenő teljesítmény; c. Félvezető "lézerekből" készült önálló ‘sorok', amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. 1 400 nm-nél kisebb hullámhossz, és 100 W-ot meghaladó átlagos vagy CW kimenő teljesítmény; 2. A hullámhosszúság legalább 1 400 nm, de kevesebb, mint 1 900 nm és az átlagos vagy CW kimenő teljesítmény több, mint 25 W; vagy 3. 1 900 nm vagy azt meghaladó hullámhossz, és 10 W-ot meghaladó átlagos vagy CW kimenő teljesítmény; d. Félvezető "lézerek" ‘mátrixai' (kétdimenziós sorok), amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. 1 400 nm-nél kisebb hullámhossz, és az alábbiak bármelyike: a. Az átlagos vagy teljes CW kimenő teljesítmény kisebb, mint 3 kW, valamint az átlagos vagy CW kimeneti ‘teljesítmény-sűrűség' meghaladja az 500 W/cm2-t; b. Az átlagos vagy teljes CW kimenő teljesítmény 3 kW vagy annál több, de nem haladja meg az 5 kW-ot, valamint az átlagos vagy CW kimeneti ‘teljesítmény-sűrűség' meghaladja a 350 W/cm2-t; c. Az átlagos vagy teljes CW kimenő teljesítmény meghaladja az 5 kW-ot; d. A maximális impulzuson mért ‘teljesítmény-sűrűség' meghaladja a 2 500 W/cm2-t; vagy Megjegyzés : A 6A005.d.1.d.1.d. nem vonja ellenőrzés alá az epitaxiálisan gyártott monolit készülékeket. e. Térben koherens átlagos vagy teljes CW kimenő teljesítmény, amely meghaladja a 150 W-ot; 2. 1 400 nm vagy azt meghaladó, de 1 900 nm-nél kisebb hullámhossz, és az alábbiak bármelyike: a. Az átlagos vagy teljes CW kimenő teljesítmény kisebb, mint 250 W, valamint az átlagos vagy CW kimeneti ‘teljesítmény-sűrűség' meghaladja a 150 W/cm2-t; b. Az átlagos vagy teljes CW kimenő teljesítmény 250 W vagy annál több, de nem haladja meg az 500 W-ot, valamint az átlagos vagy CW kimeneti ‘teljesítmény-sűrűség' meghaladja az 50 W/cm2-t; c. Az átlagos vagy teljes CW kimenő teljesítmény meghaladja az 500 W-ot; d. A maximális impulzuson mért ‘teljesítmény-sűrűség' meghaladja az 500 W/cm2-t; vagy Megjegyzés : A 6A005.d.1.d.2.d. nem vonja ellenőrzés alá az epitaxiálisan gyártott monolit készülékeket. e. Térben koherens átlagos vagy teljes CW kimenő teljesítmény, amely meghaladja a 15 W-ot; 3. 1 900 nm vagy azt meghaladó hullámhossz, és az alábbiak bármelyike: a. Az átlagos vagy CW kimeneti ‘teljesítmény-sűrűség' meghaladja az 50 W/cm2-t; b. Az átlagos vagy CW kimenő teljesítmény meghaladja a 10 W-ot; vagy c. Térben koherens átlagos vagy teljes CW kimenő teljesítmény, amely meghaladja az 1,5 W-ot; vagy 4. Legalább egy, a 6A005.d.1.c. pontban meghatározott "lézer" ‘cső' Műszaki megjegyzés : A 6A005.d.1.d. pont alkalmazásában a ‘teljesítmény-sűrűség' a teljes "lézer" kimeneti teljesítmény elosztva a ‘mátrix' kibocsátó felületének területével. e. Félvezető "lézereknek" a 6A005.d.1.d. pontban meghatározottól eltérő ‘mátrixai', amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. Kifejezetten arra tervezték vagy módosították őket, hogy más ‘mátrixokkal' együtt nagyobb ‘mátrixokat' alkossanak; és 2. Az elektronika és a hűtés terén közös integrált összekapcsolással rendelkeznek; 1. megjegyzés : A félvezető "lézereknek" a 6A005.d.1.e. pontban meghatározott ‘mátrixai' összekapcsolásával kialakított ‘mátrixok', amelyeket nem további összekapcsolásra terveztek vagy módosítottak, a 6A005.d.1.d. pontban kerültek meghatározásra. 2. megjegyzés : A félvezető "lézereknek" a 6A005.d.1.e. pontban meghatározott ‘mátrixai' összekapcsolásával kialakított ‘mátrixok', amelyeket további összekapcsolásra terveztek vagy módosítottak, a 6A005.d.1.e. pontban kerültek meghatározásra. 3. megjegyzés : A 6A005.d.1.e. pont nem vonja ellenőrzés alá a végpont-végpont közötti lineáris sorokból álló mátrixok felépítésére tervezett egyes ‘csövek' moduláris részegységeit. Műszaki megjegyzések : 1. A félvezető "lézereket" a közhasználatban "lézer" diódáknak nevezik. 2. Egy ‘sor' (más néven félvezető "lézer" ‘cső', "lézer" dióda ‘cső' vagy dióda ‘cső'), több félvezető "lézerből" áll egydimenziós sorban. 3. Egy ‘mátrix' olyan'csövek' halmaza, amelyek kétdimenziós sorból álló félvezető "lézert" alkotnak. 2. Szén-monoxid-"lézerek" (CO), amelyek rendelkeznek az alábbiak bármelyikével: a. A kimenő energia meghaladja a 2 J/impulzus értéket és a "csúcsteljesítmény" meghaladja az 5 kW-ot; vagy b. Az átlagos vagy CW kimenő teljesítmény meghaladja az 5 kW-ot; 3. Szén-dioxid-"lézerek" (CO2), amelyek rendelkeznek az alábbiak bármelyikével: a. A CW kimenő teljesítmény meghaladja a 15 kW-ot; b. Az impulzuskimeneten az "impulzus-időtartam" több, mint 10 μs, és az alábbiak bármelyike teljesül: 1. Az "átlagos kimenőteljesítmény" meghaladja a 10 kW-ot; vagy 2. A "csúcsteljesítmény" meghaladja a 100 kW-ot; vagy c. Az impulzuskimeneten az "impulzus-időtartam" legfeljebb 10 μs, és az alábbiak bármelyike teljesül: 1. Az impulzusenergia meghaladja az 5 J/impulzus értéket; vagy 2. Az "átlagos kimenőteljesítmény" meghaladja a 2,5 kW-ot; 4. Excimer "lézerek", amelyek rendelkeznek az alábbi jellemzők bármelyikével: a. A kimenő hullámhosszúság nem haladja meg a 150 nm-t, és rendelkezik az alábbiak bármelyikével: 1. A kimenő energia meghaladja az 50 mJ/impulzus értéket; vagy 2. Az "átlagos kimenőteljesítmény" meghaladja az 1 W-ot; b. A kimenő hullámhosszúság több, mint 150 nm, de legfeljebb 190 nm, és rendelkezik az alábbiak bármelyikével: 1. A kimenő energia meghaladja az 1,5 J/impulzus értéket; vagy 2. Az "átlagos kimenőteljesítmény" meghaladja a 120 W-ot; c. A kimenő hullámhosszúság több, mint 190 nm, de legfeljebb 360 nm, és rendelkezik az alábbiak bármelyikével: 1. A kimenő energia meghaladja a 10 J/impulzus értéket; vagy 2. Az "átlagos kimenőteljesítmény" meghaladja az 500 W-ot; vagy d. A kimenő hullámhosszúság meghaladja a 360 nm-t, és rendelkezik az alábbi jellemzők bármelyikével: 1. A kimenő energia meghaladja az 1,5 J/impulzus értéket; vagy 2. Az "átlagos kimenőteljesítmény" meghaladja a 30 W-ot; N.B. A kifejezetten litográfiai berendezésekhez tervezett excimer "lézerek" tekintetében lásd: 3B001. 5. "Vegyi lézerek", az alábbiak szerint: a. Hidrogén-fluorid (HF) "lézerek"; b. Deutérium-fluorid (DF) "lézerek"; c. ‘Transzferlézerek', ideértve a következőket: 1. Oxigén/jód (O2-I) "lézerek"; 2. Deutérium-fluorid/szén-dioxid (DF-CO2) "lézerek"; Műszaki megjegyzés : ‘Transzferlézer' "lézer", amelyben a lézeranyagot nemlézer-atomnak vagy -molekulának lézeratommal vagy -molekularészecskével történő ütközésekor felszabaduló energia gerjeszti. 6. ‘Nem ismétlődő impulzus' neodímium üveg "lézerek", amelyek rendelkeznek az alábbi jellemzők bármelyikével: a. Az "impulzus-időtartam" legfeljebb 1 μs-t, és kimenő energia több, mint 50 J/impulzus; vagy b. Az "impulzus-időtartam" több, mint 1 μs-t, és a kimenő energia több mint 100 J/impulzus; Megjegyzés : A ‘nem ismétlődő impulzus' azokra a "lézerekre" utal, amelyek vagy egyetlen kimeneti impulzust bocsátanak ki, vagy az impulzusok közötti időtartam meghaladja az egy percet.

e. Alkatrészek, az alábbiak szerint: 1. Hűtött tükrök, akár ‘aktív hűtéssel', akár csővezetékes hűtéssel; Műszaki megjegyzés : Az ‘aktív hűtés' az optikai alkatrészek hűtésére szolgáló olyan technológia, amely az optikai alkatrészen keletkezett hőt az alkatrész felülete alá (névlegesen az optikai felület alatt kevesebb, mint 1 mm-rel) bevezetett folyadékkal távolítja el. 2. Olvasztott kúpos szálösszefogótól és többrétegű dielektrikus rácsoktól (MLD) eltérő optikai tükrök vagy áteresztő, vagy részlegesen áteresztő optikai vagy elektro-optikai alkatrészek, amelyeket kifejezetten egyes meghatározott "lézerekhez" való használatra terveztek; Megjegyzés : A 6A005.e.3. alatt meghatározott szálösszefogók és MLD-k. 3. "Szállézer" összetevők az alábbiak szerint: a. Több módusúról több módusúra átalakító olvasztott kúpos szálösszefogó, amely rendelkezik az alábbiak mindegyikével: 1. 1 000 W-ot meghaladó méretezett teljes átlagos vagy teljes CW kimenő teljesítménynél (kivéve az egymódozatú alapon, ha van ilyen, keresztül átmenő kimenőteljesítményt) beiktatási csillapítása legfeljebb 0,3 dB vagy annál jobb (kevesebb); és 2. A bemeneti szálak száma legalább 3; b. Egymódusúról több módusúra átalakító olvasztott kúpos szálösszefogó, amely rendelkezik az alábbiak mindegyikével: 1. 4 600 W-ot meghaladó méretezett teljes átlagos vagy teljes CW kimenő teljesítménynél beiktatási csillapítása 0,5 dB-nél jobb (kevesebb); 2. A bemeneti szálak száma legalább 3; és 3. Rendelkeznek az alábbiak bármelyikével: a. A kimeneten mért sugárparaméter-szorzat (BPP) nem haladja meg az 1,5 mm mrad-ot, legfeljebb öt bemeneti szálnál; vagy b. A kimeneten mért BPP nem haladja meg a 2,5 mm mrad-ot ötnél több bemeneti szálnál; c. Többrétegű dielektrikus rácsok, amelyek rendelkeznek a következő jellemzők mindegyikével: 1. 5 vagy több szál"lézerből" álló spektrumsugár- vagy koherens sugárkombinációra tervezték; és 2. A CW "lézer" indukálta roncsolási küszöb (LIDT) legalább 10 kW/cm2.

f. Optikai berendezések, az alábbiak szerint: N.B. Az "SHPL" (szuper nagyteljesítményű lézer) alkalmazásokban felhasználható, osztott apertúrájú optikai elemek tekintetében lásd a katonai célú termékek ellenőrzési jegyzékét. 1. Nem használt; 2. Kifejezetten az "SHPL"-rendszerek sugárterelési szöghibáinak dinamikus mérésére tervezett "lézer"-diagnosztikai berendezés, amelynek "szögpontossága" 10 μrad (mikroradián) vagy kevesebb (jobb); 3. Optikai berendezések és alkatrészek, melyeket kifejezetten a fáziscsoport "SHPL"-rendszerhez, koherens sugárkombinációra terveztek, és az alábbiak bármelyikével rendelkeznek: a. 0,1 μm vagy kisebb "pontosság", legalább 1 μm hullámhossz esetén; vagy b. a tervezett hullámhosszúságon λ/10 vagy kevesebb (jobb) "pontosság", legfeljebb 1 μm hullámhossz esetén; 4. Kifejezetten az "SHPL"-rendszerekhez tervezett vetítő teleszkópok;

g. ‘Lézeres akusztikai érzékelő berendezések', amelyek az összes alábbi jellemzővel rendelkeznek: 1. A CW "lézer" kimenő teljesítmény eléri vagy meghaladja a 20 mW-ot; 2. A "lézer" frekvencia-stabilitás egyenlő vagy jobb (kisebb), mint 10 MHz; 3. A "lézer" hullámhosszúságok legalább 1 000 nm-esek, de nem haladják meg a 2 000 nm-t; 4. Az optikai rendszer felbontása jobb (kisebb), mint 1 nm; és 5. Az optikai jel-zaj viszony legalább 103. Műszaki megjegyzés : A ‘lézeres akusztikai érzékelő berendezések' "lézer" mikrofonként vagy részecskeáramlás-érzékelő mikrofonként is ismertek.

6A006"Magnetométerek", "mágneses gradiométerek", "belső mágneses gradiométerek", víz alatti elektromos térerősség-érzékelők, "kompenzációs rendszerek", valamint a kifejezetten ezekhez tervezett alkatrészek, ideértve a következőket:

N.B. LÁSD MÉG: 7A103.d.

Megjegyzés : A 6A006 nem vonja ellenőrzés alá a kifejezetten halászati alkalmazásra vagy orvosi diagnosztikai célokra szolgáló biomágneses mérésekre tervezett műszereket.

a. "Magnetométerek" és alrendszereik az alábbiak szerint: 1. "Szupravezető" (SQUID) "technológiát" alkalmazó és az alábbi tulajdonságok bármelyikével rendelkező "magnetométerek": a. különlegesen a mozgásból adódó zaj csökkentésére tervezett alrendszerek nélküli, folyamatos működésre tervezett SQUID rendszerek, amelyek 1 Hz frekvencián 50fT effektív / négyzetgyök Hz-nél alacsonyabb (jobb) vagy azzal egyenlő ‘érzékenységgel' rendelkeznek; vagy b. olyan SQUID rendszerek, amelyek 20 pT effektív / négyzetgyök Hz-nél alacsonyabb (jobb) működés közbeni magnetométer ‘érzékenységgel' rendelkeznek 1 Hz frekvencián; és amelyeket kifejezetten a működés közbeni zaj csökkentésére terveztek; 2. Optikailag pumpált, vagy magprecessziós (proton/Overhauser) "technológiát" alkalmazó, és 1 Hz frekvencián 20pT effektív / négyzetgyök Hz-nél alacsonyabb (jobb) ‘érzékenységgel' rendelkező "magnetométerek"; 3. Fluxuszsilipes "technológiát" alkalmazó, és 1 H frekvencián 10 pT effektív/négyzetgyök Hz-nél alacsonyabb (jobb) ‘érzékenységgel' rendelkező "magnetométerek"; 4. Indukciós tekercses "magnetométerek", amelyek a következő értékeknél alacsonyabb (jobb) ‘érzékenységgel' rendelkeznek: a. 1 Hz-nél kisebb frekvencián, 0,05 nT effektív /négyzetgyök Hz; b. 1-10 Hz frekvencián, 1 × 10-3 nT effektív/négyzetgyök Hz; vagy c. 10 Hz-nél nagyobb frekvencián, 1 × 10-4 nT effektív/négyzetgyök Hz; 5. Száloptikás "magnetométerek", melyek ‘érzékenysége' alacsonyabb (jobb), mint 1 nT effektív / négyzetgyök Hz;

b. Víz alatti elektromos térerősség-érzékelők, melyek ‘érzékenysége' 1 Hz-en mérve, méterenként alacsonyabb (jobb), mint 8 nanovolt/négyzetgyök Hz;

c. "Mágneses gradiométerek" az alábbiak szerint: 1. "Mágneses gradiométerek", amelyek a 6A006.a. által ellenőrzés alá vont többszörös "magnetométereket" alkalmaznak; 2. Száloptikás "belső mágneses gradiométerek", amelyek mágneses gradiens mezőjének ‘érzékenysége' alacsonyabb (jobb), mint 0,3 nT/m effektív/négyzetgyök Hz; 3. "Belső mágneses gradiométerek" nem száloptikás "technológiával", amelyek mágneses gradiens mezőjének ‘érzékenysége' alacsonyabb (jobb), mint 0,015 nT/m effektív/négyzetgyök Hz;

d. "Kompenzációs rendszerek" mágneses vagy víz alatti elektromos térerősség-érzékelőkhöz, amelyek a 6A006.a., 6A006.b. vagy 6A006.c. pontban meghatározott paraméterekkel azonos vagy azoknál jobb teljesítményt eredményeznek.

e. Víz alatti elektromágneses vevőkészülékek, a 6A006.a. alatt meghatározott beépített mágneses térerősség-érzékelővel vagy a 6A006.b. alatt meghatározott víz alatti elektromos térerősség-érzékelővel.

Műszaki megjegyzés :

A 6A006 alkalmazásában az ‘érzékenység' (zajszint) az eszközfüggő zajküszöb négyzetes középértéke, amely a legalacsonyabb mérhető jel.

6A007Graviméterek és gravitás gradiométerek, az alábbiak szerint:

N.B. LÁSD MÉG: 6A107.

a. Földi használatra tervezett graviméterek, amelyek statikus "pontossága" kevesebb (jobb), mint 10 μGal; Megjegyzés : A 6A007.a. nem vonja ellenőrzés alá a kvarcelemes (Worden) típusú földi gravimétereket;

b. A mobil platformokon történő használatra tervezett graviméterek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. 0,7 mGal-nál kevesebb (jobb) statikus "pontosság"; és 2. 0,7 mGal-nál kevesebb (jobb) működési "pontosság", a regisztrálásra kész állapot eléréséhez kevesebb, mint 2 perc szükséges a kísérő korrekciós kompenzációk és a mozgási behatások bármely kombinációja esetén;

c. Gravitációs gradiométerek.

6A008Radarrendszerek, berendezések és alrendszerek, és a kifejezetten ezekhez tervezett alkatrészek, amelyek rendelkeznek az alábbi jellemzők bármelyikével:

N.B. LÁSD MÉG: 6A108.

Megjegyzés : A 6A008 nem vonja ellenőrzés alá az alábbiakat:

- Szekunder lokátoros légtérellenőrző (SSR) radar;

- Polgári gépjármű-radar;

- A légiforgalmi irányításhoz (ATC) használt kijelző vagy monitorok;

- Meteorológiai (időjárási) radarok;

- Az ICAO szabványainak megfelelő precíziós bevezetőradar (PAR) berendezés, amely elektronikusan irányítható lineáris (egydimenziós) sorokat vagy mechanikusan rögzített passzív antennákat használ.

a. 40-230 GHz frekvencián üzemelnek, és rendelkeznek az alábbiak valamelyikével: 1. 100 mW feletti átlagos kimenőteljesítmény; vagy 2. A helymeghatározási "pontosság" eltérési tartománya 1 m vagy kevesebb (jobb), irányszög tekintetében 0,2 fok vagy kevesebb (jobb);

b. A hangolható sávszélesség meghaladja az ‘üzemi középfrekvencia' ± 6,25 %-át; Műszaki megjegyzés : Az ‘üzemi középfrekvencia' a legnagyobb és a legalacsonyabb meghatározott üzemi frekvencia összegének a fele;

c. Kettőnél több vivőfrekvencián történő egyidejű működésre alkalmas;

d. Szintetikus apertúrájú (SAR), inverz szintetikus apertúrájú (ISAR) vagy oldallátású fedélzeti (SLAR) radar-üzemmódban történő működésre alkalmas radarok;

e. Elektronikusan szkennelt antennarendszert tartalmaz; Műszaki megjegyzés : Az elektronikusan szkennelt antennarendszerek elektronikusan forgatható antennarendszerek néven is ismertek.

f. Képes a nem-együttműködő céltárgyak magasságának megállapítására;

g. Kifejezetten fedélzeti működésre (léghajóra vagy repülőgéptestre szerelt) tervezeték, és mozgó célok érzékelésére Doppler "jelfeldolgozású" radarral rendelkezik;

h. Radarjelek feldolgozása és a következők bármelyikének felhasználása: 1. "Radar kiterjesztett spektrumú" technikák; vagy 2. "Radarfrekvencia-agilitás" technikák;

i. 185 km-t meghaladó maximális ‘műszer hatósugarú' földi működtetés; Megjegyzés : A 6A008.i nem vonja ellenőrzés alá az alábbiakat: a. Halászati célú földi radar; b. A kifejezetten légi irányítási felhasználásra tervezett, az alábbiak mindegyikével rendelkező földi radarberendezések: 1. Legnagyobb ‘műszer hatósugár' 500 km, vagy annál kisebb; 2. Konfigurációja olyan, hogy a radar céladatát a radar helyétől az egy vagy több polgári ATC központhoz csak egy úton lehet eljuttatni; 3. A radar pásztázási sebessége nem távirányítható az irányító ATC központból; és 4. Állandó jelleggel állítják működésbe; c. Meteorológiai ballonkövető radarok. Műszaki megjegyzés : A 6A008.i. alkalmazásában a ‘műszer hatósugár' egy radar megjelölt, egyértelmű megjelenítési tartománya.

j. "Lézer" radar vagy fényérzékelő- és mérő (LIDAR) berendezések, amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. "Űrminősítésű"; 2. Koherens heterodin vagy homodin érzékelési technikákat alkalmazó és 20 μrad-nál (mikroradiánnál) kisebb (jobb) szögfelbontású berendezések; vagy 3. A partvidék repülőgépről végzett batimetrikus feltérképezésére tervezett, a Nemzetközi Hidrográfiai Szervezet (IHO) utasításában szereplő, a hidrográfiai felmérésekre vonatkozó 1a. szabványának (5. kiadás, 2008. február) megfelelő vagy annál jobb, egy vagy több, 400 és 600 nm közötti hullámhosszúságú "lézert" használó berendezések. 1. megjegyzés : A kifejezetten felmérések végzésére tervezett LIDAR-berendezések jellemzése csak a 6A008.j.3. pontban szerepel. 2. megjegyzés : A 6A008.j. nem vonja ellenőrzés alá a kifejezetten meteorológiai megfigyelésre tervezett LIDAR berendezéseket. 3. megjegyzés : Az IHO utasításának 2008. februári 5. kiadásában szereplő 1a. szabvány paraméterei a következők szerint foglalhatók össze: - Vízszintes pontosság (95 %-os megbízhatósági szint) = 5 m + a mélység 5 %-a. - Mélységi pontosság csekély mélységek esetében (95 %-os megbízhatósági szint) = ± √(a2+(b*d)2), ahol: a = 0,5 m = állandó mélységmérési hiba, azaz az összes állandó mélységmérési hiba összege b = 0,013 = mélységfüggő hibatényező b*d = mélységfüggő hibatényező. azaz az összes állandó mélységmérési hiba összege d = mélység - A jellemzők azonosítása = Térfogatjellemzők > 2 m, 40 m mélységig; 40 m mélységet meghaladóan a mélység 10 %-a.

k. Olyan "impulzus-kompressziót" alkalmazó "jelfeldolgozó" alrendszerekkel rendelkezik, amelyek rendelkeznek a következő jellemzők bármelyikével: 1. Az "impulzus-kompresszió" aránya meghaladja a 150-et; vagy 2. Az impulzusszélesség 200 ns-nál kisebb; vagy Megjegyzés : A 6A008.k.2. nem vonja ellenőrzés alá azon kétdimenziós ‘tengeri radart' vagy ‘hajóforgalmi szolgálati' radart, amely rendelkezik a következő jellemzők mindegyikével: a. Az "impulzus-kompresszió" aránya nem haladja meg a 150-et; b. Az impulzusszélesség 30 ns-nél nagyobb; c. Önálló és forgó mechanikusan szkennelt antenna; d. 250 W-ot nem meghaladó kimenő csúcsteljesítmény; és e. Nem képes "frekvenciaugrás".

l. Az alábbi jellemzőkkel rendelkező adatfeldolgozó alrendszerekkel rendelkezik: 1. ‘Automatikus célkövetés', amely az antenna tetszőleges fordulatszáma esetén az adott cél helyzetét még a következő antennasugár áthaladás előtt megadja; vagy Megjegyzés : A 6A008.l.1. nem vonja ellenőrzés alá a légforgalom irányító-rendszerek, a ‘tengeri radarok' vészhelyzet esetén megkövetelt riadóztatási képességét. Műszaki megjegyzés : ‘Automatikus célkövetés' egy adatfeldolgozási technika, amely valós időben automatikusan meghatározza, és eredményként megadja a cél legvalószínűbb pozíciójának extrapolált értékét. 2. Nem használt; 3. Nem használt; 4. Az egyes, a 6A008.f. vagy 6A008.i. alatt meghatározott érzékelők teljesítményét meghaladó összesített teljesítmény elérése céljából két vagy több egymástól ‘földrajzilag szétszórt' radarérzékelőből származó céladatok hat másodpercen belüli szuperponálása és korrelációja vagy összesítése céljára konfigurálták. Műszaki megjegyzés : A szenzorok akkor tekinthetők ‘földrajzilag szétszórtnak', amikor az egyes helyszínek egymástól bármely irányban több mint 1 500 méter távolságban vannak. A mobil szenzorokat mindig ‘földrajzilag szétszórtnak' kell tekinteni. N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE. Megjegyzés : A 6A008.l.4. nem vonja ellenőrzés alá a ‘hajóforgalmi szolgálatokhoz' tervezett rendszereket, berendezéseket és részegységeket. Műszaki megjegyzések : 1. A 6A008 alkalmazásában, a ‘tengeri radar' olyan radar, amelyet a tengeren, belvízi utakon és partközeli környezetekben való biztonságos navigációhoz terveztek. 2. A 6A008 alkalmazásában, a ‘hajóforgalmi szolgálat' a "légi járművekre" vonatkozó légiforgalom-ellenőrzéshez hasonló hajóforgalmi monitoring és ellenőrző szolgálat.

6A102A 6A002 alatt meghatározottaktól eltérő, sugárzással szemben ellenállóvá tett ‘detektorok', amelyeket nukleáris hatások (pl. elektromágneses impulzus [EMP], röntgensugár, kombinált lökés és hőhatás) elleni védelemre és "rakétákban" történő használatra terveztek vagy alakítottak át, valamint arra terveztek vagy úgy minősítettek, hogy kibírjon 5 × 105 rad (Si) teljes besugárzási szintnek megfelelő vagy azt meghaladó sugárzási szintet.

Műszaki megjegyzés :

A 6A102 szerinti ‘detektor' alatt egy olyan mechanikus, elektromos, optikai vagy kémiai eszközt kell érteni, amely automatikusan felismeri és rögzíti az olyan hatásokat, mint a környezeti nyomás vagy hőmérséklet megváltozása, elektromos és elektromágneses jelek vagy valamilyen radioaktív anyagból származó sugárzás. Ez magában foglalja azokat az eszközöket, amelyek érzékelik a működést vagy a hibát.

6A107Graviméterek és graviméterekhez vagy gravitációs gradiensmérőkhöz tervezett alkatrészek, az alábbiak szerint:

a. A 6A007.b. alatt meghatározottaktól eltérő graviméterek, amelyeket légi vagy tengeri felhasználásra terveztek vagy alakítottak át, és amelyek statikus vagy üzemi pontossága 0,7 milligal (mgal) vagy kevesebb (jobb), és a regisztrálásra kész állapot eléréséhez legfeljebb 2 perc szükséges;

b. Kifejezetten a 6A007.b. és 6A107.a. alatt meghatározott gravitációs mérőkhöz, valamint a 6A007.c. alatt meghatározott gravitációs graviméterekhez tervezett alkatrészek.

6A108A 6A008 alatt meghatározottaktól eltérő radarrendszerek, nyomkövető rendszerek és radomok/radarburkolatok, ideértve a következőket:

a. A 9A004 alatt meghatározott űrhajó hordozóeszközökben vagy a 9A104 alatt meghatározott rakétaszondákon történő felhasználásra tervezett vagy átalakított radar és lézerradar rendszerek; Megjegyzés : A 6A108.a. alá tartoznak a következők: a. Szintvonalas térképező berendezések; b. Tájtérképezési és korrelációs (digitális és analóg) berendezések; c. Doppler-navigációs radarberendezések. d. Passzív interferométer berendezés. e. Képérzékelő berendezés (mind az aktív, mind a passzív).

b. ‘Rakétákhoz' felhasználható precíziós célkövető rendszerek, az alábbiak szerint: 1. Célkövető rendszerek, melyek rakétára, vagy pilóta nélküli légijárműre telepített átjátszót használnak akár felszíni vagy légi referenciákkal, akár navigációs műholdrendszerekkel együtt arra, hogy a repülés alatti pozícióról és sebességről valós idejű mérési adatokat szolgáltassanak. 2. Rádiólokációs távolságmérő műszerek, beleértve a hozzájuk tartozó optikai/infravörös célkövető rendszereket, ha azok a következő képességek mindegyikével rendelkeznek: a. 1,5 milliradiánsnál jobb szögfelbontó képesség; b. 30 km vagy annál nagyobb hatótávolság, 10 m rms-nél jobb felbontóképesség; és c. 3 m/s-nál jobb sebességfelbontás; Műszaki megjegyzés : A 6A108.b. alatt ‘rakéta' minden olyan teljes rakétarendszer és pilóta nélküli légijármű, amelynek hatótávolsága legalább 300 km.

c. Nukleáris hatások (pl. elektromágneses impulzusok (EMP), röntgensugarak, kombinált lökés és hőhatás) elleni védelemre szánt és "rakétákban" felhasználható olyan radomok, amelyeket 4,184 × 106 J/m2 -nél magasabb kombinált lökésszerű hőhatással társuló és 50 kPa-t meghaladó maximális túlnyomásnak való ellenállásra terveztek.

6A202Fotoelektron sokszorozó csövek, amelyek rendelkeznek a következő mindkét jellemzővel:

a. A fotokatód területe nagyobb, mint 20 cm2; és

b. Az anód impulzusfelfutási ideje kisebb, mint 1 ns.

6A203A 6A003 alatt meghatározottaktól eltérő kamerák és alkatrészek, az alábbiak szerint:

N.B.1. A kifejezetten egy kamera vagy képalkotó eszközök teljesítményének - a 6A203.a., 6A203.b. vagy 6A203.c. pontban szereplő jellemzőknek való megfelelés érdekében történő - növelését vagy kiaknázását célzó, "szoftvert" a 6D203 határozza meg.

N.B.2. A kifejezetten egy kamera vagy képalkotó eszköz teljesítményének - a 6A203.a., 6A203.b. vagy 6A203.c. pontban szereplő jellemzőknek való megfelelés érdekében történő - növelését vagy kiaknázását célzó, kódok és kulcsok formájában megadott "technológiát" a 6E203 határozza meg.

Megjegyzés: A 6A203.a.-6A203.c. nem vonja ellenőrzés alá azon kamerákat és képalkotó eszközöket, amelyek a teljesítményt a fent meghatározottaknál kisebbre korlátozó hardver,"szoftver" vagy "technológiai" megszorításokkal rendelkeznek, feltéve, hogy eleget tesznek az alábbiak valamelyikének:

1. A teljesítménynövelés vagy a korlátozások feloldása érdekében vissza kell őket juttatni eredeti gyártójukhoz;

2. A 6A203. pont alatt szereplő jellemzőknek való megfelelés érdekében a 6D203. pont alatt meghatározottak szerinti "szoftvert" igényelnek a teljesítmény növeléséhez vagy kiaknázásához; vagy

3. A 6A203. pont alatt szereplő jellemzőknek való megfelelés érdekében a 6E203. pont alatt meghatározottak szerinti, kódok és kulcsok formájában megadott "technológiát" igényelnek a teljesítmény javításához vagy kiaknázásához.

a. Sáv (streak) kamerák, és a kifejezetten ezekhez tervezett alkatrészek, az alábbiak szerint: 1. 0,5 mm/μs-nél nagyobb sebességgel író sáv (streak) kamerák 2. Legfeljebb 50 ns felbontóképességű elektronikus sávkamerák; 3. A 6A203.a.2. alatt meghatározott kamerák streak csövei; 4. Kifejezetten moduláris szerkezetű sáv (streak) kamerákhoz tervezett, a 6A203.a.1 vagy a 6A203.a.2. pontban szereplő teljesítményjellemzőket lehetővé tevő plug-inek. 5. Kifejezetten a 6A203.a.1. pontban meghatározott kamerákhoz tervezett szinkronizáló elektronikai egységek és turbinákból, tükrökből és csapágyakból álló rotoregységek.

b. Kockázókamerák, és a kifejezetten ezekhez tervezett alkatrészek, az alábbiak szerint: 1. Másodpercenként több mint 225 000 felvételt készítő kockázókamerák; 2. Kockázó kamerák, melyek expozíciós ideje 50 ns vagy annál kevesebb; 3. Kifejezetten a 6A203.b.1. vagy a 6A203.b.2. pontban meghatározott kamerákhoz tervezett kockázó csövek és szilárdtest képalkotó eszközök, amelyek gyorsmegjelenítő kapuzási ideje (zárideje) legfeljebb 50 ns; 4. Kifejezetten moduláris szerkezetű kockázó kamerákhoz tervezett, a 6A203.b.1. vagy a 6A203.b.2. pontban szereplő teljesítményjellemzőket lehetővé tevő plug-inek; 5. Kifejezetten a 6A203.b.1. vagy 6A203.b.2. pontban meghatározott kamerákhoz tervezett szinkronizáló elektronikai egységek és turbinákból, tükrökből és csapágyakból álló rotoregységek; Műszaki megjegyzés : A 6A203.b. pontban szereplő nagy sebességű kockázó kamerákkal egyedül is lehet készíteni egyetlen képet egy dinamikus eseményről, vagy több ilyen kamerát is össze lehet kapcsolni egy szekvenciálisan kiváltott rendszerben ahhoz, hogy egy eseményről több kép készüljön.

c. Szilárdtest- és csöves kamerák, és a kifejezetten ezekhez tervezett alkatrészek, az alábbiak szerint: 1. Szilárdtest kamerák vagy elektronikus csőkamerák, amelyek gyorsmegjelenítő kapuzási ideje (zárideje) legfeljebb 50 ns; 2. Kifejezetten a 6A203.c.1. pontban meghatározott kamérákhoz tervezett szilárdtest kamerák vagy képerősítő csövek, amelyek gyorsmegjelenítő kapuzási (elektronikus zár) ideje 50 ns vagy kevesebb; 3. Elektro-optikai zárműködtetéssel rendelkező (Kerr-, vagy Pockel-cellás) eszközök, amelyek gyorsmegjelenítő kapuzási (elektronikus zár) ideje 50 ns vagy kisebb; 4. Kifejezetten moduláris szerkezetű kamerákhoz tervezett, a 6A203.c.1. pontban szereplő teljesítményjellemzőket lehetővé tevő plug-inek.

d. Sugárzásálló TV kamerák, vagy azok lencséi, amelyeket kifejezetten sugárzásállónak terveztek vagy minősítettek, és üzemi károsodás nélkül képesek 50 × 103 Gy (szilícium) (5 × 106 rad [szilícium]) sugárzásnak ellenállni. Műszaki megjegyzés : A Gy (szilícium) mértékegység árnyékolatlan szilícium minta Joule per kilogrammban megadott energiaelnyelésére vonatkozik, ha azt ionizáló sugárzásnak teszik ki.

6A205A 0B001.g.5., 0B001.h.6. és a 6A005 alatt nem meghatározott "lézerek", "lézer" erősítők és oszcillátorok az alábbiak szerint:

N.B. A réz gőz lézerek tekintetében lásd a 6A005.b. pontot.

a. Argon ion "lézerek", amelyek rendelkeznek mindkét következő jellemzővel: 1. 400 és 515 nm közötti hullámhosszon üzemelnek; és 2. "Átlagos kimenőteljesítményük" nagyobb, mint 40 W;

b. Hangolható, impulzusüzemű, egyfrekvenciás festék lézer oszcillátorok, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. 300 és 800 nm közötti hullámhosszon üzemelnek; 2. "Átlagos kimenőteljesítményük" nagyobb, mint 1 W; 3. Ismétlési frekvenciájuk nagyobb, mint 1 kHz; és 4. Impulzusszélességük kisebb, mint 100 ns;

c. Hangolható, impulzusüzemű festék lézer erősítők és oszcillátorok, amelyek rendelkeznek a következő jellemzők mindegyikével: 1. 300 és 800 nm közötti hullámhosszon üzemelnek; 2. "Átlagos kimenőteljesítményük" nagyobb, mint 30 W; 3. Ismétlési frekvenciájuk nagyobb, mint 1 kHz; és 4. Impulzusszélességük kisebb, mint 100 ns; Megjegyzés : A 6A205.c. nem vonja ellenőrzés alá az egyfrekvenciás oszcillátorokat

d. Pulzációs szén-dioxid (CO2) "lézerek", amelyek rendelkeznek a következő jellemzők mindegyikével: 1. 9 000 -11 000 nm közötti hullámhosszon üzemelnek; 2. Ismétlési frekvenciájuk nagyobb, mint 250 Hz; 3. "Átlagos kimenőteljesítményük" nagyobb, mint 500 W; és 4. Impulzusszélességük kisebb, mint 200 ns;

e. Para-hidrogén Raman fáziseltolók, amelyet 16 μm hullámhosszon és 250 Hz-nél nagyobb ismétlési frekvencián történő üzemelésre terveztek;

f. Neodímium-adalékolt (nem üveg) "lézerek", amelyeknél a kimenő hullámhosszúság 1 000 és 1 100 nm között van, és amelyek rendelkeznek a következő jellemzők valamelyikével: 1. Impulzusgerjesztésűek, Q-kapcsolásúak, és az impulzus-időtartamuk legalább 1 ns, és rendelkeznek az alábbiak valamelyikével: a. Egytranszverzális üzemmódú kimenet, 40 W-ot meghaladó "átlagos kimenőteljesítménnyel"; vagy b. Többszörös transzverzális módú kimenet, 50 W-ot meghaladó átlagos teljesítménnyel; vagy 2. Frekvenciakettőzés révén a kimenő hullámhosszúság 500 és 550 nm, 40 W-ot meghaladó "átlagos kimenőteljesítménnyel".

g. A 6A005.d.2. pontban meghatározottól eltérő pulzációs szén-monoxid (CO) "lézerek", amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. 5 000 és 6 000 nm közötti hullámhosszon üzemelnek; 2. Ismétlési frekvenciájuk nagyobb, mint 250 Hz; 3. "Átlagos kimenőteljesítményük" nagyobb, mint 200 W; és 4. Impulzusszélességük kisebb, mint 200 ns.

6A225Sebességmérő interferométerek 1 km/s-ot meghaladó sebesség 10 μs-nál rövidebb időintervallumok alatt történő mérésére.

Megjegyzés : A 6A225 magában foglalja a sebességmérő interferométereket, például a VISAR-t (Velocity interferometer systems for any reflectors), a DLI-ket (Doppler Laser Interferometer) és a PDV-ket (Photonic Doppler Velocimeters), más néven Het-V-ket (Heterodyne Velocimeters).

6A226Nyomásérzékelők, az alábbiak szerint:

a. Több mint 10 GPa nyomás mérésére képes rázási nyomásmérők, ideértve a manganinnal, itterbiummal és polivinilidén-fluoriddal (PVDF) / polivinil-difluoriddal (PVF2) készült mérőket is;

b. Kvarc nyomás-átalakítók 10 GPa-t meghaladó nyomásokhoz.

6BVizsgáló-, ellenőrző és gyártó berendezések

6B002Kifejezetten a 6A002.a.1.b. vagy a 6A002.a.1.d. pontban meghatározott optikai szenzorokhoz tervezett maszkok és hajszálvonalas lemezek.

6B004Optikai berendezések, az alábbiak szerint:

a. Az abszolút tükrözés mérésére szolgáló berendezés, amelynek "pontossága" a tükrözési érték 0,1 %-a, vagy annál jobb;

b. Berendezések - az optikai felületi szórásmérők kivételével -, amelyek 10 cm-nél nagyobb nyitott rekesznyílással rendelkeznek, és amelyeket kifejezetten nem-sík optikai felületű alakok (profilok) érintés nélküli, 2 nm vagy annál kisebb (jobb) "pontossággal" történő optikai mérésére terveztek.

Megjegyzés : A 6B004 nem vonja ellenőrzés alá a mikroszkópokat.

6B007A 0,1 mGal-nál jobb statikus "pontosságú" földi bázisú graviméterek gyártására, szabályozására és kalibrálására szolgáló berendezések.

6B008Impulzus radar keresztmetszetmérő rendszerek, melyek átviteli impulzus szélessége legfeljebb 100 ns, és a kifejezetten ezekhez tervezett alkatrészek.

N.B. LÁSD MÉG: 6B108.

6B108A 6B008 alatt meghatározottaktól eltérő, ‘rakétákban' használható, speciálisan radar keresztmetszet mérésre tervezett rendszerek és egyéb alrendszerek.

Műszaki megjegyzés :

A 6B108-ban a ‘rakéta' komplett rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent, melyek hatósugara meghaladja a 300 km-t.

6CAnyagok

6C002Optikai érzékelő anyagok, ideértve a következőket:

a. Legalább 99,9995 % tisztaságú elemi tellúr (Te);

b. Az alábbi egykristályok (beleértve az epitaxiális lapkákat is) bármelyike: 1. Legfeljebb 6 ‘mólszázalék' cinket tartalmazó kadmium-cink-tellurid (CdZnTe); 2. Bármilyen tisztaságú kadmium-tellurid (CdTe); vagy 3. Bármilyen tisztaságú higany-kadmium-tellurid (HgCdTe). Műszaki megjegyzés : A ‘mólszázalék' a kristályban lévő, mólokban kifejezett ZnTe aránya a CdTe és ZnTe mólokban kifejezett összegéhez képest.

6C004Optikai anyagok, az alábbiak szerint:

a. A gőzfázisú kémiai leválasztás módszerével gyártott Cink-szelenid (ZnSe) és cink-szulfid (ZnS) "nyers alaplemezek", amelyek rendelkeznek a következők bármelyikével: 1. Térfogatuk nagyobb, mint 100 cm3; vagy 2. Átmérőjük nagyobb, mint 80 mm, a vastagságuk legalább 20 mm;

b. Elektro-optikai anyagok és nem lineáris optikai anyagok, az alábbiak szerint: 1. Kálium-titanil-arzenát (KTA) (CAS 59400-80-5); 2. Ezüst-gallium-szelenid (AgGaSe2, más néven AGSE) (CAS 12002-67-4); 3. Tallium-arzenid-szelenid (Tl3AsSe3, másnéven TAS) (CAS 16142-89-5); 4. Cink-germánium-foszfid (ZnGeP2, más néven ZGP, cink-germánium-bifoszfid vagy cink-germánium-difoszfid); vagy 5. Gallium-szelenid (GaSe) (CAS 12024-11-2);

c. A 6C004.b. pontban meghatározottaktól eltérő nem lineáris optikai anyagok, amelyek rendelkeznek az alábbi jellemzők bármelyikével: 1. Rendelkezik a következők mindegyikével: a. 10-6 m2/V2 vagy nagyobb dinamikus (más néven nem rögzített) harmadrendű nem lineáris szuszceptibilitás (χ(3), chi 3); és b. 1 ms-nél kisebb reakcióidő; vagy 2. 3.3 × 10-11 m/V vagy nagyobb másodrendű nem lineáris szuszceptibilitás (χ(2), chi 2);

d. Szilicium-karbid vagy berillium-berillium (Be/Be) leválasztott anyagok "nyers alaplemezei", amelyek átmérője vagy nagytengelyhossza meghaladja a 300 mm-t;

e. Üveg, beleértve az olvasztott szilícium-dioxidot, foszfátüveget, fluorofoszfátüveget, cirkónium-fluoridot (ZrF4) (CAS 7783-64-4) és hafnium-fluoridot (HfF4) (CAS 13709-52-9), amelyek rendelkeznek a következő jellemzők mindegyikével: 1. Hidroxil-ion (OH-) koncentrációja kisebb, mint 5 ppm; 2. Az integrált fémtisztasági szint kisebb, mint 1 ppm; és 3. A magas homogenitás (törési varianciaindex) kevesebb, mint 5 × 10-6;

f. Szintetikusan előállított gyémánt, amelynek abszorpciója kisebb, mint 10-5 cm-1 a 200 nm-nél nagyobb, de legfeljebb 14 000 nm hullámhossztartományban.

6C005"Lézer" anyagok, az alábbiak szerint:

a. Szintetikus kristály "lézer" fogadóanyag befejezetlen formában, az alábbiak szerint: 1. Titánadalékos zafír; 2. Nem használt.

b. Ritkaföldfém-adalékos, duplán plattírozott szálak az alábbiak bármelyikével: 1. A nominális "lézer" hullámhosszúság 975-1 150 nm, és rendelkezik az alábbi összes tulajdonsággal: a. Az átlagos magátmérő legalább 25 μm; és b. A mag ‘numerikus apertúra' (‘NA') 0,065-nél kevesebb; vagy Megjegyzés : A 6C005.b.1. nem vonja ellenőrzés alá azon duplán plattírozott szálakat, amelyek belső üvegplattírozásának átmérője 150 μm-nél nagyobb, de 300 μm-nél kisebb. 2. A nominális "lézer" hullámhosszúság meghaladja az 1 530 nm-t, és rendelkezik az alábbiak összességével: a. Az átlagos magátmérő legalább 20 μm; és b. A mag ‘numerikus apertúra' (‘NA') 0,1-nél kevesebb; Műszaki megjegyzések : 1. A 6C005.b alkalmazásában a mag ‘numerikus apertúrát' (‘NA') a szál kibocsátási hullámhosszain mérik. 2. A 6C005.b. magában foglalja a zárósapkákkal összeszerelt szálakat.

6DSzoftver

6D001Kifejezetten a 6A004, 6A005, 6A008, vagy 6B008 által ellenőrzés alá vont berendezések "fejlesztésére" vagy "gyártására" tervezett "szoftver".

6D002Kifejezetten a 6A002.b, 6A008 vagy 6B008 által ellenőrzés alá vont berendezés "alkalmazására" tervezett "szoftver".

6D003Egyéb "szoftver", az alábbiak szerint:

a. "Szoftver" az alábbiak szerint: 1. Kifejezetten az akusztikai adatok passzív vételének vontatott hidrofonrendszerekkel történő "valós idejű feldolgozására" szolgáló akusztikai sugár formálására tervezett "szoftver"; 2. "Forráskód" az akusztikai adatok passzív vételének vontatott hidrofonrendszerekkel történő, "valós idejű feldolgozásához"; 3. Kifejezetten az akusztikai adatok passzív vételének tengerfenéki vagy kikötői kábelrendszerekkel történő "valós idejű feldolgozására" szolgáló akusztikai sugár formálásához tervezett "szoftver"; 4. "Forráskód" az akusztikai adatok passzív vételének tengerfenéki vagy kikötői kábelrendszerekkel történő "valós idejű feldolgozásához"; 5. Kifejezetten az alábbiak mindegyikére tervezett "szoftver" vagy "forráskód": a. A 6A001.a.1.e. pontban meghatározott szonáris rendszerek akusztikai adatainak "valós idejű feldolgozása"; és b. Búvárok vagy úszók automatikus észlelése, osztályozása és helyzetének meghatározása; N.B. A búvárok észlelésére szolgáló, a katonai felhasználásra tervezett vagy módosított "szoftver" vagy "forráskód" tekintetében LÁSD A KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKÉT.

b. Nem használt;

c. A 6A002.a.3.f. pontban meghatározott "fókuszsíkban levő detektorsorokat" tartalmazó kamerákhoz tervezett vagy átalakított, valamint a képváltásifrekvencia-korlátozás megszüntetésére és a 6A003.b.4. pontban meghatározott képváltási frekvencia kamera általi meghaladásának lehetővé tételére tervezett vagy átalakított "szoftver"; 3.a. megjegyzés

d. Kifejezetten a legalább 1 m átmérőjű vagy nagytengely-hosszúságú tükörszegmensekből álló szegmentált tükörrendszerek beállításának fenntartására vagy fázisolására tervezett "szoftver";

e. Nem használt;

f. "Szoftver" az alábbiak szerint: 1. Kifejezetten a mobil platformokon történő működésre tervezett mágneses és elektromos térerő-érzékelők mágneses "kompenzációs rendszereihez" tervezett "szoftver"; 2. Kifejezetten a mobil platformokon a mágneses és elektromos térerő-anomáliák érzékelésére tervezett "szoftver"; 3. Kifejezetten az elektromágneses adatoknak a 6A006.e. alatt meghatározott víz alatti elektromágneses vevőkészülékek segítségével történő "valós idejű feldolgozására" tervezett "szoftver"; 4. Az elektromágneses adatoknak a 6A006.e. alatt meghatározott víz alatti elektromágneses vevőkészülékek segítségével történő "valós idejű feldolgozására" szolgáló "forráskód";

g. Kifejezetten a gravitációmérők vagy gravitációs gradiométerek mozgási eltéréseinek korrigálására tervezett "szoftver";

h. "Szoftver" az alábbiak szerint: 1. A légiforgalom-irányító központokban található általános célú számítógépeken történő futtatásra tervezett légiforgalom-irányító (Air Traffic Control, ATC) "szoftver", amely képes a radar céladatainak vételére több, mint 4 primer radartól; 2. A radomok tervezésére vagy "gyártására" szolgáló "szoftver", amely rendelkezik az alábbiak mindegyikével: a. Kifejezetten a 6A008.e által ellenőrzés alá vont "elektronikusan szkennelt antennarendszer" védelmére készült; és b. Olyan antennajelet eredményez, amelynek ‘átlagos mellékhurokszintje' több, mint 40 dB-lel a fő sugárszint csúcsa alatt van. Műszaki megjegyzés : A 6D003.h.2.b. szerinti ‘átlagos mellékhurokszintet' az egész rendszerre mérik, kivéve a fősugár szögkiterjedését és az első két oldalhurkot a fősugár mindkét oldalán.

6D102A kifejezetten a 6A108 alatt meghatározott termékek "felhasználására" tervezett vagy módosított "szoftverek".

6D103Kifejezetten ‘rakétákhoz' tervezett vagy átalakított olyan "szoftver", amely a repülés befejeztével a rögzített adatokból képes meghatározni a jármű repülés alatti pozícióját.

Műszaki megjegyzés :

A 6D103 alkalmazásában ‘rakétának' minősül minden olyan teljes rakétarendszer és pilóta nélküli légijármű, amelynek hatótávolsága legalább 300 km.

6D203A kifejezetten egy kamera vagy képalkotó eszköz teljesítményének - a 6A203.a., 6A203.b. vagy 6A203.c. pontban szereplő jellemzőknek való megfelelés érdekében történő - megerősítéséhez vagy kiaknázására tervezett "szoftvert" a 6D203 határozza meg.

6ETechnológia

6E001A 6A, 6B, 6C vagy 6D alatt meghatározott berendezések, anyagok vagy "szoftver" "fejlesztésére" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

6E002A 6A, 6B vagy 6C által ellenőrzés alá vont berendezések vagy anyagok "gyártására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

6E003Egyéb "technológia", az alábbiak szerint:

a. "Technológia", az alábbiak szerint: 1. Optikai felületbevonási- és kezelési "technológia", ami ahhoz "szükséges", hogy az optikai bevonatok ‘optikai vastagságának' egyenletessége 99,5 %-os vagy annál jobb legyen, ha az átmérő vagy a nagytengely hossza legalább 500 mm és a teljes veszteség (abszorpció és szórás) kevesebb, mint 5 × 10-3; N.B. Lásd még: 2E003.f. Műszaki megjegyzés : Az ‘optikai vastagság' a refraktív (visszaverődési) indexnek és a bevonat fizikai vastagságának a matematikai szorzata. 2. Egypontos gyémántcsiszolási technikát alkalmazó optikai gyártási "technológiák", amelyek képesek a 0,5 m2-t meghaladó nem síkbeli felületeken 10 nm négyzetes középértéknél (rms) jobb felületi "pontosságot" biztosítani;

b. "SHPL" tesztelő vagy "SHPL" sugarakkal besugárzott anyagok tesztelésére vagy értékelésére szolgáló teszt létesítmények speciális diagnosztikai eszközeinek vagy céltárgyainak "fejlesztéséhez", "gyártásához" vagy "felhasználásához" "szükséges" "technológia";

6E101A 6A002, 6A007.b. és c., 6A008, 6A102, 6A107, 6A108, 6B108, 6D102 vagy 6D103 alatt meghatározott berendezés vagy szoftver "felhasználására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

Megjegyzés : A 6E101 csak akkor vonja ellenőrzés alá a 6A002, 6A007 és 6A008 alatt meghatározott eszközökhöz szolgáló "technológiát", ha az eszközöket repülőgép-fedélzeti alkalmazásra tervezték és azok "rakétákban" is felhasználhatók.

6E201A 6A003, 6A005.a.2., 6A005.b.2., 6A005.b.3., 6A005.b.4., 6A005.b.6., 6A005.c.2., 6A005.d.3.c., 6A005.d.4.c., 6A202, 6A203, 6A205, 6A225, vagy 6A226 alatt meghatározott berendezés "felhasználására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

1. megjegyzés : A 6E201 csak akkor vonja ellenőrzés alá a 6A003 alatt meghatározott kamerákhoz szolgáló "technológiát", ha a kamerákra a 6A203 pontban szereplő ellenőrzési paraméterek valamelyike szintén vonatkozik.

2. megjegyzés : A 6E201 csak a 6A005.b.6 alatt meghatározott olyan lézerekhez való "technológiát" vonja ellenőrzés alá, amelyek neodímium-adalékoltak, és a 6A205.f pontban szereplő ellenőrzési paraméterek valamelyike vonatkozik rájuk.

6E203A kifejezetten egy kamera vagy képalkotó eszköz teljesítményének - a 6A203.a.-6A203.c. pontban szereplő jellemzőknek való megfelelés érdekében történő - megerősítését vagy kiaknázását célzó, kódok és kulcsok formájában megadott "technológia".

IX. RÉSZ

7. kategória

7. KATEGÓRIA - NAVIGÁCIÓ ÉS REPÜLÉSI ELEKTRONIKA

7ABerendezések, részegységek és alkatrészek

N.B. Víz alatti járművek robotpilótái tekintetében lásd: 8. kategória.

Radarok tekintetében lásd: 6. kategória.

7A001Gyorsulásmérők, és kifejezetten ezek számára tervezett alkatrészek, az alábbiak szerint:

N.B. LÁSD MÉG: 7A101.

N.B. A szöggyorsulásmérők vagy a forgási gyorsulásmérők tekintetében lásd a 7A001.b. pontot.

a. Lineáris gyorsulásmérők, amelyek rendelkeznek az alábbiak bármelyikével: 1. Legfeljebb 15 g lineáris gyorsulási szinten történő működésre határozták meg, és rendelkezik az alábbi jellemzők valamelyikével: a. A "torzítási" "stabilitás" kevesebb (jobb), mint 130 mikro g, egy éves időszak rögzített kalibrálási értékéhez viszonyítva; vagy b. A "skálafaktor"-"stabilitás" kevesebb (jobb), mint 130 ppm, egy éves időszak rögzített kalibrálási értékéhez viszonyítva; 2. 15 g-nél nagyobb, de legfeljebb 100 g lineáris gyorsulási szinten történő működésre határozták meg, és rendelkeznek az alábbiak mindegyikével: a. A "torzítási" "ismételhetőség" kevesebb (jobb), mint 1 250 mikro g, egy éves időszak alatt; valamint b. A "skálafaktor"-"ismételhetőség" kevesebb (jobb), mint 1 250 ppm, egy éves időszak alatt; vagy 3. Inerciális navigációs vagy irányítórendszerekben történő alkalmazásra vannak tervezve, és 100 g-nél nagyobb lineáris gyorsulási szinten történő működésre határozták meg; Megjegyzés : A 7A001.a.1. és a 7A001.a.2. nem vonja ellenőrzés alá azokat a gyorsulásmérőket, amelyek működése a vibrációk vagy ütések mérésére korlátozódik.

b. 100 g-nél nagyobb lineáris gyorsulási szinten történő működésre meghatározott szöggyorsulásmérők vagy forgási gyorsulásmérők.

7A002Giroszkópok vagy szögszenzorok, amelyek rendelkeznek a következő jellemzők bármelyikével, és a kifejezetten ezekhez tervezett alkatrészek:

N.B. LÁSD MÉG: 7A102.

N.B. A szöggyorsulásmérők vagy a forgási gyorsulásmérők tekintetében lásd a 7A001.b. pontot.

a. Legfeljebb 100 g lineáris gyorsulási szinten történő működésre határozták meg, és rendelkezik az alábbi jellemzők valamelyikével: 1. A szögsebesség másodpercenként 500 foknál alacsonyabb teljesítménytartománnyal és az alábbi jellemzők valamelyikével rendelkezik: a. A "torzítási" "stabilitás", egy hónapos időszakon át 1 g környezetben mérve és a rögzített kalibrált értékhez viszonyítva kevesebb (jobb), mint 0,5 fok/óra; vagy b. Kevesebb (jobb), mint 0,0035 fok/négyzetgyök óra "véletlenszerű szögelcsúszás"; vagy Megjegyzés : A 7A002.a.1.b. nem vonja ellenőrzés alá a "tehetetlenségi giroszkópot". 2. A szögsebesség másodpercenként 500 foknál nagyobb vagy azzal egyenlő sebességtartománnyal és az alábbi jellemzők valamelyikével rendelkezik: a. A "torzítási" "stabilitás", három percen keresztül 1 g környezetben mérve és a rögzített kalibrált értékhez viszonyítva kevesebb (jobb), mint 4 fok/óra; vagy b. Kevesebb (jobb), mint 0,1 fok/négyzetgyök óra "véletlenszerű szögelcsúszás"; vagy Megjegyzés : A 7A002.a.2.b. nem vonja ellenőrzés alá a "tehetetlenségi giroszkópot".

b. 100 g fölötti lineáris gyorsulásra határozták meg.

7A003‘Inerciális mérőberendezések vagy rendszerek' az alábbi jellemzők bármelyikével:

N.B. LÁSD MÉG: 7A103.

1. megjegyzés : Az ‘inerciális mérőberendezések vagy rendszerek' gyorsulásmérőket és giroszkópokat foglalnak magukban a sebességben és irányban bekövetkező változások mérésére, annak érdekében, hogy meghatározhassák és tarthassák a haladási irányt vagy a pozíciót, anélkül, hogy a beállítás után külső referenciára lenne szükség. Az ‘inerciális mérőberendezések vagy rendszerek' az alábbiakat foglalják magukban:

- helyzet- és irányrendszer (attitude and heading reference system, AHRS);

- girokompaszok;

- inerciális mérőegységek (Inertial Measurement Units, IMU);

- inerciális navigációs rendszerek (Inertial Navigation Systems, INS);

- inerciális referencia rendszer (Inertial Reference Systems, IRS).

- inerciális referencia egység (Inertial Reference Units, IRU).

2. megjegyzés : A 7A003 nem vonja ellenőrzés alá az olyan ‘inerciális mérőberendezést vagy rendszereket', amelyeket egy vagy több uniós tagállam vagy a Wassenaari Megállapodásban részt vevő állam polgári repülési hatóságai "polgári légi járműveken" történő felhasználásra minősítettek.

Műszaki megjegyzés :

A ‘helyzetmeghatározást segítő referenciák' függetlenül adják meg a pozíciót, és magukban foglalják az alábbiakat:

a. "Műholdas navigációs rendszer";

b. "Adatalapú referencianavigáció" ("DBRN").

a. "Légi járművekhez", szárazföldi járművekhez vagy hajókhoz tervezték őket, és ‘helyzetmeghatározást segítő referenciák' alkalmazása nélkül adják meg a pozíciót, és normál beállítás esetén az alábbi "pontosságok" egyikével rendelkeznek: 1. 0,8 tengeri mérföld/óra "cirkuláris hibavalószínűség" (CEP) vagy kevesebb (jobb); 2. a megtett távolság 0,5 %-a vagy kevesebb (jobb) "CEP"; vagy 3. a teljes drift 24 órás időszakban 1 tengeri mérföld vagy annál kevesebb (jobb) "CEP"; Műszaki megjegyzés : A 7A003.a.1. pontban szereplő teljesítménymutató tipikusan a "légi járművekhez", a 7A003.a.2. pontban szereplő teljesítménymutató tipikusan a szárazföldi járművekhez, a 7A003.a.3. pontban szereplő teljesítménymutató pedig tipikusan a hajókhoz tervezett ‘inerciális mérőberendezésekre vagy rendszerekre' vonatkozik. E paraméterek a specializált, nem helyzetmeghatározást segítő referenciák segítőhivatkozások (pl. magasságmérő, kilométer-számláló, sebességnapló) alkalmazásából fakadnak. Következésképpen a meghatározott teljesítményértékeket nem lehet könnyedén átváltani e paraméterek között. A többszörös platformokhoz tervezett berendezéseket az alkalmazandó 7A003.a.1., 7A003.a.2. vagy 7A003.a.3. pont viszonylatában értékelik.

b. "Légi járművekhez", szárazföldi járművekhez vagy hajókhoz tervezték őket beágyazott ‘helyzetmeghatározást segítő referenciával', és az összes ‘helyzetmeghatározást segítő referencia' elvesztése után legfeljebb 4 percig mutatják a pozíciót 10 méter "CEP"-nél kevesebb (jobb) "pontossággal"; Műszaki megjegyzés : A 7A003.b. olyan rendszerekre utal, amelyekben ‘inerciális mérőberendezés vagy rendszerek' és más független ‘helyzetmeghatározást segítő referenciák' vannak beépítve egyetlen (beágyazott) egységben a javított teljesítmény elérése érdekében.

c. "Légi járművekhez", "szárazföldi járművekhez" vagy hajókhoz tervezték őket, biztosítják az irány vagy a valódi északi irány meghatározását, és rendelkeznek az alábbiak valamelyikével: 1. Maximális működési szögsebessége 500 fok/s-nál kevesebb (alacsonyabb) és a ‘helyzetmeghatározást segítő referenciák' alkalmazása nélküli iránymeghatározási "pontosság" 0,07 fokmásodperc (szélesség) (6 ívperc négyzetes középérték a 45. szélességi fokon) vagy annál kevesebb (jobb); vagy 2. Maximális működési szögsebessége 500 fok/s vagy annál nagyobb (magasabb) és a ‘helyzetmeghatározást segítő referenciák' alkalmazása nélküli iránymeghatározási "pontosság" 0,2 fokmásodperc (szélesség) (17 ívperc rms a 45. szélességi fokon) vagy annál kevesebb (jobb); vagy

d. Gyorsulásméréseket vagy szögsebességméréseket biztosít egynél több dimenzióban, és rendelkezik az alábbiak bármelyikével: 1. A 7A001 vagy 7A002 által bármely tengely mentén, segítő referencia alkalmazása nélkül meghatározott teljesítmény; vagy 2. "Űrminősítésű", és olyan szögsebességméréseket biztosít, amelyek bármely tengely mentén történő "véletlenszerű szögelcsúszása" kevesebb (jobb), mint 0,1 fok/négyzetgyök óra. Megjegyzés : A 7A003.d.2. nem vonja ellenőrzés alá az egyetlen giroszkóptípusként "tehetetlenségi giroszkópot" tartalmazó ‘inerciális mérőberendezéseket vagy rendszereket'.

7A004‘Csillagkövetők' és azokhoz készült alkatrészek, az alábbiak szerint:

N.B. LÁSD MÉG: 7A104.

a. ‘Csillagkövetők' a berendezés meghatározott élettartamának ideje alatt 20 ívmásodperc vagy annál kisebb (jobb) meghatározott azimut"pontossággal";

b. Kifejezetten a 7A004.a. pontban meghatározott berendezésekhez tervezett alkatrészek, az alábbiak szerint: 1. Optikai fejek vagy légterelők; 2. Adatfeldolgozó egységek.

Műszaki megjegyzés:

A ‘csillagkövetők' más néven csillagászati pozícióérzékelők vagy giroszkópos asztronómiai tájolók.

7A005"Műholdas navigációs rendszer" vevő-berendezése, valamint a kifejezetten ehhez tervezett alkatrészek, amelyek rendelkeznek a következő jellemzők bármelyikével:

N.B. LÁSD MÉG: 7A105.

N.B. A kifejezetten katonai felhasználásra tervezett berendezések tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

a. Kifejezetten kormányzati felhasználásra tervezett vagy módosított rejtjelező algoritmust alkalmaznak a helyzetre vagy az időre vonatkozó hatótávolsági kódhoz való hozzáférés céljából; vagy

b. ‘Adaptív antennarendszereket' alkalmaznak. Megjegyzés : A 7A005.b. pont nem vonja ellenőrzés alá azon, "műholdas navigációs rendszerhez" tervezett vevő-berendezéseket, amelyek kizárólag adaptív antennatechnikákat végre nem hajtó, több körsugárzó antenna által kibocsátott jelek szűrésére, át- vagy összekapcsolására tervezett elemeket használnak. Műszaki megjegyzés : A 7A005.b. pont alkalmazásában az ‘adaptív antennarendszerek' az idő vagy a frekvencia tartományában való jelfeldolgozás útján dinamikusan egy vagy több térbeli nullhelyet generálnak az antennasorok mintájában.

7A006Fedélzeti magasságmérők, amelyek nem a 4,2-4,4 GHz frekvencia tartományban működnek, és rendelkeznek a következő jellemzők bármelyikével:

N.B. LÁSD MÉG: 7A106.

a. ‘Teljesítmény-irányítás'; vagy

b. Fázisváltásos moduláció alkalmazása; Műszaki megjegyzés : ‘Teljesítmény-irányítás' (power management): a magasságmérő által kisugárzott jelteljesítmény olyan módosítása, hogy a "légi jármű" repülési magasságán vett visszavert jel teljesítménye mindig legalább akkora legyen, mint ami a magasság meghatározásához szükséges.

7A008Víz alatti szonáris navigációs rendszerek, amelyek tájolóval összekapcsolt Doppler sebességmérőt vagy korrelációs sebességmérőt alkalmaznak, és helymeghatározó pontosságuk kisebb (jobb), mint a megtett távolság 3 %-a "cirkuláris hibavalószínűség" ("CEP") vagy egyenlő azzal; valamint a kifejezetten ezekhez tervezett alkatrészek.

Megjegyzés : A 7A008 nem vonja ellenőrzése alá a kifejezetten felszíni vízi járművekre szánt irányítórendszereket vagy azokat a rendszereket, amelyek akusztikus jelzők vagy bóják segítségével szolgáltatnak helymeghatározási adatokat.

N.B. Az akusztikus rendszerek tekintetében lásd a 6A001.a.-t, a korrelációs sebesség szonár log berendezés és a Doppler sebesség szonár log berendezés tekintetében pedig a 6A001.b.-t.

Az egyéb tengeri rendszerek tekintetében lásd a 8A002-t.

7A101Inerciális navigációs rendszerben vagy bármely típusú irányítórendszerben történő felhasználásra tervezett, ‘rakétákban' felhasználható, a 7A001 alatt meghatározottaktól eltérő lineáris gyorsulásmérők, amelyek rendelkeznek a következő jellemzők mindegyikével, valamint a kifejezetten ezekhez tervezett alkatrészek:

a. 1 250 mikro g-nél kisebb (jobb) "torzítási" "ismételhetőség"; valamint

b. 1 250 ppm-nél kisebb (jobb) "skálafaktor"-"ismételhetőség";

Megjegyzés : A 7A101 nem vonja ellenőrzés alá azokat a gyorsulásmérőket, melyeket kifejezetten MWD (Measurement While Drilling - fúrás közbeni mérés) érzékelőként történő felhasználásra fejlesztettek ki vagy terveztek, fúrt kutak üzemeltetéséhez kapcsolódó felhasználás céljából.

Műszaki megjegyzések :

1. A 7A101 pont alatt a ‘rakéta' 300 km-t meghaladó hatótávolságú teljes rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent;

2. A 7A101 pont alatt a "torzítás" és a "skálafaktor" mértéke 1 szigma normál eltérésre utal egy éves időszak rögzített kalibrálási értékéhez viszonyítva;

7A102A 7A002 alatt meghatározottaktól eltérő, bármely típusú giroszkóp, amely felhasználható ‘rakétákban' és melynek a névleges "eltérési-arány" ‘stabilitása' 1 g-s környezetben, óránként 0,5 foknál (1 szigmánál vagy négyzetes középértéknél (rms)) kisebb, és a kifejezetten ezekhez tervezett alkatrészek.

Műszaki megjegyzések :

1. A 7A102. pont alatt a ‘rakéta' 300 km-t meghaladó hatótávolságú teljes rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent;

2. A 7A102-ben a ‘stabilitás' egy bizonyos mechanizmus vagy teljesítményi együttható azon képességének mértéke, hogy egy állandó működési feltételnek folyamatosan kitéve változatlan marad (528-2001 IEEE-szabvány, 2.247. pont).

7A103A 7A003 alatt meghatározottaktól eltérő műszerek, navigációs berendezések és rendszerek, valamint a kifejezetten ezekhez tervezett alkatrészek, ideértve a következőket:

a. Gyorsulásmérőket vagy giroszkópokat alkalmazó ‘inerciális mérőberendezések vagy rendszerek', az alábbiak szerint: 1. A 7A001.a.3., 7A001.b. vagy 7A101 alatt meghatározott gyorsulásmérők, vagy a 7A002 vagy 7A102 alatt meghatározott giroszkópok; vagy Megjegyzés : A 7A103.a.1. nem vonja ellenőrzés alá a 7A001.a.3. alatt meghatározott gyorsulásmérőket tartalmazó olyan berendezéseket, amelyet vibrációk vagy ütések mérésére terveztek. 2. A 7A001.a.1 vagy a 7A001.a.2. pontban meghatározott, inerciális navigációs rendszerekben vagy az irányítási rendszerek valamennyi típusában való felhasználásra tervezett, és ‘rakétákban' használható sebességmérők; Megjegyzés : A 7A103.a.2. nem vonja ellenőrzés alá a 7A001.a.1. vagy a 7A001.a.2. alatt meghatározott gyorsulásmérőket tartalmazó berendezéseket, ahol ezeket a gyorsulásmérőket kifejezetten MWD (Measurement While Drilling) érzékelőként történő felhasználásra fejlesztették ki vagy tervezték, fúrt kutak üzemeltetéséhez kapcsolódó felhasználás céljából. Műszaki megjegyzés : A 7A103.a. alatt meghatározott ‘inerciális mérőberendezések vagy rendszerek' gyorsulásmérőket és giroszkópokat foglalnak magukban a sebességben és irányban bekövetkező változások mérésére, annak érdekében, hogy meghatározhassák és tarthassák a haladási irányt vagy a pozíciót, anélkül, hogy a beállítás után külső referenciára lenne szükség. Megjegyzés : A 7A103.a. szerinti ‘inerciális mérőberendezések vagy rendszerek' az alábbiakat foglalják magukban: - helyzet- és irányrendszer (attitude and heading reference system, AHRS); - girokompaszok; - inerciális mérőegységek (Inertial Measurement Units, IMU); - inerciális navigációs rendszerek (Inertial Navigation Systems, INS); - inerciális referencia rendszer (Inertial Reference Systems, IRS). - inerciális referencia egység (Inertial Reference Units, IRU).

b. Girostabilizátorokat vagy robotpilótákat magukban foglaló integrált repülési műszerrendszerek, amelyeket ‘rakétákban' történő felhasználásra terveztek, ill. alakítottak át;

c. ‘Integrált navigációs rendszerek', amelyeket ‘rakétákhoz' terveztek vagy alakítottak át, és képesek legfeljebb 200 m-es ‘CEP'-el jellemezhető navigációs pontosságot biztosítani; Műszaki megjegyzések : 1. Az ‘integrált navigációs rendszerek' általában az alábbi részekből épülnek fel: a. Egy inerciális navigációs mérőeszköz (pl. egy helyzet és irány referencia rendszer, inerciális referencia egység, vagy inerciális navigációs rendszer); b. Egy vagy több külső érzékelő a pozíció és/vagy a sebesség szakaszos vagy folyamatos aktualizálására a repülés során (pl. egy műholdvevő, egy radaros magasságmérő és/vagy egy Doppler-radar); valamint c. Integrációs hardver és szoftver; 2. A 7A103.c. alkalmazásában ‘CEP' (cirkuláris hibavalószínűség vagy egyenlő valószínűségi kör) a pontosság mértéke: annak a körnek a sugara, amelyben 50 % az előfordulás valószínűsége.

d. A 6A006 pontban meghatározottaktól eltérő repülésirányítási és -navigációs rendszerekkel való integrálásra tervezett, ill. átalakított háromtengelyű mágneses irányszenzorok, amelyek rendelkeznek az összes alábbi jellemzővel, valamint a kifejezetten ezek számára tervezett alkatrészek: 1. Belső hosszdőléskiegyenlítés a bólintási (± 90 fok) és dőlési (± 180 fok) tengelyen; és 2. ± 80 hosszúsági fokon 0,5 fok rms-nél jobb (kevesebb) azimutpontosság, helyi mágneses mezőhöz viszonyítva. Megjegyzés : A 7A103.d.-ben a repülésirányítási és -navigációs rendszerek magukban foglalják a girostabilizátorokat, a robotpilótákat és az inerciális navigációs rendszereket.

Műszaki megjegyzés :

A 7A103. pont alatt a ‘rakéta' 300 km-t meghaladó hatótávolságú teljes rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent;

7A104A 7A004 alatt meghatározottaktól eltérő giroszkópos asztronómiai tájolók vagy egyéb olyan készülékek, melyek a pozíciót vagy tájolást az égitestek vagy műholdak automatikus követéséből állapítják meg, valamint a kifejezetten ezekhez tervezett alkatrészek.

7A105A következők bármelyikével jellemezhető, ‘navigációs műholdrendszerekhez' alkalmazott vevő berendezések, amelyek eltérnek a 7A005 alatt meghatározottaktól, valamint a kifejezetten ezekhez tervezett alkatrészek:

a. A 9A004 alatt meghatározott űrhajó hordozóeszközökben, a 9A104 alatt meghatározott rakétaszondákban, illetve a 9A012 vagy 9A112.a alatt meghatározott pilóta nélküli légijárművekben történő felhasználásra tervezték vagy alakították át; vagy

b. Légi alkalmazásokhoz terveztek, illetve alakítottak át, és a következők bármelyikével jellemezhetők: 1. Alkalmas 600 m/s-ot meghaladó sebességnél navigációs információ szolgáltatására; 2. Katonai vagy kormányzati célokra tervezett vagy átalakított dekódolást alkalmaz a ‘navigációs műholdrendszerek' titkosított jeleihez/adataihoz történő hozzáféréshez; vagy 3. Kifejezetten zavarelhárító elemek (pl. null irányított antenna, vagy elektronikusan irányított antenna) alkalmazására tervezték, hogy aktív vagy passzív ellenintézkedésekkel jellemzett környezetben is működni tudjon. Megjegyzés : A 7A105.b.2. és a 7A105.b.3. nem vonják ellenőrzés alá a kereskedelmi, polgári vagy ‘létbiztonsági' (pl. adatintegritási, repülésbiztonsági) ‘műholdas navigációs rendszerek' szolgáltatásait.

Műszaki megjegyzés :

A 7A105 pontban a ‘műholdas navigációs rendszer' magában foglalja a globális műholdas navigációs rendszereket (GNSS; pl. GPS, GLONASS, Galileo vagy BeiDou) valamint regionális műholdas navigációs rendszereket (RNSS; pl. NavIC, QZSS).

7A106A 7A006 alatt meghatározottaktól eltérő radar, vagy lézerradar típusú magasságmérők, amelyeket a 9A004 alatt meghatározott űrhajóhordozó eszközökben vagy 9A104 alatt meghatározott rakétaszondákban történő felhasználásra terveztek, illetve alakítottak át.

7A115Meghatározott elektromágneses forrásokhoz viszonyított vízszintes irányszög (iránymérő berendezések) vagy terepjellemzők meghatározására szolgáló passzív érzékelők, amelyeket a 9A004 alatt meghatározott űrhajóhordozó eszközökben vagy 9A104 alatt meghatározott rakétaszondákban történő felhasználásra terveztek, illetve alakítottak át.

Megjegyzés : A 7A105., 7A106. és 7A115. pontban meghatározott berendezések közé tartoznak a következők:

a. Szintvonalas térképező berendezések;

b. Tájtérképezési és korrelációs (digitális és analóg) berendezések;

c. Doppler-navigációs radarberendezések.

d. Passzív interferométer berendezés.

e. Képérzékelő berendezés (mind az aktív, mind a passzív).

7A116Repülésirányító rendszerek és szervoszelepek, az alábbiak szerint: A 9A004 alatt meghatározott űrhajó hordozóeszközökben vagy 9A104 alatt meghatározott rakétaszondákban történő felhasználásra tervezett, illetve átalakított repülésirányító rendszerek és szervoszelepek vagy "rakéták".

a. Pneumatikus, hidraulikus, mechanikus, elektro-optikai, vagy elektro-mechanikus repülésirányító rendszerek (beleértve az elektronikus repülésvezérlő - fly-by-wire - és az optikai repülésvezérlő - fly-by-light - rendszereket);

b. Magasság-ellenőrzők;

c. A 7A116.a. és a 7A116.b. alatt meghatározott rendszerekhez tervezett vagy átalakított repülésellenőrző szervoszelepek, amelyeket úgy terveztek vagy alakítottak át, hogy a 20 Hz-től 2 kHz-ig terjedő tartományban 10 g rms effektív érték feletti vibráció esetén is működjenek.

Megjegyzés : A személyzettel ellátott légi járművek "rakétaként" történő átalakítása esetén a 7A116 magában foglalja azokat a rendszereket, berendezéseket és szelepeket, amelyeket úgy terveztek vagy alakítottak át, hogy lehetővé tegyék a személyzettel ellátott légi jármű pilóta nélküli légijárműként történő működését.

7A117"Rakétákban" felhasználható "irányítási/vezérlő készletek", amelyek 3,33 %-os vagy jobb rendszerpontosságot biztosítanak (pl. 300 km-es távolságnál a ‘CEP' legfeljebb 10 km).

Műszaki megjegyzés :

A 7A117 alkalmazásában ‘CEP' (cirkuláris hibavalószínűség vagy egyenlő valószínűségi kör) a pontosság mértéke: a céltárgy mint középpont köré, meghatározott távolságban rajzolt kör sugara, amelybe a töltetek 50 %-a becsapódik.

7BVizsgáló-, ellenőrző és gyártó berendezések

7B001Kifejezetten a 7A alatt meghatározott berendezésekhez tervezett vizsgáló-, kalibráló- vagy szabályozóberendezések.

Megjegyzés : A 7B001 nem vonja ellenőrzés alá az ‘I. vagy II. karbantartási szint' vizsgáló-, kalibráló- vagy szabályozóberendezéseit.

Műszaki megjegyzések :

1. ‘I. karbantartási szint'

Az inerciális navigálási egység meghibásodását a "légi járművön" a vezérlő és kijelző egység (CDU) kijelzései vagy a megfelelő alrendszerből kapott állapot-üzenet mutatja. A hiba oka a meghibásodott gépben-cserélhető egység (LRU) szintjén a gyártó kézikönyve alapján lokalizálható. Az operátor eltávolítja az LRU-t, és azt egy tartalékra cseréli ki.

2. ‘II. karbantartási szint'

A hibás LRU-t elküldik javításra (vagy a gyártó javítóüzemébe vagy a II. karbantartási szintért felelős operátor javítóüzemébe). A javítóüzemben a hibás LRU-t különféle megfelelő eszközökkel vizsgálják, hogy ellenőrizzék és megállapítsák, hogy a hibás modulban melyik volt az a műhelyben cserélhető egység (SRA), amely a hibáért felelős. Ezt az SRA-t eltávolítják, és kicserélik egy újra. A hibás SRA-t (vagy esetleg az egész LRU-t) ezután a gyártónak elszállítják. A ‘II. karbantartási szint' nem foglalja magában az ellenőrzés alá vont gyorsulásmérők vagy giro-szenzorok szétszerelését vagy javítását.

7B002Kifejezetten a gyűrűs "lézer"giroszkópokhoz tervezett berendezések, az alábbiak szerint:

N.B. LÁSD MÉG: 7B102.

a. 10 ppm vagy annál kisebb (jobb) mérési "pontosságú" szórásmérők;

b. 0,5 nm (5 Angström) vagy kevesebb (jobb) mérési "pontosságú" érdességmérők (profilométerek).

7B003Kifejezetten a 7A által ellenőrzés alá vont berendezések "gyártására" tervezett berendezések:

Megjegyzés : A 7B003 magában foglalja a következőket:

- Giroszkóp-beállító vizsgálóállomások;

- Giroszkóp dinamikus egyensúly-állomások;

- Giroszkóp működés közbeni motor-vizsgálóállomás;

- Giroszkóp-ürítő- és töltőállomások;

- Centrifugál rögzítők giroszkóp-csapágyakhoz;

- Gyorsulásmérő tengelyek beállítására szolgáló állomások

- Száloptikai giroszkóp tekercselő gépek.

7B102Kifejezetten "lézer"-giroszkóp tükrök karakterizálására tervezett reflektométerek, 50 ppm vagy annál kisebb (jobb) pontossággal.

7B103"Gyártó létesítmények" és "gyártó berendezések", az alábbiak szerint:

a. Kifejezetten a 7A117 alatt meghatározott berendezésekhez tervezett "gyártó létesítmények";

b. A 7A alatt meghatározott berendezésekhez való használatra tervezett vagy átalakított, a 7B001 és a 7B003 alatt meghatározottaktól eltérő "gyártó berendezések" és egyéb vizsgáló-, kalibráló- vagy szabályozó-berendezések.

7CAnyagok

Nincs.

7DSzoftver

7D001Kifejezetten a 7A vagy 7B által ellenőrzés alá vont berendezések "kifejlesztésére" vagy "gyártására" tervezett vagy átalakított "szoftver".

7D002Bármely inerciális navigációs berendezés, beleértve a 7A003 vagy a 7A004 pontban nem említett inerciális berendezéseket, valamint a helyzet- és irányszögreferencia-rendszerek (Attitude and Heading Reference Systems - ‘AHRS') működésére vagy karbantartására szolgáló "forráskód".

Megjegyzés : A 7D002 nem vonja ellenőrzés alá a csuklós ‘AHRS' "felhasználásához" szükséges "forráskódot".

Műszaki megjegyzés :

Az ‘AHRS' általában abban tér el az inerciális navigációs rendszerektől (INS), hogy az ‘AHRS' helyzet- és irányinformációt ad, és általában nem adja meg az INS-nél szokásos gyorsulási, sebesség- és pozícióinformációkat.

7D003Egyéb "szoftver", az alábbiak szerint:

a. Az üzemi teljesítmény javítása céljából, vagy a rendszer navigációs hibáinak a 7A003-ban, a 7A004-ben vagy a 7A008-ban meghatározott szintekre történő csökkentésére tervezett vagy átalakított "szoftver";

b. "Forráskód" a hibrid integrált rendszerekhez, amely az irányadatoknak a következő bármelyikével történő folyamatos kombinálásával javítja az üzemi teljesítményt, és a rendszer navigációs hibáit a 7A003-ban vagy a 7A008-ban meghatározott szintre csökkenti: 1. Doppler-radar vagy szonár sebességi adatok; 2. "Műholdas navigációs rendszerre" vonatkozó referenciaadatok; vagy 3. "Adatalapú referencia navigációs" ("DBRN") rendszerekből származó adat;

c. Nem használt;

d. Nem használt;

e. Kifejezetten olyan "aktív repülésirányítási rendszerek", többtengelyes elektronikus (fly-by-wire), vagy lézeres (fly-by-light) helikopter vezérlő rendszerek, vagy helikopter "cirkulációvezérlésű nyomatékkiegyenlítő vagy cirkulációvezérlésű iránytartó-rendszerek" "fejlesztéséhez" tervezett CAD "szoftver", melyek "technológiáját" a 7E004.b.1., 7E004.b.3. 7E004.b.5., 7E004.b.7., 7E004.b.8., 7E004.c.1. vagy 7E004.c.2. határozza meg.

7D004A 7E004.a.2., 7E004.a.3., 7E004.a.5., 7E004.a.6. vagy 7E004.b. pontban meghatározott "fejlesztési" "technológiát" magában foglaló "forráskód", az alábbiak bármelyikére:

a. Digitális repülésirányító rendszerek "teljes repülésirányításhoz";

b. Integrált meghajtó- és repülésirányító-rendszerek;

c. "Elektronikus repülésvezérlő rendszerek (fly-by-wire rendszerek)" vagy "Optikai repülésvezérlő rendszerek (fly-by-light rendszerek)";

d. Hibatűrő, vagy önrekonfiguráló "aktív repülésirányítási rendszerek";

e. Nem használt;

f. A felszíni statikus adatokon alapuló légi adatrendszerek; vagy

g. Háromdimenziós kijelzők.

Megjegyzés : A 7D004 nem vonja ellenőrzés alá a külön repülésirányító rendszer funkciót nem nyújtó közös számítógépelemekhez és szolgáltatásokhoz (pl, bemenetijel-vétel, kimenetijel-továbbítás, számítógépes program és adatbetöltés, beépített teszt, feladatütemező mechanizmusok) társított "forráskódot".

7D005Kifejezetten a "műholdas navigációs rendszer" távolságmérő kódjának dekódolásához, kormányzati felhasználásra tervezett "szoftver".

7D101Kifejezetten a 7A001-7A006, 7A101-7A106, 7A115, 7A116.a., 7A116.b., 7B001, 7B002, 7B003, 7B102 vagy 7B103 által ellenőrzés alá vont berendezések "felhasználására" tervezett vagy módosított "szoftver".

7D102Integrációs "szoftver", az alábbiak szerint:

a. Integrációs "szoftver" a 7A103.b. alatt meghatározott berendezésekhez;

b. Kifejezetten a 7A003 vagy 7A103.a. alatt meghatározott berendezésekhez tervezett integrációs "szoftver".

c. A 7A103.c. alatt meghatározott berendezésekhez tervezett vagy átalakított integrációs "szoftver".

Megjegyzés : Az integrációs "szoftverek" egy közönséges formája a Kalman-szűrés.

7D103Kifejezetten a 7A117 alatt meghatározott "irányítási/vezérlő készletek" modellezésére vagy szimulálására, illetve a 9A004 alatt meghatározott űrhajóhordozó eszközök vagy 9A104 alatt meghatározott rakétaszondák tervezési integrációjára tervezett "szoftver".

Megjegyzés : A 7D103 alatt meghatározott "szoftver" ellenőrzött marad, ha a 4A102 alatt meghatározott különlegesen tervezett hardverrel kombinálják.

7D104Kifejezetten a 7A117 alatt meghatározott "irányítási/vezérlő készletek" működtetésére vagy karbantartására tervezett vagy átalakított "szoftver".

Megjegyzés : A 7D104 magában foglalja a 7A117 alatt meghatározott pontosság elérése vagy meghaladása céljából az "irányítási/vezérlő készletek" teljesítményének növelésére tervezett vagy átalakított "szoftvert" is.

7ETechnológia

7E001A 7A, 7B, 7D001, 7D002, 7D003, 7D005 és 7D101-7D103 alatt meghatározott berendezések vagy "szoftver" "kifejlesztésére" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

Megjegyzés : A 7E001 kizárólag a 7A005.a. pontban meghatározott berendezésre vonatkozó rejtjelkulcskezelési "technológiát" foglalja magában.

7E002A 7A vagy 7B által ellenőrzés alá vont berendezések "gyártására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

7E003A 7A001-7A004 által ellenőrzés alá vont berendezések javítására, átalakítására vagy nagyjavítására vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

Megjegyzés : A 7E003 nem vonja ellenőrzés alá az olyan karbantartási "technológiát", amely közvetlenül kapcsolódik a "polgári légi jármű" meghibásodott vagy üzemképtelen gépben-cserélhető egységei (LRU) és a javítóműhelyben cserélhető részegységei (SRA) kalibrálásához, eltávolításához vagy cseréjéhez, az ‘I. karbantartási szintnél' vagy ‘II. karbantartási szintnél' leírtak szerint.

N.B. Lásd a 7B001-hez fűzött műszaki megjegyzéseket.

7E004Egyéb "technológia", az alábbiak szerint:

a. A következők bármelyikének "kifejlesztésére" vagy "gyártására" szolgáló "technológia": 1. Nem használt; 2. Csupán a felszíni statikus adatokon alapuló repülési adatrendszer, azaz olyan, amely csak a hagyományos repülési adatokat használja; 3. Háromdimenziós kijelzők "légi járművekhez"; 4. Nem használt; 5. Kifejezetten a ‘primer repülésirányításra' tervezett elektromos működtető szervek (azaz elektromechanikus, elektrohidrosztatikus, és integrált működtető szerv csomagok); Műszaki megjegyzés : ‘Primer repülésirányítás' (primary flight control): "légi jármű" stabilitásának, vagy manőverezésének szabályozása erő- vagy nyomatékgenerátorok, azaz például aerodinamikai vezérlő felületek vagy tolóerő-irányítás felhasználásával. 6. Kifejezetten "aktív repülésirányítási rendszerek" megvalósítására tervezett ‘repülésirányító optikai szenzorrendszerek'; vagy Műszaki megjegyzés : ‘Repülésirányító optikai szenzorrendszer' (flight control optical sensor array): elosztott optikai érzékelők hálózata, amely "lézer"-sugarat használ fel fedélzeti felhasználású valós idejű repülésirányítási adatok szolgáltatására. 7. Víz alatti navigációra tervezett, szonáris vagy gravitációs adatbázisokat használó "DBRN"-rendszerek, amelyek helymeghatározási "pontossága" 0,4 tengeri mérföld vagy annál kisebb (jobb);

b. "Fejlesztési" "technológiák", "aktív repülésirányítási rendszerekhez" (beleértve az "elektronikus repülésvezérlő - fly-by-wire" - és az "optikai repülésvezérlő - fly-by-light - rendszereket"), az alábbiak szerint: 1. Foton-alapú "technológia" a "légi jármű" vagy légiellenőrzési elem állapotának érzékelésére, a légiellenőrzési adatok továbbítására, vagy a szabályozószervek mozgatására, amelyek az "optikai repülésvezérlő rendszerű - Fly-by-light rendszerű" "aktív repülésirányítási rendszerekhez" "szükségesek"; 2. Nem használt; 3. Valós idejű algoritmusok az alkatrészszenzor-információk elemzéséhez az "aktív repülésirányító rendszeren" belüli alkatrészek hamarosan bekövetkező romlására és meghibásodásaira való felkészülés és azok előzetes enyhítése céljából; Megjegyzés : A 7E004.b.3. nem vonja ellenőrzés alá az off-line karbantartást céljából kialakított algoritmusokat. 4. Valós idejű algoritmusok az alkatrész-meghibásodások feltárása, valamint a tolóerő és nyomaték rekonfigurációja és a pillanatnyi irányítás céljából, az "aktív repülésirányító rendszer" romlásának és meghibásodásainak enyhítése érdekében; Megjegyzés : A 7E004.b.4. nem vonja ellenőrzés alá a hibahatásoknak redundáns adatforrások összevetésével történő megszüntetését célzó algoritmusokat és az előre látható meghibásodásokra adott előre tervezett off-line válaszokat. 5. Digitális repülésirányítás, a navigációs és hajtásvezérlési adatok digitális repülésirányítási rendszerbe történő integrálása a "teljes repülésirányítás" megvalósításához; Megjegyzés : A 7E004.b.5 nem vonja ellenőrzés alá: a. A digitális repülésirányításnak, a navigációnak és a meghajtás irányításnak a ‘repülési útvonal optimalizálására' szolgáló digitális repülésmenedzselő rendszerbe történő integrációjára vonatkozó "technológiát"; b. Kizárólag VOR, DME, ILS vagy MLS navigálási vagy bevezető rendszerekhez integrált "légi jármű" műszerezési rendszerek "technológiája". Műszaki megjegyzés : ‘Repülési útvonal optimalizálása' (flight path optimisation): olyan eljárás, amely minimalizálja a repülési feladat teljesítésének és hatékonyságának maximalizálása érdekében kívánatos, négydimenziós (idő és tér) röppályától történő eltérést. 6. Nem használt; 7. Az "elektronikus repülésvezérlő rendszerekre - Fly-by-wire rendszerekre" vonatkozó funkcionális követelmények megállapításához "szükséges" "technológiák", az alábbi összes jellemzővel: a. A repülőgéptest stabilitásának ‘belső hurkos', 40 Hz vagy nagyobb huroklezárási frekvenciát igénylő ellenőrzései; és Műszaki megjegyzés : A ‘belső hurok' az "aktív repülésirányítási rendszerek" azon funkcióira utal, amelyek automatikussá teszik a repülőgéptest stabilitását mérő ellenőrzéseket. b. Rendelkeznek az alábbiak bármelyikével: 1. Korrigálja az aerodinamikai szempontból - a tervezett repülési határgörbe bármely pontján mért - instabil repülőgéptestet, amely elveszítené a visszaállítható irányítást, ha 0,5 másodpercen belül nem korrigálnák; 2. Két vagy több tengelyen végez ellenőrzéseket a ‘légi jármű állapotában bekövetkező abnormális változások' ellensúlyozásával egyidejűleg; Műszaki megjegyzés : A ‘légi jármű állapotában bekövetkező abnormális változások' magukban foglalják a repülés alatt bekövetkező szerkezeti károsodást, a hajtómű tolóerejének elveszítését, a működésképtelen irányítófelületet, vagy a teherrakomány destabilizáló elmozdulását. 3. Ellátja a 7E004.b.5. alatt meghatározott funkciókat; vagy Megjegyzés : A 7E004.b.7.b.3. nem vonja ellenőrzés alá a robotpilótákat. 4. Lehetővé teszi a "légi jármű" számára a - felszálláson és leszálláson kívüli - stabil ellenőrzött repülést 18 foknál nagyobb állásszögnél, 15 foknál nagyobb oldalcsúszásnál, 15 fok/másodpercnél nagyobb bólintási vagy legyezési szögsebességnél, illetve 90 fok/másodpercnél nagyobb orsózási szögsebességnél; 8. Az "elektronikus repülésvezérlő rendszerekre -Ffly-by-wire rendszerekre" vonatkozó funkcionális követelmények megállapításához "szükséges" "technológiák", az alábbiak összességének elérése céljából: a. Az "elektronikus repülésvezérlő rendszeren -Fly-by-wire rendszeren" belül két egymás után bekövetkező egyéni hiba esetén nem veszítik el a "légi jármű" feletti ellenőrzést; és b. A "légi jármű" feletti ellenőrzés elveszítésének valószínűsége kevesebb (jobb), mint repülési óránként 1 × 10-9 kudarcesemény; Megjegyzés : A 7E004.b. nem vonja ellenőrzés alá a külön repülésirányító rendszer funkciót nem nyújtó közönséges számítógépelemekkel és funkciókkal (pl. bemenetijel-vétel, kimenetijel-továbbítás, számítógépes program és adatbetöltés, beépített teszt, feladatütemező mechanizmusok) kapcsolatos "technológiát".

c. Helikopter-rendszerek "kifejlesztésére" szolgáló "technológia", az alábbiak szerint: 1. Többtengelyes fly-by-wire vagy fly-by-light vezérlők, amelyek egy vezérlőelemben a következők közül legalább két funkcióit kombinálnak: a. Kollektív vezérlés; b. Ciklikus vezérlés; c. Legyezés-vezérlés; 2. "Cirkulációvezérlésű nyomatékkiegyenlítő vagy cirkulációvezérlésű iránytartó-rendszerek"; 3. Forgószárny lapátok, azaz ‘változó geometriájú szárnyak' az egyedi forgószárny-vezérlésű rendszerekben történő alkalmazásra. Műszaki megjegyzés : ‘Változó geometriájú szárny' (variable geometry aerofoils): olyan fékszárny vagy kiegyenlítőlap, illetve orrsegédszárny vagy orrkiképzés, amely helyzete repülés közben irányítható.

7E101A 7A001-7A006, 7A101-7A106, 7A115-7A117, 7B001, 7B002, 7B003, 7B102, 7B103, 7D101-7D103 által ellenőrzés alá vont berendezések "felhasználására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

7E102Repülő-elektronikának és elektromos alrendszereknek külső forrásokból származó elektromágneses impulzusok (EMP) és elektromágneses interferenciák (EMI) elleni védelmét szolgáló "technológia", az alábbiak szerint:

a. Az árnyékoló rendszerek tervezési "technológiája";

b. Megerősített elektromos áramkörök és alrendszerek konfigurálásának tervezési "technológiája";

c. A fenti 7E102.a. és 7E102.b. megerősítési kritériumok meghatározásának tervezési "technológiája".

7E104A rakéta röppályájának optimalizálása céljából a repülésvezérlési, irányítási és meghajtási adatok repülésirányító rendszerbe történő integrálására szolgáló "technológia".

X. RÉSZ

8. kategória

8. KATEGÓRIA - TENGERÉSZET

8ABerendezések, részegységek és alkatrészek

8A001Merülő járművek vagy felszíni vízi járművek, az alábbiak szerint:

N.B. A merülő járművek berendezéseinek ellenőrzési státusa tekintetében lásd:

- Szenzorok tekintetében a 6. kategória;

- A navigációs berendezések tekintetében a 7. és 8. kategória;

- A víz alatti berendezések tekintetében a 8A kategória.

a. Legénységgel rendelkező, 1 000 m-t meghaladó mélységben történő üzemeltetésre tervezett, kábellel összekötött merülő járművek;

b. Legénységgel rendelkező, kábellel nem összekötött merülő járművek, amelyek rendelkeznek a következők bármelyikével: 1. ‘Autonóm üzemelésre' tervezték, és rendelkeznek a következő emelőkapacitások mindegyikével: a. Saját súlyuk min. 10 %-a levegőben; és b. 15 kN vagy annál több; 2. 1 000 m-nél nagyobb mélységben való működésre tervezték; vagy 3. Rendelkezik a következők mindegyikével: a. 10 órás vagy hosszabb folyamatos ‘autonóm üzemelésre' tervezték; és b. A ‘hatósugár' 25 tengeri mérföld vagy több; Műszaki megjegyzések : 1. A 8A001.b. alkalmazásában az ‘autonóm üzemelés' azt jelenti, hogy a jármű légzőcső nélkül teljes egészében víz alá merül, minden rendszer működik és olyan minimális sebességgel cirkál, amelyen a merülő jármű biztonságosan képes mélységét dinamikusan szabályozni csupán siklólemezei révén, anélkül, hogy a felületen, a fenéken vagy a parton lévő segédhajóra vagy bázisra lenne szüksége, és a víz alatti vagy a felszíni működéshez meghajtórendszert tartalmaz. 2. A 8A001.b. alkalmazásában a ‘hatósugár' annak a maximális távolságnak a felét jelenti, amelyet a merülő jármű ‘autonóm üzemelés' közben képes megtenni.

c. Legénység nélküli, merülő járművek, az alábbiak szerint: 1. Legénység nélküli, merülő járművek, amelyek rendelkeznek a következők bármelyikével: a. Úgy tervezték, hogy bármely földrajzi referenciához viszonyított pálya meghatározása tekintetében képes valósidejű emberi segítség nélküli döntéshozatalra; b. Akusztikai adat- vagy parancskapcsolattal rendelkezik; vagy c. 1 000 m-t meghaladó optikai adat- vagy parancskapcsolattal rendelkezik; 2. A 8A001.c.1. alatt nem meghatározott, az alábbi összes jellemzővel rendelkező, legénység nélküli, merülő járművek: a. Kábellel történő működésre tervezték; b. 1 000 m-nél nagyobb mélységben való működésre tervezték; c. Rendelkeznek az alábbiak bármelyikével: 1. A 8A002.a.2. által ellenőrzés alá vont hajtómotorok vagy hajócsavarok segítségével történő önmozgásra tervezték; vagy 2. Száloptikás adatkapcsolattal rendelkezik;

d. Nem használt;

e. A kimentendő objektumok 250 m-nél nagyobb mélységből történő kiemelésére szolgáló óceáni mentőrendszerek, amelyek emelőkapacitása meghaladja az 5 MN-t, és rendelkeznek a következők bármelyikével: 1. Dinamikus pozícionáló rendszerek, amelyek a pozíciót a navigációs rendszer által megadott ponthoz képest 20 m-en belül képesek megtartani; vagy 2. Tengerfenék-navigálási és navigációs integráló rendszerek 1 000 m-nél nagyobb mélységre, az előre meghatározott ponthoz képest 10 m-en belüli pozícionálási "pontossággal";

f. Nem használt;

g. Nem használt;

h. Nem használt;

i. Nem használt.

8A002Tengerészeti rendszerek, berendezések és alkatrészek, az alábbiak szerint:

Megjegyzés: A víz alatti kommunikációs rendszerek tekintetében lásd: 5. kategória 1. rész - Távközlés.

a. Kifejezetten az 1 000 m-t meghaladó mélységben történő üzemeltetésre tervezett merülő járművekhez tervezett vagy átalakított rendszerek, berendezések és alkatrészek, az alábbiak szerint: 1. Nagynyomású fülkék és búvárharangok, amelyeknél a belső kamra maximális átmérője meghaladja az 1,5 m-t; 2. Egyenáramú hajtó-, illetve tolómotorok; 3. Optikai szálas és szintetikus erősítésű tagot tartalmazó köldökzsinór kábelek és csatlakozóik; 4. A 8C001-ben meghatározott anyagból készült alkatrészek; Műszaki megjegyzés : A 8A002.a.4. célja nem kerülhető meg a 8C001-ben meghatározott olyan ‘szintaktikus hab' kivitelével, amely közbenső gyártási stádiumban van, és még nem nyerte el végleges alkatrészi formáját.

b. Kifejezetten a 8A001 által ellenőrzés alá vont merülő járművek mozgásának automatikus vezérlésére tervezett vagy átalakított rendszerek, amelyek navigációs adatokkal és zárt hurkos szervovezérléssel működnek, valamint az alábbiak bármelyikével rendelkeznek: 1. Lehetővé teszik járműnek a vízoszlopban előre meghatározott ponthoz képest 10 m-en belül történő mozgásban tartását; 2. A vízoszlopban előre meghatározott ponthoz képest 10 m-en belül fenntartják a jármű helyzetét; vagy 3. A tengerfenéken vagy az alatt fektetett kábelt 10 m-en belül követve fenntartják a jármű helyzetét;

c. Száloptikás penetrátorok a nyomásálló hajótestben;

d. Víz alatti képalkotó rendszerek, amelyek rendelkeznek a következők mindegyikével: 1. Kifejezetten a víz alatti járműveken, távvezérléssel történő üzemeltetésre tervezték vagy alakították át; és 2. A visszaszórási hatások minimalizálását célzó alábbi technikák bármelyikét alkalmazza: a. Stroboszkópos távolságmérő illuminátorok; vagy b. Stroboszkópos távolságmérő lézerrendszerek;

e. Nem használt;

f. Nem használt;

g. Kifejezetten víz alatti használatra tervezett vagy átalakított világítási rendszerek, az alábbiak szerint: 1. Sztroboszkópos világítási rendszerek, amelyek képesek villanásonként több mint 300 J kimenő energiájú fény kibocsátására, és másodpercenként legalább 5 villanás létrehozására; 2. Argon ív-fény rendszerek, amelyeket kifejezetten 1 000 m alatti használatra terveztek;

h. Kifejezetten víz alatti használatra tervezett "robotok", amelyeket kimondottan e célra kifejlesztett számítógéppel irányítanak, és amelyek rendelkeznek a következők bármelyikével: 1. Olyan rendszerek, amelyek az érzékelők információi alapján, a külső tárgyra kifejtett erőt vagy forgatónyomatékot, vagy egy külső tárgytól való távolságot mérve, vagy a "robot" és egy külső tárgy közötti érintkezést érzékelve irányítják a "robotot"; vagy 2. Képesek legalább 250 N erőt vagy 250 Nm nyomatékot leadni, és szerkezeti elemként titánalapú ötvözeteket vagy "szálas vagy rostos" "kompozit" anyagokat tartalmaznak;

i. Olyan távirányítású, csuklósan összekapcsolt manipulátorok, amelyeket kifejezetten víz alatti járművekhez terveztek vagy alakítottak át, az alábbiak szerint: 1. Olyan rendszerek, amelyek a manipulátort az alábbiak valamelyikét mérő érzékelők információi alapján irányítják: a. a külső tárgyra kifejtett erőt vagy forgatónyomatékot; vagy b. a manipulátor és egy külső tárgy közötti érintkezést; vagy 2. Arányos "master-slave" technikával vagy kimondottan e célra kifejlesztett számítógép felhasználásával irányítják, és a ‘mozgási szabadságfoka' legalább 5; Műszaki megjegyzés : A ‘mozgási szabadságfok' meghatározásához csak a helyzetvisszacsatolást alkalmazó arányos vezérlési funkciókat, illetve a kimondottan e célra kifejlesztett számítógép alkalmazásával megvalósuló funkciókat kell figyelembe venni.

j. Levegőtől független energiaellátó-rendszerek, amelyeket kifejezetten víz alatti alkalmazásra terveztek, az alábbiak szerint: 1. Brayton, vagy Rankine ciklusú motor levegő-független energiaellátó-rendszerek, amelyek rendelkeznek a következők bármelyikével: a. Kifejezetten szén-dioxid, szén-monoxid és egyéb, a recirkulált kipufogógázokból származó részecskék eltávolítására tervezett vegyi gáztisztítók vagy abszorpciós rendszerek; b. Kifejezetten egyatomos gázok felhasználására tervezett rendszerek; c. Kifejezetten 10 kHz-nél alacsonyabb frekvenciájú víz alatti zajok csökkentésére tervezett eszközök vagy borítások, vagy speciális rezgéscsillapító eszközök; vagy d. Az alábbiak mindegyikével rendelkező rendszerek: 1. Kifejezetten reakcióban keletkező anyagok sűrítése vagy az üzemanyag megújítása céljára tervezték; 2. Kifejezetten reakciótermékek tárolása céljára tervezték; és 3. Kifejezetten reakciótermékek eltávolítása céljára tervezték 100 kPa vagy nagyobb nyomás ellenében; 2. Dízelciklusú-motor levegőfüggetlen-rendszerek, amelyek rendelkeznek a következő jellemzők mindegyikével: a. Kifejezetten szén-dioxid, szén-monoxid és egyéb, a recirkulált kipufogógázokból származó részecskék eltávolítására tervezett vegyi gáztisztítók vagy abszorpciós rendszerek; b. Kifejezetten egyatomos gázok felhasználására tervezett rendszerek; c. Kifejezetten 10 kHz-nél alacsonyabb frekvenciájú víz alatti zajok csökkentésére tervezett eszközök vagy borítások, vagy speciális rezgéscsillapító eszközök; és d. Speciálisan tervezett kipufogórendszerek, amelyek az égéstermékeket nem folyamatosan távolítják el; 3. "Üzemanyag-cellás" levegő-független energiaellátó rendszerek, amelyek kimenő teljesítménye meghaladja a 2 kW-ot, és amelyek rendelkeznek a következő jellemzők bármelyikével: a. Kifejezetten 10 kHz-nél alacsonyabb frekvenciájú víz alatti zajok csökkentésére tervezett eszközök vagy borítások, vagy speciális rezgéscsillapító eszközök; vagy b. Az alábbiak mindegyikével rendelkező rendszerek: 1. Kifejezetten reakcióban keletkező anyagok sűrítése vagy az üzemanyag megújítása céljára tervezték; 2. Kifejezetten reakciótermékek tárolása céljára tervezték; és 3. Kifejezetten reakciótermékek eltávolítása céljára tervezték 100 kPa vagy nagyobb nyomás ellenében; 4. Stirling ciklusú motor levegő-független rendszerek, amelyek rendelkeznek a következő jellemzők mindegyikével: a. Kifejezetten 10 kHz-nél alacsonyabb frekvenciájú víz alatti zajok csökkentésére tervezett eszközök vagy borítások, vagy speciális rezgéscsillapító eszközök; és b. Speciálisan tervezett kipufogórendszerek, amelyek az égéstermékeket 100 kPa vagy nagyobb nyomás ellenében távolítják el;

k. Nem használt;

l. Nem használt;

m. Nem használt;

n. Nem használt;

o. Propellerek, erőátviteli rendszerek, áramtermelő rendszerek és zajcsökkentő rendszerek, az alábbiak szerint: 1. Nem használt 2. Hajókon történő felhasználásra tervezett hajócsavarok, energiatermelő és átviteli rendszerek, az alábbiak szerint: a. Több mint 30 MW-ra méretezett szabályozható csavaremelkedésű hajócsavar és hajócsavaragy-szerelvények; b. Belső folyadékhűtésű villamos hajtómotorok, amelyek kimenő teljesítménye meghaladja a 2,5 MW-ot; c. "Szupravezető" hajómotorok, vagy állandó mágneses villamos hajómotorok 0,1 MW-ot meghaladó kimenő teljesítménnyel; d. "Kompozit" anyagból készült alkatrészeket tartalmazó erőátviteli tengely-rendszerek, amelyek több mint 2 MW átvitelére képesek; e. Több mint 2,5 MW-ra méretezett ventilációs vagy alap-ventilációs propeller-rendszerek; 3. Zajcsökkentő rendszerek az 1 000 tonna vagy annál nagyobb vízkiszorítású hajókhoz, az alábbiak szerint: a. Kifejezetten hang- és rezgés-szigetelésre tervezett víz alatti zajcsökkentő rendszerek, amelyek 500 Hz alatti frekvencián csillapítanak és a dízelmotorok, dízelgenerátor-készletek, gázturbinák, gázturbina-generátor-készletek, hajtómotorok vagy gyorsító-lassító áttételek akusztikai szigetelésére összetett akusztikai szerelvényeket tartalmaznak, és amelyek tömege meghaladja az összeszerelésre kerülő berendezések 30 %-át; b. ‘Aktív zajcsökkentő- vagy kiküszöbölő rendszerek' vagy mágneses csapágyak, amelyeket kifejezetten erőátviteli rendszerekhez terveztek; Műszaki megjegyzés : Az ‘aktív zajcsökkentő- vagy kiküszöbölő rendszerek' olyan elektronikus vezérlőrendszerekből állnak, amelyek a forráshoz közvetlenül adott zajcsillapító vagy antivibrációs jelek generálásával képesek aktívan csökkenteni a berendezések rezgését.

p. Sugárszivattyú-rendszerek, amelyek az alábbi jellemzők mindegyikével rendelkeznek: 1. kimenő teljesítményük meghaladja a 2,5 MW-ot; és 2. a hajtási hatékonyság javítása, vagy a hajtás által generált víz alatti zajcsökkentés céljából divergens fúvókát és áramlásszabályozó forgólapát technikát használnak;

q. Készülékek víz alatti úszáshoz vagy merüléshez, az alábbiak szerint: 1. zárt körű (lélegeztető) készülékek 2. félig zárt körű (lélegeztető) készülékek Megjegyzés : A 8A002.q. nem vonja ellenőrzés alá a személyes használatra szolgáló és a felhasználónál lévő egyedi berendezéseket. N.B. A kifejezetten katonai felhasználásra tervezett berendezések és eszközök tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

r. Kifejezetten búvárok megzavarására tervezett vagy átalakított akusztikus búvárriasztó berendezések, amelyek hangnyomásszintje legfeljebb 200 Hz-es frekvencián legalább 190 dB (vonatkoztatási alap 1 μPa, 1 m-en). 1. megjegyzés : A 8A002.r. nem vonja ellenőrzés alá a víz alatti robbanóeszközökön, víz alatti sűrített gázzal működő szeizmikus rezgéskeltőkön (underwater air guns) vagy víz alatti gyúlékony forrásokon alapuló búvárriasztó berendezéseket. 2. megjegyzés : A 8A002.r. pontba beletartoznak a szikraköz-forrást, más néven plazma hangforrást alkalmazó akusztikus búvárriasztó berendezések is.

8BVizsgáló-, ellenőrző és gyártó berendezések

8B001A hajtórendszer-modellek körül az áramlás által keltett akusztikai mezők mérésére tervezett, a 0 Hz-et meghaladó, de 500 Hz-t nem meghaladó frekvenciatartományban kevesebb mint 100 dB (referencia 1 μPa, 1 Hz) háttérzajjal tervezett tesztelő vízalagutak.

8CAnyagok

8C001Víz alatti alkalmazásra tervezett ‘szintaktikus hab', amely rendelkezik a következők mindegyikével:

N.B. Lásd még: 8A002.a.4.

a. 1 000 m-nél nagyobb tengeri mélységben való működésre tervezték; és

b. Sűrűségük kisebb, mint 561 kg/m3.

Műszaki megjegyzés :

A ‘szintaktikus hab' műgyanta "mátrixba" ágyazott műanyagból vagy üvegből készült üreges gömbökből áll.

8DSzoftver

8D001Kifejezetten a 8A, 8B vagy 8C alatt meghatározott berendezések vagy anyagok "kifejlesztéséhez", "gyártásához" vagy "felhasználásához" tervezett vagy átalakított "szoftver".

8D002Kifejezetten víz alatti zajcsökkentésre tervezett vagy módosított hajócsavarok "kifejlesztéséhez", "gyártásához", javításához, nagyjavításához vagy felújításához tervezett vagy átalakított különleges "szoftver".

8ETechnológia

8E001A 8A, 8B vagy 8C alatt meghatározott berendezések vagy anyagok "kifejlesztésére", "gyártására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

8E002Egyéb "technológia", az alábbiak szerint:

a. Kifejezetten a víz alatti zajcsökkentésre tervezett hajócsavarok "fejlesztésére", "gyártására", javítására, nagyjavítására vagy felújítására szolgáló "technológia".

b. A 8A001, 8A002.b., 8A002.j., 8A002.o. vagy 8A002.p. által ellenőrzés alá vont berendezések nagyjavítására vagy felújítására szolgáló "technológia".

c. Az Általános technológiai megjegyzések szerinti, a következők bármelyikének "kifejlesztésére" vagy "gyártására" szolgáló "technológia": 1. Párnahatás vízi járművek (teljesen zárt szoknyás légpárnás változat), amelyek rendelkeznek a következő jellemzők mindegyikével: a. 1,25 m-es vagy azt meghaladó hullámmagasságnál maximális névleges sebessége, teljes terhelés mellett meghaladja a 30 csomót; b. A légpárna nyomása meghaladja a 3 830 Pa-t; és c. A terheletlen hajó/maximálisan terhelt állapot vízkiszorítási aránya kevesebb, mint 0,70; 2. Párnahatás járművek (merev oldalfalakkal), amelyek maximális névleges sebessége, teljes terhelés mellett meghaladja a 40 csomót, a 3,25 m-es vagy azt meghaladó hullámmagasságnál; 3. Szárnyashajók, a hajót a víz szintje fölé emelő rendszerek automatikus vezérlésére szolgáló aktív rendszerekkel, amelyek maximális méretezési sebessége, teljes terhelés mellett, 3,25 m-es vagy azt meghaladó hullámmagasságnál legalább 40 csomó; vagy 4. ‘Félig merülő katamaránok', amelyek rendelkeznek a következők bármelyikével: a. Teljes terhelés mellett, 3,25 m-es vagy azt meghaladó hullámmagasságnál, és 35 csomót meghaladó maximális sebességnél a teljes vízkiszorítás terhelt állapotban több, mint 500 tonna; vagy b. Teljes terhelés mellett, 4 m-es vagy azt meghaladó hullámmagasságnál, és 25 csomót meghaladó maximális sebességnél a teljes vízkiszorítás terhelt állapotban több, mint 1 500 tonna. Műszaki megjegyzés : A ‘félig merülő katamaránokat' a következő képlettel kell meghatározni: a vízi jármű területe az üzemi tervezési merülésnél kevesebb, mint 2x (a vízkiszorítás az üzemi tervezési merülésnél) 2/3.

XI. RÉSZ

9. kategória

9. KATEGÓRIA - LÉGTÉR ÉS HAJTÓMŰRENDSZEREK

9ABerendezések, részegységek és alkatrészek

N.B. A neutron- vagy tranziens ionizáló sugárzás ellen védett, vagy erre méretezett meghajtórendszerek tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

9A001Az alábbiak bármelyikével rendelkező gázturbinás sugárhajtóművek:

N.B. LÁSD MÉG: 9A101.

a. A 9E003.a., a 9E003.h. vagy a 9E003.i. pontban meghatározott "technológiák" bármelyikét alkalmazza; vagy 1. megjegyzés : 9A001.a. nem vonja ellenőrzése alá azokat a gázturbinás sugárhajtóműveket, amelyek valamennyi alábbi feltételnek megfelelnek: a. Egy vagy több uniós tagállam vagy a Wassenaari Megállapodásban részt vevő államok polgári repülésügyi hatóságai hitelesítették; valamint b. Olyan nem katonai, legénységgel felszerelt "légi jármű" meghajtására tervezték, amelyre egy vagy több uniós tagállam vagy a Wassenaari Megállapodásban részt vevő állam polgári repülésügyi hatóságai kiadták az ilyen motortípussal felszerelt "repülőgépre" vonatkozó alábbi okmányok egyikét: 1. Polgári típusalkalmassági bizonyítvány; vagy 2. A Nemzetközi Polgári Repülési Szervezet (ICAO) által elismert, ezzel egyenértékű dokumentum. 2. megjegyzés : A 9A001.a. nem vonja ellenőrzés alá a valamely uniós tagállam vagy a Wassenaari Megállapodásban részt vevő állam polgári repülésügyi hatósága által jóváhagyott segédhajtóművekhez (APU) tervezett gázturbinás sugárhajtóműveket.

b. Arra tervezték, hogy több mint 30 percig 1 Mach vagy annál nagyobb sebességgel repülő "légi járművet" működtessen.

9A002Folyékony tüzelőanyaggal való üzemelésre tervezett, az alábbi jellemzők mindegyikével rendelkező ‘tengeri gázturbina motorok', valamint a kifejezetten azokhoz tervezett tartozékok és alkatrészek:

a. "Folyamatos motorműködés" közben, az ISO 3977-2:1997 (vagy az egyenértékű nemzeti szabvány) szerinti szabványos referenciafeltételek mellett a leadott legnagyobb folyamatos teljesítményük legalább 24 245 kW; valamint

b. Folyékony tüzelőanyaggal, a leadott legnagyobb folyamatos teljesítmény 35 %-án üzemeltetve ‘korrigált fajlagos tüzelőanyag-fogyasztásuk' legfeljebb 0,219 kg/kWh.

Megjegyzés : A ‘tengeri gázturbina motor' magában foglalja mindazokat az ipari vagy repülőgép-ipari gázturbina motorokat, amelyeket arra alakítottak át, hogy egy hajó számára áramot termeljenek, vagy egy hajót meghajtsanak.

Műszaki megjegyzés :

A 9A002 alkalmazásában ‘korrigált fajlagos tüzelőanyag-fogyasztás': a motor fajlagos tüzelőanyag-fogyasztása, átszámítva 42 MJ/kg nettó fajlagos energiatartalmú (fűtőértékű) folyékony tengeri tüzelőolajra (ISO 3977-2:1997).

9A003Kifejezetten gázturbinás sugárhajtóművekhez tervezett, a 9A003.a., a 9A003.h. vagy a 9E003.i. pontban meghatározott "technológiák" bármelyikét alkalmazó, részegységek vagy alkatrészek az alábbiak valamelyikéhez:

a. A 9A001 alatt meghatározott; vagy

b. Tervezési, vagy gyártási eredete vagy nem uniós tagállambeli vagy a Wassenaari Megállapodásban részt vevő állambeli; vagy ismeretlen a gyártó előtt.

9A004Űrhajózási hordozórakéta, "űreszköz", "űreszközplatform", "űreszköz hasznos terhe", az "űreszköz" fedélzeti rendszerei vagy berendezése, földi berendezés, légi indításra szolgáló platform és "szuborbitális jármű" az alábbiak szerint:

N.B. LÁSD MÉG: 9A104.

a. Űrhajózási hordozórakéták;

b. "Űreszköz";

c. "Űreszközplatform";

d. "Űreszköz hasznos terhe", amely a 3A001.b.1.a.4., 3A002.g., 5A001.a.1., 5A001.b.3., 5A002.c., 5A002.e., 6A002.a.1., 6A002.a.2., 6A002.b., 6A002.d., 6A003.b., 6A004.c., 6A004.e., 6A008.d., 6A008.e., 6A008.k., 6A008.l. vagy 9A010.c. pontban meghatározott elemeket foglalja magában;

e. Kifejezetten "űreszközökhöz" tervezett fedélzeti rendszer vagy berendezés, amely rendelkezik az alábbiak bármelyikével: 1. ‘Vezérlés és telemetrikus adatkezelés'; Megjegyzés : A 9A004.e.1. alkalmazásában a ‘vezérlés és telemetrikus adatkezelés' magában foglalja a platform adatainak kezelését, tárolását és feldolgozását. 2. ‘Űreszköz hasznos terhét alkotó berendezések adatainak kezelése'; vagy Megjegyzés : A 9A004.e.2. alkalmazásában az ‘űreszköz hasznos terhét alkotó berendezések adatainak kezelése' magában foglalja az űreszköz hasznos terhét alkotó berendezések adatainak kezelését, tárolását és feldolgozását. 3. ‘Térbeli helyzet- és keringésellenőrzés'; Megjegyzés : A 9A004.e.3. alkalmazásában a ‘helyzet- és keringésellenőrzés' magában foglalja a valamely "űreszköz" helyzetének és irányának meghatározását és ellenőrzését biztosító érzékelést és szabályozást. N.B. A kifejezetten katonai felhasználásra tervezett berendezések tekintetében LÁSD: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

f. Kifejezetten "űreszközhöz" tervezett földi berendezés, az alábbiak szerint: 1. Olyan telemetrikus és távirányító berendezés, amelyet kifejezetten az alábbi adatfeldolgozási funkciók valamelyikére terveztek: a. Képszinkronizálási és hibajavítási célú telemetriai adatfeldolgozás "űreszközplatform" üzemi státuszának (épségének és biztonságának) nyomon követéséhez; vagy b. Parancsadat-feldolgozás az "űreszköznek" az "űreszközplatform" vezérléséhez küldött parancsadatok formázásához; 2. Kifejezetten "űreszköz" ‘üzemi eljárásainak ellenőrzése' céljára tervezett szimulátorok. Műszaki megjegyzés : A 9A004.f.2. alkalmazásában ‘üzemi eljárások ellenőrzése' a következők bármelyikét jelentheti: 1. Parancssorozat megerősítése; 2. Operatív képzés; 3. Operatív gyakorlat; vagy 4. Operatív elemzés.

g. Kifejezetten űrhajózási hordozórakéták légi indítására tervezett vagy átalakított "légi jármű", vagy "szuborbitális jármű";

h. "Szuborbitális jármű".

9A005A 9A006 alatt meghatározott rendszerek vagy alkatrészek bármelyikét tartalmazó folyékony rakétameghajtó rendszerek.

N.B. LÁSD MÉG: 9A105 és 9A119.

9A006Kifejezetten folyékony rakétahajtóművekhez tervezett rendszerek vagy alkatrészek, az alábbiak szerint:

N.B. LÁSD MÉG: 9A106, 9A108 és 9A120.

a. Kriogén hűtők, igen kis súlyú dewar-edények, kriogén fűtőcsövek vagy kriogén rendszerek, amelyeket kifejezetten űrjárművekben történő felhasználásra terveztek, és amelyek képesek a kriogén folyadék éves veszteségét 30 % alatt tartani;

b. Kriogén tartályok, vagy zárt körű hűtőrendszerek, amelyek alkalmasak arra, hogy 3 Mach sebesség folyamatos meghaladására képes "légi járművön", hordozórakétán vagy "űreszközön" a hőmérsékletet 100 K-en (-173 °C) vagy az alatt tartsák;

c. Hidrogéniszap-tároló, vagy -továbbító rendszerek;

d. Nagynyomású (17,5 MPa feletti) turbószivattyúk, szivattyúalkatrészek, vagy az azokhoz kapcsolódó gázgenerátor, vagy tágulási ciklusú turbinameghajtó rendszerek;

e. Nagynyomású (10,6 MPa feletti) égőterek és az ezekhez való fúvókák;

f. A kapilláristartály vagy a pozitív expulzió (azaz rugalmas belső tömlő) elvét alkalmazó hajtóanyag-tároló rendszerek;

g. Folyékony hajtóanyag injektorok 0,381 mm, vagy kisebb átmérőjű szűkítővel (1,14 × 10-3 cm2 vagy kisebb nem-cirkuláris szűkítők), amelyeket kifejezetten folyékony rakétahajtóművekhez terveztek;

h. Egy darabból álló szén-szén rakétahajtómű égőtér vagy kilépőkúpok 1,4 g/cm3-t meghaladó sűrűséggel és 48 MPa szakítószilárdsággal.

9A007Szilárd rakétameghajtó rendszerek, amelyek rendelkeznek a következők bármelyikével:

N.B. LÁSD MÉG: 9A107 és 9A119.

a. 1,1 MNs feletti teljes impulzuskapacitás;

b. A fajlagos impulzus 2,4 kNs/kg vagy több, amikor a fúvóka tengerszinten, normál környezeti hőmérsékleten, 7 MPa beállított nyomáson fúj ki;

c. A fokozat tömegaránya meghaladja a 88 %-ot, és a szilárd hajtóanyag mennyisége meghaladja a 86 %-ot;

d. A 9A008 alatt meghatározott alkatrészek; vagy

e. Olyan szigetelő és hajtóanyagkötő rendszerek, amelyek közvetlenül rögzített motorkialakítást használnak az ‘erős mechanikus kötés' vagy a szilárd hajtóanyag és a házszigetelés közötti kémiai migráció megakadályozását szolgáló gát biztosítására. Műszaki megjegyzés : Az ‘erős mechanikus kötés' a hajtóanyag szilárdságát elérő, vagy azt meghaladó erősség.

9A008Kifejezetten szilárd rakétameghajtó rendszerekhez tervezett alkatrészek, az alábbiak szerint:

N.B. LÁSD MÉG: 9A108.

a. Szigetelés és hajtóanyag rögzítő rendszerek, amelyek béléseket alkalmaznak az ‘erős mechanikus kötés' vagy a szilárd hajtóanyag és a házszigetelés közötti kémiai migráció megakadályozását szolgáló gát biztosítására; Műszaki megjegyzés : Az ‘erős mechanikus kötés' a hajtóanyag szilárdságát elérő, vagy azt meghaladó erősség.

b. Száltekercselésű "kompozit" motortestek, amelyeknek átmérője nagyobb, mint 0,61 m, vagy amelyeknek ‘szerkezeti hatékonysági aránya (PV/W)' meghaladja a 25 km-t; Műszaki megjegyzés : A ‘szerkezeti hatékonysági arány (PV/W)' az égési nyomás (P) és az eszköz térfogat (V) szorzata osztva az össztömeggel (W).

c. Fúvókák 45 kN-t meghaladó tolóerővel vagy 0,075 mm/s-nál kisebb fúvótorok-kopási sebességgel;

d. Mozgatható fúvókák, vagy másodlagos fluidinjektoros tolóerővektor szabályozó rendszerek, amelyek képesek a következők bármelyikére: 1. A tetszőleges tengelymozgás meghaladja a ± 5o-ot; 2. 20o/s vagy nagyobb szögsebességvektor-forgás; vagy 3. 40o/s2 vagy nagyobb szögsebesség vektorgyorsulás.

9A009Hibrid rakétameghajtó rendszerek, amelyek rendelkeznek a következők bármelyikével:

N.B. LÁSD MÉG: 9A109 és 9A119.

a. 1,1 MNs feletti teljes impulzuskapacitás; vagy

b. A tolóerő a vákuumba történő kilépés körülményei között mérve nagyobb, mint 220 kN.

9A010Kifejezetten hordozórakétához, hordozórakéta-meghajtórendszerekhez vagy "űreszközhöz" tervezett alkatrészek, rendszerek vagy szerkezetek, az alábbiak szerint:

N.B. LÁSD MÉG: 1A002 és 9A110.

a. 10 kg tömeget meghaladó és kifejezetten az alábbi anyagok felhasználásával gyártott hordozórakétákhoz tervezett alkatrészek és szerkezetek: 1. Az 1C010.e. pontban meghatározott "rostos vagy szálas anyagokból", valamint az 1C008 vagy 1C009.b. alatt meghatározott gyantákból álló "kompozit" anyagok; 2. Fém-"mátrix" "kompozit", az alábbiak valamelyikével megerősítve: a. Az 1C007. alatt meghatározott anyagok; b. Az 1C010 alatt meghatározott "rostos vagy szálas anyagok"; vagy c. Az 1C002.a. pontban meghatározott aluminidek; vagy 3. Az 1C007 pontban meghatározott kerámia-"mátrix" "kompozit" anyagok; Megjegyzés : A tömeghatárt az orrkúpoknál nem kell figyelembe venni.

b. Kifejezetten a 9A005-9A009 alatt meghatározott hordozórakéta-meghajtórendszerekhez tervezett, az alábbiak bármelyikének felhasználásával gyártott alkatrészek és szerkezetek: 1. Az 1C010.e. pontban meghatározott "rostos vagy szálas anyagok", valamint az 1C008 vagy 1C009.b. alatt meghatározott gyanták; 2. Fém-"mátrix" "kompozit", az alábbiak valamelyikével megerősítve: a. Az 1C007. alatt meghatározott anyagok; b. Az 1C010 alatt meghatározott "rostos vagy szálas anyagok"; vagy c. Az 1C002.a. pontban meghatározott aluminidek; vagy 3. Az 1C007 pontban meghatározott kerámia-"mátrix" "kompozit" anyagok;

c. Kifejezetten az "űreszköz" szerkezetek alakváltozásának, vagy dinamikus reakciójának aktív ellenőrzésére tervezett szerkezeti alkatrészek és szigetelő rendszerek;

d. Pulzáló folyékony hajtóanyagú rakétahajtóművek, amelyeknek tolóerő/tömeg aránya eléri vagy meghaladja az 1 kN/kg-ot, és a ‘válaszideje' kevesebb, mint 30 ms. Műszaki megjegyzés : A 9A010.d. alkalmazásában ‘válaszidő': az az idő, amely indulástól a teljes névleges nyomaték 90 %-ának eléréséig eltelik.

9A011Torlósugár, szuperszonikus sebességű torlósugaras vagy ‘kombinált ciklusú hajtóművek' és a kifejezetten ezekhez tervezett alkatrészek.

N.B. LÁSD MÉG: 9A111 és 9A118.

Műszaki megjegyzés :

A 9A011. alkalmazásában a ‘kombinált ciklusú hajtóművek' a következő hajtóműtípusok közül kettőt vagy többet kombinálnak:

- Gázturbinás sugárhajtómű (turbó-sugárhajtómű, turbólégcsavaros hajtómű és turbóventillátoros hajtómű);

- Torlósugaras vagy szuperszonikus sebességű torlósugaras hajtómű;

- Rakétamotor vagy -hajtómű (folyékony/gél állapotú/szilárd hajtóanyaggal meghajtott és hibrid)

9A012"Pilóta nélküli légijárművek" ("UAV"-k), pilóta nélküli "léghajók", valamint az ezekhez kapcsolódó rendszerek, berendezések és alkatrészek:

N.B.1. LÁSD MÉG: 9A112.

N.B.2. Azon "UAV"-k esetében, amelyek "szuborbitális járművek", lásd: 9A004.h.

a. Az ‘operátor' közvetlen ‘természetes látóhatárán' kívüli ellenőrzött repülésre tervezett "UAV"-k vagy pilóta nélküli "léghajók", amelyek rendelkeznek az alábbiak valamelyikével: 1. Rendelkezik a következők mindegyikével: a. legalább 30 perc, de kevesebb, mint egy óra maximális ‘üzemidő'; valamint b. úgy tervezték, hogy 46,3 km/h (25 csomó) vagy annál nagyobb széllökések esetén is fel tudjanak szállni, és stabilan, irányítottan tudjanak repülni; vagy 2. 1 órás vagy annál nagyobb maximális ‘üzemidő'; Műszaki megjegyzések : 1. A 9A012.a. alkalmazásában, az ‘operátor' az a személy, aki az "UAV" vagy pilóta nélküli "léghajó" repülését elindítja vagy irányítja. 2. A 9A012.a. alkalmazásában az ‘üzemidőt' az International Standard Atmospherere (Nemzetközi Egyezményes Légkör) feltételekre kell kiszámítani (ISO 2533:1975) tengerszinten, szélcsendben. 3. A 9A012.a. alkalmazásában, a ‘természetes látóhatár' segítség nélküli emberi látásra vonatkozik, korrekciós lencsével, vagy anélkül.

b. Kapcsolódó berendezések és alkatrészek, az alábbiak szerint: 1. Nem használt; 2. Nem használt; 3. Kifejezetten a pilótával rendelkező "légi járművek" vagy pilótával rendelkező "léghajók" 9A012.a. pontban meghatározott "UAV"-vá vagy pilóta nélküli "léghajóvá" történő átalakítására tervezett berendezések vagy alkatrészek; 4. Légbeszívásos reciprok vagy forgó belső égésű motortípusok, amelyeket kifejezetten "UAV"-k vagy pilóta nélküli "léghajók" 15 240 m (50 000 láb) feletti meghajtására terveztek vagy módosítottak.

9A101A 9A001 alatt meghatározottaktól eltérő, turbó sugárhajtóművek és turbó légcsavaros hajtóművek, ideértve a következőket:

a. Hajtóművek, amelyek rendelkeznek az alábbi jellemzők mindegyikével: 1. ‘Maximális tolóerejük' meghaladja a 400 N-t, kivéve azokat a polgárinak minősített hajtóműveket, amelyek legnagyobb nyomatéka meghaladja a 8 890 Nt; 2. Fajlagos üzemanyag-fogyasztásuk 0,15 kg N-1 h-1 vagy annál kisebb; 3. ‘Száraz tömegük' 750 kg-nál kisebb; valamint 4. ‘Első rotorátmérőjük' 1 m-nél kisebb; Műszaki megjegyzések : 1. A 9A101.a.1 alkalmazásában ‘maximális tolóerő': a gyártó által a hajtóműtípusra vonatkozóan tengerszinten, statikus körülmények között, az egyezményes légkör felhasználásával igazolt beszerelés előtti maximális nyomaték. A polgári típusalkalmassági bizonyítvánnyal tanúsított nyomaték a beszerelés előtti motortípusra vonatkozóan a gyártó által bemutatott maximális tolóerővel megegyező vagy annál kisebb. 2. A fajlagos üzemanyag-fogyasztás meghatározása a hajtóműtípusra vonatkozóan tengerszinten, statikus körülmények között, az egyezményes légkör felhasználásával, maximális állandó tolóerő mellett, beszerelés előtt történik. 3. ‘Száraz tömeg': a hajtómű folyadékok (tüzelőanyag, hidraulikafolyadék, kenőolaj stb.) és a hajtóműgondola (ház) nélküli tömege. 4. ‘Első rotorátmérő': a hajtómű első forgó elemének (ventilátor vagy kompresszor) átmérője a lapátcsúcsok belépő élénél mérve.

b. "Rakétákban" történő felhasználásra tervezett vagy átalakított motorok, vagy a 9A012 vagy a 9A112.a. alatt meghatározott pilóta nélküli légijárművek.

9A102A 9A012 vagy a 9A112.a. alatt meghatározott pilóta nélküli légijárművekhez tervezett ‘turbólégcsavaros motorrendszerek', és a kifejezetten azokhoz tervezett alkatrészek, amelyek ‘maximális teljesítménye' a 10 kW-ot meghaladja.

Megjegyzés : A 9A102 nem vonja ellenőrzés alá a tanúsítvánnyal rendelkező polgári motorokat.

Műszaki megjegyzések :

1. A 9A102 alkalmazásában a ‘turbólégcsavaros motorrendszerek' magukban foglalják az alábbiak mindegyikét:

a. szabadtengelyű hajtómű; valamint

b. erőátviteli rendszer a tolóerőnek a légcsavarhoz való átviteléhez.

2. A 9A102 alkalmazásában a ‘maximális teljesítmény' leszerelt helyzetben tengerszinten, statikus körülmények között, az egyezményes légkör felhasználásával elért legnagyobb teljesítmény.

9A104Rakétaszondák legalább 300 km hatótávolsággal.

N.B. LÁSD MÉG: 9A004.

9A105Folyékony hajtóanyagú rakétamotorok, vagy gél állapotú rakétahajtóművek, ideértve a következőket:

N.B. LÁSD MÉG: 9A119.

a. A 9A005 alatt meghatározottaktól eltérő, "rakétákban" felhasználható folyékony hajtóanyagú rakétamotorok vagy gél állapotú rakétahajtóművek, amelyeket legalább 1,1 MNs teljes impulzuskapacitású, folyékony vagy gél állapotú hajtóanyaggal működő meghajtórendszerekbe építettek be, vagy ilyen rendszerekbe történő beépítésre terveztek vagy módosítottak;

b. A 9A005 vagy 9A105.a. alatt meghatározottaktól eltérő, 300 km hatótávolságú teljes rakétarendszerekben vagy pilóta nélküli légi járművekben felhasználható folyékony hajtóanyagú rakétamotorok, vagy gél állapotú rakétahajtóművek, amelyeket legalább 0,841 MNs teljes impulzuskapacitású, folyékony vagy gél állapotú hajtóanyaggal működő meghajtórendszerekbe építettek be, vagy ilyen rendszerekbe történő beépítésre terveztek vagy módosítottak.

9A106A 9A006 alatt meghatározottaktól eltérő rendszerek és alkatrészek, amelyeket kifejezetten folyékony rakétahajtóanyag-rendszerekhez terveztek, az alábbiak szerint:

a. Nem használt;

b. Nem használt;

c. "Rakétákban" használható tolóerővektor vezérlő alrendszerek; Műszaki megjegyzés : Példák a 9A106.c. alatt meghatározott tolóerővektoros vezérlés módszereire: 1. rugalmas fúvóka; 2. folyadék vagy másodlagos gázinjektálás; 3. mozgatható hajtómű vagy fúvóka; 4. tolósugár áramlásának eltérítése (sugáreltérítő síkok vagy szondák); vagy 5. tolóerő-szabályzó lapok.

d. Folyékony, sűrű szuszpenziójú és gél állapotú rakétahajtóanyagok (az oxidálóanyagokkal együtt) "rakétákban" felhasználható vezérlőrendszerei, valamint a kifejezetten ezekhez tervezett alkatrészek, amelyeket abból a célból terveztek vagy alakítottak át, hogy 10 g négyzetes középértéket (rms) meghaladó vibrációs környezetben 20 Hz és 2 kHz közötti tartományban üzemeljenek; Megjegyzés : A 9A106.d. csak a következő szervószelepeket, szivattyúkat és gázturbinákat határozza meg: a. 7 MPa vagy annál nagyobb abszolút nyomás mellett percenkénti 24 literrel egyenlő vagy annál nagyobb áramlási sebességre tervezett szervószelepek, amelyek 100 ms-nál rövidebb működtetési reakcióidővel rendelkeznek; b. Folyékony hajtóanyaghoz használt szivattyúk, amelyeknek a tengelyfordulatszáma maximális üzemmódban 8 000 ford/perc vagy nagyobb, kilépő nyomásuk pedig 7 MPa vagy nagyobb. c. Gázturbinák folyékony hajtóanyaghoz használt turbószivattyúkhoz, amelyek tengelyfordulatszáma maximális üzemmódban 8 000 ford/perc vagy nagyobb.

e. Égőterek és fúvókák a 9A005 vagy 9A105 alatt meghatározottak folyékony hajtóanyagú rakétamotorokhoz vagy gél állapotú rakétahajtóművekhez.

9A107A 9A007 alatt meghatározottaktól eltérő, teljes rakétarendszerekben vagy pilóta nélküli légijárművekben felhasználható szilárd hajtóanyagú rakétahajtóművek, amelyek hatósugara 300 km és teljes impulzuskapacitása 0,841 MNs-mal egyenlő vagy annál nagyobb.

N.B. LÁSD MÉG: 9A119.

9A108A 9A008 alatt meghatározottaktól eltérő alkatrészek, amelyeket kifejezetten szilárd és hibrid rakétahajtóművekhez terveztek, az alábbiak szerint:

a. A 9A007, 9A009, 9A107 vagy 9A109.a. alatt meghatározott alrendszerekben felhasználható rakétahajtómű-házak, valamint az ezekhez tartozó "szigetelő" alkatrészek;

b. A 9A007, 9A009, 9A107 vagy 9A109.a. alatt meghatározott alrendszerekben felhasználható rakétafúvókák;

c. "Rakétákban" használható tolóerővektor vezérlő alrendszerek; Műszaki megjegyzés : Példák a 9A108.c. alatt meghatározott tolóerő-vektoros vezérlés módszereire: 1. rugalmas fúvóka; 2. folyadék vagy másodlagos gázinjektálás; 3. mozgatható hajtómű vagy fúvóka; 4. tolósugár áramlásának eltérítése (sugáreltérítő síkok vagy szondák); vagy 5. tolóerő-szabályzó lapok.

9A109Hibrid rakétahajtóművek és a kifejezetten hozzájuk tervezett alkatrészek, az alábbiak szerint:

a. Teljes rakétarendszerekben és pilóta nélküli légijárművekben felhasználható, legalább 300 km-es hatótávolságú, a 9A009 alatt meghatározottaktól eltérő hibrid rakétahajtóművek 0,841 MNs-mal egyenlő vagy annál nagyobb teljes impulzuskapacitással, valamint a kifejezetten hozzájuk tervezett alkatrészek;

b. Kifejezetten a 9A009. alatt meghatározott hibrid rakétahajtóművekhez tervezett, "rakétákban" használható alkatrészek.

N.B. LÁSD MÉG: 9A009 és 9A119.

9A110A 9A010 alatt meghatározottaktól eltérő kompozit szerkezetek, rétegelt anyagok és ezekből készült termékek, amelyeket kifejezetten ‘rakétákban', illetve a 9A005, 9A007, 9A105, 9A106.c., 9A107., 9A108.c., 9A116 vagy 9A119 alatt meghatározott alrendszerekben történő felhasználásra terveztek.

N.B. LÁSD MÉG: 1A002.

Műszaki megjegyzés :

A 9A110 alatt a ‘rakéta' 300 km-t meghaladó hatótávolságú teljes rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent.

9A111"Rakétákban" vagy a 9A012 vagy 9A112.a. alatt meghatározott, pilóta nélküli légijárművekben felhasználható rezgőszelepes torlósugár-hajtóművek vagy lüktető sugárhajtóművek és a kifejezetten ezekhez tervezett alkatrészek.

N.B. LÁSD MÉG: 9A011 és 9A118.

Műszaki megjegyzés :

A 9A111 alkalmazásában a lüktető sugárhajtóművek robbanás útján növelik az effektív nyomást az égetőkamrában. A lüktető sugárhajtóművek közé tartoznak különösen a következők: rezgőszelepes torlósugár-hajtóművek, rotációs sugárhajtóművek vagy folyamatos hullámú sugárhajtóművek.

9A112A 9A012 alatt meghatározottaktól eltérő "pilóta nélküli légijárművek" ("UAV"-k), az alábbiak szerint:

a. 300 km-es hatósugarat elérő "pilóta nélküli légijárművek" ("UAV"-k);

b. "Pilóta nélküli légijárművek" ("UAV"-k), amelyek rendelkeznek az összes alábbi tulajdonsággal: 1. Rendelkeznek az alábbiak bármelyikével: a. Autonóm repülésirányítási és navigációs képesség; vagy b. Egy emberi operátor látóhatárán kívül történő ellenőrzött repülésre való képesség; valamint 2. Rendelkeznek az alábbiak bármelyikével: a. 20 litert meghaladó kapacitású aeroszol-adagoló rendszer/mechanizmus; vagy b. 20 litert meghaladó kapacitású aeroszolelosztó rendszer/mechanizmus beépítésére tervezték vagy alakították át. Műszaki megjegyzések : 1. Az aeroszol részecskékből vagy üzemanyag-alkotórészektől, melléktermékektől vagy adalékanyagoktól különböző folyadékokból áll, amely a rakomány részeként szétszóródik a légkörben. Aeroszol például a növénypermetezéshez használt növényvédő szer és a mesterséges csapadékképzéshez használt száraz vegyszer. 2. Az aeroszolelosztó rendszer/mechanizmus részét képezik azok a - mechanikus, elektromos, hidraulikus stb. - eszközök, amelyek az aeroszol tárolásához és légkörbe juttatásához szükségesek. Idetartozik az aeroszol befecskendezésének lehetősége az égéstermékgázba és a légcsavarszélbe.

9A115Indítást biztosító berendezések, az alábbiak szerint:

a. Kezelésre, ellenőrzésre, aktiválásra vagy indításra szolgáló készülékek és berendezések, amelyeket a 9A004 alatt meghatározott űrhajózási hordozórakétákhoz, a 9A104 alatt meghatározott kutatórakétákhoz, vagy ‘rakétákhoz' terveztek vagy alakítottak át; Műszaki megjegyzés : A 9A115.a. alkalmazásában ‘rakéta': 300 km-t meghaladó hatótávolságú teljes rakétarendszer és pilóta nélküli légijármű-rendszer.

b. Szállításra, kezelésre, ellenőrzésre, aktiválásra vagy indításra szolgáló járművek, amelyeket a 9A004 alatt meghatározott űrhajózási hordozórakétákhoz, a 9A104 alatt meghatározott rakétaszondákhoz, illetve "rakétákhoz" terveztek vagy alakítottak át.

9A116"Rakétákban" felhasználható visszatérő egységek, és az ezekhez tervezett vagy átalakított berendezések, az alábbiak szerint:

a. visszatérő egységek;

b. kerámiából vagy hőfelvevő anyagból készült hőpajzsok és azok alkatrészei;

c. kistömegű, nagy hőkapacitású anyagokból készült hőelnyelők és azok alkotórészei;

d. kifejezetten visszatérő egységekhez tervezett elektronikus berendezések.

9A117"Rakétákban" felhasználható indító és leválasztó berendezések és közbülső fokozatok.

N.B. LÁSD MÉG 9A121.

9A118"Rakétákban" vagy a 9A012 vagy 9A112.a. alatt meghatározott, pilóta nélküli légi járművekben felhasználható, a 9A011 vagy a 9A111 alatt meghatározott motorok belső égését szabályozó eszközök.

9A119A 9A005, 9A007, 9A009, 9A105, 9A107 és 9A109 alatt meghatározottaktól eltérő, 300 km hatótávolságú teljes rakéta rendszerekben vagy pilóta nélküli légi járművekben felhasználható egyedi rakétafokozatok.

9A120Azok a 9A006 alatt meghatározottaktól eltérő, legalább 500 kg rakomány legalább 300 km-es távolságra való eljuttatására alkalmas rakétarendszerekben használt folyékony vagy gél állapotú rakéta-hajtóanyag tartályok, amelyeket kifejezetten az 1C111 alatt meghatározott hajtóanyagokhoz vagy ‘egyéb folyékony vagy gél állapotú hajtóanyagokhoz' terveztek.

Megjegyzés : A 9A120 alatt említett ‘egyéb folyékony vagy gél állapotú hajtóanyagok' kifejezés magában foglalja a KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKÉBEN szereplő hajtóanyagokat, de nem korlátozódik azokra.

9A121A kifejezetten a 9A004-ben meghatározott űrhajózási hordozó"rakétákhoz" vagy a 9A104 pontban meghatározott rakétaszondákhoz tervezett köldökzsinór és közbülső elektromos konnektorok.

Műszaki megjegyzés :

A 9A121 alatt említett közbülső konnektorok magukban foglalják a "rakéták", űrhajózási hordozórakéták vagy rakétaszondák, illetve hasznos terhet alkotó berendezéseik között telepített elektronikus konnektorokat is.

9A350Permetező vagy ködképző rendszerek, amelyeket kifejezetten úgy terveztek vagy módosítottak, hogy megfeleljenek a repülőgépeknek, "a levegőnél könnyebb légi járművek"-nek vagy a pilóta nélküli légijárműveknek, valamint a kifejezetten ezekhez tervezett, következő alkotórészek:

a. Teljes permetező vagy ködképző rendszerek, amelyek képesek egy folyadékszuszpenzióból percenként két liternél nagyobb áramlási sebességgel 50 μm-nél kisebb ‘VMD'-jű kezdeti cseppek előállítására;

b. Aeroszolgeneráló egységek permetelosztó szárnyvezetéke vagy -konzolja, amely képes egy folyadékszuszpenzióból percenként két liternél nagyobb áramlási sebességgel 50 μm-nél kisebb ‘VMD'-jű kezdeti cseppek előállítására;

c. Olyan aeroszolgeneráló egységek, amelyeket kifejezetten a 9A350.a. és b. alatt meghatározott rendszerekhez terveztek. Megjegyzés : Az aeroszolgeneráló egységek olyan berendezések - például fúvókák, forgódobos porlasztók és ezekhez hasonló berendezések -, amelyeket kifejezetten úgy terveztek vagy módosítottak, hogy légi járművekre szerelhetőek legyenek.

Megjegyzés : A 9A350. nem vonja ellenőrzés alá azokat a permetező és ködképző rendszereket és alkotórészeket, amelyek bizonyítottan nem alkalmasak biológiai szer előállítására kórokozótartalmú aeroszol formájában.

Műszaki megjegyzések :

1. A kifejezetten repülőgépekhez, "a levegőnél könnyebb légi járművek"-hez vagy a pilóta nélküli légijárművekhez tervezett permetezőberendezések vagy fúvókák esetében a cseppméret a következő módszerek valamelyikével mérendő:

a. lézer-Doppler módszer;

b. lézerdiffrakciós módszer.

2. A 9A350. pontban a ‘VMD' a Volume Median Diameter-t (térgogati középátmérőt) jelenti, és a vízalapú rendszerek esetében ez megegyezik a Mass Median Diameter-rel (tömeg-középátmérő) (MMD).

9BVizsgáló-, ellenőrző és gyártó berendezések

9B001Gyártó berendezés, szerszámok vagy tartozék, az alábbiak szerint:

N.B. LÁSD MÉG: 2B226.

a. "Szuperötvözetekhez" tervezett, irányított kristályosítást végző vagy egykristálynövesztő öntőberendezés;

b. Kifejezetten gázturbinás hajtóművek lapátjai, terelőlapátok vagy öntött "lapátvégtömítések" gyártására tervezett, tűzálló fémből vagy kerámiából gyártott öntőszerszámok, az alábbiak szerint: 1. Magok 2. Héjak (öntőformák) 3. Kombinált mag és héj (öntőforma) egységek

c. "Szuperötvözetekhez" tervezett, irányított kristályosítást végző vagy egykristálynövesztő, additív gyártási technológiát alkalmazó berendezés;

9B002Online (valós idejű) vezérlőrendszerek, eszközök (a szenzorokat is beleértve) vagy automata adatvevő és feldolgozó berendezések, amelyek az összes alábbi jellemzővel rendelkeznek:

a. Kifejezetten gázturbina motorok, szerelvények vagy alkatrészek "fejlesztéséhez" tervezték; valamint

b. A 9E003.h. vagy a 9E003.i. pontban meghatározott "technológiák" bármelyikét alkalmazza;

9B003Kifejezetten a 335 m/s-t meghaladó kerületi sebességen és 773 K-t (500 °C) meghaladó hőmérsékleten történő üzemelésre tervezett kefés gázturbina-tömítések "gyártására" vagy vizsgálatára tervezett berendezés, és a kifejezetten ehhez tervezett alkatrészek vagy tartozékok.

9B004A 9E003.a.3., vagy 9E003.a.6. alatt meghatározott "szuperötvözet" titán vagy intermetallikus szárnyszelvény-lemez kombinációk szilárd csatlakoztatására szolgáló szerszámok, matricák vagy rögzítőelemek gázturbinákhoz.

9B005Online (valósidejű) vezérlőrendszerek, eszközök (a szenzorokat is beleértve) vagy automata adatgyűjtő és feldolgozó berendezések, amelyeket kifejezetten a következők valamelyikével való felhasználásra terveztek:

N.B. LÁSD MÉG: 9B105.

a. 1,2 Mach vagy annál nagyobb sebességre tervezett szélcsatornák; Megjegyzés : A 9B005.a. nem alkalmazandó a kifejezetten oktatási célokat szolgáló szélcsatornákra, amelyek 250 mm-nél kisebb (belső méretű) ‘tesztszakaszmérettel' rendelkeznek; Műszaki megjegyzés : A ‘tesztszakaszméret' a tesztszakasz legnagyobb keresztmetszeténél a kör átmérője, vagy a négyzet oldala, vagy a téglalap hosszabbik oldala.

b. 5 Mach fölötti áramlási környezetek szimulálására szolgáló készülékek, ideértve a hot-shot csatornákat, plazmaív csatornákat, rázócsöveket, rázócsatornákat, gázcsatornákat és könnyűgáz-ágyúkat; vagy

c. Szélcsatornák vagy készülékek - kivéve a kétdimenziós (2D) szakaszúakat - amelyek alkalmasak 25 × 106-t meghaladó Reynolds számú áramlás szimulálására.

9B006Akusztikai vibrációs vizsgálókészülék, amely 160 dB és annál nagyobb hangnyomásszintet képes biztosítani (referencia 20 μPa), minimum 4 kW névleges kimenő-teljesítménnyel, ha a vizsgáló cella hőmérséklete meghaladja az 1 273 K-t, (1 000 °C), és a kifejezetten ehhez tervezett kvarc hevítők.

N.B. LÁSD MÉG: 9B106.

9B007Kifejezetten rakétamotorok integritásának roncsolásmentes (NDT) vizsgálatára tervezett berendezés, kivéve a planáris röntgensugaras vagy alapvető fizikai és vegyi elemzési technikákat alkalmazó berendezéseket.

9B008Közvetlen falfelületi súrlódást mérő jelátalakítók, amelyeket kifejezetten a vizsgáló áramlás 833 K (560 °C) feletti stagnálási összhőmérsékletén történő működésre terveztek.

9B009Kifejezetten porkohászati turbinamotor rotoralkatrészek gyártására tervezett eszközök, amelyek rendelkeznek az alábbi jellemzők mindegyikével:

a. 873 K (600 °C) hőmérsékleten mérve a szakítószilárdság (UTS) min. 60 %-os, vagy annál nagyobb feszültségszintjén és legalább való üzemelésre tervezték őket; valamint

b. 873 K (600 °C) vagy annál magasabb hőmérsékleten való üzemelésre tervezték őket.

Megjegyzés : A 9B009 nem vonja ellenőrzés alá a porok gyártására szolgáló eszközöket.

9B010Kifejezetten a 9A012 által ellenőrzés alá vont termékek "gyártására" tervezett berendezések.

9B1050,9 Mach vagy annál nagyobb sebességű légáram előállítására szolgáló, ‘rakétákhoz' és azok alrendszereihez alkalmazható ‘aerodinamika-tesztelő létesítmények',

N.B. LÁSD MÉG: 9B005.

Megjegyzés : A 9B105 nem vonja ellenőrzés alá a 3 Mach vagy annál kisebb sebességre tervezett, 250 mm vagy annál kisebb ‘tesztkeresztmetszet mérettel' rendelkező szélcsatornákat.

Műszaki megjegyzések :

1. A 9B105 alatt szereplő ‘aerodinamika-tesztelő létesítmények' magukban foglalják a tárgyak fölötti levegőáramlás tanulmányozását szolgáló szélcsatornákat és rázócsatornákat.

2. A 9B105-höz tartozó megjegyzésben a ‘teszt-keresztmetszet mérete' a tesztszakasz legnagyobb keresztmetszeténél a kör átmérője, a négyzet oldala, a téglalap hosszabbik oldala vagy az ellipszis nagyobbik átmérője. A ‘tesztkeresztmetszet' az áramlás irányára merőleges metszet.

3. A 9B105 alkalmazásában ‘rakétának' minősül minden olyan teljes rakétarendszer és pilóta nélküli légijármű, amelynek hatótávolsága legalább 300 km.

9B106Szabályozott környezetet biztosító kamrák és visszhangmentes kamrák, az alábbiak szerint:

a. Az alábbiak mindegyikével rendelkező, szabályozott környezetet biztosító kamrák: 1. Az alábbi repülési feltételek mindegyikének modellezésére képesek: a. 15 km vagy annál nagyobb magasság; vagy b. 223 K (- 50 °C) alattitól 398 K (+ 125 °C) felettiig terjedő hőmérséklet; valamint 2. Rázóegységet vagy egyéb rázó, vibrációs környezet kialakítására képes vizsgálati berendezést tartalmazó, vagy'arra tervezett vagy módosított', ‘csupasz asztalon' mérve 10 g-vel egyenlő vagy annál nagyobb négyzetes középértéket (rms) biztosító vibrációs környezet 20 Hz és 2 kHz közötti tartományban, legalább 5 kN erőhatás mellett; Műszaki megjegyzések : 1. A 9B106.a.2. olyan rendszereket ír le, amelyek képesek egyetlen hullám-összetevővel (pl. szinuszhullám) vibrációs környezetet gerjeszteni, és olyan rendszereket, amelyek képesek szélessávú véletlenszerű vibrációt gerjeszteni (pl. teljesítmény spektrum); 2. A 9B106.a.2. pontban az ‘arra tervezett vagy módosított' kifejezés azt jelenti, hogy az adott környezetet biztosító kamra megfelelő interfészekkel (pl. szigetelő eszköz) rendelkezik ahhoz, hogy rázó egységet vagy a 2B116 pontban meghatározott rázó vizsgálati berendezést tartalmazzon. 3. A 9B106.a.2. alatt a ‘csupasz asztal' olyan sima, lapos asztalt vagy felületet jelent, amelyen nincs semmilyen illeszték vagy szerelvény.

b. A következő repülési körülmények modellezésére képes, szabályozott környezetet biztosító kamrák: 1. 140 dB vagy azt meghaladó (referencia 20 μPa) teljes hangnyomási szintet vagy 4 kW vagy azt meghaladó teljes névleges akusztikus kimenő-teljesítményt biztosító akusztikus környezet; valamint 2. 15 km vagy annál nagyobb magasság; vagy 3. 223 K (- 50 °C) alattitól 398 K (+ 125 °C) felettiig terjedő hőmérséklet.

9B107A ‘rakétákhoz', ‘rakétahajtóművekhez', valamint a 9A116 alatt meghatározott visszatérő egységekhez és felszereléshez használható ‘aerotermodinamikai tesztelő létesítmények', amelyek rendelkeznek az alábbi jellemzők valamelyikével:

a. Villamosáram-ellátás legalább 5 MW; vagy

b. A gázellátás teljes nyomása legalább 3 MPa;

Műszaki megjegyzések :

1. Az ‘aerotermodinamikai tesztelő létesítmények' magukban foglalják a levegőáram tárgyakra gyakorolt hő- és mechanikus hatásának tanulmányozására szolgáló plazmaívsugaras létesítményeket és a plazmás szélcsatorna-létesítményeket.

2. A 9B107 alkalmazásában ‘rakétának' minősül minden olyan teljes rakétarendszer és pilóta nélküli légijármű, amelynek hatótávolsága legalább 300 km.

9B115Kifejezetten a 9A005-9A009, 9A011, 9A101, 9A102, 9A105-9A109, 9A111, 9A116-9A120 alatt meghatározott rendszerekhez, alrendszerekhez és alkatrészekhez tervezett "gyártó berendezések".

9B116Kifejezetten a 9A004 alatt meghatározott űrhajózási hordozórakétákhoz, vagy a 9A005-9A009, 9A011, 9A101, 9A102, 9A104-9A109, 9A111, valamint 9A116-9A120 alatt meghatározott rendszerekhez, alrendszerekhez és alkatrészekhez vagy ‘rakétákhoz' tervezett "gyártó létesítmények".

Műszaki megjegyzés :

A 9B116 alkalmazásában a ‘rakéta' 300 km-t meghaladó hatótávolságú teljes rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent.

9B117Szilárd vagy folyékony meghajtású rakétákhoz vagy rakétamotorokhoz való próbapadok vagy állványok, amelyek rendelkeznek a következő jellemzők bármelyikével:

a. Képesek 68 kN-t meghaladó tolóerőt kezelni; vagy

b. Képesek három tengelyirányú tolóerő-összetevőt egy időben mérni.

9CAnyagok

9C108A 9A008 pont alatt meghatározottaktól eltérő "szigetelő" anyag ömlesztett formában, valamint "belső bélelés", a "rakétákban" használható rakétahajtómű-házakhoz, vagy kifejezetten a 9A007 vagy 9A107 pont alatt meghatározott szilárd hajtóanyagú rakétamotorokhoz tervezve.

9C110A 9A110 alatt meghatározott kompozit szerkezetekhez, rétegelt anyagokhoz és termékekhez szál vagy rost erősítésű szerves mátrixból vagy fém mátrixból készített, műgyantával impregnált szálerősítésű prepreg, és az azokhoz készített fém bevonatú szálak, amelyek "fajlagos szakítószilárdsága" nagyobb, mint 7,62 × 104 m és a "fajlagos modulusa" nagyobb, mint 3,18 × 106 m.

N.B. LÁSD MÉG: 1C010 és 1C210.

Megjegyzés : A 9C110 csak azokat a műgyantával impregnált szálerősítésű prepregeket határozza meg, amelyeknél olyan műgyantát használnak, amelynek a kezelés utáni üvegesedési hőmérséklete (Tg) 418 K (145 °C) felett van az ASTM D4065 vagy annak megfelelő szabvány előírása szerint.

9DSzoftver

9D001A kifejezetten a 9A001-9A119, a 9B vagy a 9E003 alatt meghatározott berendezések vagy "technológia" "fejlesztéséhez" tervezett vagy átalakított, a 9D003 vagy a 9D004 alatt nem meghatározott "szoftver".

9D002A kifejezetten a 9A001-9A119 vagy a 9B alatt meghatározott berendezések "gyártásához" tervezett vagy átalakított, a 9D003 vagy a 9D004 alatt nem meghatározott "szoftver".

9D003A 9E003.h. alatt meghatározott "technológiát" alkalmazó, és a 9A. alatt meghatározott rendszerek "FADEC-rendszereiben" vagy a 9B. alatt meghatározott berendezésekben használt "szoftver".

9D004Egyéb "szoftver", az alábbiak szerint:

a. A részletes motormodellezéshez szükséges szélcsatornával vagy repülési vizsgálati adatokkal hitelesített két- vagy háromdimenziós viszkózus "szoftver";

b. "Szoftver" gázturbinás sugárhajtóművek, szerelvények vagy alkatrészek vizsgálatához, amely a következő jellemzők mindegyikével rendelkezik: 1. Kifejezetten a következők valamelyikének vizsgálatához tervezték: a. Olyan gázturbinás sugárhajtóművek, szerelvények vagy alkatrészek, amelyek a 9E003.a., a 9E003.h. vagy a 9E003.i. alatt meghatározott "technológiát" tartalmazzák; vagy b. Kifejezetten a 9E003.a. vagy a 9E003.h. alatt meghatározott "technológiát" tartalmazó gázturbinás sugárhajtóművekhez tervezett, segéd- vagy fő áramlást biztosító többfokozatú kompresszorok; valamint 2. Kifejezetten az alábbiak mindegyikére tervezték: a. Valós idejű adatbeolvasás és adatfeldolgozás; valamint b. A vizsgált darab vagy a vizsgálati körülmények (például hőmérséklet, nyomás, áramlási sebesség) visszacsatolásos vezérlése a vizsgálat közben; Megjegyzés : A 9D004.b nem vonja ellenőrzés alá a vizsgálólétesítmény üzemeltetését vagy a vizsgálószemélyzet biztonságát szolgáló szoftvert (például leállítás a sebességhatár túllépése esetén, tűz észlelése és oltása), sem pedig a gyártás, a javítás vagy a karbantartás utáni átvételi vizsgálathoz készült szoftvert, amennyiben az kizárólag annak meghatározására szolgál, hogy a vizsgált darabot helyesen szerelték-e össze vagy javították-e meg.

c. Kifejezetten a 9B001.a. vagy 9B001.c. alatt meghatározott berendezésekben való irányított kristályosításra vagy egykristályok növesztése tervezett "szoftver";

d. Nem használt;

e. Kifejezetten a 9A012 alatt meghatározott berendezések "működtetéséhez" tervezett vagy átalakított "szoftver".

f. Kifejezetten a légi gázturbinalapátok, terelőlapátok és "lapátvégtömítések" belső hűtőcsatornájának tervezésére tervezett "szoftver";

g. Az összes alábbi tulajdonsággal rendelkező "szoftver": 1. Kifejezetten gázturbinás sugárhajtóművek aerotermikus, aeromechanikus és belsőégési feltételeinek előrejelzésére tervezték; valamint 2. Az aerotermikus, aeromechanikus és belsőégési feltételekről elméleti modell előrejelzéseket nyújt, amelyeket gázturbinás sugárhajtóművek tényleges (kísérleti vagy gyártási) teljesítményadataival összevetve validáltak.

9D005Kifejezetten a 9A004.e. vagy 9A004.f. alatt meghatározott berendezések működtetéséhez tervezett vagy átalakított "szoftver".

N.B. A 9A004.d. alatt felsorolt, az "űreszköz hasznos terhébe" beletartozó elemekhez kapcsolódó "szoftverre" vonatkozó információkért lásd a megfelelő kategóriákat.

9D101Kifejezetten a 9B105, 9B106, 9B116, vagy 9B117 alatt meghatározott termékek "felhasználásához" tervezett vagy átalakított "szoftver".

9D103Kifejezetten a 9A004 alatt meghatározott űrhajózási hordozórakéták, a 9A104 alatt meghatározott rakétaszondák, a 9A005, 9A007, 9A105, 9A106.c., 9A107, 9A108.c., 9A116 vagy 9A119 alatt meghatározott "rakéták" vagy alrendszerek modellezésére, szimulálására vagy tervezésintegrációjára tervezett "szoftver".

Megjegyzés : A 9D103 alatt meghatározott "szoftver" ellenőrzés alatt marad, ha a 4A102 alatt meghatározott speciálisan tervezett hardverrel kombinálják.

9D104"Szoftver" az alábbiak szerint:

a. Kifejezetten a 9A001, 9A005, 9A006.d., 9A006.g., 9A007.a., 9A009.a., 9A010.d., 9A011, 9A101, 9A102, 9A105, 9A106.d., 9A107, 9A109, 9A111, 9A115.a., 9A117 vagy 9A118 alatt meghatározott termékek "használatára" tervezett vagy átalakított "szoftver"

b. Kifejezetten a 9A008.d., 9A106.c., 9A108.c. vagy 9A116.d. pontban meghatározott alrendszerek vagy berendezések működtetésére vagy karbantartására tervezett vagy átalakított "szoftver".

9D105Kifejezetten a 9A004 alatt meghatározott űrhajózási hordozórakétákban vagy a 9A104 alatt meghatározott rakétaszondákban vagy ‘rakétákban' a 9D004.e. alatt meghatározottól eltérő "szoftver", amely kifejezetten egynél több alrendszer funkcióinak koordinálására tervezett vagy átalakított.

Megjegyzés : A 9D105 magában foglalja a kifejezetten a "pilóta nélküli légijárműként" való működésre átalakított pilótával rendelkező "légi járművekhez". tervezett "szoftvert", az alábbiak szerint:

a. Kifejezetten az átalakító berendezésnek a "légi jármű" rendszerfunkcióiba történő integrálására tervezett vagy átalakított "szoftver"; valamint

b. Kifejezetten a "légi jármű" "pilóta nélküli légijárműként" való működtetéséhez tervezett vagy módosított "szoftver".

Műszaki megjegyzés :

A 9D105 alkalmazásában a ‘rakéta' olyan komplett rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent, melyek hatósugara legalább 300 km.

9ETechnológia

Megjegyzés : A 9E001-9E003 által ellenőrzés alá vont "fejlesztési" vagy "gyártás"-"technológia" gázturbina motorokhoz továbbra is ellenőrzés alatt marad, ha azt javításhoz, átépítéshez vagy nagyjavításhoz alkalmazzák. Az ellenőrzés alól kivételt jelentenek a következők: műszaki adatok, a megrongálódott vagy üzemképtelen egységek kalibrálásával, eltávolításával vagy cseréjével közvetlenül kapcsolatos - beleértve a teljes motorok vagy motormodulok cseréjét is - karbantartás céljára szolgáló rajzok vagy dokumentáció.

9E001A 9A001.b, 9A004-9A012, 9A350, 9B vagy 9D alatt meghatározott berendezések vagy "szoftver" "fejlesztésére" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

9E002A 9A001.b, 9A004-9A011, 9A350 vagy a 9B alatt meghatározott berendezések "gyártására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

N.B. Az ellenőrzés alá vont szerkezetek, rétegelt anyagok vagy anyagok javításának "technológiája" tekintetében lásd: 1E002.f.

9E003Egyéb "technológia", az alábbiak szerint:

a. A következő gázturbina motoralkatrészek vagy rendszerek "fejlesztéséhez" vagy "gyártásához" "szükséges" "technológia": 1. 1 273 K (1 000 °C) hőmérsékleten és 200 MPa feszültség mellett az átlagos élettartam alapján 400 órát meghaladó átlagos feszültségi törési idővel (a 001 Miller Index irányban) rendelkező, irányított kristályosodású (DS) vagy egykristály (SC) ötvözetekből készült gázturbinalapátok, terelőlapátok vagy "lapátvégtömítések"; Műszaki megjegyzés : A 9E003.a.1. pont alkalmazásában a feszültségi törés-ellenállási élettartam tesztelését általában tesztpéldányon végzik. 2. Égőterek, amelyek rendelkeznek az alábbi jellemzők bármelyikével: a. 1 883 K-t (1 610 °C) meghaladó ‘égőtér kimeneti hőmérsékleten' történő működésre tervezett termikusan leválasztott kamrák; b. Nemfém bélések; c. Nemfém héjak; d. 1 883 K-t (1 610 °C) meghaladó ‘égőtérből kimenő hőmérsékleten' történő működésre tervezett, és a 9E003.c. pontban meghatározott paramétereknek megfelelő furatokkal rendelkező kamrák; vagy e. ‘Nyomásfokozó égetés' alkalmazása; Műszaki megjegyzés : ‘Nyomásfokozó égetés' esetében az égőtér kimeneténél mért stagnációs nyomás hozzávetőlegesen kiszámolt átlaga nagyobb az égőtér bemeneténél mért stagnációs nyomás hozzávetőlegesen kiszámolt átlagánál, elsősorban az égési folyamat miatt, amikor a motor "folyamatos motorműködésben" fut. Megjegyzés : A 9E003.a.2. pontban meghatározott furatokra vonatkozóan "szükséges" "technológia" a furatok geometriájának és elhelyezkedésének levezetésére korlátozódik. Műszaki megjegyzések : 1. A ‘termikusan leválasztott kamrák' olyan kamrák, amelyek legalább egy, a mechanikus terhek szállítására tervezett tartószerkezetből és egy, a tartószerkezet égéshőtől való védelmére tervezett hőálló szerkezetből állnak. A hőálló szerkezet és a tartószerkezet egymástól függetlenül elmozdíthatók (a hőteher miatt mechanikus elmozdulás), vagyis termikusan szétválasztottak. 2. Az ‘égőtérből kimenő hőmérséklet' az égőtér kilépő keresztmetszete és a turbina bemenő terelőlapátjának belépő éle között (azaz az SAE ARP 755A szerint meghatározott T40 motorállomáson mért hőmérséklet) teljes (stagnációs) gázáram-hőmérséklet hozzávetőlegesen kiszámolt átlaga, amikor a motor "folyamatos motorműködésben" fut a tanúsított maximális működési hőmérsékleten. N.B. A hűtőfuratok készítéséhez "szükséges" "technológia" tekintetében lásd a 9E003.c. pontot. 3. Olyan alkatrészek, amelyek az alábbiak valamelyikét képezik: a. 588 K (315 °C) fölötti működésre tervezett szerves "kompozit" anyagokból gyártották; b. A következő anyagok bármelyikéből gyártották: 1. Fém-"mátrix" "kompozit", az alábbiak valamelyikével megerősítve: a. Az 1C007. alatt meghatározott anyagok; b. Az 1C010 alatt meghatározott "rostos vagy szálas anyagok"; vagy c. Az 1C002.a. pontban meghatározott aluminidek; vagy 2. Az 1C007 pontban meghatározott kerámia-"mátrix" "kompozitok"; vagy c. Állórész, terelőlapát, szárnylapát, végtömítés, gyűrűs forgólapát-koszorú, tárcsás forgólapát-koszorú vagy ‘légáramlás-elosztó csatorna', amelyekre igaz az alábbiak mindegyike: 1. A 9E003.a.3.a. pontban nincsenek meghatározva; 2. Kompresszorokhoz vagy ventillátorokhoz tervezték; valamint 3. Az 1C010.e. pontban meghatározott anyagból gyártották, az 1C008 által meghatározott gyantával; Műszaki megjegyzés : A ‘légáramlás-elosztó csatorna' végzi el a levegőtömeg-beáramlás kezdeti elválasztását a bypass és a motor belső szekciói között. 4. 1 373 K (1 100 °C) vagy annál magasabb ‘gázáram-hőmérsékleten' történő üzemelésre tervezett nem hűtött turbinalapátok, terelőlapátok vagy "lapátvégtömítések"; 5. A 9E003.a.1. alatt meghatározottaktól eltérő hűtött turbinalapátok, terelőlapátok vagy "lapátvégtömítések", amelyeket 1 693 K (1 420 °C) vagy annál magasabb ‘gázáram-hőmérsékleten' történő működésre terveztek; Műszaki megjegyzés : ‘Gázáram-hőmérséklet': a turbinakomponens belépő élén mért teljes (stagnációs) gázáram-hőmérséklet nagyjából kiszámított átlaga, amikor a motor "folyamatos motorműködésben" fut a tanúsított vagy meghatározott maximális folyamatos működési hőmérsékleten. 6. Merevkötéseket alkalmazó szárnyszelvénylemez lapátkombinációk; 7. Nem használt; 8. A 1C002.b alatt meghatározott porkohászati anyagokat alkalmazó ‘károsodástűrő' gázturbinamotor rotorjának alkatrészei; vagy Műszaki megjegyzés : A ‘károsodástűrő' alkatrészek tervezése a károsodások kialakulását megelőző és súlyosbodását korlátozó módszertan segítségével és szakmailag megalapozottan történik. 9. Nem használt; 10. Nem használt; 11. Az alábbi tulajdonságok mindegyikével rendelkező ‘ventillátorlapátok': a. a teljes térfogat legalább 20 %-át egy vagy több zárt üreg teszi ki, amely(ek)ben vákuum vagy kizárólag gáz van; valamint b. egy vagy több, legalább 5 cm3 térfogatú zárt üreg; Műszaki megjegyzés : A 9E003.a.11. alkalmazásában ‘ventillátorlapát' a forgóelem vagy -elemek szárnyszelvény része, amely kompresszor- és főáramlást egyaránt biztosít egy gázturbinás hajtóműben.

b. A következők bármelyikének "fejlesztéséhez" vagy "gyártásához" "szükséges" "technológia": 1. Szélcsatorna aeromodellek a szenzorokból az adatokat az adatgyűjtő rendszerbe továbbítani képes, nem intruzív szenzorokkal; vagy 2. "Kompozit" ventilátorlapátok vagy légcsavaros hajtóművek, amelyek 0,55 Mach-ot meghaladó repülési sebességnél több, mint 2 000 kW felvételére képesek;

c. A gázturbina motoralkatrészekben lévő hűtőfuratok "gyártásához" "szükséges" "technológia", amely magában foglalja a 9E003.a.1., 9E003.a.2. vagy 9E003.a.5. pontban meghatározott "technológiák" bármelyikét, és rendelkezik az alábbiak bármelyikével: 1. Rendelkezik a következők mindegyikével: a. minimális ‘keresztmetszetük' kisebb, mint 0,45 mm2; b. a ‘furatforma arány' 4,52-nél nagyobb; valamint c. a ‘beépítési szög' legfeljebb 25o; vagy 2. Rendelkezik a következők mindegyikével: a. minimális ‘keresztmetszetük' kisebb, mint 0,12 mm2; b. a ‘furatforma arány' 5,65-nél nagyobb; valamint c. a ‘beépítési szög' több, mint 25o; Megjegyzés : A 9E003.c. nem vonja ellenőrzés alá az olyan állandó sugarú hengeres furatok előállítására vonatkozó "technológiát", amelyek végig egyenesek, bemenetük és kimenetük pedig az alkatrész külső felszínén található. Műszaki megjegyzések : 1. A 9E003.c alkalmazásában a ‘keresztmetszet' az a furatnak a furat tengelyére merőleges síkon értelmezett területe. 2. A 9E003.c alkalmazásában a ‘furatforma arány' a furat tengelyének nominális hossza osztva minimális ‘keresztmetszetének' négyzetgyökével. 3. A 9E003.c alkalmazásában a ‘beépítési szöget' a szárnyszelvényre tangenciális síkban kell mérni azon az adott ponton, ahol a furat tengelye behatol a szárnyszelvény felületébe. 4. A 9E003.c. pontban szereplő furatkészítési módszerek közé tartozik a "lézer"-sugaras megmunkálás, a vízsugaras megmunkálás, az elektrokémiai megmunkálás (ECM) és a szikraforgácsoló gépes megmunkálás (EDM).

d. Helikopter erőátviteli rendszerek vagy ferde rotoros vagy ferdeszárnyú "légi jármű" erőátviteli rendszerek "fejlesztéséhez" vagy "gyártásához" "szükséges" "technológia";

e. A következő jellemzők mindegyikével rendelkező reciprok dízelmotoros földi járműhajtórendszerek "fejlesztésére", vagy "gyártására" szolgáló "technológia": 1. a ‘háztérfogat' legfeljebb 1,2 m3; 2. a teljes kimenőteljesítmény több, mint 750 kW, a 80/1269/EGK, ISO 2534 vagy annak nemzeti megfelelői alapján; valamint 3. a ‘háztérfogatra' vetített teljesítmény-sűrűség több, mint 700 kW/m3. Műszaki megjegyzés : A 9E003.e. pontban a ‘háztérfogat' a következő módon három, egymásra merőleges irányban mért érték eredménye: Hosszában : A forgattyús tengely hossza a homlokkarimától a lendkerék homlokfelületéig; Széltében : A következők közül a legszélesebb: a. Szelepfedéltől szelepfedélig mért külső méret; b. A hengerfejek külső széleinek méretei; vagy c. A lendkerékház átmérője; Magasságban : A következők közül a legnagyobb: a. A forgattyús tengely közép-vonalának mérete a szelepfedél felső síkjáig (vagy a hengerfejig) plusz kétszer a lökethossz; vagy b. A lendkerékház átmérője.

f. Kifejezetten a nagyteljesítményű dízelmotorokhoz tervezett alkatrészek "gyártásához" "szükséges" "technológia", ideértve a következőket: 1. Az 1C007 alatt meghatározott kerámiaanyagokat alkalmazó következő alkatrészek mindegyikével rendelkező motorrendszerek "gyártásához" "szükséges" "technológia": a. Hengerperselyek; b. Dugattyúk; c. Hengerfejek; valamint d. Egy vagy több egyéb alkatrész (többek között kipufogónyílások, turbótöltők, szelepvezetők, szelepszerelvények vagy szigetelt üzemanyag-injektorok); 2. A következő jellemzők mindegyikével rendelkező, egyfokozatú kompresszoros turbótöltő rendszerek "gyártásához" "szükséges" "technológia": a. A kompresszióarány 4:1 vagy nagyobb; b. A tömegáramlás nagysága 30-130 kg/perc; valamint c. Változtatható áramlási felület a kompresszor- vagy a turbinaszekciókon belül; 3. Olyan üzemanyag-befecskendező rendszerek "gyártásához" "szükséges" "technológia", amelyek speciálisan tervezett több-üzemanyagos (pl. dízel- vagy turbina üzemanyag) lehetőséggel rendelkeznek, és a viszkozitástartomány a dízelüzemanyagtól (2,5 cSt 310,8 K [37,8 °C] hőmérsékleten) a gázolaj üzemanyagig (0,5 cSt 310,8 K [37,8 °C] hőmérsékleten) tart, és rendelkeznek a következők mindegyikével: a. A befecskendezett mennyiség meghaladja a 230 mm3 befecskendezés/henger értéket; valamint b. Olyan elektronikus ellenőrző berendezések, amelyeket kifejezetten arra terveztek, hogy az üzemanyag sajátosságaitól függően a vezérlő jellemzőket automatikusan kapcsolják ugyanazon nyomatékjellemzőknek a megfelelő szenzorok alkalmazásával történő biztosítására;

g. ‘Nagyteljesítményű dízelmotorok' "fejlesztéséhez" vagy "gyártásához" "szükséges" "technológia", szilárd, gázfázisú vagy folyadékfilm (vagy ezek kombinációi) hengerfalkenéshez, 723 K (450 °C)-nál nagyobb hőmérsékleten történő üzemelésre, és amely hőmérséklet mérése a hengerfalon a dugattyúgyűrű útjának felső pontján történik. Műszaki megjegyzés : ‘Nagyteljesítményű dízelmotorok' olyan motorok, amelyek effektív átlagnyomása 2 300 ford/perc fordulatszámnál legalább 1,8 MPa, feltéve, hogy a névleges fordulatszám 2 300 ford/perc vagy nagyobb.

h. Gázturbinás hajtóművek "FADEC-rendszereihez" szükséges "technológia" az alábbiak szerint: 1. "Fejlesztési" "technológia" a hajtómű-tolóerő vagy tengely kimeneti teljesítmény szabályozását biztosító "FADEC-rendszerhez" szükséges elemek funkcionális követelményeinek megállapítására (pl. a visszacsatolás-érzékelő időállandói és pontossága, a tüzelőanyagszelep nyitási sebessége); 2. "Fejlesztési" vagy "gyártási" "technológia" a kizárólag a "FADEC-rendszer"-re jellemző ellenőrző és diagnosztikai alkatrészekhez, amelyeket a hajtómű-tolóerő vagy a tengely kimeneti teljesítmény szabályozására használnak; 3. "Fejlesztési" "technológia" a kizárólag a "FADEC-rendszer"-re jellemző szabályozás algoritmusához, beleértve a "forráskódot", amelyet a hajtómű-tolóerő vagy a tengely kimeneti teljesítmény szabályozására használnak; Megjegyzés : A 9E003h. pont nem vonja ellenőrzés alá a hajtómű és a "légi jármű" integrálásához kapcsolódó, egy vagy több uniós tagállam vagy a Wassenaari Megállapodásban részt vevő állam polgári repülésügyi hatóságának előírásai alapján általános légi üzemeltetői felhasználás céljára közzéteendő műszaki adatokat (pl. beépítési utasítások, üzemeltetési utasítások, a folyamatos légialkalmassághoz szükséges utasítások) vagy interfész funkciókat (pl. bemeneti-kimeneti jelfeldolgozás, az adott sárkányra vonatkozó tolóerő- vagy tengely kimeneti teljesítményigény).

i. "Technológia" a szabályozható áramlásiút-rendszerekhez, amelyeket arra terveztek, hogy fenntartsák a hajtómű stabilitását a gázgenerátor-turbinák, ventillátor- vagy teljesítményturbinák és hajtófúvókák esetében, az alábbiak szerint: 1. "Fejlesztési" "technológia" a hajtómű-stabilitást fenntartó alkatrészekre vonatkozó funkcionális követelmények megállapításához; 2. "Fejlesztési" vagy "gyártási" "technológia" a kizárólag a szabályozható áramlásiút-rendszerekre jellemző egyedi alkatrészekhez, amelyek fenntartják a hajtómű stabilitását; 3. "Fejlesztési" "technológia" a kizárólag a szabályozható áramlásiút-rendszerekre jellemző szabályozás algoritmusához, beleértve a "forráskódot", amelyek fenntartják a hajtómű stabilitását. Megjegyzés : A 9E003.i. nem von ellenőrzés alá semmilyen, az alábbiak valamelyikéhez használt "fejlesztési" vagy "gyártási" "technológiát": a. Bemenő terelőlapátok;; b. Változtatható szögű lapátokkal rendelkező ventillátorok vagy légcsavaros hajtóművek; c. Állítható kompresszor-terelőlapátok; d. Kompresszorürítő szelepek; vagy e. Fordított tolóerőhöz szükséges szabályozható áramlási út geometriák.

j. Gázturbinás hajtóművel működő rögzített szárnyú "légi járműhöz" tervezett szárnybehajtó rendszerek "fejlesztéséhez" "szükséges" "technológia" N.B. A rögzített szárnyú légi járműhöz tervezett szárnybehajtó rendszerek "fejlesztéséhez" szükséges "technológia" tekintetében LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.

9E101

a. A 9A101, 9A102, 9A104-9A111, 9A112.a., vagy 9A115-9A121 alatt meghatározott termékek "fejlesztésére" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

b. A 9A012 alatt meghatározott ‘UAV'-k vagy a 9A101, 9A102, 9A104-9A111, 9A112.a. vagy 9A115-9A121 alatt meghatározott termékek "gyártására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia". Műszaki megjegyzés : A 9E101.b. alkalmazásában ‘UAV': pilóta nélküli, 300 km-nél nagyobb hatótávolságú légijármű-rendszer.

9E102A 9A004 alatt meghatározott űrhajózási hordozórakéták, a 9A005-9A011 alatt meghatározott termékek, a 9A012 alatt meghatározott ‘UAV'-ok vagy a 9A101, 9A102, 9A104-9A111, 9A112.a., 9A115-9A121, 9B105, 9B106, 9B115, 9B116, 9B117, 9D101 vagy 9D103 alatt meghatározott termékek "felhasználására" vonatkozó, az Általános technológiai megjegyzés szerinti "technológia".

Műszaki megjegyzés :

A 9E102. pontban az ‘UAV' pilóta nélküli, 300 km-nél nagyobb hatótávolságú légijármű-rendszereket jelent.

II. MELLÉKLET

UNIÓS ÁLTALÁNOS EXPORTENGEDÉLY

Az alábbi szakaszok tartalmazzák az egyes exportokra vonatkozó uniós általános exportengedélyeket.

A. AZ AUSZTRÁLIÁBA, KANADÁBA, IZLANDRA, JAPÁNBA, ÚJ-ZÉLANDRA, NORVÉGIÁBA, SVÁJCBA, IDEÉRTVE LIECHTENSTEINT, VALAMINT AZ EGYESÜLT KIRÁLYSÁGBA ÉS AZ EGYESÜLT ÁLLAMOKBA IRÁNYULÓ KIVITEL

EU001. SZÁMÚ UNIÓS ÁLTALÁNOS EXPORTENGEDÉLY

(e rendelet 12. cikke (1) bekezdésének d) pontja szerint)

Az Ausztráliába, Kanadába, Izlandra, Japánba, Új-Zélandra, Norvégiába, Svájcba, ideértve Liechtensteint, az Egyesült Királyságba, valamint az Egyesült Államokba irányuló kivitel

Kibocsátó hatóság: Európai Unió

1. rész - Termékek

Ezen engedély az I. melléklet bármely pontjában szereplő valamennyi kettős felhasználású termékre vonatkozik, kivéve az e melléklet I. szakaszában felsoroltakat.

2. rész - Rendeltetési helyek

Ezen engedély az Unió vámterületének egészére érvényes a következő rendeltetési helyekre irányuló kivitel esetében::

- Ausztrália,

- Kanada,

- Izland,

- Japán,

- Új-Zéland,

- Norvégia,

- Svájc, ideértve Liechtensteint,

- Egyesült Királyság (e rendeletnek Észak-Írország tekintetében az Egyesült Királyságra és az Egyesült Királyságban történő alkalmazásának sérelme nélkül, a Nagy-Britannia és Észak-Írország Egyesült Királyságának az Európai Unióból és az Európai Atomenergia-közösségből történő kilépéséről szóló megállapodás ( 10 ) Írországról/Észak-Írországról szóló jegyzőkönyve (a továbbiakban: a jegyzőkönyv) 2. mellékletének 47. pontjával összhangban, amely felsorolja a jegyzőkönyv 5. cikkének (4) bekezdésében említett uniós jogi rendelkezéseket),

- Egyesült Államok.

3. rész - A felhasználás feltételei és követelményei

1. Ezen engedély nem jogosít fel termékek kivitelére, ha:

a) az exportőr tájékoztatást kapott a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságától arról, hogy a szóban forgó termékeket teljes egészében vagy részben az alábbi célokra szánják vagy szánhatják: i. vegyi, biológiai vagy nukleáris fegyver vagy más nukleáris robbanóeszköz fejlesztésével, gyártásával, kezelésével, működtetésével, karbantartásával, tárolásával, észlelésével, azonosításával vagy terjesztésével kapcsolatos felhasználás vagy az ilyen fegyverek célba juttatására alkalmas hordozórakéták fejlesztése, gyártása, karbantartása vagy tárolása; ii. az e rendelet 4. cikke (1) bekezdésének b) pontjában meghatározottak szerinti katonai végfelhasználás fegyverembargó hatálya alatt álló országban; vagy iii. felhasználás olyan - a nemzeti katonai listán szereplő - katonai termékek alkatrészeként vagy részegységeként, amelyet az illető tagállam területéről engedély nélkül vagy a tagállam nemzeti jogszabályaiban előírt engedélyezés megsértésével vittek ki;

b) az exportőrnek tudomása van arról, hogy a szóban forgó termékeket részben vagy egészben az a) pontban említett valamely felhasználásra szánják; vagy

c) a szóban forgó termékeket az engedélyben feltüntetett rendeltetési helyen található vámszabad területre vagy vámszabad raktárba viszik ki.

2. Az exportőr a vám-árunyilatkozatban nyilatkozatot tesz arról, hogy a termékek kivitele az EU001. számú uniós általános exportengedély alapján történik.

3. Az ezen engedélyt használó exportőr az első kivitelt követő 30 napon belül vagy - alternatív lehetőségként és az exportőr lakóhelye vagy letelepedési helye szerinti tagállam előírásainak megfelelően - ezen engedély első felhasználását megelőzően köteles tájékoztatni a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságát az engedély első felhasználásáról. A tagállamok értesítik a Bizottságot az engedélyezéshez választott értesítési mechanizmusról. A Bizottság a közölt információt az Európai Unió Hivatalos Lapjának C sorozatában közzéteszi.

A tagállamok határozzák meg az ezen engedély felhasználására vonatkozó jelentéstételi követelményeket, valamint azt, hogy az a tagállam, amelyből a kivitel megvalósul, milyen kiegészítő tájékoztatást kérhet az ezen engedély alapján kivitt termékekre vonatkozóan.

A tagállamok előírhatják, hogy a területükön lakóhellyel vagy letelepedési hellyel rendelkező exportőrök az engedély első alkalommal történő felhasználását megelőzően vetessék magukat nyilvántartásba. A nyilvántartásba vétel automatikus, és azt a hatáskörrel rendelkező hatóságoknak haladéktalanul és minden esetben a nyilvántartásba vételi kérelem beérkezésétől számított tíz munkanapon belül vissza kell igazolniuk az exportőrnek, figyelemmel e rendelet 12. cikkének (7) bekezdésére.

Adott esetben a második és harmadik albekezdésben foglalt követelményeknek a nemzeti általános exportengedélyeket előíró tagállamok által kiadott ilyen engedélyek használatához megállapított követelményeken kell alapulniuk.

B. BIZONYOS KETTŐS FELHASZNÁLÁSÚ TERMÉKEK KIVITELE EGYES RENDELTETÉSI HELYEKRE

EU002. SZÁMÚ UNIÓS ÁLTALÁNOS EXPORTENGEDÉLY

(e rendelet 12. cikke (1) bekezdésének d) pontja szerint)

Bizonyos kettős felhasználású termékek kivitele egyes rendeltetési helyekre

Kibocsátó hatóság: Európai Unió

1. rész - Termékek

Ez az engedély az I. mellékletben meghatározott következő kettős felhasználású termékekre terjed ki:

- 1A001,

- 1A003,

- 1A004,

- 1C003.b.,

- 1C003.c.,

- 1C004,

- 1C005,

- 1C006,

- 1C008,

- 1C009,

- 2B008,

- 3A001.a.3.,

- 3A001.a.6.,

- 3A001.a.7.,

- 3A001.a.9.,

- 3A001.a.10.,

- 3A001.a.11.,

- 3A001.a.12,

- 3A002.c.,

- 3A002.d.,

- 3A002.e.,

- 3A002.f.,

- 3C001,

- 3C002,

- 3C003,

- 3C004,

- 3C005,

- 3C006.

2. rész - Rendeltetési helyek

Ezen engedély az Unió vámterületének egészére érvényes a következő rendeltetési helyekre irányuló kivitel esetében:

- Argentína

- Dél-Afrika,

- Dél-Korea,

- Törökország.

3. rész - A felhasználás feltételei és követelményei

1. Ezen engedély nem jogosít fel termékek kivitelére, ha:

a) az exportőr tájékoztatást kapott a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságától arról, hogy a szóban forgó termékeket teljes egészében vagy részben az alábbi célokra szánják vagy szánhatják: i. vegyi, biológiai vagy nukleáris fegyver vagy más nukleáris robbanóeszköz fejlesztésével, gyártásával, kezelésével, működtetésével, karbantartásával, tárolásával, észlelésével, azonosításával vagy terjesztésével kapcsolatos felhasználás vagy az ilyen fegyverek célba juttatására alkalmas hordozórakéták fejlesztése, gyártása, karbantartása vagy tárolása; ii. az e rendelet 4. cikke (1) bekezdésének b) pontjában meghatározottak szerinti katonai végfelhasználás fegyverembargó hatálya alatt álló országban; vagy iii. felhasználás olyan - nemzeti katonai listán szereplő - katonai termékek alkatrészeként vagy részegységeként, amelyet az illető tagállam területéről engedély nélkül vagy a tagállam nemzeti jogszabályaiban előírt engedélyezés megsértésével vittek ki;

b) az exportőrnek tudomása van arról, hogy a szóban forgó termékeket részben vagy egészben az a) pontban említett valamely felhasználásra szánják; vagy

c) a szóban forgó termékeket az engedélyben feltüntetett rendeltetési helyen található vámszabad területre vagy vámszabad raktárba viszik ki.

2. Az exportőr a vám-árunyilatkozatban nyilatkozatot tesz arról, hogy a termékek kivitele az EU002. számú uniós általános exportengedély alapján történik.

3. Az ezen engedélyt használó exportőr az első kivitelt követő 30 napon belül vagy - alternatív lehetőségként és az exportőr lakóhelye vagy letelepedési helye szerinti tagállam előírásainak megfelelően - ezen engedély első felhasználását megelőzően köteles tájékoztatni a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságát az engedély első felhasználásáról. A tagállamok értesítik a Bizottságot az engedélyezéshez választott értesítési mechanizmusról. A Bizottság a közölt információt az Európai Unió Hivatalos Lapjának C sorozatában közzéteszi.

A tagállamok határozzák meg az ezen engedély felhasználására vonatkozó jelentéstételi követelményeket, valamint azt, hogy az a tagállam, amelyből a kivitel megvalósul, milyen kiegészítő tájékoztatást kérhet az ezen engedély alapján kivitt termékekre vonatkozóan.

A tagállamok előírhatják, hogy a területükön lakóhellyel vagy letelepedési hellyel rendelkező exportőrök az engedély első alkalommal történő felhasználását megelőzően vetessék magukat nyilvántartásba. A nyilvántartásba vétel automatikus, és azt a hatáskörrel rendelkező hatóságoknak haladéktalanul és minden esetben a nyilvántartásba vételi kérelem beérkezésétől számított tíz munkanapon belül vissza kell igazolniuk az exportőrnek, figyelemmel e rendelet 12. cikkének (7) bekezdésére.

Adott esetben a második és harmadik albekezdésben foglalt követelményeknek a nemzeti általános exportengedélyeket előíró tagállamok által kiadott ilyen engedélyek használatához megállapított követelményeken kell alapulniuk.

C. JAVÍTÁST/CSERÉT KÖVETŐ KIVITEL

EU003. SZÁMÚ UNIÓS ÁLTALÁNOS EXPORTENGEDÉLY

(e rendelet 12. cikke (1) bekezdésének d) pontja szerint)

Javítást/cserét követő kivitel

Kibocsátó hatóság: Európai Unió

1. rész - Termékek

1. Ez az engedély az I. melléklet bármely pontjában szereplő valamennyi kettős felhasználású termékre vonatkozik, kivéve az e szakasz 2. bekezdésében felsoroltakat, amennyiben:

a) a termékeket karbantartás, javítás vagy csere céljából hozták be újra az Unió vámterületére, és eredeti jellemzőinek megváltozása nélkül viszik ki vagy viszik ki újra a feladó országba, az eredeti exportengedély megadása utáni ötéves időtartamon belül; vagy

b) a termékeket az Unió vámterületére karbantartás, javítás vagy csere céljából újra behozott azonos minőségű és számú termékekért cserébe viszik ki a feladó országba, az eredeti exportengedély megadása utáni ötéves időtartamon belül.

2. Kizárt termékek:

a) az e melléklet I. szakaszában felsorolt valamennyi termék;

b) az I. melléklet valamennyi kategóriájának D. és E. szakaszában felsorolt valamennyi termék;

c) az I. mellékletben meghatározott alábbi termékek: - 1A002.a., - 1C012.a., - 1C227, - 1C228, - 1C229, - 1C230, - 1C231, - 1C236, - 1C237, - 1C240, - 1C350, - 1C450, - 5A001.b.5., - 5A002.c., - 5A002.d., - 5A002.e., - 5A003.a., - 5A003.b., - 6A001.a.2.a.1., - 6A001.a.2.a.5., - 6A002.a.1.c., - 8A001.b., - 8A001.c.1., - 9A011.

2. rész - Rendeltetési helyek

Ezen engedély az Unió vámterületének egészére érvényes a következő rendeltetési helyekre irányuló kivitel esetében:

- Albánia,

- Argentína,

- Bosznia és Hercegovina,

- Brazília,

- Chile,

- Kína (beleértve Hongkongot és Makaót),

- Franciaország tengerentúli területei,

- India,

- Kazahsztán,

- Mexikó,

- Montenegró,

- Marokkó,

- Észak-Macedónia,

- Szerbia,

- Szingapúr,

- Dél-Afrika,

- Dél-Korea,

- Tunézia,

- Törökország,

- Ukrajna,

- Egyesült Arab Emírségek,

3. rész - A felhasználás feltételei és követelményei

1. Ezen engedély csak akkor használható, ha az eredeti kivitelre uniós általános exportengedély szerint került sor, vagy az eredeti exportőr lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatósága eredeti exportengedélyt adott azokra a termékekre, amelyeket karbantartás, javítás vagy csere céljából később újra behoztak az Unió vámterületére. Ezen engedély csak az eredeti végfelhasználók számára történő kivitel esetén érvényes.

2. Ezen engedély nem jogosít fel termékek kivitelére, ha:

a) az exportőr tájékoztatást kapott a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságától arról, hogy a szóban forgó termékeket teljes egészében vagy részben az alábbi célokra szánják vagy szánhatják: i. vegyi, biológiai vagy nukleáris fegyverek vagy más nukleáris robbanószerkezetek fejlesztésével, gyártásával, kezelésével, működtetésével, karbantartásával, raktározásával, felderítésével, azonosításával vagy terjesztésével kapcsolatos felhasználás, vagy az ilyen fegyverek célba juttatására alkalmas hordozórakéták fejlesztése, gyártása, karbantartása vagy tárolása; ii. e rendelet 4. cikke (1) bekezdésének b) pontjában meghatározottak szerinti katonai végfelhasználás, amennyiben a vásárló országra vagy a rendeltetési országra fegyverembargó van érvényben; vagy iii. felhasználás olyan - a nemzeti katonai listán szereplő - katonai termékek alkatrészeként vagy részegységeként, amelyet az illető tagállam területéről engedély nélkül vagy a tagállam nemzeti jogszabályaiban előírt engedélyezés megsértésével vittek ki;

b) az exportőrnek tudomása van arról, hogy a szóban forgó termékeket részben vagy egészben az a) pontban említett valamely felhasználásra szánják;

c) a szóban forgó termékeket az engedélyben feltüntetett rendeltetési helyen található vámszabad területre vagy vámszabad raktárba viszik ki;

d) az eredeti engedélyt semmissé nyilvánították, felfüggesztették, módosították vagy visszavonták; vagy

e) az exportőrnek tudomása van arról, hogy a szóban forgó termékek végfelhasználása különbözik az eredeti exportengedélyben előírttól.

3. Bármilyen termék ezen engedély szerinti kivitele esetén az exportőr:

a) a vámhatóságnak beadott kiviteli nyilatkozaton megemlíti az eredeti exportengedély hivatkozási számát és annak a tagállamnak a nevét, amely az engedélyt megadta, valamint a vám-árunyilatkozatban nyilatkozatot tesz arról, hogy a termékeket az EU003. számú uniós általános exportengedély alapján exportálják;

b) kérésre a vámtisztviselőket írásos bizonyítékkal látja el az áru Unióba történő behozatalának dátumára, a termékeken az Unióban elvégzett karbantartásra, javításra vagy cserére és arra vonatkozóan, hogy a termékek ahhoz a végfelhasználóhoz és abba az országba fognak visszatérni, ahonnan azokat az Unióba behozták.

4. Az ezen engedélyt használó exportőr az első kivitelt követő 30 napon belül vagy - alternatív lehetőségként és az exportőr lakóhelye vagy letelepedési helye szerinti tagállam előírásainak megfelelően - ezen engedély első felhasználását megelőzően köteles tájékoztatni a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságát az engedély első felhasználásáról. A tagállamok értesítik a Bizottságot az engedélyezéshez választott értesítési mechanizmusról. A Bizottság a közölt információt az Európai Unió Hivatalos Lapjának C sorozatában közzéteszi.

A tagállamok határozzák meg az ezen engedély felhasználására vonatkozó jelentéstételi követelményeket, valamint azt, hogy az a tagállam, amelyből a kivitel megvalósul, milyen kiegészítő tájékoztatást kérhet az ezen engedély alapján kivitt termékekre vonatkozóan.

A tagállamok előírhatják, hogy a területükön lakóhellyel vagy letelepedési hellyel rendelkező exportőrök az engedély első alkalommal történő felhasználását megelőzően vetessék magukat nyilvántartásba. A nyilvántartásba vétel automatikus, és azt a hatáskörrel rendelkező hatóságoknak haladéktalanul és minden esetben a nyilvántartásba vételi kérelem beérkezésétől számított tíz munkanapon belül vissza kell igazolniuk az exportőrnek, figyelemmel e rendelet 12. cikkének (7) bekezdésére.

Adott esetben a második és harmadik albekezdésben foglalt követelményeknek a nemzeti általános exportengedélyeket előíró tagállamok által kiadott ilyen engedélyek használatához megállapított követelményeken kell alapulniuk.

5. Ezen engedély magában foglalja a "javításra", "cserére" és "karbantartásra" szánt termékeket, ideértve az eredeti áru véletlenszerű javulását is, ami például egy modern cserealkatrész felhasználásából vagy egy - megbízhatósági vagy biztonsági okokból kidolgozott - későbbi gyártási szabvány alkalmazásából ered, feltéve hogy ez nem vonja maga után a termékek működési képességeinek javulását, vagy nem látja el a termékeket új vagy kiegészítő funkciókkal.

D. IDŐSZAKOS KIVITEL KIÁLLÍTÁSRA VAGY VÁSÁRRA

EU004. SZÁMÚ UNIÓS ÁLTALÁNOS EXPORTENGEDÉLY

(e rendelet 12. cikke (1) bekezdésének d) pontja szerint)

Időszakos kivitel kiállításra vagy vásárra

Kibocsátó hatóság: Európai Unió

1. rész - Termékek

Ezen engedély az I. melléklet bármely pontjában meghatározott valamennyi kettős felhasználású termékre vonatkozik, kivéve:

a) az e melléklet I. szakaszában felsorolt valamennyi terméket;

b) az I. melléklet valamennyi kategóriájának D. szakaszában felsorolt valamennyi terméket (nem tartozik ide a berendezés bemutatóra szánt megfelelő működéséhez szükséges szoftver);

c) az I. melléklet valamennyi kategóriájának E. szakaszában felsorolt valamennyi terméket;

d) az I. mellékletben meghatározott alábbi termékeket: - 1A002.a., - 1C002.b.4., - 1C010, - 1C012.a., - 1C227, - 1C228, - 1C229, - 1C230, - 1C231, - 1C236, - 1C237, - 1C240, - 1C350, - 1C450, - 5A001.b.5., - 5A002.c., - 5A002.d., - 5A002.e., - 5A003.a., - 5A003.b., - 6A001, - 6A002.a., - 8A001.b., - 8A001.c.1., - 9A011.

2. rész - Rendeltetési helyek

Ezen engedély az Unió vámterületének egészére érvényes a következő rendeltetési helyekre irányuló kivitel esetében:

- Albánia,

- Argentína,

- Bosznia-Hercegovina,

- Brazília,

- Chile,

- Kína (beleértve Hongkongot és Makaót),

- Franciaország tengerentúli területei,

- India,

- Kazahsztán,

- Mexikó,

- Montenegró,

- Marokkó,

- Észak-Macedóna,

- Szerbia,

- Szingapúr,

- Dél-Afrika,

- Dél-Korea,

- Tunézia,

- Törökország,

- Ukrajna,

- Egyesült Arab Emírségek.

3. rész - A felhasználás feltételei és követelményei

1. Ezen engedély engedélyezi az 1. részben felsorolt termékek kivitelét azzal a feltétellel, hogy a kivitel kiállításra vagy vásárra vonatkozó időszakos kivitelt jelent az e rész 6. bekezdésében meghatározottak szerint, és hogy a termékeket az eredeti kiviteltől számított 120 napon belül teljes egészükben és változtatás nélkül újra behozzák az Unió vámterületére.

2. Az exportőr lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatósága az exportőr kérésére felmentést adhat azon követelmény alól, hogy a termékeket az 1. bekezdéssel összhangban újra behozzák. A felmentés megadására az e rendelet 12. cikkének (2) bekezdésében meghatározott, egyéni engedélyekre vonatkozó eljárás alkalmazandó.

3. Ezen engedély nem jogosít fel termékek kivitelére, ha:

a) az exportőr tájékoztatást kapott a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságától arról, hogy a szóban forgó termékeket teljes egészében vagy részben az alábbi célokra szánják vagy szánhatják: i. vegyi, biológiai vagy nukleáris fegyver vagy más nukleáris robbanóeszköz fejlesztésével, gyártásával, kezelésével, működtetésével, karbantartásával, tárolásával, észlelésével, azonosításával vagy terjesztésével kapcsolatos felhasználás vagy az ilyen fegyverek célba juttatására alkalmas hordozórakéták fejlesztése, gyártása, karbantartása vagy tárolása; ii. e rendelet 4. cikke (1) bekezdésének b) pontjában meghatározottak szerinti katonai végfelhasználás, amennyiben a vásárló országra vagy a rendeltetési országra fegyverembargó van érvényben; vagy iii. felhasználás olyan - a nemzeti katonai listán szereplő - katonai termékek alkatrészeként vagy részegységeként, amelyet az illető tagállam területéről engedély nélkül vagy a tagállam nemzeti jogszabályaiban előírt engedélyezés megsértésével vittek ki;

b) az exportőrnek tudomása van arról, hogy a szóban forgó termékeket részben vagy egészben az a) pontban említett valamely felhasználásra szánják;

c) a szóban forgó termékeket az engedélyben feltüntetett rendeltetési helyen található vámszabad területre vagy vámszabad raktárba viszik ki;

d) az exportőr tájékoztatást kapott a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságától, vagy máshonnan (például a gyártótól kapott tájékoztatás révén) tudomása van arról, hogy a szóban forgó termékeket a hatáskörrel rendelkező hatóság nemzetbiztonsági megjelöléssel bizalmasnak minősítette a CONFIDENTIEL UE/EU CONFIDENTIAL (EU bizalmas) jelölésnek megfelelő vagy ennél szigorúbb jelöléssel;

e) az exportőr nem tudja garantálni azok eredeti állapotukban, bármely alkatrész vagy szoftver eltávolítása, másolása vagy terjesztése nélkül történő visszajuttatását, vagy ha a bemutatóhoz technológiaátadás is kapcsolódik;

f) a szóban forgó termékeket magánjellegű kiállítás vagy bemutatás céljából (pl. házon belüli kiállítótermekbe) viszik ki;

g) a szóban forgó termékeket bármely gyártási folyamatba való integrálásra szánják;

h) a szóban forgó termékeket azok eredeti felhasználási céljára használják fel, kivéve a tényleges bemutatáshoz szükséges minimális mértékig, anélkül azonban, hogy az egyedi teszteredményeket harmadik felek számára hozzáférhetővé tennék;

i) a kivitel kereskedelmi ügylet eredményeképpen történik, különösen a szóban forgó termékek eladása, bérlése vagy lízingje esetében;

j) a szóban forgó termékeket kiállításon vagy vásáron kizárólag eladási, bérleti vagy lízingelési szándékkal tárolják anélkül, hogy azokat kiállítanák vagy bemutatnák; vagy

k) az exportőr olyan intézkedéseket tesz, amelyek megakadályozzák őt abban, hogy a szóban forgó termékeket saját ellenőrzése alatt tartsa az időszakos kivitel teljes ideje alatt.

4. Az exportőr a vám-árunyilatkozatban nyilatkozatot tesz arról, hogy a termékek kivitele az EU004. számú uniós általános exportengedély alapján történik.

5. Az ezen engedélyt használó exportőr az első kivitelt követő 30 napon belül vagy - alternatív lehetőségként és az exportőr lakóhelye vagy letelepedési helye szerinti tagállam előírásainak megfelelően - ezen engedély első felhasználását megelőzően köteles tájékoztatni a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságát az engedély első felhasználásáról. A tagállamok értesítik a Bizottságot az engedélyezéshez választott értesítési mechanizmusról. A Bizottság a közölt információt az Európai Unió Hivatalos Lapjának C sorozatában közzéteszi.

A tagállamok határozzák meg az ezen engedély felhasználására vonatkozó jelentéstételi követelményeket, valamint azt, hogy az a tagállam, amelyből a kivitel megvalósul, milyen kiegészítő tájékoztatást kérhet az ezen engedély alapján kivitt termékekre vonatkozóan.

A tagállamok előírhatják, hogy a területükön lakóhellyel vagy letelepedési hellyel rendelkező exportőrök az engedély első alkalommal történő felhasználását megelőzően vetessék magukat nyilvántartásba. A nyilvántartásba vétel automatikus, és azt a hatáskörrel rendelkező hatóságoknak haladéktalanul és minden esetben a nyilvántartásba vételi kérelem beérkezésétől számított tíz munkanapon belül vissza kell igazolniuk az exportőrnek, figyelemmel e rendelet 12. cikkének (7) bekezdésére.

Adott esetben a második és harmadik albekezdésben foglalt követelményeknek a nemzeti általános exportengedélyeket előíró tagállamok által kiadott ilyen engedélyek használatához megállapított követelményeken kell alapulniuk.

6. Ezen engedély alkalmazásában "kiállítás vagy vásár" minden olyan meghatározott időtartamú, kereskedelmi célú esemény, amelyen kiállítók vonultatják fel termékeiket üzleti látogatók vagy a nagyközönség számára.

E. TÁVKÖZLÉS

EU005. SZÁMÚ UNIÓS ÁLTALÁNOS EXPORTENGEDÉLY

(e rendelet 12. cikke (1) bekezdésének d) pontja szerint)

Távközlés

Kibocsátó hatóság: Európai Unió

1. rész - Termékek

Ezen engedély az I. mellékletben meghatározott következő kettős felhasználású termékekre vonatkozik:

a) az 5. kategória 1. részében található termékek: i. termékek, ideértve az 5A001.b.2., az 5A001.c. és az 5A001.d. alatt meghatározott, a termékekhez különlegesen tervezett vagy fejlesztett alkatrészeket és tartozékokat; ii. az 5B001 és 5D001 alatt meghatározott termékek, amennyiben vizsgáló-, ellenőrző- és gyártó berendezésre vonatkoznak, valamint az i. pontban említett termékekhez való szoftver;

b) az 5E001.a. által vezérelt technológia, amennyiben az a) pont alatt meghatározott termékek üzembe helyezéséhez, üzemeltetéséhez, karbantartásához vagy javításához szükséges, és ugyanazon végfelhasználóknak szánják.

2. rész - Rendeltetési helyek

Ezen engedély az Unió vámterületének egészére érvényes a következő rendeltetési helyekre irányuló kivitel esetében:

- Argentína,

- Kína (beleértve Hongkongot és Makaót),

- India,

- Dél-Afrika,

- Dél-Korea,

- Törökország,

- Ukrajna.

3. rész - A felhasználás feltételei és követelményei

1. Ezen engedély nem jogosít fel termékek kivitelére, ha:

a) az exportőr tájékoztatást kapott a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságától arról, hogy a szóban forgó termékeket teljes egészében vagy részben az alábbi célokra szánják vagy szánhatják: i. vegyi, biológiai vagy nukleáris fegyver vagy más nukleáris robbanóeszköz fejlesztésével, gyártásával, kezelésével, működtetésével, karbantartásával, tárolásával, észlelésével, azonosításával vagy terjesztésével kapcsolatos felhasználás vagy az ilyen fegyverek célba juttatására alkalmas hordozórakéták fejlesztése, gyártása, karbantartása vagy tárolása; ii. e rendelet 4. cikke (1) bekezdésének b) pontjában meghatározottak szerinti katonai végfelhasználás, amennyiben a vásárló országra vagy a rendeltetési országra fegyverembargó van érvényben; iii. felhasználás olyan - a nemzeti katonai listán szereplő - katonai termékek alkatrészeként vagy részegységeként, amelyet az illető tagállam területéről engedély nélkül vagy a tagállam nemzeti jogszabályaiban előírt engedélyezés megsértésével vittek ki; vagy iv. az Európai Unió Alapjogi Chartájában meghatározott emberi jogok, demokratikus elvek vagy véleménynyilvánítás szabadságának megsértésével kapcsolatos felhasználás a mobiltelefonok és szöveges üzenetek megfigyelésére és az internethasználat célzott felügyeletére (pl. megfigyelőközpontokon és törvényes lehallgatási átviteli módszereken keresztül) lehallgatási technológiák és digitális adattovábbító eszközök használata révén;

b) az exportőrnek tudomása van arról, hogy a szóban forgó termékeket részben vagy egészben az a) pontban említett valamely felhasználásra szánják;

c) az exportőrnek tudomása van arról, hogy a szóban forgó termékeket újra kiviszik az e szakasz 2. részében vagy az e melléklet A szakaszának 2. részében felsoroltaktól, valamint a tagállamoktól eltérő rendeltetési helyre;

d) a szóban forgó termékeket az engedélyben feltüntetett rendeltetési helyen található vámszabad területre vagy vámszabad raktárba viszik ki.

2. Az exportőr a vám-árunyilatkozatban nyilatkozatot tesz arról, hogy a termékek kivitele az EU005. számú uniós általános exportengedély alapján történik.

3. Az ezen engedélyt használó exportőr az első kivitelt követő 30 napon belül vagy - alternatív lehetőségként és az exportőr lakóhelye vagy letelepedési helye szerinti tagállam előírásainak megfelelően - ezen engedély első felhasználását megelőzően köteles tájékoztatni a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságát az engedély első felhasználásáról. A tagállamok értesítik a Bizottságot az engedélyezéshez választott értesítési mechanizmusról. A Bizottság a közölt információt az Európai Unió Hivatalos Lapjának C sorozatában közzéteszi.

A tagállamok határozzák meg az ezen engedély felhasználására vonatkozó jelentéstételi követelményeket, valamint azt, hogy az a tagállam, amelyből a kivitel megvalósul, milyen kiegészítő tájékoztatást kérhet az ezen engedély alapján kivitt termékekre vonatkozóan.

A tagállamok előírhatják, hogy a területükön lakóhellyel vagy letelepedési hellyel rendelkező exportőrök az engedély első alkalommal történő felhasználását megelőzően vetessék magukat nyilvántartásba. A nyilvántartásba vétel automatikus, és azt a hatáskörrel rendelkező hatóságoknak haladéktalanul és minden esetben a nyilvántartásba vételi kérelem beérkezésétől számított tíz munkanapon belül vissza kell igazolniuk az exportőrnek, figyelemmel e rendelet 12. cikkének (7) bekezdésére.

Adott esetben a második és harmadik albekezdésben foglalt követelményeknek a nemzeti általános exportengedélyeket előíró tagállamok által kiadott ilyen engedélyek használatához megállapított követelményeken kell alapulniuk.

F. VEGYSZEREK

EU006. SZÁMÚ UNIÓS ÁLTALÁNOS EXPORTENGEDÉLY

(e rendelet 12. cikke (1) bekezdésének d) pontja szerint)

Vegyszerek

Kibocsátó hatóság: Európai Unió

1. rész - Termékek

Ezen engedély az I. mellékletben meghatározott következő kettős felhasználású termékekre vonatkozik:

1. Tiodiglikol (CAS 111-48-8);

2. Foszfor-oxiklorid (CAS 10025-87-3);

3. Dimetil-metil-foszfonát (CAS 756-79-6);

5. Metil-foszfinil-diklorid (CAS 676-97-1);

6. Dimetil-foszfit (DMP) (CAS 868-85-9);

7. Foszfor-triklorid (CAS 7719-12-2);

8. Trimetil-foszfit (TMP) (CAS 121-45-9);

9. Tionil-klorid (CAS 7719-09-7);

10. 3-hidroxi-1-metil-piperidin (CAS 3554-74-3);

11. N,N-Diizopropil-ß-aminoetil-klorid (CAS 96-79-7);

12. N,N-Diizopropil-ß-aminoetán-tiol (CAS 5842-07-9);

13. 3-kvinuklidinol (CAS 1619-34-7);

14. Kálium-fluorid (CAS 7789-23-3);

15. 2-klór-etanol (CAS 107-07-3);

16. Dimetil-amin (CAS 124-40-3);

17. Dietil-etil-foszfonát (CAS 78-38-6);

18. Dietil-N,N-dimetil-foszforamidát (CAS 2404-03-7);

19. Dietil-foszfit (CAS 762-04-9);

20. Dimetil-amin-hidroklorid (CAS 506-59-2);

21. Etil-foszfinil-diklorid (CAS 1498-40-4);

22. Etil-foszfonil-diklorid (CAS 1066-50-8);

24. Hidrogén-fluorid (CAS 7664-39-3);

25. Metil-benzilát (CAS 76-89-1);

26. Metil-foszfinil-diklorid (CAS 676-83-5);

27. N,N-Diizopropil-ß-amino-etanol (CAS 96-80-0);

28. Pinakolil-alkohol (CAS 464-07-3);

30. Trietil-foszfit (CAS 122-52-1);

31. Arzén-triklorid (CAS 7784-34-1);

32. Benzilsav (CAS 76-93-7);

33. Dietil-metil-foszfonit (CAS 15715-41-0);

34. Dimetil-etil-foszfonát (CAS 6163-75-3);

35. Etil-foszfinil-difluorid (CAS 430-78-4);

36. Metil-foszfinil-difluorid (CAS 753-59-3);

37. 3-kvinuklidon (CAS 3731-38-2);

38. Foszfor-pentaklorid (CAS 10026-13-8);

39. Pinakolon (CAS 75-97-8);

40. Kálium-cianid (CAS 151-50-8);

41. Kálium-bifluorid (CAS 7789-29-9);

42. Ammónium-hidrogén-fluorid vagy ammónium-bifluorid (CAS 1341-49-7);

43. Nátrium-fluorid (CAS 7681-49-4);

44. Nátrium-bifluorid (CAS 1333-83-1);

45. Nátrium-cianid (CAS 143-33-9);

46. Trietanol-amin (CAS 102-71-6);

47. Foszfor-pentaszulfid (CAS 1314-80-3);

48. Diizopropil-amin (CAS 108-18-9);

49. Dietil-amino-etanol (CAS 100-37-8);

50. Nátrium-szulfid (CAS 1313-82-2);

51. Kén-monoklorid (CAS 10025-67-9);

52. Kén-diklorid (CAS 10545-99-0);

53. Trietanol-amin-hidroklorid (CAS 637-39-8);

54. N,N-Diizopropil-ß-aminoetil-klorid-hidroklorid (CAS 4261-68-1);

55. Metilfoszfonsav (CAS 993-13-5);

56. Dietil-metilfoszfonát (CAS 683-08-9);

57. N,N-dimetilamino-foszforsav-diklorid (CAS 677-43-0);

58. Triizopropil-foszfit (CAS 116-17-6);

59. Etil-dietanol-amin (CAS 139-87-7);

60. O,O-dietil-tiofoszforsav (CAS 2465-65-8);

61. O,O-dietil-ditiofoszforsav (CAS 298-06-6);

62. Nátrium-szilícium-hexafluorid (CAS 16893-85-9);

63. Metil-diklór-tiofoszfát (CAS 676-98-2);

64. Dietil-amin (CAS 109-89-7);

65. N,N-diizopropil-amino-etántiol-hidroklorid (CAS 41480-75-5)

4. Foszgén: Karbonil-diklorid (CAS 75-44-5);

5. Cianogén-klorid (CAS 506-77-4);

6. Hidrogén-cianid (CAS 74-90-8);

7. Klórpikrin: Triklór-nitro-metán (CAS 76-06-2);

1. A katonai célú termékek ellenőrzési jegyzékében és az 1C350 alatt meghatározottaktól eltérő olyan vegyületek, amelyek tartalmaznak egy olyan foszforatomot, amihez egy (normál- vagy izo-) metil-, etil- vagy propilcsoport kötődik, de további szénatomok nem;

2. Az 1C350.57 alatt meghatározott N,N-dimetilamino-foszforsav-dikloridtól eltérő N,N-dialkil-(metil, etil vagy propil [normál- vagy izo-])-foszforamido-dihalidok;

3. Az 1C350 alatt meghatározott dietil-N,N-dimetil-foszforamidáttól eltérő dialkil-(metil, etil vagy propil [normál- vagy izo-]) N,N-dialkil-(metil, etil vagy propil [normál- vagy izo-])-foszforamidátok;

4. Az 1C350 alatt meghatározott N,N-diizopropil-béta-amino-etil-kloridtól vagy N,N-diizopropil-béta-amino-etil-klorid-hidrokloridtól eltérő N,N-dialkil-(metil, etil vagy propil [normál- vagy izo-])-aminoetil-2-kloridok és a megfelelő protonált sók;

5. Az 1C350 alatt meghatározott N,N-di-izopropil-béta-amino-etanoltól (CAS 96-80-0) és N,N-dietil-amino-etanoltól (CAS 100-37-8) eltérő N,N-dialkil-(metil, etil vagy propil [normál- vagy izo-])-amino-etán-2-olok és a megfelelő protonált sók;

6. Az 1C350 alatt meghatározott N,N-di-izopropil-béta-amino-etán-tioltól (CAS 5842-07-9) és N,N-di-izopropil-amino-etán-tiol-hidrokloridtól (CAS 41480-75-5) eltérő N,N-dialkil-(metil, etil vagy propil [normál- vagy izo-])-amino-etán-2-tiolok és a megfelelő protonált sók;

8. Metil-dietanol-amin (CAS 105-59-9).

2. rész - Rendeltetési helyek

Ezen engedély az Unió vámterületének egészére érvényes a következő rendeltetési helyekre irányuló kivitel esetében:

- Argentína,

- Dél-Korea,

- Törökország,

- Ukrajna.

3. rész - A felhasználás feltételei és követelményei

1. Ezen engedély nem jogosít fel termékek kivitelére, ha:

a) az exportőr tájékoztatást kapott a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságától arról, hogy a szóban forgó termékeket teljes egészében vagy részben az alábbi célokra szánják vagy szánhatják: i. vegyi, biológiai vagy nukleáris fegyver vagy más nukleáris robbanóeszköz fejlesztésével, gyártásával, kezelésével, működtetésével, karbantartásával, tárolásával, észlelésével, azonosításával vagy terjesztésével kapcsolatos felhasználás vagy az ilyen fegyverek célba juttatására alkalmas hordozórakéták fejlesztése, gyártása, karbantartása vagy tárolása; ii. katonai végfelhasználás az e rendelet 4. cikke (1) bekezdésének b) pontjában meghatározottak szerint, amennyiben a vásárló országra vagy a rendeltetési országra fegyverembargó van érvényben; vagy iii. felhasználás olyan - a nemzeti katonai listán szereplő - katonai termékek alkatrészeként vagy részegységeként, amelyet az illető tagállam területéről engedély nélkül vagy a tagállam nemzeti jogszabályaiban előírt engedélyezés megsértésével vittek ki;

b) az exportőrnek tudomása van arról, hogy a szóban forgó termékeket részben vagy egészben az a) pontban említett valamely felhasználásra szánják;

c) az exportőrnek tudomása van arról, hogy a szóban forgó termékeket az e szakasz 2. részében vagy az e melléklet A szakaszának 2. részében fel nem sorolt rendeltetési helyre vagy a tagállamokba újra kiviszik; vagy

d) a szóban forgó termékeket az engedélyben feltüntetett rendeltetési helyen található vámszabad területre vagy vámszabad raktárba viszik ki.

2. Az exportőrnek a vám-árunyilatkozatban nyilatkozatot kell tennie arról, hogy a termékek kivitele az EU006. számú uniós általános exportengedély alapján történik.

3. Az ezen engedélyt használó exportőr az első kivitelt követő 30 napon belül vagy - alternatív lehetőségként és az exportőr lakóhelye vagy letelepedési helye szerinti tagállam előírásainak megfelelően - ezen engedély első felhasználását megelőzően köteles tájékoztatni a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságát az engedély első felhasználásáról. A tagállamok értesítik a Bizottságot az engedélyezéshez választott értesítési mechanizmusról. A Bizottság a közölt információt az Európai Unió Hivatalos Lapjának C sorozatában közzéteszi.

A tagállamok határozzák meg az ezen engedély felhasználására vonatkozó jelentéstételi követelményeket, valamint azt, hogy az a tagállam, amelyből a kivitel megvalósul, milyen kiegészítő tájékoztatást kérhet az ezen engedély alapján kivitt termékekre vonatkozóan.

A tagállamok előírhatják, hogy a területükön lakóhellyel vagy letelepedési hellyel rendelkező exportőrök az engedély első alkalommal történő felhasználását megelőzően vetessék magukat nyilvántartásba. A nyilvántartásba vétel automatikus, és azt a hatáskörrel rendelkező hatóságoknak haladéktalanul és minden esetben a nyilvántartásba vételi kérelem beérkezésétől számított tíz munkanapon belül vissza kell igazolniuk az exportőrnek, figyelemmel e rendelet 12. cikkének (7) bekezdésére.

Adott esetben a második és harmadik albekezdésben foglalt követelményeknek a nemzeti általános exportengedélyeket előíró tagállamok által kiadott ilyen engedélyek használatához megállapított követelményeken kell alapulniuk.

G. CSOPORTON BELÜLI SZOFTVER- ÉS TECHNOLÓGIAÁTADÁS

EU007. SZÁMÚ UNIÓS ÁLTALÁNOS EXPORTENGEDÉLY

(e rendelet 12. cikke (1) bekezdésének d) pontja szerint)

Csoporton belüli szoftver- és technológiaátadás

Kibocsátó hatóság: Európai Unió

1. rész - Termékek

Ez az engedély kiterjed az I. mellékletben meghatározott összes technológiára és szoftverre, kivéve az e melléklet I. szakaszában felsoroltakat, valamint a 4A005, 4D004, 4E001.c, 5A001.f és 5A001.j pontban felsorolt termékekhez kapcsolódó technológiákat és szoftvereket.

2. rész - Rendeltetési helyek

Ezen engedély az Unió egész vámterületén a következő rendeltetési helyekre irányuló szoftver- és technológiaátadásra érvényes:

- Argentína,

- Brazília,

- Chile,

- India,

- Indonézia,

- Izrael,

- Jordánia,

- Malajzia,

- Marokkó,

- Mexikó,

- Fülöp-szigetek,

- Szingapúr,

- Dél-Afrika,

- Dél-Korea,

- Thaiföld,

- Tunézia.

3. rész - A felhasználás feltételei és követelményei

1. Ezen engedély engedélyezi az 1. részben felsorolt szoftvereknek és technológiának az Unió valamely tagállamában letelepedett, jogi személyiséggel rendelkező exportőr általi kivitelét az exportőr (leányvállalat) kizárólagos tulajdonában és ellenőrzése alatt álló vállalat vagy az exportőr anyavállalata (testvérvállalat) közvetlen és kizárólagos tulajdonában és ellenőrzése alatt álló vállalat részére, feltéve, hogy:

a) az exportőrt közvetlenül ellenőrző anyavállalat és az exportőrt végső soron ellenőrző jogalany az Unió valamely tagállamában vagy az EU001. számú uniós általános exportengedély hatálya alá tartozó országban lakóhellyel vagy letelepedési hellyel rendelkezik; és

b) az exportőrt közvetlenül ellenőrző anyavállalat kötelező garanciát nyújt arra, hogy a testvérvállalat megfelel ezen engedély követelményeinek; és Ennek az engedélynek az alkalmazásában az anyavállalat akkor gyakorol ellenőrzést egy másik vállalat felett, ha képes arra, hogy meghatározó befolyást gyakoroljon rá;

c) az exportált szoftvert és technológiát kizárólag az exportőr, illetve a leányvállalat vagy testvérvállalat kereskedelmi termékfejlesztési tevékenységeihez, alkalmazottak esetében pedig a munkaviszonyt létesítő megállapodás alapján használják fel; és

d) az exportált szoftver és technológia, valamint az azokból származó termékek az exportőr teljes ellenőrzése alatt maradnak, vagy - ezen engedély követelményeinek teljesítése céljából, amennyiben az export egy testvérvállalathoz irányul - annak az anyavállalatnak a teljes ellenőrzése alatt maradnak, amely közvetlenül ellenőrzi a testvérvállalatot, és azokat semmilyen más szervezettel nem fogják megosztani; és

e) az exportált szoftvert és technológiát visszaszolgáltatják az exportőrnek, és a fejlesztési tevékenység befejezésekor, illetve abban az esetben, ha a leányvállalatot vagy testvérvállalatot más jogalany szerezte meg, a leányvállalat vagy testvérvállalat teljes egészében törli. Az így létrejövő fejlett technológiát az exportőrnek is továbbítják, és azt a leányvállalat vagy testvérvállalat teljes egészében törli.

2. Ezen engedély nem jogosít fel szoftverek és technológia kivitelére, ha:

a) az exportőr tájékoztatást kapott a letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságától arról, hogy a szóban forgó szoftvert vagy technológiát teljes egészében vagy részben az alábbi célokra szánják vagy szánhatják: i. vegyi, biológiai vagy nukleáris fegyver vagy más nukleáris robbanóeszköz fejlesztésével, gyártásával, kezelésével, működtetésével, karbantartásával, tárolásával, észlelésével, azonosításával vagy terjesztésével kapcsolatos felhasználás vagy az ilyen fegyverek célba juttatására alkalmas hordozórakéták fejlesztése, gyártása, karbantartása vagy tárolása; ii. a kormány vagy a kormány nevében eljáró szervek általi katonai, félkatonai, rendőrségi, hírszerzési, megfigyelési célú végfelhasználás vagy egyéb biztonsági végfelhasználás; iii. felhasználás olyan - a nemzeti katonai listán szereplő - katonai termékek alkatrészeként vagy részegységeként, amelyet az illető tagállam területéről engedély nélkül vagy a tagállam nemzeti jogszabályaiban előírt engedélyezés megsértésével vittek ki; vagy iv. az Európai Unió Alapjogi Chartájában meghatározott emberi jogok, demokratikus elvek vagy a véleménynyilvánítás szabadsága megsértésével kapcsolatos felhasználás;

b) az exportőrnek tudomása van arról, hogy a szóban forgó szoftvert vagy technológiát részben vagy egészben az a) pontban említett valamely felhasználásra szánják;

c) az exportőrnek tudomása van arról, hogy a szóban forgó szoftvert vagy technológiát újra exportálják az e melléklet A. szakaszának 2. részében felsorolt rendeltetési helyektől és a tagállamoktól eltérő rendeltetési helyre; vagy

d) az exportőrnek tudomása van arról, hogy a szóban forgó termékek címzettje vagy végfelhasználója katonai, katonai jellegű, rendőri vagy hírszerző szolgálat vagy más biztonsági kormányzati szolgálat, vagy hogy a termékeket a fent említett szolgálatok nevében eljáró jogalanyoknak szánják. A tagállamok elfogadhatnak olyan nemzeti jogszabályokat, amelyek kiterjesztik a b) és c) pontot olyan esetekre, amikor az exportőr okkal feltételezi, hogy a szóban forgó szoftvert vagy technológiát a b) vagy c) pontban említett felhasználási célokra szánják.

3. Az ezen engedélyt használni kívánó exportőrnek belső megfelelési programot kell végrehajtania.

4. Szoftverek vagy technológia kézzel fogható kivitele esetén az exportőrök a vám-árunyilatkozatban nyilatkozatot tesznek arról, hogy a termékeket az EU007. sz. uniós általános exportengedély alapján exportálják.

5. Az ezen engedélyt felhasználni kívánó exportőröknek ezen engedély első alkalommal történő felhasználását megelőzően nyilvántartásba kell vetetniük magukat a letelepedési helyük szerinti tagállam hatáskörrel rendelkező hatóságánál.

A nyilvántartásba vétel automatikus, és azt a hatáskörrel rendelkező hatóságnak a nyilvántartásba vételi kérelem beérkezésétől számított tíz munkanapon belül vissza kell igazolnia az exportőrnek.

6. Az ezen engedélyt felhasználó exportőrök kötelesek legalább 30 nappal az első kivitel napja előtt értesíteni a letelepedési helyük szerinti tagállam hatáskörrel rendelkező hatóságát az ezen engedély első alkalommal történő felhasználásáról.

7. Az ezen engedélyt felhasználó exportőrök kötelesek jelentést készíteni ezen engedély első alkalommal történő felhasználásáról a letelepedési helyük szerinti tagállam hatáskörrel rendelkező hatóságának. Az engedély felhasználásáról szóló jelentést legalább évente egyszer el kell készíteni, és legalább a következőkre vonatkozó információkat kell tartalmaznia:

a) a szoftver és a technológia leírása;

b) amennyiben rendelkezésre áll, a szoftver és a technológia mennyisége és értéke;

c) az engedély hatálya alá tartozó leányvállalatok, testvérvállalatok és anyavállalatok.

A tagállamok határozzák meg, hogy az a tagállam, amelyből a kivitel megvalósul, milyen kiegészítő tájékoztatást kérhet az ezen engedély alapján kivitt termékekre vonatkozóan.

H. TITKOSÍTÁS

EU008. SZÁMÚ UNIÓS ÁLTALÁNOS EXPORTENGEDÉLY

(e rendelet 12. cikke (1) bekezdésének d) pontja szerint)

Titkosítás

Kibocsátó hatóság: Európai Unió

1. rész - Termékek

1. Ezen engedély az e rendelet I. mellékletében meghatározott következő kettős felhasználású termékekre terjed ki:

- 5A002.a.2,

- 5A002.a.3,

- 5A002.b., kizárólag "rejtjelaktiválási token", amely az 5. kategória 2. részében nem meghatározott terméket "rejtjelaktiválással" a fenti 5A002.a. vagy az alábbi 5D002.c.1. pontban meghatározott termékké konvertálja, és a kriptográfiai megjegyzés (5. kategória, 2. rész, 3. megjegyzés) nem vonja ki az ellenőrzés alól;

- 5D002.a.1., kizárólag kifejezetten a fenti 5A002.a. vagy az alábbi 5D002.c.1. pont alatt meghatározott berendezések "felhasználásához" tervezett vagy átalakított "szoftver" vagy az alábbi 5D002.c.1. pont alatt meghatározott "szoftver".

- 5D002.b., a fenti 5A002.b. pont alatt meghatározott "rejtjelaktiválási token" jellemzőivel rendelkező "szoftver";

- 5D002.c.1., kizárólag a fenti 5A002.a. pont alatt meghatározott berendezések jellemzőivel rendelkező, illetve funkcióit megvalósító vagy szimuláló "szoftver";

- 5E002.b., kizárólag a fenti 5A002.b. pont alatt meghatározott "rejtjelaktiválási token" jellemzőivel rendelkező "technológia".

2. Ezen engedély csak akkor érvényes, ha a termékek teljesítik a következő feltételek mindegyikét:

a) a termékek csak olyan közzétett vagy kereskedelmi kriptográfiai szabványokat használnak, amelyeket nemzetközileg elismert szabványügyi testületek hagytak jóvá vagy fogadtak el;

b) a termékek nem használnak kifejezetten kormányzati felhasználásra tervezett kriptográfiai szabványokat (pl. a közbiztonsági rádiórendszerekben, többek között a TETRA-ban, a TETRAPOL-ban és a P25-ben használt kriptográfiai szabványokat); valamint

c) a termékek által használt rejtjelezési funkciót a felhasználó nem tudja könnyen megváltoztatni.

3. Ezen engedély nem használható, ha:

a) az exportőrt tájékoztatta a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatósága vagy másként (például a gyártótól kapott tájékoztatás révén) az exportőr tudomására jutott, hogy a szóban forgó termékeket valamely tagállam kijelölt hatósága akkreditálta vagy más módon hivatalosan jóváhagyta (vagy folyamatban van a termékek akkreditálása vagy más hivatalos jóváhagyása) arra a célra, hogy a "RESTREINT UE/EU RESTRICTED" jelölésnek megfelelő vagy ennél szigorúbb jelölésű minősített információkat továbbítsanak, feldolgozzanak vagy tároljanak;

b) az exportőrt tájékoztatta a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatósága vagy másként (például a gyártótól kapott tájékoztatás révén) az exportőr tudomására jutott, hogy a szóban forgó termékeket valamely tagállam kijelölt hatósága nemzetbiztonsági megjelöléssel minősítette (vagy folyamatban van a termékek minősítése) a "RESTREINT UE/EU RESTRICTED" jelölésnek megfelelő vagy ennél szigorúbb jelöléssel.

2. rész - Rendeltetési helyek

Ezen engedély az Unió egész vámterületén, valamennyi rendeltetési helyre irányuló exportra érvényes, kivéve az alábbiakat:

a) az EU001. számú uniós általános exportengedély alapján engedélyezett rendeltetési helyek,

b) Afganisztán, Örményország, Azerbajdzsán, Belarusz, Kambodzsa, Közép-afrikai Köztársaság, Kína (beleértve Hongkongot és Makaót), Kongó, Kongói Demokratikus Köztársaság, Egyiptom, Eritrea, Grúzia, Irán, Irak, Izrael, Kazahsztán, Kirgizisztán, Libanon, Líbia, Malajzia, Mali, Mauritius, Mongólia, Burma (Mianmar), Észak-Korea, Omán, Pakisztán, Katar, Oroszország, Szaúd-Arábia, Szomália, Dél-Szudán, Szudán, Szíria, Tádzsikisztán, Türkmenisztán, Egyesült Arab Emírségek, Üzbegisztán, Venezuela, Jemen, Zimbabwe;

c) a b) pontban felsoroltaktól eltérő bármely rendeltetési hely, amelyre fegyverembargó vonatkozik, vagy amely a kettős felhasználású termékekre alkalmazandó uniós korlátozó intézkedések hatálya alá tartozik.

3. rész - A felhasználás feltételei és követelményei

1. Ezen engedély nem jogosít fel termékek kivitelére, ha:

a) az exportőr tájékoztatást kapott a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságától arról, hogy a szóban forgó termékeket teljes egészében vagy részben az alábbi célokra szánják vagy szánhatják: i. vegyi, biológiai vagy nukleáris fegyver vagy más nukleáris robbanóeszköz fejlesztésével, gyártásával, kezelésével, működtetésével, karbantartásával, tárolásával, észlelésével, azonosításával vagy terjesztésével kapcsolatos felhasználás vagy az ilyen fegyverek célba juttatására alkalmas hordozórakéták fejlesztése, gyártása, karbantartása vagy tárolása; ii. a kormány vagy a kormány nevében eljáró szervek általi katonai, félkatonai, rendőrségi, hírszerzési, megfigyelési célú végfelhasználás vagy egyéb biztonsági végfelhasználás; iii. felhasználás olyan - nemzeti katonai listán szereplő - katonai termékek alkatrészeként vagy részegységeként, amelyet az illető tagállam területéről engedély nélkül vagy a tagállam nemzeti jogszabályaiban előírt engedélyezés megsértésével vittek ki; vagy iv. az Európai Unió Alapjogi Chartájában meghatározott emberi jogok, demokratikus elvek vagy a véleménynyilvánítás szabadsága megsértésével kapcsolatos felhasználás,

b) az exportőrnek tudomása van arról, hogy a szóban forgó termékeket részben vagy egészben az a) pontban említett valamely felhasználásra szánják;

c) az exportőrnek tudomása van arról, hogy a szóban forgó termékeket újra kiviszik az ezen engedély 2. részének b) vagy c) pontjában kizárt bármely rendeltetési helyre;

d) a szóban forgó termékeket az engedélyben feltüntetett rendeltetési helyen található vámszabad területre vagy vámszabad raktárba viszik ki;

e) az exportőrnek tudomása van arról, hogy a szóban forgó termékek címzettje vagy végfelhasználója katonai, katonai jellegű, rendőri vagy hírszerző szolgálat vagy más biztonsági kormányzati szolgálat, vagy hogy a termékeket a fent említett szolgálatok nevében eljáró jogalanyoknak szánják; vagy

f) a kivitel az ezen engedélyben nem meghatározott, az I. mellékletben szereplő bármely bejegyzés alapján ellenőrzés alatt áll.

2. Amennyiben be kell nyújtani vám-árunyilatkozatot, az exportőr a vám-árunyilatkozatban nyilatkozatot tesz arról, hogy a termékek kivitele az EU008. számú uniós általános exportengedély alapján történik.

3. Az ezen engedélyt felhasználni kívánó exportőröknek ezen engedély első alkalommal történő használatát megelőzően nyilvántartásba vételre kell jelentkezniük a lakóhelyük vagy letelepedési helyük szerinti tagállam hatáskörrel rendelkező hatóságánál. A nyilvántartásba vétel automatikus, és azt a hatáskörrel rendelkező hatóságnak a nyilvántartásba vételi kérelem beérkezésétől számított tíz munkanapon belül vissza kell igazolnia az exportőrnek.

4. A nyilvántartásba vett exportőr legalább 10 nappal az első kivitel napja előtt bejelenti ezen engedély első alkalommal történő felhasználását a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságának.

5. Az exportőr a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságának kérésére technikai adatokat nyújt be az ezen engedély alapján tervezett vagy végrehajtott bármely kivitelről. Ha egy adott termékkel kapcsolatban ilyen műszaki adatokat kértek, és a technikai adatok megváltoznak, az exportőr erről haladéktalanul értesíti a hatáskörrel rendelkező hatóságot. A műszaki adatok legalább a következő információkat tartalmazzák a termékkel kapcsolatban:

a) gyártó;

b) terméknév;

c) modellszám;

d) a termék megnevezése - a termékről szóló rövid általános leírás, amelyet például a termék brossúrája tartalmazhat;

e) a hatáskörrel rendelkező hatóság által meghatározottak szerint, amennyiben szükséges, műszaki leírások, amelyek a következőket tartalmazzák: i. az adatok bizalmas kezelésével kapcsolatos valamennyi releváns kriptográfiai algoritmus felsorolása, beleértve a kapcsolódó rejtjelkulcskezelést is; ii. azon protokollok jegyzéke, amelyek követelményeinek a termék eleget tesz; iii. az adatok elő- vagy utókezelésére vonatkozó előírások, például a közönséges szöveg tömörítése vagy a titkosított adatok csomagolása; iv. a termék kriptográfiai funkciójához való hozzáféréshez felhasználható programozási interfészek részletei;

f) exportellenőrzési besorolás.

6. Az exportőr lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatósága nemzetbiztonsági okokból megtilthatja az exportőrnek ezen általános uniós exportengedély használatát az 1. részben említett bármely termék tekintetében. Az érintett tagállam tájékoztatja a Bizottságot és a többi tagállamot e rendelkezés alkalmazásáról.

7. A nyilvántartásba vett exportőr a lakóhelye vagy letelepedési helye szerinti tagállam hatáskörrel rendelkező hatóságának kérésére bejelenti ezen engedély felhasználását. Kérésre az engedély felhasználásáról szóló jelentést legalább évente egyszer el kell készíteni, és tartalmaznia kell legalább az alábbi információkat:

a) a kettős felhasználású termékek exportellenőrzési besorolása;

b) a kettős felhasználású termékek mennyisége és értéke;

c) a címzett neve és címe;

d) amennyiben ismert, a kettős felhasználású termékek végfelhasználása és végső felhasználója;

e) hivatkozás a kettős felhasználású termékekre vonatkozó műszaki adatok utolsó benyújtására.

I. AZ E RENDELET 12. CIKKE (6) BEKEZDÉSÉNEK A) PONTJÁBAN ÉS E MELLÉKLET A., C., D. ÉS G. SZAKASZÁBAN EMLÍTETT JEGYZÉK

A tételek nem minden esetben adják meg a termék teljes leírását és az I. mellékletben található kapcsolódó megjegyzéseket. A termékek teljes leírását csak az I. melléklet tartalmazza.

Egy terméknek ebben a mellékletben történő említése nem érinti az I. mellékletben található általános szoftvermegjegyzést (General Software Note, GSN).

- a IV. mellékletben meghatározott valamennyi termék,

- 0C001 "Természetes urán" vagy "szegényített urán" vagy tórium, fém, ötvözet, vegyület vagy koncentrátum formájában és bármilyen más anyag, amely fent említettek közül egyet vagy többet tartalmaz,

- 0C002 A IV. mellékletben meghatározottaktól eltérő "különleges hasadóanyag",

- 0D001 A 0. kategóriában meghatározott áruk "fejlesztésére", "gyártására" és "..." tervezett vagy átalakított "szoftver", amennyiben a 0C001-re vagy a IV. mellékletből kizárt 0C002 termékekre vonatkozik,

- 0E001 A 0. kategóriában meghatározott áruk "fejlesztésére", "gyártására" vagy "..." tervezett vagy átalakított, a nukleáris technológiai megjegyzés szerinti "technológia", amennyiben a 0C001-re vagy a IV. mellékletből kizárt 0C002 termékekre vonatkozik,

- 1A102 A 9A004 alatt meghatározott hordozórakétákhoz vagy a 9A104 alatt meghatározott rakétaszondához tervezett, újratelített pirolizált szén-szén anyagok,

- 1C351 Humán és állati patogének és "toxinok",

- 1C353 Genetikai elemek és a géntechnológiával módosított szervezetek,

- 1C354 Növényi patogének,

- 1C450.a.1. Amiton: O,O-dietil-S-[2-(dietil-amino)-etil] foszfor-tiolát (78-53-5) és a megfelelő alkilezett vagy protonált sók,

- 1C450.a.2. PFIB: 1,1,3,3,3-pentafluor-2-(trifluor-metil)-1-propén (382-21-8).

- 7E104 A rakéta röppályájának optimalizálása céljából a repülésvezérlési, irányítási és meghajtási adatok repülésirányító rendszerbe történő integrálására szolgáló "technológia",

- 9A009.a. Hibrid rakétahajtómű-rendszerek 1,1 MNs feletti teljes impulzuskapacitással.

- 9A117 "Rakétákban" felhasználható indító és leválasztó berendezések és közbülső fokozatok.

III. MELLÉKLET

ENGEDÉLYEK FORMANYOMTATVÁNYAINAK MINTÁJA

A. Az egyedi exportengedély és a globális exportengedély formanyomtatványainak mintája

(e rendelet 12. cikkének (2) bekezdése szerint)

A tagállamok az exportengedélyek kiadása során törekednek az engedély (egyedi vagy globális) jellegének feltüntetésére a formanyomtatványon.

Ez az exportengedély annak érvényességi dátumáig az Európai Unió valamennyi tagállamában érvényes.

EURÓPAI UNIÓKETTŐS FELHASZNÁLÁSÚ TERMÉKEK KIVITELE ((EU) 2021/821 RENDELET)
11. Exportőrszáma2. Azonosítási szám3. Érvényességi dátum (ha alkalmazható)
ENGEDÉLY4. Kapcsolattartó
5. Címzett6. Kibocsátó hatóság
7. Ügynökség/képviselet (ha különbözik az exportőrtől)száma
8. Feladási országKód
9. Végfelhasználó (ha különbözik a címzettől)10. Az a tagállam, amelyben a termék jelenleg vagy a jövőben fellelhetőKód
11. A szándékolt kiviteli vámeljárás tagállamaKód
112. A végső rendeltetési hely országaKód
13. A termékek megnevezése (1)14. Származási országKód2
15. A Harmonizált Rendszer vagy a Kombinált Nómenklatúra szerinti (adott esetben nyolcjegyű) vámtarifaszám (CAS-számmal, ha rendelkezésre áll)16. Ellenőrzési jegyzék száma (a listán szereplő termékek esetében)
17. Pénznem és érték18. Tételek mennyisége
19. Végfelhasználás20. Szerződés dátuma (ha alkalmazható)21. Kiviteli vámeljárás
22. A nemzeti jogszabályok által előírt kiegészítő információ (a formanyomtatványon kell megadni)
Előzetesen nyomtatott információk számára fenntartott hely
A tagállam tölti ki
A kibocsátó hatóság tölti ki
Aláírás
Kibocsátó hatóság
Bélyegző
Dátum
1 a1. Exportőr2. Azonosítási szám
ENGEDÉLY
13. A termék megnevezése14. Származási országKód2
15. Vámtarifaszám (adott esetben nyolcjegyű; CAS-számmal, ha rendelkezésre áll)16. Ellenőrzési jegyzék száma (a listán szereplő termékek esetében)
17. Pénznem és érték18. Tételek mennyisége
13. A termékek megnevezése14. Származási országKód2
15. Vámtarifaszám (adott esetben nyolcjegyű; CAS-számmal, ha rendelkezésre áll)16. Ellenőrzési jegyzék száma (a listán szereplő termékek esetében)
17. Pénznem és érték18. Tételek mennyisége
13. A termék megnevezése14. Származási országKód2
15. Vámtarifaszám16. Ellenőrzési jegyzék száma
17. Pénznem és érték18. Tételek mennyisége
13. A termék megnevezése14. Származási országKód2
15. Vámtarifaszám16. Ellenőrzési jegyzék száma
17. Pénznem és érték18. Tételek mennyisége
13. A termék megnevezése14. Származási országKód2
15. Vámtarifaszám16. Ellenőrzési jegyzék száma
17. Pénznem és érték18. Tételek mennyisége
13. A termék megnevezése14. Származási országKód2
15. Vámtarifaszám16. Ellenőrzési jegyzék száma
17. Pénznem és érték18. Tételek mennyisége
13. A termék megnevezése14. Származási országKód2
15. Vámtarifaszám16. Ellenőrzési jegyzék száma
17. Pénznem és érték18. Tételek mennyisége
13. A termék megnevezése14. Származási országKód2
15. Vámtarifaszám16. Ellenőrzési jegyzék száma
17. Pénznem és érték18. Tételek mennyisége
13. A termék megnevezése14. Származási országKód2
15. Vámtarifaszám16. Ellenőrzési jegyzék száma
17. Pénznem és érték18. Tételek mennyisége
13. A termék megnevezése14. Származási országKód2
15. Vámtarifaszám16. Ellenőrzési jegyzék száma
17. Pénznem és érték18. Tételek mennyisége
Megjegyzés: A 24. oszlop 1. sorában a meglévő mennyiséget, a 2. sorban az ez alkalommal levont mennyiséget kell feltüntetni
23. Nettó mennyiség/érték (Nettó tömeg/egyéb értékek a mennyiségi egység megadásával)26. Vámdokumentumok (típus és szám) vagy a kivonat (száma) és a levonás dátuma27. Tagállam, név és aláírás, levonás igazolása bélyegzővel
24. Számokkal25. A levonás értéke/mennyisége betűkkel
1.
2.
1.
2.
1.
2.
1.
2.
1.
2.
1.
2.
1.
2.
1.
2.
(1)
Szükség esetén e megnevezés egy vagy több függelékként csatolható e formanyomtatványhoz (1a). Ebben az esetben ebben a mezőben pontosan meg kell adni a függelékek számát. A megnevezésnek a lehető legpontosabbnak kell lennie, és adott esetben tartalmaznia kell a CAS-számot vagy más hivatkozásokat, különösen a vegyi termékek esetében.

B. Brókertevékenység / technikai segítségnyújtás végzésére vonatkozó engedély formanyomtatványának mintája)

(e rendelet 13. cikkének (5) bekezdése szerint)

EURÓPAI UNIÓBRÓKERTEVÉKENYSÉG /TECHNIKAI SEGÍTSÉGNYÚJTÁS VÉGZÉSE ((EU) 2021/821rendelet)
11. Bróker/ Technikai segítségnyújtást végző/ KérelmezőSzám2. Azonosítási szám3. Érvényességi dátum
(ha alkalmazható)
ENGEDÉLY4. Kapcsolattartó
5. A származási harmadik ország exportőre (adott esetben)6. Kibocsátó hatóság
7. CímzettSzám
8. A bróker / technikai segítségnyújtást végző lakóhelye vagy letelepedési helye szerinti tagállamKód (1)
9. Származási ország / A brókertevékenység tárgyát képező termékek helye szerinti harmadik országKód (1)
10. A rendeltetési harmadik ország végfelhasználója (ha eltér a címzettől)11. Rendeltetési országKód (1)
12. Részt vevő harmadik felek, pl. ügynökök (adott esetben)
1
13. A termékek / technikai segítségnyújtás megnevezése.14. A Harmonizált Rendszer vagy a Kombinált Nómenklatúra szerinti vámtarifaszám (adott esetben)15. Ellenőrzési jegyzékszám (adott esetben)
16. Pénznem és érték17. Tételek mennyisége (adott esetben)
18. Végfelhasználás
19. A nemzeti jogszabályok által előírt kiegészítő információ (a formanyomtatványon kell megadni)
Előzetesen nyomtatott információk számára fenntartott hely
A tagállam tölti ki
A kibocsátó hatóság tölti ki
Aláírás
Kibocsátó hatóság
Bélyegző
Dátum
(1)
Lásd az 1172/95/EK rendeletet (HL L 118., 1995.5.25., 10. o.).

C. A nemzeti általános exportengedélyek nemzeti hivatalos lapokban történő kiadásának közös elemei

(e rendelet 12. cikke (6) bekezdésének b) pontja szerint)

1. A nemzeti általános exportengedély címe

2. Az engedélyt kibocsátó hatóság

3. EU-érvényesség. A következő szöveget kell alkalmazni:

"Ez a nemzeti általános exportengedély az (EU) [2021/821] rendelet 12. cikkének (6) bekezdése alapján került kiadásra. Ezen engedély a rendelet 12. cikkének (6) bekezdése alapján az Európai Unió valamennyi tagállamában érvényes."

Érvényesség: a nemzeti joggyakorlatnak megfelelően.

4. Érintett termékek: a következő bevezető szöveget kell alkalmazni:

"Ez az exportengedély a következő termékekre terjed ki:"

5. Érintett célországok: a következő bevezető szöveget kell alkalmazni:

"Ez az exportengedély a következő rendeltetési helyekre érvényes:"

6. Feltételek és követelmények

IV. MELLÉKLET

AZ E RENDELET 11. CIKKÉNEK (1) BEKEZDÉSÉBEN EMLÍTETT KETTŐS FELHASZNÁLÁSÚ TERMÉKEK JEGYZÉKE

A tételek nem minden esetben tartalmazzák a termékek teljes megnevezését és az I. melléklet ( 11 )hozzá tartozó megjegyzéseit. Csak az I. melléklet tartalmazza a termékek teljes megnevezését.

Egy termék ebben a mellékletben történő említése nem érinti az I. melléklet tömegcikk jellegű termékekre vonatkozó előírásainak alkalmazását.

A kettős egyenes idézőjelek között szereplő kifejezések az I. mellékletben foglalt általános fogalommeghatározásokban meghatározott kifejezések.

I. RÉSZ

(Nemzeti Általános Engedély lehetősége az Unión belüli kereskedelemben)

Lopakodó technológiai termékek

1C001Kifejezetten az elektromágneses sugárzások elnyelésére tervezett anyagok vagy belsőleg vezető polimerek.
N.B. LÁSD MÉG: 1C101
1C101Az 1C001 alatt nem részletezett, 'rakétákban' és „rakéta”-alrendszerekben vagy a 9A012 alatt meghatározott pilóta nélküli légijárművekben felhasználható, a csökkentett észlelhetőség érdekében – úgy mint radarvisszaverő-képesség, ibolyántúli/infravörös és akusztikus jelek – alkalmazott anyagok és eszközök.
Megjegyzés: Az 1C101 nem vonja ellenőrzés alá a kizárólag polgári alkalmazásra kialakított anyagokat.
Műszaki megjegyzés:
Az 1C101 alatt a 'rakéták' kifejezés olyan komplett rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent, melyek hatósugara legalább 300 km.
1D103Kifejezetten a csökkentett észlelhetőség – úgymint radarvisszaverő-képesség, ibolyántúli/infravörös és akusztikus jelek – elemzésére tervezett „szoftver”.
1E101Az 1C101 vagy 1D103 alatt meghatározott áruk „felhasználására” vonatkozó, az általános technológiai megjegyzés szerinti „technológia”.
1E102Az 1D103 alatt meghatározott „szoftver”„fejlesztésére” vonatkozó, az általános technológiai megjegyzés szerinti „technológia”.
6B008Impulzus radar keresztmetszetmérő rendszerek, melyek átviteli impulzus szélessége legfeljebb 100 ns, és a kifejezetten ezekhez tervezett alkatrészek.
N.B. LÁSD MÉG: 6B108
6B108'Rakétákhoz' és azok alrendszereihez felhasználható, speciálisan radarkeresztmetszet-méréshez tervezett rendszerek.
Műszaki megjegyzés:
A 6B108-ban a 'rakéta' komplett rakétarendszereket és pilóta nélküli légijármű-rendszereket jelent, melyek hatósugara meghaladja a 300 km-t.

A közösségi stratégiai ellenőrzés alá tartozó termékek

1A007Kifejezetten gyújtás kiváltására tervezett elektromos berendezések és eszközök, valamint „energiahordozó anyagokat” tartalmazó eszközök, az alábbiak szerint:
N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE, 3A229 ÉS 3A232.
a. Az alábbi 1A007.b. pontban meghatározott többszörös vezérlésű robbanóanyag-detonátorokhoz tervezett robbanóanyag-detonátor gyújtóegysége;
b. Elektromosan vezérelt robbanóanyag-detonátorok, az alábbiak szerint:
1. robbantó kapcsoló (EB);
2. robbantó izzószál (EBW);
3. ütőszeg;
4. robbantófólia-iniciátor (EFI).
Megjegyzés: Az 1A007.b. nem vonja ellenőrzés alá a kizárólag primer robbanóanyagokat, például ólomazidot alkalmazó detonátorokat.
1C239A katonai célú termékek ellenőrzési jegyzékében meghatározottaktól eltérő nagy hatású robbanószerek, vagy olyan anyagok vagy keverékek, amelyek ezekből 2 tömegszázaléknál nagyobb mennyiséget tartalmaznak, és amelyek kristálysűrűsége meghaladja az 1,8 g/cm3-t, detonációs sebessége pedig a 8 000 m/s-ot.
1E201Az 1C239 alatt meghatározott termékek „felhasználására” szolgáló, az Általános Technológiai Megjegyzés szerinti „technológia”.
3A229Nagy áramerősségű impulzusgenerátorok, ideértve a következőket: …
N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.
3A232A fenti 1A007 pontban meghatározottaktól eltérő többpontos indítórendszerek, az alábbiak szerint:
N.B. LÁSD MÉG: KATONAI CÉLÚ TERMÉKEK ELLENŐRZÉSI JEGYZÉKE.
3E201A 3A229 vagy a 3A232 alatt meghatározott termékek „felhasználására” szolgáló, az Általános technológiai megjegyzés szerinti „technológia”.
6A001Akusztika a következő megszorításokkal:
6A001.a.1.b.Tárgyészlelési vagy helymeghatározó rendszerek, amelyek rendelkeznek az alábbiak bármelyikével:
1. 5 kHz alatti átviteli frekvencia;
6. úgy terveztek, hogy ellenálljanak …;
6A001.a.2.a.2.hidrofonok, amelyek … tartalmazzák …
6A001.a.2.a.3.hidrofonok, amelyek … rendelkeznek …
6A001.a.2.a.6.hidrofonok, amelyeket … terveztek …
6A001.a.2.b.vontatott akusztikus hidrofonrendszerek…
6A001.a.2.c.Kifejezetten a vontatott akusztikai hidrofon rendszerekkel együtt történő valós idejű alkalmazások számára tervezett, „felhasználó által programozható” feldolgozó-berendezés, amely rendelkezik idő- vagy frekvenciaosztásos feldolgozással és korrelációval, beleértve a spektrumelemzést, a gyors Fourier vagy más transzformáció vagy eljárások alkalmazásával végrehajtott digitális szűrést és sugáralakítást;
6A001.a.2.e.Tengerfenéki vagy sekélyvízi kábelrendszerrel működő hidrofonrendszerek, amelyek rendelkeznek a következők bármelyikével:
1. hidrofonokat tartalmaznak, vagy
2. multiplexelt hidrofoncsoport jelmodulokat tartalmaznak;
6A001.a.2.f.Kifejezetten tengerfenékkábel rendszerekkel együtt történő valós idejű alkalmazások számára tervezett, „felhasználó által programozható” feldolgozó-berendezés, amely rendelkezik idő- vagy frekvenciaosztásos feldolgozással és korrelációval, beleértve a spektrumelemzést, a gyors Fourier vagy más transzformáció vagy eljárások alkalmazásával végrehajtott digitális szűrést és sugáralakítást;
6D003.a.Az akusztikus adatok „valós idejű feldolgozására” szolgáló „szoftver”;
8A002.o.3.Zajcsökkentő rendszerek az 1 000 tonna vagy annál nagyobb vízkiszorítású hajókhoz, az alábbiak szerint:
b. 'Aktív zajcsökkentő- vagy kiküszöbölő' rendszerek vagy mágneses csapágyak, amelyeket kifejezetten erőátviteli rendszerekhez terveztek, és olyan elektronikus vezérlőrendszerekből állnak, amelyek a forráshoz közvetlenül adott zajcsillapító vagy antivibrációs jelek generálásával képesek aktívan csökkenteni a berendezések rezgését;
Műszaki megjegyzés:
Az 'aktív zajcsökkentő- vagy kiküszöbölő rendszerek' olyan elektronikus vezérlőrendszerekből állnak, amelyek a forráshoz közvetlenül adott zajcsillapító vagy antivibrációs jelek generálásával képesek aktívan csökkenteni a berendezések rezgését.
8E002.a.Kifejezetten a víz alatti zajcsökkentésre tervezett hajócsavarok „fejlesztésére”, „gyártására”, javítására, nagyjavítására vagy felújítására szolgáló „technológia”.

A közösségi stratégiai ellenőrzés alá eső termékek - Kriptoanalízis - 5. kategória 2. rész

5A004.a.'Rejtjelfejtési funkciók' elvégzésére tervezett vagy átalakított berendezés.
Megjegyzés: Az 5A004.a. magában foglalja a 'rejtjelfejtési funkciók' műszaki visszafejtéssel történő elvégzésére tervezett vagy átalakított rendszereket vagy berendezést.
Műszaki megjegyzés:
A 'rejtjelfejtési funkciók' olyan funkciók, amelyeket a rejtjelezési mechanizmusok hatálytalanítására terveztek a célból, hogy a bizalmas változókhoz vagy érzékeny adatokhoz – ideértve a tiszta szövegeket, jelszavakat vagy rejtjelezési kódokat – jussanak.
5D002.a.Kifejezetten a következők valamelyikének „kifejlesztésére”, „gyártására”, vagy „felhasználására” tervezett „szoftver”:
3. Berendezések, az alábbiak szerint:
a. Az 5A004.a. pontban meghatározott berendezés;
5D002.c.A következők bármelyikének jellemzőivel rendelkező, vagy funkcióit megvalósító vagy szimuláló „szoftver”:
3. Berendezések, az alábbiak szerint:
a. Az 5A004.a. pontban meghatározott berendezés;
5E002.a.Kizárólag a fenti 5A004.a., 5D002.a.3. vagy 5D002.c.3 alatt meghatározott áruk „fejlesztésére”, „gyártására” vagy „felhasználására” vonatkozó „technológia”.

Az MTCR technológia termékei

7A117„Rakétákban” felhasználható „irányítási/vezérlő készletek”, amelyek 3,33 % vagy jobb rendszerpontosságot biztosítanak (pl. 300 km-es távolságnál a 'CEP' legfeljebb 10 km), kivéve a 300 km-en belüli tartományra tervezett rakéták vagy személyzettel ellátott légi járművek „irányítási/vezérlő készleteit”.
Műszaki megjegyzés:
A 7A117 alkalmazásában 'CEP' (cirkuláris hibavalószínűség vagy egyenlő valószínűségi kör) a pontosság mértéke: a céltárgy mint középpont köré, meghatározott távolságban rajzolt kör sugara, amelybe a töltetek 50 %-a becsapódik.
7B001Kifejezetten a fenti 7A117 alatt meghatározott berendezésekhez tervezett vizsgáló-, kalibráló- vagy szabályozóberendezések.
Megjegyzés: A 7B001 nem vonja ellenőrzés alá az 'I. vagy II. karbantartási szint' vizsgáló-, kalibráló- vagy szabályozóberendezéseit.
7B003Kifejezetten a fenti 7A117 alatt meghatározott berendezések „gyártására” tervezett berendezések.
7B103Kifejezetten a fenti 7A117 alatt meghatározott berendezésekhez tervezett „gyártó létesítmények”.
7D101Kifejezetten a fenti 7B003 vagy 7B103 alatt meghatározott berendezések „felhasználására” tervezett „szoftverek”.
7E001A fenti 7A117, 7B003, 7B103 vagy 7D101 alatt meghatározott berendezés vagy „szoftver”„fejlesztésére” vonatkozó, az Általános Technológiai Megjegyzés szerinti „technológia”.
7E002A fenti 7A117, 7B003 és 7B103 alatt meghatározott berendezés „gyártására” vonatkozó, az Általános Technológiai Megjegyzés szerinti „technológia”.
7E101A fenti 7A117, 7B003, 7B103 és 7D101 alatt meghatározott berendezés „felhasználására” vonatkozó, az Általános Technológiai Megjegyzés szerinti „technológia”.
9A004Hordozórakéta, amely képes legalább 500 kg hasznos terhet legalább 300 km-es távolságra eljuttatni .
N.B. LÁSD MÉG: 9A104.
1. megjegyzés: A 9A004 nem vonja ellenőrzés alá a hasznos terhet.
9A005A fenti 9A004 alatt meghatározott hordozórakétákhoz vagy az alábbi 9A104 alatt meghatározott rakétaszondákhoz felhasználható , a 9A006 alatt meghatározott rendszert vagy berendezést tartalmazó folyékony rakétahajtómű-rendszerek.
N.B. LÁSD: 9A105 és 9A119.
9A007.a.A fenti 9A004 alatt meghatározott hordozórakétákhoz vagy az alábbi 9A104 alatt meghatározott rakétaszondákhoz felhasználható szilárd rakétahajtómű-rendszerek a következők bármelyikével:
N.B. LÁSD MÉG: 9A119.
a. A teljes impulzus kapacitás meghaladja az 1,1 MNs-t;
9A008.d.Kifejezetten szilárd rakétahajtómű-rendszerekhez tervezett alkatrészek, az alábbiak szerint:
N.B. LÁSD MÉG: 9A108.c.
d. A fenti 9A004 alatt meghatározott űrhajóhordozó eszközökhöz vagy az alábbi 9A104 alatt meghatározott rakétaszondákhoz felhasználható mozgatható fúvókás vagy másodlagos folyadék-injektálásos tolóerővektor vezérlő rendszer, amely a következők bármelyikére képes:
1. a tetszőleges tengelymozgás meghaladja a ± 5°-ot;
2. a szögvektor forgása 20°/s vagy több; vagy
3. a szögvektor gyorsulása 40°/s2 vagy több.
9A104Rakétaszondák, amelyek képesek legalább 500 kg hasznos terhet legalább 300 km-es távolságra eljuttatni.
N.B. LÁSD MÉG: 9A004.
9A105.a.Folyékony hajtóanyagú rakétamotorok, az alábbiak szerint:
N.B. LÁSD MÉG: 9A119.
a. A 9A005 alatt meghatározottaktól eltérő, 'rakétákban' felhasználható folyékony hajtóanyagú rakétamotorok, amelyeket legalább 1,1 MNs teljes impulzuskapacitású, folyékony hajtóanyaggal működő meghajtórendszerekbe építettek be, vagy ilyen rendszerekbe történő beépítésre terveztek vagy módosítottak; kivéve a kifejezetten műholdalkalmazásokhoz tervezett vagy átalakított folyékony hajtóanyagú apogeum motorokat, amelyek rendelkeznek a következők mindegyikével:
1. a fúvókatorok átmérője 20 mm vagy kisebb; és
2. az égőkamra nyomása 15 bar vagy kevesebb.
9A106.c.A 9A006 alatt meghatározottaktól eltérő, „rakétákban” felhasználható rendszerek és alkatrészek, amelyeket kifejezetten folyékony rakétahajtóanyag-rendszerekhez terveztek, az alábbiak szerint:
c. Tolóerővektor vezérlő alrendszerek, kivéve azokat, amelyeket rakétarendszerekhez tervezetek, és amelyek nem képesek legalább 500 kg hasznos terhet legalább 300 km-es távolságra eljuttatni .
Műszaki megjegyzés:
Példák a 9A106.c. alatt meghatározott tolóerővektoros vezérlés módszereire:
1. Rugalmas fúvóka;
2. Folyadék vagy másodlagos gázinjektálás;
3. Mozgatható hajtómű vagy fúvóka;
4. Tolósugár áramlásának eltérítése (sugáreltérítő síkok vagy szondák); vagy
5. Tolóerő-szabályzó lapok.
9A108.c.A 9A008 alatt meghatározottaktól eltérő, 'rakétákban' felhasználható alkatrészek, amelyeket kifejezetten szilárd rakétahajtóművekhez terveztek, az alábbiak szerint :
c. Tolóerővektor vezérlő alrendszerek, kivéve azokat, amelyeket rakétarendszerekhez tervezetek, és amelyek nem képesek legalább 500 kg hasznos terhet legalább 300 km-es távolságra eljuttatni .
Műszaki megjegyzés:
Példák a 9A108.c. alatt meghatározott tolóerő-vektoros vezérlés módszereire:
1. Rugalmas fúvóka;
2. Folyadék vagy másodlagos gázinjektálás;
3. Mozgatható hajtómű vagy fúvóka;
4. Tolósugár áramlásának eltérítése (sugáreltérítő síkok vagy szondák); vagy
5. Tolóerő-szabályzó lapok.
9A116„Rakétákban” felhasználható visszatérő egységek, és az ezekhez tervezett vagy átalakított berendezések, az alábbiak szerint, kivéve a nem fegyverek szállítására tervezett járművek visszatérő egységei:
a. visszatérő egységek;
b. kerámiából vagy hőfelvevő anyagból készült hőpajzsok és azok alkatrészei;
c. kistömegű, nagy hőkapacitású anyagokból készült hőelnyelők és azok alkotórészei;
d. kifejezetten visszatérő egységekhez tervezett elektronikus berendezések.
9A119A fenti 9A005 vagy 9A007.a. alatt meghatározottaktól eltérő, komplett rakétarendszerekben vagy pilóta nélküli légi járművekben felhasználható, legalább 500 kg hasznos teher legalább 300 km-re történő eljuttatására képes egyedi rakétafokozatok.
9B115Kifejezetten a fenti 9A005, 9A007.a., 9A008.d., 9A105.a., 9A106.c., 9A108.c., 9A116 vagy 9A119 alatt meghatározott rendszerekhez, alrendszerekhez és alkatrészekhez tervezett „gyártó berendezések”.
9B116Kifejezetten a 9A004 alatt meghatározott űrhajóhordozó eszközökhöz vagy a fenti 9A005, 9A007.a., 9A008.d., 9A104, 9A105.a., 9A106.c., 9A108.c., 9A116 vagy 9A119 alatt meghatározott rendszerekhez, alrendszerekhez és alkatrészekhez tervezett „gyártó létesítmények”.
9D101Kifejezetten a fenti 9B116 alatt meghatározott termékek „felhasználására” tervezett „szoftver”.
9E001A fenti 9A004, 9A005, 9A007.a., 9A008.d., 9B115, 9B116 vagy 9D101 alatt meghatározott berendezések vagy „szoftver”„fejlesztésére” vonatkozó, az Általános Technológiai Megjegyzés szerinti „technológia”.
9E002A fenti 9A004, 9A005, 9A007.a., 9A008.d., 9B115 vagy 9B116 alatt meghatározott berendezések „gyártására” vonatkozó, az Általános Technológiai Megjegyzés szerinti „technológia”.
Megjegyzés: Az ellenőrzés alá vont szerkezetek, rétegelt anyagok vagy anyagok javításának „technológiája” tekintetében lásd: 1E002.f.
9E101A fenti 9A104, 9A105.a., 9A106.c., 9A108.c., 9A116 vagy 9A119 alatt meghatározott termékek „fejlesztésére” vagy „gyártására” vonatkozó, az Általános Technológiai Megjegyzés szerinti „technológia”.
9E102A fenti 9A004, 9A005, 9A007.a., 9A008.d., 9A104, 9A105.a., 9A106.c., 9A108.c., 9A116, 9A119, 9B115, 9B116 vagy 9D101 alatt meghatározott űrhajóhordozó eszközök „felhasználására” vonatkozó, az Általános Technológiai Megjegyzés szerinti „technológia”.

Kivételek:

A IV. melléklet nem vonja ellenőrzés alá a következő MTCR technológiai termékeket:

1. a European Space Agency (ESA) szerződéses kapcsolataival összefüggő megrendelések alapján szállított technológiák vagy az ESA által hivatalos feladata teljesítése során szállított technológiák;

2. valamely tagállam űrkutatási szervezetének szerződéses kapcsolataival összefüggő megrendelések alapján szállított technológiák vagy az e szervezet hivatalos feladatának teljesítése során szállított technológiák;

3. a legalább két vagy több európai kormány által aláírt, a Közösség űrhajóhordozó rakéta fejlesztési és gyártási programja keretében létrejött szerződéses kapcsolattal összefüggő megrendelések alapján szállított technológiák;

4. a valamely tagállam területén lévő, állami irányítású űrhajókilövő helyre szállított technológiák, amennyiben a tagállam az ilyen szállítást ennek a rendeletnek megfelelően ellenőrzi.

II. RÉSZ

(Nemzeti Általános Engedély hiánya az Unión belüli kereskedelemben)

A CWC (Vegyifegyver-tilalmi Egyezmény) tételei

1C351.d.4.Ricin
1C351.d.5.Szaxitoxin

Az NSG technológia tételei

Az I. melléklet teljes 0. kategóriája a IV. melléklet részét képezi, az alábbi feltételekkel:

- 0C001: ez a termék nem képezi a IV. melléklet részét;

- 0C002: ez a termék nem képezi a IV. melléklet részét, kivéve az alábbi "különleges hasadóanyagokat": a) leválasztott plutónium; b) 20 %-ot meghaladó mértékben "235U vagy 233U izotópban dúsított urán";

- 0C003: csak az "atomreaktorokban" történő felhasználás esetén (a 0A001.a. ponton belül);

- 0D001 ("szoftver"): a IV. melléklet részét képezi, amennyiben a 0C001-re vagy a IV. mellékletből kizárt 0C002 termékekre vonatkozik;

- 0E001 ("technológia"): a IV. melléklet részét képezi, amennyiben a 0C001-re vagy a IV. mellékletből kizárt 0C002 termékekre vonatkozik.

1B226Elektromágneses izotópelválasztók, amelyekhez olyan egyszeres vagy többszörös ionforrásokat terveztek, amelyek képesek 50 mA vagy azt meghaladó erősségű ionáram létrehozására, vagy amelyeket ilyenekkel szereltek fel.
Megjegyzés: Az 1B226 magában foglalja azokat a szeparátorokat, amelyek:
a. Képesek stabil izotópok dúsítására;
b. A mágneses mezőben, valamint azokon kívül egyaránt elhelyezhető ionforrásokkal és kollektorokkal rendelkeznek.
1B231Trícium létesítmények, vagy üzemek, valamint azok berendezései, az alábbiak szerint:
a. Trícium gyártására, visszanyerésére, kivonására, koncentrálására vagy kezelésére szolgáló létesítmények vagy üzemek;
b. Berendezések tríciumlétesítményekhez vagy -üzemekhez, az alábbiak szerint:
1. Hidrogén vagy hélium hűtőegységek, amelyek képesek 23 K (– 250 °C) alatti hőmérsékletre hűteni és hőelvételi teljesítményük nagyobb, mint 150 W;
2. Hidrogén izotóp tárolására vagy hidrogén izotóp tisztítására szolgáló rendszerek, amelyekben tároló- vagy tisztítóközegként fémhidrideket alkalmaznak.
1B233Lítiumizotóp-szétválasztó létesítmények, vagy üzemek, valamint azok berendezései, az alábbiak szerint:
a. Lítiumizotópok szétválasztására szolgáló létesítmények vagy üzemek;
b. Lítiumizotóp-szétválasztó berendezések, az alábbiak szerint:
1. kifejezetten lítium-amalgámokhoz tervezett töltött folyadék-folyadék oszlopok;
2. higany- vagy lítium-amalgám szivattyúk;
3. lítium-amalgám elektrolízis cellák;
4. bepárlók tömény lítium-hidroxid oldathoz.
1C012A következő anyagok:
Műszaki megjegyzés:
Ezeket az anyagokat tipikusan nukleáris hőforrásokhoz használják fel.
b. „Előzetesen leválasztott” neptúnium-237, bármilyen formában.
Megjegyzés: Az 1C012.b. nem vonja ellenőrzés alá az 1 g vagy annál kisebb neptúnium-237 tartalmú szállítmányokat.
1C233Hatos izotóppal (6Li) a természetes előfordulásnál nagyobb mértékben dúsított lítium, dúsított lítiumot tartalmazó termékek, illetve eszközök, az alábbiak szerint: elemi lítium, ötvözet, vegyület, lítium tartalmú keverék, ezekből gyártott termékek, és a fentiek hulladékai és selejtjei.
Megjegyzés: Az 1C233 nem vonja ellenőrzés alá a termolumineszcens dozimétereket.
Műszaki megjegyzés:
A lítiumban a hatos izotóp természetes előfordulása 6,5 tömegszázalék (7,5 atomszázalék).
1C235Trícium, tríciumvegyületek és tríciumot tartalmazó keverékek, amelyekben a trícium és a hidrogénatomok számaránya meghaladja az 1: 1 000 -et, vagy az ezek bármelyikét tartalmazó termékek és eszközök.
Megjegyzés: Az 1C235 nem vonja ellenőrzés alá az olyan terméket vagy eszközt, amely nem tartalmaz 1,48 × 103 GBq (40 Ci) tríciumnál többet.
1E001Az 1C012 alatt meghatározott berendezések vagy anyagok „fejlesztésére” vagy „gyártására” vonatkozó, az Általános Technológiai Megjegyzés szerinti „technológia”.
1E201Az 1B226, 1B231, 1B233, 1C233 vagy 1C235 által ellenőrzés alá vont termékek „felhasználására” vonatkozó, az Általános Technológiai Megjegyzés szerinti „technológia”.
3A228Kapcsoló-berendezések, az alábbiak szerint:
a. Hideg katódcsövek – függetlenül attól, hogy gázzal töltöttek-e vagy sem – amelyek a szikraközhöz hasonlóan működnek, és rendelkeznek az alábbi jellemzők mindegyikével:
1. három vagy annál több elektródát tartalmaznak;
2. névleges anódcsúcsfeszültség 2,5 kV vagy annál nagyobb;
3. névleges anód-csúcsáramerősség 100 A vagy annál nagyobb; és
4. az anódkésleltetési idő 10 μs vagy kisebb;
Megjegyzés: A 3A228 magában foglalja a gázkritron- és a vákuumspritron-csöveket is.
b. Kioldó szikraközök, amelyek rendelkeznek az alábbi mindkét jellemzővel:
1. az anódkésleltetési idő 15 μs vagy kisebb; és
2. 500 A vagy nagyobb névleges csúcsáramerősség;
3A231Neutrongenerátor-rendszerek, beleértve a csöveket is, amelyek rendelkeznek mindkét alábbi jellemzővel:
a. Külső vákuumrendszer nélküli üzemelésre tervezték őket; és
b. A trícium-deutérium magreakciót elektrosztatikus gyorsítás alkalmazásával idézik elő.
3E201A fenti 3A228 vagy a 3A231 alatt meghatározott termékek „felhasználására” szolgáló, az Általános technológiai megjegyzés szerinti „technológia”.
6A203A 6A003 alatt meghatározottaktól eltérő kamerák és alkatrészek, az alábbiak szerint:
a. Mechanikus forgótükrös sávkamerák és a kifejezetten azokhoz tervezett alkatrészek, az alábbiak szerint:
1. 0,5 mm/μs-nál nagyobb sebességgel író sáv-(streak) kamerák;
b. Mechanikus forgótükrös kockázókamerák és a kifejezetten azokhoz tervezett alkatrészek, az alábbiak szerint:
1. Másodpercenként több mint 225 000 felvételt készítő kockázókamerák;
Megjegyzés: A 6A203a. szerinti kamerák alkatrészei közé tartoznak azok szinkronizáló elektronikai egységei és a turbinákból, tükrökből és csapágyakból álló rotoregységek.
6A225Sebességmérő interferométerek 1 km/s-ot meghaladó sebesség 10 μs-nál rövidebb időintervallumok alatt történő mérésére.
Megjegyzés: A 6A225 az olyan sebességmérő interferométereket foglalja magában, mint például a VISAR (sebességmérő interferométer bármely reflektáló tárgyra) és a DLI-k (Doppler lézeres interferométerek).
6A226Nyomásérzékelők, az alábbiak szerint:
a. Több mint 10 GPa nyomás mérésére képes rázási nyomásmérők, ideértve a manganinnal, itterbiummal és polivinilidén-fluoriddal (PVDF)/polivinil-difluoriddal (PVF2) készült mérőket is;
b. Kvarc nyomás-átalakítók 10 GPa-t meghaladó nyomásokhoz.

V. MELLÉKLET

A HATÁLYON KÍVÜL HELYEZETT RENDELET ÉS A MÓDOSÍTÓ JOGSZABÁLYOK JEGYZÉKE

A Tanács 428/2009/EK rendelete (HL L 134., 2009.5.29., 1. o.)

Az Európai Parlament és a Tanács 1232/2011/EU rendelete (HL L 326., 2011.12.8., 26. o.)

Az Európai Parlament és a Tanács 388/2012/EU rendelete (HL L 129., 2012.5.16., 12. o.)

Az Európai Parlament és a Tanács 599/2014/EU rendelete (HL L 173., 2014.6.12., 79. o.)

A Bizottság 1382/2014/EU felhatalmazáson alapuló rendelete (HL L 371., 2014.12.30., 1. o.)

A Bizottság (EU) 2015/2420 felhatalmazáson alapuló rendelete (HL L 340., 2015.12.24., 1. o.)

A Bizottság (EU) 2016/1969 felhatalmazáson alapuló rendelete (HL L 307., 2016.11.15., 1. o.)

A Bizottság (EU) 2017/2268 felhatalmazáson alapuló rendelete (HL L 334., 2017.12.15., 1. o.)

A Bizottság (EU) 2018/1922 felhatalmazáson alapuló rendelete (HL L 319., 2018.12.14., 1. o.)

A Bizottság (EU) 2019/2199 felhatalmazáson alapuló rendelete (HL L 338., 2019.12.30., 1. o.)

A Bizottság (EU) 2020/1749 felhatalmazáson alapuló rendelete (HL L 421., 2020.12.14., 1. o.)

Az Európai Parlament és a Tanács (EU) 2020/2171 rendelete (HL L 432., 2020.12.21., 4. o.)

VI. MELLÉKLET

MEGFELELÉSI TÁBLÁZAT

A 428/2009/EK rendeletEz a rendelet
1. cikk1. cikk
2. cikk, bevezető szövegrész2. cikk, bevezető szövegrész
2. cikk, 1. pont2. cikk, 2. pont
2. cikk, 2. pont, bevezető szövegrész2. cikk, 2. pont, bevezető szövegrész
2. cikk, 2. pont, i. és ii. alpont2. cikk, 2. pont, a) és b) alpont
-2. cikk, 2. pont, c) alpont
2 cikk, 2. pont, iii. alpont2. cikk, 2. pont, d) alpont
2. cikk, 3. pont, első albekezdés, bevezető szövegrész2. cikk, 3. pont, első albekezdés, bevezető szövegrész
2. cikk, 3. pont, első albekezdés, i. alpont2. cikk, 3. pont, első albekezdés, a) alpont
2. cikk, 3. pont, első albekezdés, ii. alpont2. cikk, 3. pont, első albekezdés, b) alpont
2. cikk, 3. pont, második albekezdés2. cikk, 3. pont,, c) alpont
-2. cikk, 3. pont,, d) alpont
2. cikk, 4. pont2. cikk, 4. pont
-2. cikk, 5. pont
-2. cikk, 6. pont
2. cikk, 5. pont, első albekezdés, bevezető szövegrész2. cikk, 7. pont, első albekezdés, bevezető szövegrész
2. cikk, 5. pont, első albekezdés, első franciabekezdés2. cikk, 7. pont
2. cikk, 5. pont, első albekezdés, második franciabekezdés2. cikk, 7. pont
2. cikk, 5. pont, második albekezdés2. cikk, 7. pont
2. cikk, 6. pont2. cikk, 8. pont
-2. cikk, 9. és 10. pont
2. cikk, 7. pont2. cikk, 11. pont
2. cikk, 8. pont2. cikk, 12. pont
2. cikk, 9. pont2. cikk, 15. pont
2. cikk, 10. pont2. cikk, 13. pont
-2. cikk, 14. pont
2. cikk, 11. pont2. cikk, 16. pont
2. cikk, 12. pont2. cikk, 17. pont
2. cikk, 13. pont2. cikk, 18. pont
-2. cikk, 19. pont
-2. cikk, 20. pont
-2. cikk, 21. és 22. pont
3. cikk3. cikk
4. cikk, (1) bekezdés4. cikk, (1) bekezdés, bevezető szövegrész és a) pont
4. cikk, (2) bekezdés, első mondat2. cikk, (19) bekezdés és 4. cikk, (1) bekezdés, b) pont
4. cikk, (2) bekezdés, második mondat4. cikk, (1) bekezdés, b) pont, bevezető szövegrész
4. cikk, (2) bekezdés, a), b) és c) pont4. cikk, (1) bekezdés, b) pont, i., ii. és iii. alpont
4. cikk, (3) bekezdés4. cikk, (1) bekezdés, c) pont
4. cikk, (4) bekezdés4. cikk, (2) bekezdés
4. cikk, (5) bekezdés4. cikk, (3) bekezdés
4. cikk, (6) bekezdés4. cikk, (4) és (5) bekezdés
4. cikk, (7) bekezdés4. cikk, (6) bekezdés
-4. cikk, (7) bekezdés
4. cikk, (8) bekezdés4. cikk, (8) bekezdés
-5. cikk
5. cikk, (1) bekezdés, első mondat6. cikk, (1) bekezdés
5. cikk, (1) bekezdés, második mondat6. cikk, (2) bekezdés
5. cikk, (2), (3) és (4) bekezdés6. cikk, (3), (4) és (5) bekezdés
6. cikk, (1) bekezdés, első mondat7. cikk, (1) bekezdés
6. cikk, (1) bekezdés, második mondat-
6. cikk, (2) bekezdés, első mondat7. cikk, (2) bekezdés, első mondat
-7. cikk, (2) bekezdés, második mondat
6. cikk, (3) bekezdés7. cikk, (3) bekezdés
6. cikk, (4) bekezdés7. cikk, (4) bekezdés
7. cikk-
-8. cikk
8. cikk9. cikk
-10. cikk
9. cikk, (1) bekezdés, első albekezdés12. cikk, (1) bekezdés, d) pont
9. cikk, (1) bekezdés, második és harmadik albekezdés12. cikk, (7) bekezdés
9. cikk, (1) bekezdés, negyedik és ötödik albekezdés17. és 19. cikk
9. cikk, (2) bekezdés, első albekezdés12. cikk, (1) bekezdés, a)–c) pont és 12. cikk, (2) bekezdés, első albekezdés
9. cikk, (2) bekezdés, második albekezdés12. cikk, (1) bekezdés, második albekezdés
-12. cikk, (2) bekezdés, második albekezdés
-12. cikk, (3) bekezdés
9. cikk, (2) bekezdés, harmadik albekezdés12. cikk, (4) bekezdés, első és második albekezdés
-12. cikk, (4) bekezdés, harmadik albekezdés
9. cikk, (3) bekezdés12. cikk, (5) bekezdés
9. cikk, (4) bekezdés12. cikk, (6) bekezdés
9. cikk, (5) bekezdés-
9. cikk, (6) bekezdés12. cikk, (6) bekezdés, negyedik albekezdés és 23. cikk, (1) bekezdés
10. cikk, (1) bekezdés kiterjesztve a technikai segítségnyújtásra13. cikk, (1) bekezdés, első albekezdés és 13. cikk, (2) bekezdés
-13. cikk, (1) bekezdés, második albekezdés
10. cikk, (2) bekezdés13. cikk, (3) bekezdés
10. cikk, (3) bekezdés13. cikk, (4) bekezdés
11. cikk14. cikk
12. cikk, (1) bekezdés15. cikk, (1) bekezdés
12. cikk, (2) bekezdés-
-15. cikk, (2) bekezdés
13. cikk16. cikk
14. cikk, (1) bekezdés12. cikk, (2) bekezdés, harmadik albekezdés és 13. cikk, (5) bekezdés kiterjesztve a technikai segítségnyújtásra
14. cikk, (2) bekezdés12. cikk, (4) bekezdés, negyedik albekezdés
15. cikk, (1) bekezdés17. cikk, (1) bekezdés, a) pont
15. cikk, (2) bekezdés20. cikk
15. cikk, (3) bekezdés17. cikk, (1) bekezdés, bevezető szövegrész és b) pont
-17. cikk, (2) bekezdés
16. cikk21. cikk
17. cikk22. cikk
18. cikk-
19. cikk, (1) bekezdés-
19. cikk, (1) bekezdés, bevezető szövegrész23. cikk, (2) bekezdés, bevezető szövegrész
-23. cikk, (2) bekezdés, a) pont
-23. cikk, (2) bekezdés, b) pont
-23. cikk, (2) bekezdés, c) pont
19. cikk, (2) bekezdés, a) pont23. cikk, (2) bekezdés, d) pont
19. cikk, (2) bekezdés, b) pont23. cikk, (2) bekezdés, e) pont
-23. cikk, (3) bekezdés
-23. cikk, (4) bekezdés
19. cikk, (3) bekezdés23. cikk, (5) bekezdés
19. cikk, (4) bekezdés23. cikk, (6) bekezdés
19. cikk, (5) bekezdés26. cikk, (1) bekezdés, második mondat
19. cikk, (6) bekezdés23. cikk, (7) bekezdés
20. cikk, (1)–(3) bekezdés27. cikk, (1)–(3) bekezdés
21. cikk28. cikk
22. cikk, (1) és (2) bekezdés11. cikk, (1) és (2) bekezdés
22. cikk, (3) és (4) bekezdés11. cikk, (3) és (4) bekezdés
22. cikk, (5)–(7) bekezdés11. cikk, (5)–(7) bekezdés
22. cikk, (8) bekezdés27. cikk, (4) bekezdés
22. cikk, (9) és (10) bekezdés11. cikk, (8) és (9) bekezdés
23. cikk, (1) és (2) bekezdés24. cikk, (1) és (2) bekezdés
-24. cikk, (3) bekezdés
-24. cikk, (4) bekezdés
23. cikk, (3) bekezdés26. cikk, (2) bekezdés
-26. cikk, (3) bekezdés
-26. cikk, (4) bekezdés
23a. cikk, (1) bekezdés18. cikk, (1) bekezdés
23a. cikk, (2) és (3) bekezdés18. cikk, (2) és (3) bekezdés
-18. cikk, (4) bekezdés
23a. cikk, (4) és (5) bekezdés18. cikk, (5) és (6) bekezdés
23b. cikk19. cikk
24. cikk25. cikk, (1) bekezdés
-25. cikk, (2) bekezdés
25. cikk, (1) bekezdés23. cikk, (1) bekezdés, első és második albekezdés
25. cikk, (2) és (3) bekezdés-
25. cikk, (4) bekezdés26. cikk, (2) bekezdés
-29. cikk, (1) bekezdés
25a. cikk29. cikk, (2) bekezdés
26. cikk-
-30. cikk
27. cikk31. cikk
28. cikk32. cikk
I. mellékletI. melléklet
-I. melléklet
IIa. mellékletII. melléklet, A. szakasz
IIb. mellékletII. melléklet, B. szakasz
IIc. mellékletII. melléklet, C. szakasz
IId. mellékletII. melléklet, D. szakasz
IIe. mellékletII. melléklet, E. szakasz
IIf. mellékletII. melléklet, F. szakasz
-II. melléklet, G. szakasz
-II. melléklet, H. szakasz
IIg. mellékletII. melléklet, I. szakasz
IIIa. mellékletIII. melléklet, A. szakasz
IIIb. mellékletIII. melléklet, B. szakasz
IIIc. mellékletIII. melléklet, C. szakasz
IV. mellékletIV. melléklet
V. mellékletV. melléklet
VI. mellékletVI. melléklet

( 1 ) A Bizottság (EU) 2015/2446 felhatalmazáson alapuló rendelete (2015. július 28.) a 952/2013/EU európai parlamenti és tanácsi rendeletnek az Uniós Vámkódex egyes rendelkezéseire vonatkozó részletes szabályok tekintetében történő kiegészítéséről (HL L 343., 2015.12.29., 1. o.).

( 2 ) A Tanács 515/97/EK rendelete (1997. március 13.) a tagállamok közigazgatási hatóságai közötti kölcsönös segítségnyújtásról, valamint a vám- és mezőgazdasági jogszabályok helyes alkalmazásának biztosítása érdekében e hatóságok és a Bizottság együttműködéséről (HL L 82., 1997.3.22., 1. o.).

( 3 ) Az Európai Parlament és a Tanács 223/2009/EK rendelete (2009. március 11.) az európai statisztikákról és a titoktartási kötelezettség hatálya alá tartozó statisztikai adatoknak az Európai Közösségek Statisztikai Hivatala részére történő továbbításáról szóló 1101/2008/EK, Euratom európai parlamenti és tanácsi rendelet, a közösségi statisztikákról szóló 322/97/EK tanácsi rendelet és az Európai Közösségek statisztikai programbizottságának létrehozásáról szóló 89/382/EGK, Euratom tanácsi határozat hatályon kívül helyezéséről (HL L 87., 2009.3.31., 164. o.).

( 4 ) https://www.australiagroup.net/

( 5 ) http://mtcr.info/

( 6 ) http://www.nuclearsuppliersgroup.org/

( 7 ) http://www.wassenaar.org/

( 8 ) https://www.opcw.org/chemical-weapons-convention

( 9 ) A pozicionálási pontosságot ISO 230-2:1997 vagy 2006 szerint mérő gyártóknak konzultálniuk kell a letelepedési helyük szerinti uniós tagállam illetékes hatóságával.

( 10 ) Megállapodás Nagy-Britannia és Észak-Írország Egyesült Királyságának az Európai Unióból és az Európai Atomenergia-közösségből történő kilépéséről (HL L 29., 2020.1.31., 7. o.).

( 11 ) Az I. melléklet és a IV. melléklet szövege és tárgya közötti eltéréseket félkövér dőlt betűvel jelöljük.

Lábjegyzetek:

[1] A dokumentum eredetije megtekinthető CELEX: 32021R0821 - https://eur-lex.europa.eu/legal-content/HU/ALL/?uri=CELEX:32021R0821&locale=hu Utolsó elérhető, magyar nyelvű konszolidált változat CELEX: 02021R0821-20230526 - https://eur-lex.europa.eu/legal-content/HU/ALL/?uri=CELEX:02021R0821-20230526&locale=hu

Tartalomjegyzék